mirror of
https://github.com/flarum/framework.git
synced 2025-06-04 23:14:32 +08:00
23276 lines
673 KiB
JavaScript
23276 lines
673 KiB
JavaScript
(function (global) {
|
|
var babelHelpers = global.babelHelpers = {};
|
|
babelHelpers.typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) {
|
|
return typeof obj;
|
|
} : function (obj) {
|
|
return obj && typeof Symbol === "function" && obj.constructor === Symbol ? "symbol" : typeof obj;
|
|
};
|
|
|
|
babelHelpers.jsx = function () {
|
|
var REACT_ELEMENT_TYPE = typeof Symbol === "function" && Symbol.for && Symbol.for("react.element") || 0xeac7;
|
|
return function createRawReactElement(type, props, key, children) {
|
|
var defaultProps = type && type.defaultProps;
|
|
var childrenLength = arguments.length - 3;
|
|
|
|
if (!props && childrenLength !== 0) {
|
|
props = {};
|
|
}
|
|
|
|
if (props && defaultProps) {
|
|
for (var propName in defaultProps) {
|
|
if (props[propName] === void 0) {
|
|
props[propName] = defaultProps[propName];
|
|
}
|
|
}
|
|
} else if (!props) {
|
|
props = defaultProps || {};
|
|
}
|
|
|
|
if (childrenLength === 1) {
|
|
props.children = children;
|
|
} else if (childrenLength > 1) {
|
|
var childArray = Array(childrenLength);
|
|
|
|
for (var i = 0; i < childrenLength; i++) {
|
|
childArray[i] = arguments[i + 3];
|
|
}
|
|
|
|
props.children = childArray;
|
|
}
|
|
|
|
return {
|
|
$$typeof: REACT_ELEMENT_TYPE,
|
|
type: type,
|
|
key: key === undefined ? null : '' + key,
|
|
ref: null,
|
|
props: props,
|
|
_owner: null
|
|
};
|
|
};
|
|
}();
|
|
|
|
babelHelpers.asyncToGenerator = function (fn) {
|
|
return function () {
|
|
var gen = fn.apply(this, arguments);
|
|
return new Promise(function (resolve, reject) {
|
|
function step(key, arg) {
|
|
try {
|
|
var info = gen[key](arg);
|
|
var value = info.value;
|
|
} catch (error) {
|
|
reject(error);
|
|
return;
|
|
}
|
|
|
|
if (info.done) {
|
|
resolve(value);
|
|
} else {
|
|
return Promise.resolve(value).then(function (value) {
|
|
return step("next", value);
|
|
}, function (err) {
|
|
return step("throw", err);
|
|
});
|
|
}
|
|
}
|
|
|
|
return step("next");
|
|
});
|
|
};
|
|
};
|
|
|
|
babelHelpers.classCallCheck = function (instance, Constructor) {
|
|
if (!(instance instanceof Constructor)) {
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
};
|
|
|
|
babelHelpers.createClass = function () {
|
|
function defineProperties(target, props) {
|
|
for (var i = 0; i < props.length; i++) {
|
|
var descriptor = props[i];
|
|
descriptor.enumerable = descriptor.enumerable || false;
|
|
descriptor.configurable = true;
|
|
if ("value" in descriptor) descriptor.writable = true;
|
|
Object.defineProperty(target, descriptor.key, descriptor);
|
|
}
|
|
}
|
|
|
|
return function (Constructor, protoProps, staticProps) {
|
|
if (protoProps) defineProperties(Constructor.prototype, protoProps);
|
|
if (staticProps) defineProperties(Constructor, staticProps);
|
|
return Constructor;
|
|
};
|
|
}();
|
|
|
|
babelHelpers.defineEnumerableProperties = function (obj, descs) {
|
|
for (var key in descs) {
|
|
var desc = descs[key];
|
|
desc.configurable = desc.enumerable = true;
|
|
if ("value" in desc) desc.writable = true;
|
|
Object.defineProperty(obj, key, desc);
|
|
}
|
|
|
|
return obj;
|
|
};
|
|
|
|
babelHelpers.defaults = function (obj, defaults) {
|
|
var keys = Object.getOwnPropertyNames(defaults);
|
|
|
|
for (var i = 0; i < keys.length; i++) {
|
|
var key = keys[i];
|
|
var value = Object.getOwnPropertyDescriptor(defaults, key);
|
|
|
|
if (value && value.configurable && obj[key] === undefined) {
|
|
Object.defineProperty(obj, key, value);
|
|
}
|
|
}
|
|
|
|
return obj;
|
|
};
|
|
|
|
babelHelpers.defineProperty = function (obj, key, value) {
|
|
if (key in obj) {
|
|
Object.defineProperty(obj, key, {
|
|
value: value,
|
|
enumerable: true,
|
|
configurable: true,
|
|
writable: true
|
|
});
|
|
} else {
|
|
obj[key] = value;
|
|
}
|
|
|
|
return obj;
|
|
};
|
|
|
|
babelHelpers.extends = Object.assign || function (target) {
|
|
for (var i = 1; i < arguments.length; i++) {
|
|
var source = arguments[i];
|
|
|
|
for (var key in source) {
|
|
if (Object.prototype.hasOwnProperty.call(source, key)) {
|
|
target[key] = source[key];
|
|
}
|
|
}
|
|
}
|
|
|
|
return target;
|
|
};
|
|
|
|
babelHelpers.get = function get(object, property, receiver) {
|
|
if (object === null) object = Function.prototype;
|
|
var desc = Object.getOwnPropertyDescriptor(object, property);
|
|
|
|
if (desc === undefined) {
|
|
var parent = Object.getPrototypeOf(object);
|
|
|
|
if (parent === null) {
|
|
return undefined;
|
|
} else {
|
|
return get(parent, property, receiver);
|
|
}
|
|
} else if ("value" in desc) {
|
|
return desc.value;
|
|
} else {
|
|
var getter = desc.get;
|
|
|
|
if (getter === undefined) {
|
|
return undefined;
|
|
}
|
|
|
|
return getter.call(receiver);
|
|
}
|
|
};
|
|
|
|
babelHelpers.inherits = function (subClass, superClass) {
|
|
if (typeof superClass !== "function" && superClass !== null) {
|
|
throw new TypeError("Super expression must either be null or a function, not " + typeof superClass);
|
|
}
|
|
|
|
subClass.prototype = Object.create(superClass && superClass.prototype, {
|
|
constructor: {
|
|
value: subClass,
|
|
enumerable: false,
|
|
writable: true,
|
|
configurable: true
|
|
}
|
|
});
|
|
if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass;
|
|
};
|
|
|
|
babelHelpers.instanceof = function (left, right) {
|
|
if (right != null && typeof Symbol !== "undefined" && right[Symbol.hasInstance]) {
|
|
return right[Symbol.hasInstance](left);
|
|
} else {
|
|
return left instanceof right;
|
|
}
|
|
};
|
|
|
|
babelHelpers.interopRequireDefault = function (obj) {
|
|
return obj && obj.__esModule ? obj : {
|
|
default: obj
|
|
};
|
|
};
|
|
|
|
babelHelpers.interopRequireWildcard = function (obj) {
|
|
if (obj && obj.__esModule) {
|
|
return obj;
|
|
} else {
|
|
var newObj = {};
|
|
|
|
if (obj != null) {
|
|
for (var key in obj) {
|
|
if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key];
|
|
}
|
|
}
|
|
|
|
newObj.default = obj;
|
|
return newObj;
|
|
}
|
|
};
|
|
|
|
babelHelpers.newArrowCheck = function (innerThis, boundThis) {
|
|
if (innerThis !== boundThis) {
|
|
throw new TypeError("Cannot instantiate an arrow function");
|
|
}
|
|
};
|
|
|
|
babelHelpers.objectDestructuringEmpty = function (obj) {
|
|
if (obj == null) throw new TypeError("Cannot destructure undefined");
|
|
};
|
|
|
|
babelHelpers.objectWithoutProperties = function (obj, keys) {
|
|
var target = {};
|
|
|
|
for (var i in obj) {
|
|
if (keys.indexOf(i) >= 0) continue;
|
|
if (!Object.prototype.hasOwnProperty.call(obj, i)) continue;
|
|
target[i] = obj[i];
|
|
}
|
|
|
|
return target;
|
|
};
|
|
|
|
babelHelpers.possibleConstructorReturn = function (self, call) {
|
|
if (!self) {
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
}
|
|
|
|
return call && (typeof call === "object" || typeof call === "function") ? call : self;
|
|
};
|
|
|
|
babelHelpers.selfGlobal = typeof global === "undefined" ? self : global;
|
|
|
|
babelHelpers.set = function set(object, property, value, receiver) {
|
|
var desc = Object.getOwnPropertyDescriptor(object, property);
|
|
|
|
if (desc === undefined) {
|
|
var parent = Object.getPrototypeOf(object);
|
|
|
|
if (parent !== null) {
|
|
set(parent, property, value, receiver);
|
|
}
|
|
} else if ("value" in desc && desc.writable) {
|
|
desc.value = value;
|
|
} else {
|
|
var setter = desc.set;
|
|
|
|
if (setter !== undefined) {
|
|
setter.call(receiver, value);
|
|
}
|
|
}
|
|
|
|
return value;
|
|
};
|
|
|
|
babelHelpers.slicedToArray = function () {
|
|
function sliceIterator(arr, i) {
|
|
var _arr = [];
|
|
var _n = true;
|
|
var _d = false;
|
|
var _e = undefined;
|
|
|
|
try {
|
|
for (var _i = arr[Symbol.iterator](), _s; !(_n = (_s = _i.next()).done); _n = true) {
|
|
_arr.push(_s.value);
|
|
|
|
if (i && _arr.length === i) break;
|
|
}
|
|
} catch (err) {
|
|
_d = true;
|
|
_e = err;
|
|
} finally {
|
|
try {
|
|
if (!_n && _i["return"]) _i["return"]();
|
|
} finally {
|
|
if (_d) throw _e;
|
|
}
|
|
}
|
|
|
|
return _arr;
|
|
}
|
|
|
|
return function (arr, i) {
|
|
if (Array.isArray(arr)) {
|
|
return arr;
|
|
} else if (Symbol.iterator in Object(arr)) {
|
|
return sliceIterator(arr, i);
|
|
} else {
|
|
throw new TypeError("Invalid attempt to destructure non-iterable instance");
|
|
}
|
|
};
|
|
}();
|
|
|
|
babelHelpers.slicedToArrayLoose = function (arr, i) {
|
|
if (Array.isArray(arr)) {
|
|
return arr;
|
|
} else if (Symbol.iterator in Object(arr)) {
|
|
var _arr = [];
|
|
|
|
for (var _iterator = arr[Symbol.iterator](), _step; !(_step = _iterator.next()).done;) {
|
|
_arr.push(_step.value);
|
|
|
|
if (i && _arr.length === i) break;
|
|
}
|
|
|
|
return _arr;
|
|
} else {
|
|
throw new TypeError("Invalid attempt to destructure non-iterable instance");
|
|
}
|
|
};
|
|
|
|
babelHelpers.taggedTemplateLiteral = function (strings, raw) {
|
|
return Object.freeze(Object.defineProperties(strings, {
|
|
raw: {
|
|
value: Object.freeze(raw)
|
|
}
|
|
}));
|
|
};
|
|
|
|
babelHelpers.taggedTemplateLiteralLoose = function (strings, raw) {
|
|
strings.raw = raw;
|
|
return strings;
|
|
};
|
|
|
|
babelHelpers.temporalRef = function (val, name, undef) {
|
|
if (val === undef) {
|
|
throw new ReferenceError(name + " is not defined - temporal dead zone");
|
|
} else {
|
|
return val;
|
|
}
|
|
};
|
|
|
|
babelHelpers.temporalUndefined = {};
|
|
|
|
babelHelpers.toArray = function (arr) {
|
|
return Array.isArray(arr) ? arr : Array.from(arr);
|
|
};
|
|
|
|
babelHelpers.toConsumableArray = function (arr) {
|
|
if (Array.isArray(arr)) {
|
|
for (var i = 0, arr2 = Array(arr.length); i < arr.length; i++) arr2[i] = arr[i];
|
|
|
|
return arr2;
|
|
} else {
|
|
return Array.from(arr);
|
|
}
|
|
};
|
|
})(typeof global === "undefined" ? self : global);;
|
|
(function(exports) {
|
|
|
|
'use strict';
|
|
|
|
var headEl = document.getElementsByTagName('head')[0],
|
|
ie = /MSIE/.test(navigator.userAgent);
|
|
|
|
/*
|
|
normalizeName() is inspired by Ember's loader:
|
|
https://github.com/emberjs/ember.js/blob/0591740685ee2c444f2cfdbcebad0bebd89d1303/packages/loader/lib/main.js#L39-L53
|
|
*/
|
|
function normalizeName(child, parentBase) {
|
|
if (child.charAt(0) === '/') {
|
|
child = child.slice(1);
|
|
}
|
|
if (child.charAt(0) !== '.') {
|
|
return child;
|
|
}
|
|
var parts = child.split('/');
|
|
while (parts[0] === '.' || parts[0] === '..') {
|
|
if (parts.shift() === '..') {
|
|
parentBase.pop();
|
|
}
|
|
}
|
|
return parentBase.concat(parts).join('/');
|
|
}
|
|
|
|
var seen = Object.create(null);
|
|
var internalRegistry = Object.create(null);
|
|
var externalRegistry = Object.create(null);
|
|
var anonymousEntry;
|
|
|
|
function ensuredExecute(name) {
|
|
var mod = internalRegistry[name];
|
|
if (mod && !seen[name]) {
|
|
seen[name] = true;
|
|
// one time operation to execute the module body
|
|
mod.execute();
|
|
}
|
|
return mod && mod.proxy;
|
|
}
|
|
|
|
function set(name, values) {
|
|
externalRegistry[name] = values;
|
|
}
|
|
|
|
function get(name) {
|
|
return externalRegistry[name] || ensuredExecute(name);
|
|
}
|
|
|
|
function has(name) {
|
|
return !!externalRegistry[name] || !!internalRegistry[name];
|
|
}
|
|
|
|
function createScriptNode(src, callback) {
|
|
var node = document.createElement('script');
|
|
// use async=false for ordered async?
|
|
// parallel-load-serial-execute http://wiki.whatwg.org/wiki/Dynamic_Script_Execution_Order
|
|
if (node.async) {
|
|
node.async = false;
|
|
}
|
|
if (ie) {
|
|
node.onreadystatechange = function() {
|
|
if (/loaded|complete/.test(this.readyState)) {
|
|
this.onreadystatechange = null;
|
|
callback();
|
|
}
|
|
};
|
|
} else {
|
|
node.onload = node.onerror = callback;
|
|
}
|
|
node.setAttribute('src', src);
|
|
headEl.appendChild(node);
|
|
}
|
|
|
|
function load(name) {
|
|
return new Promise(function(resolve, reject) {
|
|
createScriptNode((System.baseURL || '/') + name + '.js', function(err) {
|
|
if (anonymousEntry) {
|
|
System.register(name, anonymousEntry[0], anonymousEntry[1]);
|
|
anonymousEntry = undefined;
|
|
}
|
|
var mod = internalRegistry[name];
|
|
if (!mod) {
|
|
reject(new Error('Error loading module ' + name));
|
|
return;
|
|
}
|
|
Promise.all(mod.deps.map(function (dep) {
|
|
if (externalRegistry[dep] || internalRegistry[dep]) {
|
|
return Promise.resolve();
|
|
}
|
|
return load(dep);
|
|
})).then(resolve, reject);
|
|
});
|
|
});
|
|
}
|
|
|
|
|
|
var System = {
|
|
set: set,
|
|
get: get,
|
|
has: has,
|
|
import: function(name) {
|
|
return new Promise(function(resolve, reject) {
|
|
var normalizedName = normalizeName(name, []);
|
|
var mod = get(normalizedName);
|
|
return mod ? resolve(mod) : load(name).then(function () {
|
|
return get(normalizedName);
|
|
});
|
|
});
|
|
},
|
|
register: function(name, deps, wrapper) {
|
|
if (Array.isArray(name)) {
|
|
// anounymous module
|
|
anonymousEntry = [];
|
|
anonymousEntry.push.apply(anonymousEntry, arguments);
|
|
return; // breaking to let the script tag to name it.
|
|
}
|
|
var proxy = Object.create(null),
|
|
values = Object.create(null),
|
|
mod, meta;
|
|
// creating a new entry in the internal registry
|
|
internalRegistry[name] = mod = {
|
|
// live bindings
|
|
proxy: proxy,
|
|
// exported values
|
|
values: values,
|
|
// normalized deps
|
|
deps: deps.map(function(dep) {
|
|
return normalizeName(dep, name.split('/').slice(0, -1));
|
|
}),
|
|
// other modules that depends on this so we can push updates into those modules
|
|
dependants: [],
|
|
// method used to push updates of deps into the module body
|
|
update: function(moduleName, moduleObj) {
|
|
meta.setters[mod.deps.indexOf(moduleName)](moduleObj);
|
|
},
|
|
execute: function() {
|
|
mod.deps.map(function(dep) {
|
|
var imports = externalRegistry[dep];
|
|
if (imports) {
|
|
mod.update(dep, imports);
|
|
} else {
|
|
imports = get(dep) && internalRegistry[dep].values; // optimization to pass plain values instead of bindings
|
|
if (imports) {
|
|
internalRegistry[dep].dependants.push(name);
|
|
mod.update(dep, imports);
|
|
}
|
|
}
|
|
});
|
|
meta.execute();
|
|
}
|
|
};
|
|
// collecting execute() and setters[]
|
|
meta = wrapper(function(identifier, value) {
|
|
values[identifier] = value;
|
|
mod.lock = true; // locking down the updates on the module to avoid infinite loop
|
|
mod.dependants.forEach(function(moduleName) {
|
|
if (internalRegistry[moduleName] && !internalRegistry[moduleName].lock) {
|
|
internalRegistry[moduleName].update(name, values);
|
|
}
|
|
});
|
|
mod.lock = false;
|
|
if (!Object.getOwnPropertyDescriptor(proxy, identifier)) {
|
|
Object.defineProperty(proxy, identifier, {
|
|
enumerable: true,
|
|
get: function() {
|
|
return values[identifier];
|
|
}
|
|
});
|
|
}
|
|
return value;
|
|
});
|
|
}
|
|
};
|
|
|
|
// exporting the System object
|
|
exports.System = System;
|
|
|
|
})(window);
|
|
;
|
|
;(function (global, factory) { // eslint-disable-line
|
|
"use strict"
|
|
/* eslint-disable no-undef */
|
|
var m = factory(global)
|
|
if (typeof module === "object" && module != null && module.exports) {
|
|
module.exports = m
|
|
} else if (typeof define === "function" && define.amd) {
|
|
define(function () { return m })
|
|
} else {
|
|
global.m = m
|
|
}
|
|
/* eslint-enable no-undef */
|
|
})(typeof window !== "undefined" ? window : {}, function (global, undefined) { // eslint-disable-line
|
|
"use strict"
|
|
|
|
m.version = function () {
|
|
return "v0.2.3"
|
|
}
|
|
|
|
var hasOwn = {}.hasOwnProperty
|
|
var type = {}.toString
|
|
|
|
function isFunction(object) {
|
|
return typeof object === "function"
|
|
}
|
|
|
|
function isObject(object) {
|
|
return type.call(object) === "[object Object]"
|
|
}
|
|
|
|
function isString(object) {
|
|
return type.call(object) === "[object String]"
|
|
}
|
|
|
|
var isArray = Array.isArray || function (object) {
|
|
return type.call(object) === "[object Array]"
|
|
}
|
|
|
|
function noop() {}
|
|
|
|
var voidElements = {
|
|
AREA: 1,
|
|
BASE: 1,
|
|
BR: 1,
|
|
COL: 1,
|
|
COMMAND: 1,
|
|
EMBED: 1,
|
|
HR: 1,
|
|
IMG: 1,
|
|
INPUT: 1,
|
|
KEYGEN: 1,
|
|
LINK: 1,
|
|
META: 1,
|
|
PARAM: 1,
|
|
SOURCE: 1,
|
|
TRACK: 1,
|
|
WBR: 1
|
|
}
|
|
|
|
// caching commonly used variables
|
|
var $document, $location, $requestAnimationFrame, $cancelAnimationFrame
|
|
|
|
// self invoking function needed because of the way mocks work
|
|
function initialize(mock) {
|
|
$document = mock.document
|
|
$location = mock.location
|
|
$cancelAnimationFrame = mock.cancelAnimationFrame || mock.clearTimeout
|
|
$requestAnimationFrame = mock.requestAnimationFrame || mock.setTimeout
|
|
}
|
|
|
|
// testing API
|
|
m.deps = function (mock) {
|
|
initialize(global = mock || window)
|
|
return global
|
|
}
|
|
|
|
m.deps(global)
|
|
|
|
/**
|
|
* @typedef {String} Tag
|
|
* A string that looks like -> div.classname#id[param=one][param2=two]
|
|
* Which describes a DOM node
|
|
*/
|
|
|
|
function parseTagAttrs(cell, tag) {
|
|
var classes = []
|
|
var parser = /(?:(^|#|\.)([^#\.\[\]]+))|(\[.+?\])/g
|
|
var match
|
|
|
|
while ((match = parser.exec(tag))) {
|
|
if (match[1] === "" && match[2]) {
|
|
cell.tag = match[2]
|
|
} else if (match[1] === "#") {
|
|
cell.attrs.id = match[2]
|
|
} else if (match[1] === ".") {
|
|
classes.push(match[2])
|
|
} else if (match[3][0] === "[") {
|
|
var pair = /\[(.+?)(?:=("|'|)(.*?)\2)?\]/.exec(match[3])
|
|
cell.attrs[pair[1]] = pair[3] || (pair[2] ? "" : true)
|
|
}
|
|
}
|
|
|
|
return classes
|
|
}
|
|
|
|
function getVirtualChildren(args, hasAttrs) {
|
|
var children = hasAttrs ? args.slice(1) : args
|
|
|
|
if (children.length === 1 && isArray(children[0])) {
|
|
return children[0]
|
|
} else {
|
|
return children
|
|
}
|
|
}
|
|
|
|
function assignAttrs(target, attrs, classes) {
|
|
var classAttr = "class" in attrs ? "class" : "className"
|
|
|
|
for (var attrName in attrs) {
|
|
if (hasOwn.call(attrs, attrName)) {
|
|
if (attrName === classAttr &&
|
|
attrs[attrName] != null &&
|
|
attrs[attrName] !== "") {
|
|
classes.push(attrs[attrName])
|
|
// create key in correct iteration order
|
|
target[attrName] = ""
|
|
} else {
|
|
target[attrName] = attrs[attrName]
|
|
}
|
|
}
|
|
}
|
|
|
|
if (classes.length) target[classAttr] = classes.join(" ")
|
|
}
|
|
|
|
/**
|
|
*
|
|
* @param {Tag} The DOM node tag
|
|
* @param {Object=[]} optional key-value pairs to be mapped to DOM attrs
|
|
* @param {...mNode=[]} Zero or more Mithril child nodes. Can be an array,
|
|
* or splat (optional)
|
|
*/
|
|
function m(tag, pairs) {
|
|
var args = [].slice.call(arguments, 1)
|
|
|
|
if (isObject(tag)) return parameterize(tag, args)
|
|
|
|
if (!isString(tag)) {
|
|
throw new Error("selector in m(selector, attrs, children) should " +
|
|
"be a string")
|
|
}
|
|
|
|
var hasAttrs = pairs != null && isObject(pairs) &&
|
|
!("tag" in pairs || "view" in pairs || "subtree" in pairs)
|
|
|
|
var attrs = hasAttrs ? pairs : {}
|
|
var cell = {
|
|
tag: "div",
|
|
attrs: {},
|
|
children: getVirtualChildren(args, hasAttrs)
|
|
}
|
|
|
|
assignAttrs(cell.attrs, attrs, parseTagAttrs(cell, tag))
|
|
return cell
|
|
}
|
|
|
|
function forEach(list, f) {
|
|
for (var i = 0; i < list.length && !f(list[i], i++);) {
|
|
// function called in condition
|
|
}
|
|
}
|
|
|
|
function forKeys(list, f) {
|
|
forEach(list, function (attrs, i) {
|
|
return (attrs = attrs && attrs.attrs) &&
|
|
attrs.key != null &&
|
|
f(attrs, i)
|
|
})
|
|
}
|
|
// This function was causing deopts in Chrome.
|
|
function dataToString(data) {
|
|
// data.toString() might throw or return null if data is the return
|
|
// value of Console.log in some versions of Firefox (behavior depends on
|
|
// version)
|
|
try {
|
|
if (data != null && data.toString() != null) return data
|
|
} catch (e) {
|
|
// silently ignore errors
|
|
}
|
|
return ""
|
|
}
|
|
|
|
// This function was causing deopts in Chrome.
|
|
function injectTextNode(parentElement, first, index, data) {
|
|
try {
|
|
insertNode(parentElement, first, index)
|
|
first.nodeValue = data
|
|
} catch (e) {
|
|
// IE erroneously throws error when appending an empty text node
|
|
// after a null
|
|
}
|
|
}
|
|
|
|
function flatten(list) {
|
|
// recursively flatten array
|
|
for (var i = 0; i < list.length; i++) {
|
|
if (isArray(list[i])) {
|
|
list = list.concat.apply([], list)
|
|
// check current index again and flatten until there are no more
|
|
// nested arrays at that index
|
|
i--
|
|
}
|
|
}
|
|
return list
|
|
}
|
|
|
|
function insertNode(parentElement, node, index) {
|
|
parentElement.insertBefore(node,
|
|
parentElement.childNodes[index] || null)
|
|
}
|
|
|
|
var DELETION = 1
|
|
var INSERTION = 2
|
|
var MOVE = 3
|
|
|
|
function handleKeysDiffer(data, existing, cached, parentElement) {
|
|
forKeys(data, function (key, i) {
|
|
existing[key = key.key] = existing[key] ? {
|
|
action: MOVE,
|
|
index: i,
|
|
from: existing[key].index,
|
|
element: cached.nodes[existing[key].index] ||
|
|
$document.createElement("div")
|
|
} : {action: INSERTION, index: i}
|
|
})
|
|
|
|
var actions = []
|
|
for (var prop in existing) if (hasOwn.call(existing, prop)) {
|
|
actions.push(existing[prop])
|
|
}
|
|
|
|
var changes = actions.sort(sortChanges)
|
|
var newCached = new Array(cached.length)
|
|
|
|
newCached.nodes = cached.nodes.slice()
|
|
|
|
forEach(changes, function (change) {
|
|
var index = change.index
|
|
if (change.action === DELETION) {
|
|
clear(cached[index].nodes, cached[index])
|
|
newCached.splice(index, 1)
|
|
}
|
|
if (change.action === INSERTION) {
|
|
var dummy = $document.createElement("div")
|
|
dummy.key = data[index].attrs.key
|
|
insertNode(parentElement, dummy, index)
|
|
newCached.splice(index, 0, {
|
|
attrs: {key: data[index].attrs.key},
|
|
nodes: [dummy]
|
|
})
|
|
newCached.nodes[index] = dummy
|
|
}
|
|
|
|
if (change.action === MOVE) {
|
|
var changeElement = change.element
|
|
var maybeChanged = parentElement.childNodes[index]
|
|
if (maybeChanged !== changeElement && changeElement !== null) {
|
|
parentElement.insertBefore(changeElement,
|
|
maybeChanged || null)
|
|
}
|
|
newCached[index] = cached[change.from]
|
|
newCached.nodes[index] = changeElement
|
|
}
|
|
})
|
|
|
|
return newCached
|
|
}
|
|
|
|
function diffKeys(data, cached, existing, parentElement) {
|
|
var keysDiffer = data.length !== cached.length
|
|
|
|
if (!keysDiffer) {
|
|
forKeys(data, function (attrs, i) {
|
|
var cachedCell = cached[i]
|
|
return keysDiffer = cachedCell &&
|
|
cachedCell.attrs &&
|
|
cachedCell.attrs.key !== attrs.key
|
|
})
|
|
}
|
|
|
|
if (keysDiffer) {
|
|
return handleKeysDiffer(data, existing, cached, parentElement)
|
|
} else {
|
|
return cached
|
|
}
|
|
}
|
|
|
|
function diffArray(data, cached, nodes) {
|
|
// diff the array itself
|
|
|
|
// update the list of DOM nodes by collecting the nodes from each item
|
|
forEach(data, function (_, i) {
|
|
if (cached[i] != null) nodes.push.apply(nodes, cached[i].nodes)
|
|
})
|
|
// remove items from the end of the array if the new array is shorter
|
|
// than the old one. if errors ever happen here, the issue is most
|
|
// likely a bug in the construction of the `cached` data structure
|
|
// somewhere earlier in the program
|
|
forEach(cached.nodes, function (node, i) {
|
|
if (node.parentNode != null && nodes.indexOf(node) < 0) {
|
|
clear([node], [cached[i]])
|
|
}
|
|
})
|
|
|
|
if (data.length < cached.length) cached.length = data.length
|
|
cached.nodes = nodes
|
|
}
|
|
|
|
function buildArrayKeys(data) {
|
|
var guid = 0
|
|
forKeys(data, function () {
|
|
forEach(data, function (attrs) {
|
|
if ((attrs = attrs && attrs.attrs) && attrs.key == null) {
|
|
attrs.key = "__mithril__" + guid++
|
|
}
|
|
})
|
|
return 1
|
|
})
|
|
}
|
|
|
|
function isDifferentEnough(data, cached, dataAttrKeys) {
|
|
if (data.tag !== cached.tag) return true
|
|
|
|
if (dataAttrKeys.sort().join() !==
|
|
Object.keys(cached.attrs).sort().join()) {
|
|
return true
|
|
}
|
|
|
|
if (data.attrs.id !== cached.attrs.id) {
|
|
return true
|
|
}
|
|
|
|
if (data.attrs.key !== cached.attrs.key) {
|
|
return true
|
|
}
|
|
|
|
if (m.redraw.strategy() === "all") {
|
|
return !cached.configContext || cached.configContext.retain !== true
|
|
}
|
|
|
|
if (m.redraw.strategy() === "diff") {
|
|
return cached.configContext && cached.configContext.retain === false
|
|
}
|
|
|
|
return false
|
|
}
|
|
|
|
function maybeRecreateObject(data, cached, dataAttrKeys) {
|
|
// if an element is different enough from the one in cache, recreate it
|
|
if (isDifferentEnough(data, cached, dataAttrKeys)) {
|
|
if (cached.nodes.length) clear(cached.nodes)
|
|
|
|
if (cached.configContext &&
|
|
isFunction(cached.configContext.onunload)) {
|
|
cached.configContext.onunload()
|
|
}
|
|
|
|
if (cached.controllers) {
|
|
forEach(cached.controllers, function (controller) {
|
|
if (controller.onunload) controller.onunload({preventDefault: noop});
|
|
});
|
|
}
|
|
}
|
|
}
|
|
|
|
function getObjectNamespace(data, namespace) {
|
|
if (data.attrs.xmlns) return data.attrs.xmlns
|
|
if (data.tag === "svg") return "http://www.w3.org/2000/svg"
|
|
if (data.tag === "math") return "http://www.w3.org/1998/Math/MathML"
|
|
return namespace
|
|
}
|
|
|
|
var pendingRequests = 0
|
|
m.startComputation = function () { pendingRequests++ }
|
|
m.endComputation = function () {
|
|
if (pendingRequests > 1) {
|
|
pendingRequests--
|
|
} else {
|
|
pendingRequests = 0
|
|
m.redraw()
|
|
}
|
|
}
|
|
|
|
function unloadCachedControllers(cached, views, controllers) {
|
|
if (controllers.length) {
|
|
cached.views = views
|
|
cached.controllers = controllers
|
|
forEach(controllers, function (controller) {
|
|
if (controller.onunload && controller.onunload.$old) {
|
|
controller.onunload = controller.onunload.$old
|
|
}
|
|
|
|
if (pendingRequests && controller.onunload) {
|
|
var onunload = controller.onunload
|
|
controller.onunload = noop
|
|
controller.onunload.$old = onunload
|
|
}
|
|
})
|
|
}
|
|
}
|
|
|
|
function scheduleConfigsToBeCalled(configs, data, node, isNew, cached) {
|
|
// schedule configs to be called. They are called after `build` finishes
|
|
// running
|
|
if (isFunction(data.attrs.config)) {
|
|
var context = cached.configContext = cached.configContext || {}
|
|
|
|
// bind
|
|
configs.push(function () {
|
|
return data.attrs.config.call(data, node, !isNew, context,
|
|
cached)
|
|
})
|
|
}
|
|
}
|
|
|
|
function buildUpdatedNode(
|
|
cached,
|
|
data,
|
|
editable,
|
|
hasKeys,
|
|
namespace,
|
|
views,
|
|
configs,
|
|
controllers
|
|
) {
|
|
var node = cached.nodes[0]
|
|
|
|
if (hasKeys) {
|
|
setAttributes(node, data.tag, data.attrs, cached.attrs, namespace)
|
|
}
|
|
|
|
cached.children = build(
|
|
node,
|
|
data.tag,
|
|
undefined,
|
|
undefined,
|
|
data.children,
|
|
cached.children,
|
|
false,
|
|
0,
|
|
data.attrs.contenteditable ? node : editable,
|
|
namespace,
|
|
configs
|
|
)
|
|
|
|
cached.nodes.intact = true
|
|
|
|
if (controllers.length) {
|
|
cached.views = views
|
|
cached.controllers = controllers
|
|
}
|
|
|
|
return node
|
|
}
|
|
|
|
function handleNonexistentNodes(data, parentElement, index) {
|
|
var nodes
|
|
if (data.$trusted) {
|
|
nodes = injectHTML(parentElement, index, data)
|
|
} else {
|
|
nodes = [$document.createTextNode(data)]
|
|
if (!(parentElement.nodeName in voidElements)) {
|
|
insertNode(parentElement, nodes[0], index)
|
|
}
|
|
}
|
|
|
|
var cached
|
|
|
|
if (typeof data === "string" ||
|
|
typeof data === "number" ||
|
|
typeof data === "boolean") {
|
|
cached = new data.constructor(data)
|
|
} else {
|
|
cached = data
|
|
}
|
|
|
|
cached.nodes = nodes
|
|
return cached
|
|
}
|
|
|
|
function reattachNodes(
|
|
data,
|
|
cached,
|
|
parentElement,
|
|
editable,
|
|
index,
|
|
parentTag
|
|
) {
|
|
var nodes = cached.nodes
|
|
if (!editable || editable !== $document.activeElement) {
|
|
if (data.$trusted) {
|
|
clear(nodes, cached)
|
|
nodes = injectHTML(parentElement, index, data)
|
|
} else if (parentTag === "textarea") {
|
|
// <textarea> uses `value` instead of `nodeValue`.
|
|
parentElement.value = data
|
|
} else if (editable) {
|
|
// contenteditable nodes use `innerHTML` instead of `nodeValue`.
|
|
editable.innerHTML = data
|
|
} else {
|
|
// was a trusted string
|
|
if (nodes[0].nodeType === 1 || nodes.length > 1 ||
|
|
(nodes[0].nodeValue.trim &&
|
|
!nodes[0].nodeValue.trim())) {
|
|
clear(cached.nodes, cached)
|
|
nodes = [$document.createTextNode(data)]
|
|
}
|
|
|
|
injectTextNode(parentElement, nodes[0], index, data)
|
|
}
|
|
}
|
|
cached = new data.constructor(data)
|
|
cached.nodes = nodes
|
|
return cached
|
|
}
|
|
|
|
function handleTextNode(
|
|
cached,
|
|
data,
|
|
index,
|
|
parentElement,
|
|
shouldReattach,
|
|
editable,
|
|
parentTag
|
|
) {
|
|
if (!cached.nodes.length) {
|
|
return handleNonexistentNodes(data, parentElement, index)
|
|
} else if (cached.valueOf() !== data.valueOf() || shouldReattach) {
|
|
return reattachNodes(data, cached, parentElement, editable, index,
|
|
parentTag)
|
|
} else {
|
|
return (cached.nodes.intact = true, cached)
|
|
}
|
|
}
|
|
|
|
function getSubArrayCount(item) {
|
|
if (item.$trusted) {
|
|
// fix offset of next element if item was a trusted string w/ more
|
|
// than one html element
|
|
// the first clause in the regexp matches elements
|
|
// the second clause (after the pipe) matches text nodes
|
|
var match = item.match(/<[^\/]|\>\s*[^<]/g)
|
|
if (match != null) return match.length
|
|
} else if (isArray(item)) {
|
|
return item.length
|
|
}
|
|
return 1
|
|
}
|
|
|
|
function buildArray(
|
|
data,
|
|
cached,
|
|
parentElement,
|
|
index,
|
|
parentTag,
|
|
shouldReattach,
|
|
editable,
|
|
namespace,
|
|
configs
|
|
) {
|
|
data = flatten(data)
|
|
var nodes = []
|
|
var intact = cached.length === data.length
|
|
var subArrayCount = 0
|
|
|
|
// keys algorithm: sort elements without recreating them if keys are
|
|
// present
|
|
//
|
|
// 1) create a map of all existing keys, and mark all for deletion
|
|
// 2) add new keys to map and mark them for addition
|
|
// 3) if key exists in new list, change action from deletion to a move
|
|
// 4) for each key, handle its corresponding action as marked in
|
|
// previous steps
|
|
|
|
var existing = {}
|
|
var shouldMaintainIdentities = false
|
|
|
|
forKeys(cached, function (attrs, i) {
|
|
shouldMaintainIdentities = true
|
|
existing[cached[i].attrs.key] = {action: DELETION, index: i}
|
|
})
|
|
|
|
buildArrayKeys(data)
|
|
if (shouldMaintainIdentities) {
|
|
cached = diffKeys(data, cached, existing, parentElement)
|
|
}
|
|
// end key algorithm
|
|
|
|
var cacheCount = 0
|
|
// faster explicitly written
|
|
for (var i = 0, len = data.length; i < len; i++) {
|
|
// diff each item in the array
|
|
var item = build(
|
|
parentElement,
|
|
parentTag,
|
|
cached,
|
|
index,
|
|
data[i],
|
|
cached[cacheCount],
|
|
shouldReattach,
|
|
index + subArrayCount || subArrayCount,
|
|
editable,
|
|
namespace,
|
|
configs)
|
|
|
|
if (item !== undefined) {
|
|
intact = intact && item.nodes.intact
|
|
subArrayCount += getSubArrayCount(item)
|
|
cached[cacheCount++] = item
|
|
}
|
|
}
|
|
|
|
if (!intact) diffArray(data, cached, nodes)
|
|
return cached
|
|
}
|
|
|
|
function makeCache(data, cached, index, parentIndex, parentCache) {
|
|
if (cached != null) {
|
|
if (type.call(cached) === type.call(data)) return cached
|
|
|
|
if (parentCache && parentCache.nodes) {
|
|
var offset = index - parentIndex
|
|
var end = offset + (isArray(data) ? data : cached.nodes).length
|
|
clear(
|
|
parentCache.nodes.slice(offset, end),
|
|
parentCache.slice(offset, end))
|
|
} else if (cached.nodes) {
|
|
clear(cached.nodes, cached)
|
|
}
|
|
}
|
|
|
|
cached = new data.constructor()
|
|
// if constructor creates a virtual dom element, use a blank object as
|
|
// the base cached node instead of copying the virtual el (#277)
|
|
if (cached.tag) cached = {}
|
|
cached.nodes = []
|
|
return cached
|
|
}
|
|
|
|
function constructNode(data, namespace) {
|
|
if (data.attrs.is) {
|
|
if (namespace == null) {
|
|
return $document.createElement(data.tag, data.attrs.is)
|
|
} else {
|
|
return $document.createElementNS(namespace, data.tag,
|
|
data.attrs.is)
|
|
}
|
|
} else if (namespace == null) {
|
|
return $document.createElement(data.tag)
|
|
} else {
|
|
return $document.createElementNS(namespace, data.tag)
|
|
}
|
|
}
|
|
|
|
function constructAttrs(data, node, namespace, hasKeys) {
|
|
if (hasKeys) {
|
|
return setAttributes(node, data.tag, data.attrs, {}, namespace)
|
|
} else {
|
|
return data.attrs
|
|
}
|
|
}
|
|
|
|
function constructChildren(
|
|
data,
|
|
node,
|
|
cached,
|
|
editable,
|
|
namespace,
|
|
configs
|
|
) {
|
|
if (data.children != null && data.children.length > 0) {
|
|
return build(
|
|
node,
|
|
data.tag,
|
|
undefined,
|
|
undefined,
|
|
data.children,
|
|
cached.children,
|
|
true,
|
|
0,
|
|
data.attrs.contenteditable ? node : editable,
|
|
namespace,
|
|
configs)
|
|
} else {
|
|
return data.children
|
|
}
|
|
}
|
|
|
|
function reconstructCached(
|
|
data,
|
|
attrs,
|
|
children,
|
|
node,
|
|
namespace,
|
|
views,
|
|
controllers
|
|
) {
|
|
var cached = {
|
|
tag: data.tag,
|
|
attrs: attrs,
|
|
children: children,
|
|
nodes: [node]
|
|
}
|
|
|
|
unloadCachedControllers(cached, views, controllers)
|
|
|
|
if (cached.children && !cached.children.nodes) {
|
|
cached.children.nodes = []
|
|
}
|
|
|
|
// edge case: setting value on <select> doesn't work before children
|
|
// exist, so set it again after children have been created
|
|
if (data.tag === "select" && "value" in data.attrs) {
|
|
setAttributes(node, data.tag, {value: data.attrs.value}, {},
|
|
namespace)
|
|
}
|
|
|
|
return cached
|
|
}
|
|
|
|
function getController(views, view, cachedControllers, controller) {
|
|
var controllerIndex
|
|
|
|
if (m.redraw.strategy() === "diff" && views) {
|
|
controllerIndex = views.indexOf(view)
|
|
} else {
|
|
controllerIndex = -1
|
|
}
|
|
|
|
if (controllerIndex > -1) {
|
|
return cachedControllers[controllerIndex]
|
|
} else if (isFunction(controller)) {
|
|
return new controller()
|
|
} else {
|
|
return {}
|
|
}
|
|
}
|
|
|
|
var unloaders = []
|
|
|
|
function updateLists(views, controllers, view, controller) {
|
|
if (controller.onunload != null && unloaders.map(function(u) {return u.handler}).indexOf(controller.onunload) < 0) {
|
|
unloaders.push({
|
|
controller: controller,
|
|
handler: controller.onunload
|
|
})
|
|
}
|
|
|
|
views.push(view)
|
|
controllers.push(controller)
|
|
}
|
|
|
|
var forcing = false
|
|
function checkView(data, view, cached, cachedControllers, controllers, views) {
|
|
var controller = getController(cached.views, view, cachedControllers, data.controller)
|
|
var key = data && data.attrs && data.attrs.key
|
|
data = pendingRequests === 0 || forcing || cachedControllers && cachedControllers.indexOf(controller) > -1 ? data.view(controller) : {tag: "placeholder"}
|
|
if (data.subtree === "retain") return data;
|
|
data.attrs = data.attrs || {}
|
|
data.attrs.key = key
|
|
updateLists(views, controllers, view, controller)
|
|
return data
|
|
}
|
|
|
|
function markViews(data, cached, views, controllers) {
|
|
var cachedControllers = cached && cached.controllers
|
|
|
|
while (data.view != null) {
|
|
data = checkView(
|
|
data,
|
|
data.view.$original || data.view,
|
|
cached,
|
|
cachedControllers,
|
|
controllers,
|
|
views)
|
|
}
|
|
|
|
return data
|
|
}
|
|
|
|
function buildObject( // eslint-disable-line max-statements
|
|
data,
|
|
cached,
|
|
editable,
|
|
parentElement,
|
|
index,
|
|
shouldReattach,
|
|
namespace,
|
|
configs
|
|
) {
|
|
var views = []
|
|
var controllers = []
|
|
|
|
data = markViews(data, cached, views, controllers)
|
|
|
|
if (data.subtree === "retain") return cached
|
|
|
|
if (!data.tag && controllers.length) {
|
|
throw new Error("Component template must return a virtual " +
|
|
"element, not an array, string, etc.")
|
|
}
|
|
|
|
data.attrs = data.attrs || {}
|
|
cached.attrs = cached.attrs || {}
|
|
|
|
var dataAttrKeys = Object.keys(data.attrs)
|
|
var hasKeys = dataAttrKeys.length > ("key" in data.attrs ? 1 : 0)
|
|
|
|
maybeRecreateObject(data, cached, dataAttrKeys)
|
|
|
|
if (!isString(data.tag)) return
|
|
|
|
var isNew = cached.nodes.length === 0
|
|
|
|
namespace = getObjectNamespace(data, namespace)
|
|
|
|
var node
|
|
if (isNew) {
|
|
node = constructNode(data, namespace)
|
|
// set attributes first, then create children
|
|
var attrs = constructAttrs(data, node, namespace, hasKeys)
|
|
|
|
var children = constructChildren(data, node, cached, editable,
|
|
namespace, configs)
|
|
|
|
cached = reconstructCached(
|
|
data,
|
|
attrs,
|
|
children,
|
|
node,
|
|
namespace,
|
|
views,
|
|
controllers)
|
|
} else {
|
|
node = buildUpdatedNode(
|
|
cached,
|
|
data,
|
|
editable,
|
|
hasKeys,
|
|
namespace,
|
|
views,
|
|
configs,
|
|
controllers)
|
|
}
|
|
|
|
if (isNew || shouldReattach === true && node != null) {
|
|
insertNode(parentElement, node, index)
|
|
}
|
|
|
|
// The configs are called after `build` finishes running
|
|
scheduleConfigsToBeCalled(configs, data, node, isNew, cached)
|
|
|
|
return cached
|
|
}
|
|
|
|
function build(
|
|
parentElement,
|
|
parentTag,
|
|
parentCache,
|
|
parentIndex,
|
|
data,
|
|
cached,
|
|
shouldReattach,
|
|
index,
|
|
editable,
|
|
namespace,
|
|
configs
|
|
) {
|
|
/*
|
|
* `build` is a recursive function that manages creation/diffing/removal
|
|
* of DOM elements based on comparison between `data` and `cached` the
|
|
* diff algorithm can be summarized as this:
|
|
*
|
|
* 1 - compare `data` and `cached`
|
|
* 2 - if they are different, copy `data` to `cached` and update the DOM
|
|
* based on what the difference is
|
|
* 3 - recursively apply this algorithm for every array and for the
|
|
* children of every virtual element
|
|
*
|
|
* The `cached` data structure is essentially the same as the previous
|
|
* redraw's `data` data structure, with a few additions:
|
|
* - `cached` always has a property called `nodes`, which is a list of
|
|
* DOM elements that correspond to the data represented by the
|
|
* respective virtual element
|
|
* - in order to support attaching `nodes` as a property of `cached`,
|
|
* `cached` is *always* a non-primitive object, i.e. if the data was
|
|
* a string, then cached is a String instance. If data was `null` or
|
|
* `undefined`, cached is `new String("")`
|
|
* - `cached also has a `configContext` property, which is the state
|
|
* storage object exposed by config(element, isInitialized, context)
|
|
* - when `cached` is an Object, it represents a virtual element; when
|
|
* it's an Array, it represents a list of elements; when it's a
|
|
* String, Number or Boolean, it represents a text node
|
|
*
|
|
* `parentElement` is a DOM element used for W3C DOM API calls
|
|
* `parentTag` is only used for handling a corner case for textarea
|
|
* values
|
|
* `parentCache` is used to remove nodes in some multi-node cases
|
|
* `parentIndex` and `index` are used to figure out the offset of nodes.
|
|
* They're artifacts from before arrays started being flattened and are
|
|
* likely refactorable
|
|
* `data` and `cached` are, respectively, the new and old nodes being
|
|
* diffed
|
|
* `shouldReattach` is a flag indicating whether a parent node was
|
|
* recreated (if so, and if this node is reused, then this node must
|
|
* reattach itself to the new parent)
|
|
* `editable` is a flag that indicates whether an ancestor is
|
|
* contenteditable
|
|
* `namespace` indicates the closest HTML namespace as it cascades down
|
|
* from an ancestor
|
|
* `configs` is a list of config functions to run after the topmost
|
|
* `build` call finishes running
|
|
*
|
|
* there's logic that relies on the assumption that null and undefined
|
|
* data are equivalent to empty strings
|
|
* - this prevents lifecycle surprises from procedural helpers that mix
|
|
* implicit and explicit return statements (e.g.
|
|
* function foo() {if (cond) return m("div")}
|
|
* - it simplifies diffing code
|
|
*/
|
|
data = dataToString(data)
|
|
if (data.subtree === "retain") return cached
|
|
cached = makeCache(data, cached, index, parentIndex, parentCache)
|
|
|
|
if (isArray(data)) {
|
|
return buildArray(
|
|
data,
|
|
cached,
|
|
parentElement,
|
|
index,
|
|
parentTag,
|
|
shouldReattach,
|
|
editable,
|
|
namespace,
|
|
configs)
|
|
} else if (data != null && isObject(data)) {
|
|
return buildObject(
|
|
data,
|
|
cached,
|
|
editable,
|
|
parentElement,
|
|
index,
|
|
shouldReattach,
|
|
namespace,
|
|
configs)
|
|
} else if (!isFunction(data)) {
|
|
return handleTextNode(
|
|
cached,
|
|
data,
|
|
index,
|
|
parentElement,
|
|
shouldReattach,
|
|
editable,
|
|
parentTag)
|
|
} else {
|
|
return cached
|
|
}
|
|
}
|
|
|
|
function sortChanges(a, b) {
|
|
return a.action - b.action || a.index - b.index
|
|
}
|
|
|
|
function copyStyleAttrs(node, dataAttr, cachedAttr) {
|
|
for (var rule in dataAttr) if (hasOwn.call(dataAttr, rule)) {
|
|
if (cachedAttr == null || cachedAttr[rule] !== dataAttr[rule]) {
|
|
node.style[rule] = dataAttr[rule]
|
|
}
|
|
}
|
|
|
|
for (rule in cachedAttr) if (hasOwn.call(cachedAttr, rule)) {
|
|
if (!hasOwn.call(dataAttr, rule)) node.style[rule] = ""
|
|
}
|
|
}
|
|
|
|
var shouldUseSetAttribute = {
|
|
list: 1,
|
|
style: 1,
|
|
form: 1,
|
|
type: 1,
|
|
width: 1,
|
|
height: 1
|
|
}
|
|
|
|
function setSingleAttr(
|
|
node,
|
|
attrName,
|
|
dataAttr,
|
|
cachedAttr,
|
|
tag,
|
|
namespace
|
|
) {
|
|
if (attrName === "config" || attrName === "key") {
|
|
// `config` isn't a real attribute, so ignore it
|
|
return true
|
|
} else if (isFunction(dataAttr) && attrName.slice(0, 2) === "on") {
|
|
// hook event handlers to the auto-redrawing system
|
|
node[attrName] = autoredraw(dataAttr, node)
|
|
} else if (attrName === "style" && dataAttr != null &&
|
|
isObject(dataAttr)) {
|
|
// handle `style: {...}`
|
|
copyStyleAttrs(node, dataAttr, cachedAttr)
|
|
} else if (namespace != null) {
|
|
// handle SVG
|
|
if (attrName === "href") {
|
|
node.setAttributeNS("http://www.w3.org/1999/xlink",
|
|
"href", dataAttr)
|
|
} else {
|
|
node.setAttribute(
|
|
attrName === "className" ? "class" : attrName,
|
|
dataAttr)
|
|
}
|
|
} else if (attrName in node && !shouldUseSetAttribute[attrName]) {
|
|
// handle cases that are properties (but ignore cases where we
|
|
// should use setAttribute instead)
|
|
//
|
|
// - list and form are typically used as strings, but are DOM
|
|
// element references in js
|
|
//
|
|
// - when using CSS selectors (e.g. `m("[style='']")`), style is
|
|
// used as a string, but it's an object in js
|
|
//
|
|
// #348 don't set the value if not needed - otherwise, cursor
|
|
// placement breaks in Chrome
|
|
try {
|
|
if (tag !== "input" || node[attrName] !== dataAttr) {
|
|
node[attrName] = dataAttr
|
|
}
|
|
} catch (e) {
|
|
node.setAttribute(attrName, dataAttr)
|
|
}
|
|
}
|
|
else node.setAttribute(attrName, dataAttr)
|
|
}
|
|
|
|
function trySetAttr(
|
|
node,
|
|
attrName,
|
|
dataAttr,
|
|
cachedAttr,
|
|
cachedAttrs,
|
|
tag,
|
|
namespace
|
|
) {
|
|
if (!(attrName in cachedAttrs) || (cachedAttr !== dataAttr)) {
|
|
cachedAttrs[attrName] = dataAttr
|
|
try {
|
|
return setSingleAttr(
|
|
node,
|
|
attrName,
|
|
dataAttr,
|
|
cachedAttr,
|
|
tag,
|
|
namespace)
|
|
} catch (e) {
|
|
// swallow IE's invalid argument errors to mimic HTML's
|
|
// fallback-to-doing-nothing-on-invalid-attributes behavior
|
|
if (e.message.indexOf("Invalid argument") < 0) throw e
|
|
}
|
|
} else if (attrName === "value" && tag === "input" &&
|
|
node.value !== dataAttr) {
|
|
// #348 dataAttr may not be a string, so use loose comparison
|
|
node.value = dataAttr
|
|
}
|
|
}
|
|
|
|
function setAttributes(node, tag, dataAttrs, cachedAttrs, namespace) {
|
|
for (var attrName in dataAttrs) if (hasOwn.call(dataAttrs, attrName)) {
|
|
if (trySetAttr(
|
|
node,
|
|
attrName,
|
|
dataAttrs[attrName],
|
|
cachedAttrs[attrName],
|
|
cachedAttrs,
|
|
tag,
|
|
namespace)) {
|
|
continue
|
|
}
|
|
}
|
|
return cachedAttrs
|
|
}
|
|
|
|
function clear(nodes, cached) {
|
|
for (var i = nodes.length - 1; i > -1; i--) {
|
|
if (nodes[i] && nodes[i].parentNode) {
|
|
try {
|
|
nodes[i].parentNode.removeChild(nodes[i])
|
|
} catch (e) {
|
|
/* eslint-disable max-len */
|
|
// ignore if this fails due to order of events (see
|
|
// http://stackoverflow.com/questions/21926083/failed-to-execute-removechild-on-node)
|
|
/* eslint-enable max-len */
|
|
}
|
|
cached = [].concat(cached)
|
|
if (cached[i]) unload(cached[i])
|
|
}
|
|
}
|
|
// release memory if nodes is an array. This check should fail if nodes
|
|
// is a NodeList (see loop above)
|
|
if (nodes.length) {
|
|
nodes.length = 0
|
|
}
|
|
}
|
|
|
|
function unload(cached) {
|
|
if (cached.configContext && isFunction(cached.configContext.onunload)) {
|
|
cached.configContext.onunload()
|
|
cached.configContext.onunload = null
|
|
}
|
|
if (cached.controllers) {
|
|
forEach(cached.controllers, function (controller) {
|
|
if (isFunction(controller.onunload)) {
|
|
controller.onunload({preventDefault: noop})
|
|
}
|
|
})
|
|
}
|
|
if (cached.children) {
|
|
if (isArray(cached.children)) forEach(cached.children, unload)
|
|
else if (cached.children.tag) unload(cached.children)
|
|
}
|
|
}
|
|
|
|
function appendTextFragment(parentElement, data) {
|
|
try {
|
|
parentElement.appendChild(
|
|
$document.createRange().createContextualFragment(data))
|
|
} catch (e) {
|
|
parentElement.insertAdjacentHTML("beforeend", data)
|
|
}
|
|
}
|
|
|
|
function injectHTML(parentElement, index, data) {
|
|
var nextSibling = parentElement.childNodes[index]
|
|
if (nextSibling) {
|
|
var isElement = nextSibling.nodeType !== 1
|
|
var placeholder = $document.createElement("span")
|
|
if (isElement) {
|
|
parentElement.insertBefore(placeholder, nextSibling || null)
|
|
placeholder.insertAdjacentHTML("beforebegin", data)
|
|
parentElement.removeChild(placeholder)
|
|
} else {
|
|
nextSibling.insertAdjacentHTML("beforebegin", data)
|
|
}
|
|
} else {
|
|
appendTextFragment(parentElement, data)
|
|
}
|
|
|
|
var nodes = []
|
|
|
|
while (parentElement.childNodes[index] !== nextSibling) {
|
|
nodes.push(parentElement.childNodes[index])
|
|
index++
|
|
}
|
|
|
|
return nodes
|
|
}
|
|
|
|
function autoredraw(callback, object) {
|
|
return function (e) {
|
|
e = e || event
|
|
m.redraw.strategy("diff")
|
|
m.startComputation()
|
|
try {
|
|
return callback.call(object, e)
|
|
} finally {
|
|
endFirstComputation()
|
|
}
|
|
}
|
|
}
|
|
|
|
var html
|
|
var documentNode = {
|
|
appendChild: function (node) {
|
|
if (html === undefined) html = $document.createElement("html")
|
|
if ($document.documentElement &&
|
|
$document.documentElement !== node) {
|
|
$document.replaceChild(node, $document.documentElement)
|
|
} else {
|
|
$document.appendChild(node)
|
|
}
|
|
|
|
this.childNodes = $document.childNodes
|
|
},
|
|
|
|
insertBefore: function (node) {
|
|
this.appendChild(node)
|
|
},
|
|
|
|
childNodes: []
|
|
}
|
|
|
|
var nodeCache = []
|
|
var cellCache = {}
|
|
|
|
m.render = function (root, cell, forceRecreation) {
|
|
if (!root) {
|
|
throw new Error("Ensure the DOM element being passed to " +
|
|
"m.route/m.mount/m.render is not undefined.")
|
|
}
|
|
var configs = []
|
|
var id = getCellCacheKey(root)
|
|
var isDocumentRoot = root === $document
|
|
var node
|
|
|
|
if (isDocumentRoot || root === $document.documentElement) {
|
|
node = documentNode
|
|
} else {
|
|
node = root
|
|
}
|
|
|
|
if (isDocumentRoot && cell.tag !== "html") {
|
|
cell = {tag: "html", attrs: {}, children: cell}
|
|
}
|
|
|
|
if (cellCache[id] === undefined) clear(node.childNodes)
|
|
if (forceRecreation === true) reset(root)
|
|
|
|
cellCache[id] = build(
|
|
node,
|
|
null,
|
|
undefined,
|
|
undefined,
|
|
cell,
|
|
cellCache[id],
|
|
false,
|
|
0,
|
|
null,
|
|
undefined,
|
|
configs)
|
|
|
|
forEach(configs, function (config) { config() })
|
|
}
|
|
|
|
function getCellCacheKey(element) {
|
|
var index = nodeCache.indexOf(element)
|
|
return index < 0 ? nodeCache.push(element) - 1 : index
|
|
}
|
|
|
|
m.trust = function (value) {
|
|
value = new String(value) // eslint-disable-line no-new-wrappers
|
|
value.$trusted = true
|
|
return value
|
|
}
|
|
|
|
function gettersetter(store) {
|
|
function prop() {
|
|
if (arguments.length) store = arguments[0]
|
|
return store
|
|
}
|
|
|
|
prop.toJSON = function () {
|
|
return store
|
|
}
|
|
|
|
return prop
|
|
}
|
|
|
|
m.prop = function (store) {
|
|
if ((store != null && isObject(store) || isFunction(store)) &&
|
|
isFunction(store.then)) {
|
|
return propify(store)
|
|
}
|
|
|
|
return gettersetter(store)
|
|
}
|
|
|
|
var roots = []
|
|
var components = []
|
|
var controllers = []
|
|
var lastRedrawId = null
|
|
var lastRedrawCallTime = 0
|
|
var computePreRedrawHook = null
|
|
var computePostRedrawHook = null
|
|
var topComponent
|
|
var FRAME_BUDGET = 16 // 60 frames per second = 1 call per 16 ms
|
|
|
|
function parameterize(component, args) {
|
|
function controller() {
|
|
/* eslint-disable no-invalid-this */
|
|
return (component.controller || noop).apply(this, args) || this
|
|
/* eslint-enable no-invalid-this */
|
|
}
|
|
|
|
if (component.controller) {
|
|
controller.prototype = component.controller.prototype
|
|
}
|
|
|
|
function view(ctrl) {
|
|
var currentArgs = [ctrl].concat(args)
|
|
for (var i = 1; i < arguments.length; i++) {
|
|
currentArgs.push(arguments[i])
|
|
}
|
|
|
|
return component.view.apply(component, currentArgs)
|
|
}
|
|
|
|
view.$original = component.view
|
|
var output = {controller: controller, view: view}
|
|
if (args[0] && args[0].key != null) output.attrs = {key: args[0].key}
|
|
return output
|
|
}
|
|
|
|
m.component = function (component) {
|
|
var args = [].slice.call(arguments, 1)
|
|
|
|
return parameterize(component, args)
|
|
}
|
|
|
|
function checkPrevented(component, root, index, isPrevented) {
|
|
if (!isPrevented) {
|
|
m.redraw.strategy("all")
|
|
m.startComputation()
|
|
roots[index] = root
|
|
var currentComponent
|
|
|
|
if (component) {
|
|
currentComponent = topComponent = component
|
|
} else {
|
|
currentComponent = topComponent = component = {controller: noop}
|
|
}
|
|
|
|
var controller = new (component.controller || noop)()
|
|
|
|
// controllers may call m.mount recursively (via m.route redirects,
|
|
// for example)
|
|
// this conditional ensures only the last recursive m.mount call is
|
|
// applied
|
|
if (currentComponent === topComponent) {
|
|
controllers[index] = controller
|
|
components[index] = component
|
|
}
|
|
endFirstComputation()
|
|
if (component === null) {
|
|
removeRootElement(root, index)
|
|
}
|
|
return controllers[index]
|
|
} else if (component == null) {
|
|
removeRootElement(root, index)
|
|
}
|
|
}
|
|
|
|
m.mount = m.module = function (root, component) {
|
|
if (!root) {
|
|
throw new Error("Please ensure the DOM element exists before " +
|
|
"rendering a template into it.")
|
|
}
|
|
|
|
var index = roots.indexOf(root)
|
|
if (index < 0) index = roots.length
|
|
|
|
var isPrevented = false
|
|
var event = {
|
|
preventDefault: function () {
|
|
isPrevented = true
|
|
computePreRedrawHook = computePostRedrawHook = null
|
|
}
|
|
}
|
|
|
|
forEach(unloaders, function (unloader) {
|
|
unloader.handler.call(unloader.controller, event)
|
|
unloader.controller.onunload = null
|
|
})
|
|
|
|
if (isPrevented) {
|
|
forEach(unloaders, function (unloader) {
|
|
unloader.controller.onunload = unloader.handler
|
|
})
|
|
} else {
|
|
unloaders = []
|
|
}
|
|
|
|
if (controllers[index] && isFunction(controllers[index].onunload)) {
|
|
controllers[index].onunload(event)
|
|
}
|
|
|
|
return checkPrevented(component, root, index, isPrevented)
|
|
}
|
|
|
|
function removeRootElement(root, index) {
|
|
roots.splice(index, 1)
|
|
controllers.splice(index, 1)
|
|
components.splice(index, 1)
|
|
reset(root)
|
|
nodeCache.splice(getCellCacheKey(root), 1)
|
|
}
|
|
|
|
var redrawing = false
|
|
m.redraw = function (force) {
|
|
if (redrawing) return
|
|
redrawing = true
|
|
if (force) forcing = true
|
|
|
|
try {
|
|
// lastRedrawId is a positive number if a second redraw is requested
|
|
// before the next animation frame
|
|
// lastRedrawID is null if it's the first redraw and not an event
|
|
// handler
|
|
if (lastRedrawId && !force) {
|
|
// when setTimeout: only reschedule redraw if time between now
|
|
// and previous redraw is bigger than a frame, otherwise keep
|
|
// currently scheduled timeout
|
|
// when rAF: always reschedule redraw
|
|
if ($requestAnimationFrame === global.requestAnimationFrame ||
|
|
new Date() - lastRedrawCallTime > FRAME_BUDGET) {
|
|
if (lastRedrawId > 0) $cancelAnimationFrame(lastRedrawId)
|
|
lastRedrawId = $requestAnimationFrame(redraw, FRAME_BUDGET)
|
|
}
|
|
} else {
|
|
redraw()
|
|
lastRedrawId = $requestAnimationFrame(function () {
|
|
lastRedrawId = null
|
|
}, FRAME_BUDGET)
|
|
}
|
|
} finally {
|
|
redrawing = forcing = false
|
|
}
|
|
}
|
|
|
|
m.redraw.strategy = m.prop()
|
|
function redraw() {
|
|
if (computePreRedrawHook) {
|
|
computePreRedrawHook()
|
|
computePreRedrawHook = null
|
|
}
|
|
forEach(roots, function (root, i) {
|
|
var component = components[i]
|
|
if (controllers[i]) {
|
|
var args = [controllers[i]]
|
|
m.render(root,
|
|
component.view ? component.view(controllers[i], args) : "")
|
|
}
|
|
})
|
|
// after rendering within a routed context, we need to scroll back to
|
|
// the top, and fetch the document title for history.pushState
|
|
if (computePostRedrawHook) {
|
|
computePostRedrawHook()
|
|
computePostRedrawHook = null
|
|
}
|
|
lastRedrawId = null
|
|
lastRedrawCallTime = new Date()
|
|
m.redraw.strategy("diff")
|
|
}
|
|
|
|
function endFirstComputation() {
|
|
if (m.redraw.strategy() === "none") {
|
|
pendingRequests--
|
|
m.redraw.strategy("diff")
|
|
} else {
|
|
m.endComputation()
|
|
}
|
|
}
|
|
|
|
m.withAttr = function (prop, withAttrCallback, callbackThis) {
|
|
return function (e) {
|
|
e = e || event
|
|
/* eslint-disable no-invalid-this */
|
|
var currentTarget = e.currentTarget || this
|
|
var _this = callbackThis || this
|
|
/* eslint-enable no-invalid-this */
|
|
var target = prop in currentTarget ?
|
|
currentTarget[prop] :
|
|
currentTarget.getAttribute(prop)
|
|
withAttrCallback.call(_this, target)
|
|
}
|
|
}
|
|
|
|
// routing
|
|
var modes = {pathname: "", hash: "#", search: "?"}
|
|
var redirect = noop
|
|
var isDefaultRoute = false
|
|
var routeParams, currentRoute
|
|
|
|
m.route = function (root, arg1, arg2, vdom) { // eslint-disable-line
|
|
// m.route()
|
|
if (arguments.length === 0) return currentRoute
|
|
// m.route(el, defaultRoute, routes)
|
|
if (arguments.length === 3 && isString(arg1)) {
|
|
redirect = function (source) {
|
|
var path = currentRoute = normalizeRoute(source)
|
|
if (!routeByValue(root, arg2, path)) {
|
|
if (isDefaultRoute) {
|
|
throw new Error("Ensure the default route matches " +
|
|
"one of the routes defined in m.route")
|
|
}
|
|
|
|
isDefaultRoute = true
|
|
m.route(arg1, true)
|
|
isDefaultRoute = false
|
|
}
|
|
}
|
|
|
|
var listener = m.route.mode === "hash" ?
|
|
"onhashchange" :
|
|
"onpopstate"
|
|
|
|
global[listener] = function () {
|
|
var path = $location[m.route.mode]
|
|
if (m.route.mode === "pathname") path += $location.search
|
|
if (currentRoute !== normalizeRoute(path)) redirect(path)
|
|
}
|
|
|
|
computePreRedrawHook = setScroll
|
|
global[listener]()
|
|
|
|
return
|
|
}
|
|
|
|
// config: m.route
|
|
if (root.addEventListener || root.attachEvent) {
|
|
var base = m.route.mode !== "pathname" ? $location.pathname : ""
|
|
root.href = base + modes[m.route.mode] + vdom.attrs.href
|
|
if (root.addEventListener) {
|
|
root.removeEventListener("click", routeUnobtrusive)
|
|
root.addEventListener("click", routeUnobtrusive)
|
|
} else {
|
|
root.detachEvent("onclick", routeUnobtrusive)
|
|
root.attachEvent("onclick", routeUnobtrusive)
|
|
}
|
|
|
|
return
|
|
}
|
|
// m.route(route, params, shouldReplaceHistoryEntry)
|
|
if (isString(root)) {
|
|
var oldRoute = currentRoute
|
|
currentRoute = root
|
|
|
|
var args = arg1 || {}
|
|
var queryIndex = currentRoute.indexOf("?")
|
|
var params
|
|
|
|
if (queryIndex > -1) {
|
|
params = parseQueryString(currentRoute.slice(queryIndex + 1))
|
|
} else {
|
|
params = {}
|
|
}
|
|
|
|
for (var i in args) if (hasOwn.call(args, i)) {
|
|
params[i] = args[i]
|
|
}
|
|
|
|
var querystring = buildQueryString(params)
|
|
var currentPath
|
|
|
|
if (queryIndex > -1) {
|
|
currentPath = currentRoute.slice(0, queryIndex)
|
|
} else {
|
|
currentPath = currentRoute
|
|
}
|
|
|
|
if (querystring) {
|
|
currentRoute = currentPath +
|
|
(currentPath.indexOf("?") === -1 ? "?" : "&") +
|
|
querystring
|
|
}
|
|
|
|
var replaceHistory =
|
|
(arguments.length === 3 ? arg2 : arg1) === true ||
|
|
oldRoute === root
|
|
|
|
if (global.history.pushState) {
|
|
var method = replaceHistory ? "replaceState" : "pushState"
|
|
computePreRedrawHook = setScroll
|
|
computePostRedrawHook = function () {
|
|
global.history[method](null, $document.title,
|
|
modes[m.route.mode] + currentRoute)
|
|
}
|
|
redirect(modes[m.route.mode] + currentRoute)
|
|
} else {
|
|
$location[m.route.mode] = currentRoute
|
|
redirect(modes[m.route.mode] + currentRoute)
|
|
}
|
|
}
|
|
}
|
|
|
|
m.route.param = function (key) {
|
|
if (!routeParams) {
|
|
throw new Error("You must call m.route(element, defaultRoute, " +
|
|
"routes) before calling m.route.param()")
|
|
}
|
|
|
|
if (!key) {
|
|
return routeParams
|
|
}
|
|
|
|
return routeParams[key]
|
|
}
|
|
|
|
m.route.mode = "search"
|
|
|
|
function normalizeRoute(route) {
|
|
return route.slice(modes[m.route.mode].length)
|
|
}
|
|
|
|
function routeByValue(root, router, path) {
|
|
routeParams = {}
|
|
|
|
var queryStart = path.indexOf("?")
|
|
if (queryStart !== -1) {
|
|
routeParams = parseQueryString(
|
|
path.substr(queryStart + 1, path.length))
|
|
path = path.substr(0, queryStart)
|
|
}
|
|
|
|
// Get all routes and check if there's
|
|
// an exact match for the current path
|
|
var keys = Object.keys(router)
|
|
var index = keys.indexOf(path)
|
|
|
|
if (index !== -1){
|
|
m.mount(root, router[keys [index]])
|
|
return true
|
|
}
|
|
|
|
for (var route in router) if (hasOwn.call(router, route)) {
|
|
if (route === path) {
|
|
m.mount(root, router[route])
|
|
return true
|
|
}
|
|
|
|
var matcher = new RegExp("^" + route
|
|
.replace(/:[^\/]+?\.{3}/g, "(.*?)")
|
|
.replace(/:[^\/]+/g, "([^\\/]+)") + "\/?$")
|
|
|
|
if (matcher.test(path)) {
|
|
/* eslint-disable no-loop-func */
|
|
path.replace(matcher, function () {
|
|
var keys = route.match(/:[^\/]+/g) || []
|
|
var values = [].slice.call(arguments, 1, -2)
|
|
forEach(keys, function (key, i) {
|
|
routeParams[key.replace(/:|\./g, "")] =
|
|
decodeURIComponent(values[i])
|
|
})
|
|
m.mount(root, router[route])
|
|
})
|
|
/* eslint-enable no-loop-func */
|
|
return true
|
|
}
|
|
}
|
|
}
|
|
|
|
function routeUnobtrusive(e) {
|
|
e = e || event
|
|
if (e.ctrlKey || e.metaKey || e.shiftKey || e.which === 2) return
|
|
|
|
if (e.preventDefault) {
|
|
e.preventDefault()
|
|
} else {
|
|
e.returnValue = false
|
|
}
|
|
|
|
var currentTarget = e.currentTarget || e.srcElement
|
|
var args
|
|
|
|
if (m.route.mode === "pathname" && currentTarget.search) {
|
|
args = parseQueryString(currentTarget.search.slice(1))
|
|
} else {
|
|
args = {}
|
|
}
|
|
|
|
while (currentTarget && !/a/i.test(currentTarget.nodeName)) {
|
|
currentTarget = currentTarget.parentNode
|
|
}
|
|
|
|
// clear pendingRequests because we want an immediate route change
|
|
pendingRequests = 0
|
|
m.route(currentTarget[m.route.mode]
|
|
.slice(modes[m.route.mode].length), args)
|
|
}
|
|
|
|
function setScroll() {
|
|
if (m.route.mode !== "hash" && $location.hash) {
|
|
$location.hash = $location.hash
|
|
} else {
|
|
global.scrollTo(0, 0)
|
|
}
|
|
}
|
|
|
|
function buildQueryString(object, prefix) {
|
|
var duplicates = {}
|
|
var str = []
|
|
|
|
for (var prop in object) if (hasOwn.call(object, prop)) {
|
|
var key = prefix ? prefix + "[" + prop + "]" : prop
|
|
var value = object[prop]
|
|
|
|
if (value === null) {
|
|
str.push(encodeURIComponent(key))
|
|
} else if (isObject(value)) {
|
|
str.push(buildQueryString(value, key))
|
|
} else if (isArray(value)) {
|
|
var keys = []
|
|
duplicates[key] = duplicates[key] || {}
|
|
/* eslint-disable no-loop-func */
|
|
forEach(value, function (item) {
|
|
/* eslint-enable no-loop-func */
|
|
if (!duplicates[key][item]) {
|
|
duplicates[key][item] = true
|
|
keys.push(encodeURIComponent(key) + "=" +
|
|
encodeURIComponent(item))
|
|
}
|
|
})
|
|
str.push(keys.join("&"))
|
|
} else if (value !== undefined) {
|
|
str.push(encodeURIComponent(key) + "=" +
|
|
encodeURIComponent(value))
|
|
}
|
|
}
|
|
return str.join("&")
|
|
}
|
|
|
|
function parseQueryString(str) {
|
|
if (str === "" || str == null) return {}
|
|
if (str.charAt(0) === "?") str = str.slice(1)
|
|
|
|
var pairs = str.split("&")
|
|
var params = {}
|
|
|
|
forEach(pairs, function (string) {
|
|
var pair = string.split("=")
|
|
var key = decodeURIComponent(pair[0])
|
|
var value = pair.length === 2 ? decodeURIComponent(pair[1]) : null
|
|
if (params[key] != null) {
|
|
if (!isArray(params[key])) params[key] = [params[key]]
|
|
params[key].push(value)
|
|
}
|
|
else params[key] = value
|
|
})
|
|
|
|
return params
|
|
}
|
|
|
|
m.route.buildQueryString = buildQueryString
|
|
m.route.parseQueryString = parseQueryString
|
|
|
|
function reset(root) {
|
|
var cacheKey = getCellCacheKey(root)
|
|
clear(root.childNodes, cellCache[cacheKey])
|
|
cellCache[cacheKey] = undefined
|
|
}
|
|
|
|
m.deferred = function () {
|
|
var deferred = new Deferred()
|
|
deferred.promise = propify(deferred.promise)
|
|
return deferred
|
|
}
|
|
|
|
function propify(promise, initialValue) {
|
|
var prop = m.prop(initialValue)
|
|
promise.then(prop)
|
|
prop.then = function (resolve, reject) {
|
|
return propify(promise.then(resolve, reject), initialValue)
|
|
}
|
|
|
|
prop.catch = prop.then.bind(null, null)
|
|
return prop
|
|
}
|
|
// Promiz.mithril.js | Zolmeister | MIT
|
|
// a modified version of Promiz.js, which does not conform to Promises/A+
|
|
// for two reasons:
|
|
//
|
|
// 1) `then` callbacks are called synchronously (because setTimeout is too
|
|
// slow, and the setImmediate polyfill is too big
|
|
//
|
|
// 2) throwing subclasses of Error cause the error to be bubbled up instead
|
|
// of triggering rejection (because the spec does not account for the
|
|
// important use case of default browser error handling, i.e. message w/
|
|
// line number)
|
|
|
|
var RESOLVING = 1
|
|
var REJECTING = 2
|
|
var RESOLVED = 3
|
|
var REJECTED = 4
|
|
|
|
function Deferred(onSuccess, onFailure) {
|
|
var self = this
|
|
var state = 0
|
|
var promiseValue = 0
|
|
var next = []
|
|
|
|
self.promise = {}
|
|
|
|
self.resolve = function (value) {
|
|
if (!state) {
|
|
promiseValue = value
|
|
state = RESOLVING
|
|
|
|
fire()
|
|
}
|
|
|
|
return self
|
|
}
|
|
|
|
self.reject = function (value) {
|
|
if (!state) {
|
|
promiseValue = value
|
|
state = REJECTING
|
|
|
|
fire()
|
|
}
|
|
|
|
return self
|
|
}
|
|
|
|
self.promise.then = function (onSuccess, onFailure) {
|
|
var deferred = new Deferred(onSuccess, onFailure)
|
|
|
|
if (state === RESOLVED) {
|
|
deferred.resolve(promiseValue)
|
|
} else if (state === REJECTED) {
|
|
deferred.reject(promiseValue)
|
|
} else {
|
|
next.push(deferred)
|
|
}
|
|
|
|
return deferred.promise
|
|
}
|
|
|
|
function finish(type) {
|
|
state = type || REJECTED
|
|
next.map(function (deferred) {
|
|
if (state === RESOLVED) {
|
|
deferred.resolve(promiseValue)
|
|
} else {
|
|
deferred.reject(promiseValue)
|
|
}
|
|
})
|
|
}
|
|
|
|
function thennable(then, success, failure, notThennable) {
|
|
if (((promiseValue != null && isObject(promiseValue)) ||
|
|
isFunction(promiseValue)) && isFunction(then)) {
|
|
try {
|
|
// count protects against abuse calls from spec checker
|
|
var count = 0
|
|
then.call(promiseValue, function (value) {
|
|
if (count++) return
|
|
promiseValue = value
|
|
success()
|
|
}, function (value) {
|
|
if (count++) return
|
|
promiseValue = value
|
|
failure()
|
|
})
|
|
} catch (e) {
|
|
m.deferred.onerror(e)
|
|
promiseValue = e
|
|
failure()
|
|
}
|
|
} else {
|
|
notThennable()
|
|
}
|
|
}
|
|
|
|
function fire() {
|
|
// check if it's a thenable
|
|
var then
|
|
try {
|
|
then = promiseValue && promiseValue.then
|
|
} catch (e) {
|
|
m.deferred.onerror(e)
|
|
promiseValue = e
|
|
state = REJECTING
|
|
return fire()
|
|
}
|
|
|
|
if (state === REJECTING) {
|
|
m.deferred.onerror(promiseValue)
|
|
}
|
|
|
|
thennable(then, function () {
|
|
state = RESOLVING
|
|
fire()
|
|
}, function () {
|
|
state = REJECTING
|
|
fire()
|
|
}, function () {
|
|
try {
|
|
if (state === RESOLVING && isFunction(onSuccess)) {
|
|
promiseValue = onSuccess(promiseValue)
|
|
} else if (state === REJECTING && isFunction(onFailure)) {
|
|
promiseValue = onFailure(promiseValue)
|
|
state = RESOLVING
|
|
}
|
|
} catch (e) {
|
|
m.deferred.onerror(e)
|
|
promiseValue = e
|
|
return finish()
|
|
}
|
|
|
|
if (promiseValue === self) {
|
|
promiseValue = TypeError()
|
|
finish()
|
|
} else {
|
|
thennable(then, function () {
|
|
finish(RESOLVED)
|
|
}, finish, function () {
|
|
finish(state === RESOLVING && RESOLVED)
|
|
})
|
|
}
|
|
})
|
|
}
|
|
}
|
|
|
|
m.deferred.onerror = function (e) {
|
|
if (type.call(e) === "[object Error]" &&
|
|
!/ Error/.test(e.constructor.toString())) {
|
|
pendingRequests = 0
|
|
throw e
|
|
}
|
|
}
|
|
|
|
m.sync = function (args) {
|
|
var deferred = m.deferred()
|
|
var outstanding = args.length
|
|
var results = new Array(outstanding)
|
|
var method = "resolve"
|
|
|
|
function synchronizer(pos, resolved) {
|
|
return function (value) {
|
|
results[pos] = value
|
|
if (!resolved) method = "reject"
|
|
if (--outstanding === 0) {
|
|
deferred.promise(results)
|
|
deferred[method](results)
|
|
}
|
|
return value
|
|
}
|
|
}
|
|
|
|
if (args.length > 0) {
|
|
forEach(args, function (arg, i) {
|
|
arg.then(synchronizer(i, true), synchronizer(i, false))
|
|
})
|
|
} else {
|
|
deferred.resolve([])
|
|
}
|
|
|
|
return deferred.promise
|
|
}
|
|
|
|
function identity(value) { return value }
|
|
|
|
function handleJsonp(options) {
|
|
var callbackKey = "mithril_callback_" +
|
|
new Date().getTime() + "_" +
|
|
(Math.round(Math.random() * 1e16)).toString(36)
|
|
|
|
var script = $document.createElement("script")
|
|
|
|
global[callbackKey] = function (resp) {
|
|
script.parentNode.removeChild(script)
|
|
options.onload({
|
|
type: "load",
|
|
target: {
|
|
responseText: resp
|
|
}
|
|
})
|
|
global[callbackKey] = undefined
|
|
}
|
|
|
|
script.onerror = function () {
|
|
script.parentNode.removeChild(script)
|
|
|
|
options.onerror({
|
|
type: "error",
|
|
target: {
|
|
status: 500,
|
|
responseText: JSON.stringify({
|
|
error: "Error making jsonp request"
|
|
})
|
|
}
|
|
})
|
|
global[callbackKey] = undefined
|
|
|
|
return false
|
|
}
|
|
|
|
script.onload = function () {
|
|
return false
|
|
}
|
|
|
|
script.src = options.url +
|
|
(options.url.indexOf("?") > 0 ? "&" : "?") +
|
|
(options.callbackKey ? options.callbackKey : "callback") +
|
|
"=" + callbackKey +
|
|
"&" + buildQueryString(options.data || {})
|
|
|
|
$document.body.appendChild(script)
|
|
}
|
|
|
|
function createXhr(options) {
|
|
var xhr = new global.XMLHttpRequest()
|
|
xhr.open(options.method, options.url, true, options.user,
|
|
options.password)
|
|
|
|
xhr.onreadystatechange = function () {
|
|
if (xhr.readyState === 4) {
|
|
if (xhr.status >= 200 && xhr.status < 300) {
|
|
options.onload({type: "load", target: xhr})
|
|
} else {
|
|
options.onerror({type: "error", target: xhr})
|
|
}
|
|
}
|
|
}
|
|
|
|
if (options.serialize === JSON.stringify &&
|
|
options.data &&
|
|
options.method !== "GET") {
|
|
xhr.setRequestHeader("Content-Type",
|
|
"application/json; charset=utf-8")
|
|
}
|
|
|
|
if (options.deserialize === JSON.parse) {
|
|
xhr.setRequestHeader("Accept", "application/json, text/*")
|
|
}
|
|
|
|
if (isFunction(options.config)) {
|
|
var maybeXhr = options.config(xhr, options)
|
|
if (maybeXhr != null) xhr = maybeXhr
|
|
}
|
|
|
|
var data = options.method === "GET" || !options.data ? "" : options.data
|
|
|
|
if (data && !isString(data) && data.constructor !== global.FormData) {
|
|
throw new Error("Request data should be either be a string or " +
|
|
"FormData. Check the `serialize` option in `m.request`")
|
|
}
|
|
|
|
xhr.send(data)
|
|
return xhr
|
|
}
|
|
|
|
function ajax(options) {
|
|
if (options.dataType && options.dataType.toLowerCase() === "jsonp") {
|
|
return handleJsonp(options)
|
|
} else {
|
|
return createXhr(options)
|
|
}
|
|
}
|
|
|
|
function bindData(options, data, serialize) {
|
|
if (options.method === "GET" && options.dataType !== "jsonp") {
|
|
var prefix = options.url.indexOf("?") < 0 ? "?" : "&"
|
|
var querystring = buildQueryString(data)
|
|
options.url += (querystring ? prefix + querystring : "")
|
|
} else {
|
|
options.data = serialize(data)
|
|
}
|
|
}
|
|
|
|
function parameterizeUrl(url, data) {
|
|
if (data) {
|
|
url = url.replace(/:[a-z]\w+/gi, function(token){
|
|
var key = token.slice(1)
|
|
var value = data[key]
|
|
delete data[key]
|
|
return value
|
|
})
|
|
}
|
|
return url
|
|
}
|
|
|
|
m.request = function (options) {
|
|
if (options.background !== true) m.startComputation()
|
|
var deferred = new Deferred()
|
|
var isJSONP = options.dataType &&
|
|
options.dataType.toLowerCase() === "jsonp"
|
|
|
|
var serialize, deserialize, extract
|
|
|
|
if (isJSONP) {
|
|
serialize = options.serialize =
|
|
deserialize = options.deserialize = identity
|
|
|
|
extract = function (jsonp) { return jsonp.responseText }
|
|
} else {
|
|
serialize = options.serialize = options.serialize || JSON.stringify
|
|
|
|
deserialize = options.deserialize =
|
|
options.deserialize || JSON.parse
|
|
extract = options.extract || function (xhr) {
|
|
if (xhr.responseText.length || deserialize !== JSON.parse) {
|
|
return xhr.responseText
|
|
} else {
|
|
return null
|
|
}
|
|
}
|
|
}
|
|
|
|
options.method = (options.method || "GET").toUpperCase()
|
|
options.url = parameterizeUrl(options.url, options.data)
|
|
bindData(options, options.data, serialize)
|
|
options.onload = options.onerror = function (ev) {
|
|
try {
|
|
ev = ev || event
|
|
var response = deserialize(extract(ev.target, options))
|
|
if (ev.type === "load") {
|
|
if (options.unwrapSuccess) {
|
|
response = options.unwrapSuccess(response, ev.target)
|
|
}
|
|
|
|
if (isArray(response) && options.type) {
|
|
forEach(response, function (res, i) {
|
|
response[i] = new options.type(res)
|
|
})
|
|
} else if (options.type) {
|
|
response = new options.type(response)
|
|
}
|
|
|
|
deferred.resolve(response)
|
|
} else {
|
|
if (options.unwrapError) {
|
|
response = options.unwrapError(response, ev.target)
|
|
}
|
|
|
|
deferred.reject(response)
|
|
}
|
|
} catch (e) {
|
|
deferred.reject(e)
|
|
} finally {
|
|
if (options.background !== true) m.endComputation()
|
|
}
|
|
}
|
|
|
|
ajax(options)
|
|
deferred.promise = propify(deferred.promise, options.initialValue)
|
|
return deferred.promise
|
|
}
|
|
|
|
return m
|
|
})
|
|
;
|
|
( function _package( factory ){
|
|
if( typeof define === 'function' && define.amd ){
|
|
define( [ 'mithril' ], factory )
|
|
}
|
|
else if( typeof exports === 'object' ){
|
|
module.exports = factory( require( 'mithril' ) )
|
|
}
|
|
else{
|
|
factory( m )
|
|
}
|
|
}( function define( m ){
|
|
function bidi( node, prop ){
|
|
var type = node.tag === 'select'
|
|
? node.attrs.multi
|
|
? 'multi'
|
|
: 'select'
|
|
: node.attrs.type
|
|
|
|
// Setup: bind listeners
|
|
if( type === 'multi' ){
|
|
node.attrs.onchange = function(){
|
|
prop( [].slice.call( this.selectedOptions, function( x ){
|
|
return x.value
|
|
} ) )
|
|
}
|
|
}
|
|
else if( type === 'select' ){
|
|
node.attrs.onchange = function( e ){
|
|
prop( this.selectedOptions[ 0 ].value )
|
|
}
|
|
}
|
|
else if( type === 'checkbox' ){
|
|
node.attrs.onchange = function( e ){
|
|
prop( this.checked )
|
|
}
|
|
}
|
|
else {
|
|
node.attrs.onchange = node.attrs.oninput = function( e ){
|
|
prop( this.value )
|
|
}
|
|
}
|
|
|
|
if( node.tag === 'select' ){
|
|
node.children.forEach( function( option ){
|
|
if( option.attrs.value === prop() || option.children[ 0 ] === prop() ){
|
|
option.attrs.selected = true
|
|
}
|
|
} )
|
|
}
|
|
else if( type === 'checkbox' ){
|
|
node.attrs.checked = prop()
|
|
}
|
|
else if( type === 'radio' ){
|
|
node.attrs.checked = prop() === node.attrs.value
|
|
}
|
|
else {
|
|
node.attrs.value = prop()
|
|
}
|
|
|
|
return node
|
|
}
|
|
|
|
bidi.view = function( ctrl, node, prop ){
|
|
return bidi( node, node.attrs.bidi )
|
|
}
|
|
|
|
if( m.attrs ) m.attrs.bidi = bidi
|
|
|
|
m.bidi = bidi
|
|
|
|
return bidi
|
|
} ) )
|
|
;
|
|
/*!
|
|
* jQuery JavaScript Library v2.1.4
|
|
* http://jquery.com/
|
|
*
|
|
* Includes Sizzle.js
|
|
* http://sizzlejs.com/
|
|
*
|
|
* Copyright 2005, 2014 jQuery Foundation, Inc. and other contributors
|
|
* Released under the MIT license
|
|
* http://jquery.org/license
|
|
*
|
|
* Date: 2015-04-28T16:01Z
|
|
*/
|
|
|
|
(function( global, factory ) {
|
|
|
|
if ( typeof module === "object" && typeof module.exports === "object" ) {
|
|
// For CommonJS and CommonJS-like environments where a proper `window`
|
|
// is present, execute the factory and get jQuery.
|
|
// For environments that do not have a `window` with a `document`
|
|
// (such as Node.js), expose a factory as module.exports.
|
|
// This accentuates the need for the creation of a real `window`.
|
|
// e.g. var jQuery = require("jquery")(window);
|
|
// See ticket #14549 for more info.
|
|
module.exports = global.document ?
|
|
factory( global, true ) :
|
|
function( w ) {
|
|
if ( !w.document ) {
|
|
throw new Error( "jQuery requires a window with a document" );
|
|
}
|
|
return factory( w );
|
|
};
|
|
} else {
|
|
factory( global );
|
|
}
|
|
|
|
// Pass this if window is not defined yet
|
|
}(typeof window !== "undefined" ? window : this, function( window, noGlobal ) {
|
|
|
|
// Support: Firefox 18+
|
|
// Can't be in strict mode, several libs including ASP.NET trace
|
|
// the stack via arguments.caller.callee and Firefox dies if
|
|
// you try to trace through "use strict" call chains. (#13335)
|
|
//
|
|
|
|
var arr = [];
|
|
|
|
var slice = arr.slice;
|
|
|
|
var concat = arr.concat;
|
|
|
|
var push = arr.push;
|
|
|
|
var indexOf = arr.indexOf;
|
|
|
|
var class2type = {};
|
|
|
|
var toString = class2type.toString;
|
|
|
|
var hasOwn = class2type.hasOwnProperty;
|
|
|
|
var support = {};
|
|
|
|
|
|
|
|
var
|
|
// Use the correct document accordingly with window argument (sandbox)
|
|
document = window.document,
|
|
|
|
version = "2.1.4",
|
|
|
|
// Define a local copy of jQuery
|
|
jQuery = function( selector, context ) {
|
|
// The jQuery object is actually just the init constructor 'enhanced'
|
|
// Need init if jQuery is called (just allow error to be thrown if not included)
|
|
return new jQuery.fn.init( selector, context );
|
|
},
|
|
|
|
// Support: Android<4.1
|
|
// Make sure we trim BOM and NBSP
|
|
rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g,
|
|
|
|
// Matches dashed string for camelizing
|
|
rmsPrefix = /^-ms-/,
|
|
rdashAlpha = /-([\da-z])/gi,
|
|
|
|
// Used by jQuery.camelCase as callback to replace()
|
|
fcamelCase = function( all, letter ) {
|
|
return letter.toUpperCase();
|
|
};
|
|
|
|
jQuery.fn = jQuery.prototype = {
|
|
// The current version of jQuery being used
|
|
jquery: version,
|
|
|
|
constructor: jQuery,
|
|
|
|
// Start with an empty selector
|
|
selector: "",
|
|
|
|
// The default length of a jQuery object is 0
|
|
length: 0,
|
|
|
|
toArray: function() {
|
|
return slice.call( this );
|
|
},
|
|
|
|
// Get the Nth element in the matched element set OR
|
|
// Get the whole matched element set as a clean array
|
|
get: function( num ) {
|
|
return num != null ?
|
|
|
|
// Return just the one element from the set
|
|
( num < 0 ? this[ num + this.length ] : this[ num ] ) :
|
|
|
|
// Return all the elements in a clean array
|
|
slice.call( this );
|
|
},
|
|
|
|
// Take an array of elements and push it onto the stack
|
|
// (returning the new matched element set)
|
|
pushStack: function( elems ) {
|
|
|
|
// Build a new jQuery matched element set
|
|
var ret = jQuery.merge( this.constructor(), elems );
|
|
|
|
// Add the old object onto the stack (as a reference)
|
|
ret.prevObject = this;
|
|
ret.context = this.context;
|
|
|
|
// Return the newly-formed element set
|
|
return ret;
|
|
},
|
|
|
|
// Execute a callback for every element in the matched set.
|
|
// (You can seed the arguments with an array of args, but this is
|
|
// only used internally.)
|
|
each: function( callback, args ) {
|
|
return jQuery.each( this, callback, args );
|
|
},
|
|
|
|
map: function( callback ) {
|
|
return this.pushStack( jQuery.map(this, function( elem, i ) {
|
|
return callback.call( elem, i, elem );
|
|
}));
|
|
},
|
|
|
|
slice: function() {
|
|
return this.pushStack( slice.apply( this, arguments ) );
|
|
},
|
|
|
|
first: function() {
|
|
return this.eq( 0 );
|
|
},
|
|
|
|
last: function() {
|
|
return this.eq( -1 );
|
|
},
|
|
|
|
eq: function( i ) {
|
|
var len = this.length,
|
|
j = +i + ( i < 0 ? len : 0 );
|
|
return this.pushStack( j >= 0 && j < len ? [ this[j] ] : [] );
|
|
},
|
|
|
|
end: function() {
|
|
return this.prevObject || this.constructor(null);
|
|
},
|
|
|
|
// For internal use only.
|
|
// Behaves like an Array's method, not like a jQuery method.
|
|
push: push,
|
|
sort: arr.sort,
|
|
splice: arr.splice
|
|
};
|
|
|
|
jQuery.extend = jQuery.fn.extend = function() {
|
|
var options, name, src, copy, copyIsArray, clone,
|
|
target = arguments[0] || {},
|
|
i = 1,
|
|
length = arguments.length,
|
|
deep = false;
|
|
|
|
// Handle a deep copy situation
|
|
if ( typeof target === "boolean" ) {
|
|
deep = target;
|
|
|
|
// Skip the boolean and the target
|
|
target = arguments[ i ] || {};
|
|
i++;
|
|
}
|
|
|
|
// Handle case when target is a string or something (possible in deep copy)
|
|
if ( typeof target !== "object" && !jQuery.isFunction(target) ) {
|
|
target = {};
|
|
}
|
|
|
|
// Extend jQuery itself if only one argument is passed
|
|
if ( i === length ) {
|
|
target = this;
|
|
i--;
|
|
}
|
|
|
|
for ( ; i < length; i++ ) {
|
|
// Only deal with non-null/undefined values
|
|
if ( (options = arguments[ i ]) != null ) {
|
|
// Extend the base object
|
|
for ( name in options ) {
|
|
src = target[ name ];
|
|
copy = options[ name ];
|
|
|
|
// Prevent never-ending loop
|
|
if ( target === copy ) {
|
|
continue;
|
|
}
|
|
|
|
// Recurse if we're merging plain objects or arrays
|
|
if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) {
|
|
if ( copyIsArray ) {
|
|
copyIsArray = false;
|
|
clone = src && jQuery.isArray(src) ? src : [];
|
|
|
|
} else {
|
|
clone = src && jQuery.isPlainObject(src) ? src : {};
|
|
}
|
|
|
|
// Never move original objects, clone them
|
|
target[ name ] = jQuery.extend( deep, clone, copy );
|
|
|
|
// Don't bring in undefined values
|
|
} else if ( copy !== undefined ) {
|
|
target[ name ] = copy;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
// Return the modified object
|
|
return target;
|
|
};
|
|
|
|
jQuery.extend({
|
|
// Unique for each copy of jQuery on the page
|
|
expando: "jQuery" + ( version + Math.random() ).replace( /\D/g, "" ),
|
|
|
|
// Assume jQuery is ready without the ready module
|
|
isReady: true,
|
|
|
|
error: function( msg ) {
|
|
throw new Error( msg );
|
|
},
|
|
|
|
noop: function() {},
|
|
|
|
isFunction: function( obj ) {
|
|
return jQuery.type(obj) === "function";
|
|
},
|
|
|
|
isArray: Array.isArray,
|
|
|
|
isWindow: function( obj ) {
|
|
return obj != null && obj === obj.window;
|
|
},
|
|
|
|
isNumeric: function( obj ) {
|
|
// parseFloat NaNs numeric-cast false positives (null|true|false|"")
|
|
// ...but misinterprets leading-number strings, particularly hex literals ("0x...")
|
|
// subtraction forces infinities to NaN
|
|
// adding 1 corrects loss of precision from parseFloat (#15100)
|
|
return !jQuery.isArray( obj ) && (obj - parseFloat( obj ) + 1) >= 0;
|
|
},
|
|
|
|
isPlainObject: function( obj ) {
|
|
// Not plain objects:
|
|
// - Any object or value whose internal [[Class]] property is not "[object Object]"
|
|
// - DOM nodes
|
|
// - window
|
|
if ( jQuery.type( obj ) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) {
|
|
return false;
|
|
}
|
|
|
|
if ( obj.constructor &&
|
|
!hasOwn.call( obj.constructor.prototype, "isPrototypeOf" ) ) {
|
|
return false;
|
|
}
|
|
|
|
// If the function hasn't returned already, we're confident that
|
|
// |obj| is a plain object, created by {} or constructed with new Object
|
|
return true;
|
|
},
|
|
|
|
isEmptyObject: function( obj ) {
|
|
var name;
|
|
for ( name in obj ) {
|
|
return false;
|
|
}
|
|
return true;
|
|
},
|
|
|
|
type: function( obj ) {
|
|
if ( obj == null ) {
|
|
return obj + "";
|
|
}
|
|
// Support: Android<4.0, iOS<6 (functionish RegExp)
|
|
return typeof obj === "object" || typeof obj === "function" ?
|
|
class2type[ toString.call(obj) ] || "object" :
|
|
typeof obj;
|
|
},
|
|
|
|
// Evaluates a script in a global context
|
|
globalEval: function( code ) {
|
|
var script,
|
|
indirect = eval;
|
|
|
|
code = jQuery.trim( code );
|
|
|
|
if ( code ) {
|
|
// If the code includes a valid, prologue position
|
|
// strict mode pragma, execute code by injecting a
|
|
// script tag into the document.
|
|
if ( code.indexOf("use strict") === 1 ) {
|
|
script = document.createElement("script");
|
|
script.text = code;
|
|
document.head.appendChild( script ).parentNode.removeChild( script );
|
|
} else {
|
|
// Otherwise, avoid the DOM node creation, insertion
|
|
// and removal by using an indirect global eval
|
|
indirect( code );
|
|
}
|
|
}
|
|
},
|
|
|
|
// Convert dashed to camelCase; used by the css and data modules
|
|
// Support: IE9-11+
|
|
// Microsoft forgot to hump their vendor prefix (#9572)
|
|
camelCase: function( string ) {
|
|
return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase );
|
|
},
|
|
|
|
nodeName: function( elem, name ) {
|
|
return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase();
|
|
},
|
|
|
|
// args is for internal usage only
|
|
each: function( obj, callback, args ) {
|
|
var value,
|
|
i = 0,
|
|
length = obj.length,
|
|
isArray = isArraylike( obj );
|
|
|
|
if ( args ) {
|
|
if ( isArray ) {
|
|
for ( ; i < length; i++ ) {
|
|
value = callback.apply( obj[ i ], args );
|
|
|
|
if ( value === false ) {
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
for ( i in obj ) {
|
|
value = callback.apply( obj[ i ], args );
|
|
|
|
if ( value === false ) {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
|
|
// A special, fast, case for the most common use of each
|
|
} else {
|
|
if ( isArray ) {
|
|
for ( ; i < length; i++ ) {
|
|
value = callback.call( obj[ i ], i, obj[ i ] );
|
|
|
|
if ( value === false ) {
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
for ( i in obj ) {
|
|
value = callback.call( obj[ i ], i, obj[ i ] );
|
|
|
|
if ( value === false ) {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
return obj;
|
|
},
|
|
|
|
// Support: Android<4.1
|
|
trim: function( text ) {
|
|
return text == null ?
|
|
"" :
|
|
( text + "" ).replace( rtrim, "" );
|
|
},
|
|
|
|
// results is for internal usage only
|
|
makeArray: function( arr, results ) {
|
|
var ret = results || [];
|
|
|
|
if ( arr != null ) {
|
|
if ( isArraylike( Object(arr) ) ) {
|
|
jQuery.merge( ret,
|
|
typeof arr === "string" ?
|
|
[ arr ] : arr
|
|
);
|
|
} else {
|
|
push.call( ret, arr );
|
|
}
|
|
}
|
|
|
|
return ret;
|
|
},
|
|
|
|
inArray: function( elem, arr, i ) {
|
|
return arr == null ? -1 : indexOf.call( arr, elem, i );
|
|
},
|
|
|
|
merge: function( first, second ) {
|
|
var len = +second.length,
|
|
j = 0,
|
|
i = first.length;
|
|
|
|
for ( ; j < len; j++ ) {
|
|
first[ i++ ] = second[ j ];
|
|
}
|
|
|
|
first.length = i;
|
|
|
|
return first;
|
|
},
|
|
|
|
grep: function( elems, callback, invert ) {
|
|
var callbackInverse,
|
|
matches = [],
|
|
i = 0,
|
|
length = elems.length,
|
|
callbackExpect = !invert;
|
|
|
|
// Go through the array, only saving the items
|
|
// that pass the validator function
|
|
for ( ; i < length; i++ ) {
|
|
callbackInverse = !callback( elems[ i ], i );
|
|
if ( callbackInverse !== callbackExpect ) {
|
|
matches.push( elems[ i ] );
|
|
}
|
|
}
|
|
|
|
return matches;
|
|
},
|
|
|
|
// arg is for internal usage only
|
|
map: function( elems, callback, arg ) {
|
|
var value,
|
|
i = 0,
|
|
length = elems.length,
|
|
isArray = isArraylike( elems ),
|
|
ret = [];
|
|
|
|
// Go through the array, translating each of the items to their new values
|
|
if ( isArray ) {
|
|
for ( ; i < length; i++ ) {
|
|
value = callback( elems[ i ], i, arg );
|
|
|
|
if ( value != null ) {
|
|
ret.push( value );
|
|
}
|
|
}
|
|
|
|
// Go through every key on the object,
|
|
} else {
|
|
for ( i in elems ) {
|
|
value = callback( elems[ i ], i, arg );
|
|
|
|
if ( value != null ) {
|
|
ret.push( value );
|
|
}
|
|
}
|
|
}
|
|
|
|
// Flatten any nested arrays
|
|
return concat.apply( [], ret );
|
|
},
|
|
|
|
// A global GUID counter for objects
|
|
guid: 1,
|
|
|
|
// Bind a function to a context, optionally partially applying any
|
|
// arguments.
|
|
proxy: function( fn, context ) {
|
|
var tmp, args, proxy;
|
|
|
|
if ( typeof context === "string" ) {
|
|
tmp = fn[ context ];
|
|
context = fn;
|
|
fn = tmp;
|
|
}
|
|
|
|
// Quick check to determine if target is callable, in the spec
|
|
// this throws a TypeError, but we will just return undefined.
|
|
if ( !jQuery.isFunction( fn ) ) {
|
|
return undefined;
|
|
}
|
|
|
|
// Simulated bind
|
|
args = slice.call( arguments, 2 );
|
|
proxy = function() {
|
|
return fn.apply( context || this, args.concat( slice.call( arguments ) ) );
|
|
};
|
|
|
|
// Set the guid of unique handler to the same of original handler, so it can be removed
|
|
proxy.guid = fn.guid = fn.guid || jQuery.guid++;
|
|
|
|
return proxy;
|
|
},
|
|
|
|
now: Date.now,
|
|
|
|
// jQuery.support is not used in Core but other projects attach their
|
|
// properties to it so it needs to exist.
|
|
support: support
|
|
});
|
|
|
|
// Populate the class2type map
|
|
jQuery.each("Boolean Number String Function Array Date RegExp Object Error".split(" "), function(i, name) {
|
|
class2type[ "[object " + name + "]" ] = name.toLowerCase();
|
|
});
|
|
|
|
function isArraylike( obj ) {
|
|
|
|
// Support: iOS 8.2 (not reproducible in simulator)
|
|
// `in` check used to prevent JIT error (gh-2145)
|
|
// hasOwn isn't used here due to false negatives
|
|
// regarding Nodelist length in IE
|
|
var length = "length" in obj && obj.length,
|
|
type = jQuery.type( obj );
|
|
|
|
if ( type === "function" || jQuery.isWindow( obj ) ) {
|
|
return false;
|
|
}
|
|
|
|
if ( obj.nodeType === 1 && length ) {
|
|
return true;
|
|
}
|
|
|
|
return type === "array" || length === 0 ||
|
|
typeof length === "number" && length > 0 && ( length - 1 ) in obj;
|
|
}
|
|
var Sizzle =
|
|
/*!
|
|
* Sizzle CSS Selector Engine v2.2.0-pre
|
|
* http://sizzlejs.com/
|
|
*
|
|
* Copyright 2008, 2014 jQuery Foundation, Inc. and other contributors
|
|
* Released under the MIT license
|
|
* http://jquery.org/license
|
|
*
|
|
* Date: 2014-12-16
|
|
*/
|
|
(function( window ) {
|
|
|
|
var i,
|
|
support,
|
|
Expr,
|
|
getText,
|
|
isXML,
|
|
tokenize,
|
|
compile,
|
|
select,
|
|
outermostContext,
|
|
sortInput,
|
|
hasDuplicate,
|
|
|
|
// Local document vars
|
|
setDocument,
|
|
document,
|
|
docElem,
|
|
documentIsHTML,
|
|
rbuggyQSA,
|
|
rbuggyMatches,
|
|
matches,
|
|
contains,
|
|
|
|
// Instance-specific data
|
|
expando = "sizzle" + 1 * new Date(),
|
|
preferredDoc = window.document,
|
|
dirruns = 0,
|
|
done = 0,
|
|
classCache = createCache(),
|
|
tokenCache = createCache(),
|
|
compilerCache = createCache(),
|
|
sortOrder = function( a, b ) {
|
|
if ( a === b ) {
|
|
hasDuplicate = true;
|
|
}
|
|
return 0;
|
|
},
|
|
|
|
// General-purpose constants
|
|
MAX_NEGATIVE = 1 << 31,
|
|
|
|
// Instance methods
|
|
hasOwn = ({}).hasOwnProperty,
|
|
arr = [],
|
|
pop = arr.pop,
|
|
push_native = arr.push,
|
|
push = arr.push,
|
|
slice = arr.slice,
|
|
// Use a stripped-down indexOf as it's faster than native
|
|
// http://jsperf.com/thor-indexof-vs-for/5
|
|
indexOf = function( list, elem ) {
|
|
var i = 0,
|
|
len = list.length;
|
|
for ( ; i < len; i++ ) {
|
|
if ( list[i] === elem ) {
|
|
return i;
|
|
}
|
|
}
|
|
return -1;
|
|
},
|
|
|
|
booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",
|
|
|
|
// Regular expressions
|
|
|
|
// Whitespace characters http://www.w3.org/TR/css3-selectors/#whitespace
|
|
whitespace = "[\\x20\\t\\r\\n\\f]",
|
|
// http://www.w3.org/TR/css3-syntax/#characters
|
|
characterEncoding = "(?:\\\\.|[\\w-]|[^\\x00-\\xa0])+",
|
|
|
|
// Loosely modeled on CSS identifier characters
|
|
// An unquoted value should be a CSS identifier http://www.w3.org/TR/css3-selectors/#attribute-selectors
|
|
// Proper syntax: http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier
|
|
identifier = characterEncoding.replace( "w", "w#" ),
|
|
|
|
// Attribute selectors: http://www.w3.org/TR/selectors/#attribute-selectors
|
|
attributes = "\\[" + whitespace + "*(" + characterEncoding + ")(?:" + whitespace +
|
|
// Operator (capture 2)
|
|
"*([*^$|!~]?=)" + whitespace +
|
|
// "Attribute values must be CSS identifiers [capture 5] or strings [capture 3 or capture 4]"
|
|
"*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + identifier + "))|)" + whitespace +
|
|
"*\\]",
|
|
|
|
pseudos = ":(" + characterEncoding + ")(?:\\((" +
|
|
// To reduce the number of selectors needing tokenize in the preFilter, prefer arguments:
|
|
// 1. quoted (capture 3; capture 4 or capture 5)
|
|
"('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|" +
|
|
// 2. simple (capture 6)
|
|
"((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" +
|
|
// 3. anything else (capture 2)
|
|
".*" +
|
|
")\\)|)",
|
|
|
|
// Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter
|
|
rwhitespace = new RegExp( whitespace + "+", "g" ),
|
|
rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g" ),
|
|
|
|
rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ),
|
|
rcombinators = new RegExp( "^" + whitespace + "*([>+~]|" + whitespace + ")" + whitespace + "*" ),
|
|
|
|
rattributeQuotes = new RegExp( "=" + whitespace + "*([^\\]'\"]*?)" + whitespace + "*\\]", "g" ),
|
|
|
|
rpseudo = new RegExp( pseudos ),
|
|
ridentifier = new RegExp( "^" + identifier + "$" ),
|
|
|
|
matchExpr = {
|
|
"ID": new RegExp( "^#(" + characterEncoding + ")" ),
|
|
"CLASS": new RegExp( "^\\.(" + characterEncoding + ")" ),
|
|
"TAG": new RegExp( "^(" + characterEncoding.replace( "w", "w*" ) + ")" ),
|
|
"ATTR": new RegExp( "^" + attributes ),
|
|
"PSEUDO": new RegExp( "^" + pseudos ),
|
|
"CHILD": new RegExp( "^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + whitespace +
|
|
"*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace +
|
|
"*(\\d+)|))" + whitespace + "*\\)|)", "i" ),
|
|
"bool": new RegExp( "^(?:" + booleans + ")$", "i" ),
|
|
// For use in libraries implementing .is()
|
|
// We use this for POS matching in `select`
|
|
"needsContext": new RegExp( "^" + whitespace + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" +
|
|
whitespace + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i" )
|
|
},
|
|
|
|
rinputs = /^(?:input|select|textarea|button)$/i,
|
|
rheader = /^h\d$/i,
|
|
|
|
rnative = /^[^{]+\{\s*\[native \w/,
|
|
|
|
// Easily-parseable/retrievable ID or TAG or CLASS selectors
|
|
rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,
|
|
|
|
rsibling = /[+~]/,
|
|
rescape = /'|\\/g,
|
|
|
|
// CSS escapes http://www.w3.org/TR/CSS21/syndata.html#escaped-characters
|
|
runescape = new RegExp( "\\\\([\\da-f]{1,6}" + whitespace + "?|(" + whitespace + ")|.)", "ig" ),
|
|
funescape = function( _, escaped, escapedWhitespace ) {
|
|
var high = "0x" + escaped - 0x10000;
|
|
// NaN means non-codepoint
|
|
// Support: Firefox<24
|
|
// Workaround erroneous numeric interpretation of +"0x"
|
|
return high !== high || escapedWhitespace ?
|
|
escaped :
|
|
high < 0 ?
|
|
// BMP codepoint
|
|
String.fromCharCode( high + 0x10000 ) :
|
|
// Supplemental Plane codepoint (surrogate pair)
|
|
String.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 );
|
|
},
|
|
|
|
// Used for iframes
|
|
// See setDocument()
|
|
// Removing the function wrapper causes a "Permission Denied"
|
|
// error in IE
|
|
unloadHandler = function() {
|
|
setDocument();
|
|
};
|
|
|
|
// Optimize for push.apply( _, NodeList )
|
|
try {
|
|
push.apply(
|
|
(arr = slice.call( preferredDoc.childNodes )),
|
|
preferredDoc.childNodes
|
|
);
|
|
// Support: Android<4.0
|
|
// Detect silently failing push.apply
|
|
arr[ preferredDoc.childNodes.length ].nodeType;
|
|
} catch ( e ) {
|
|
push = { apply: arr.length ?
|
|
|
|
// Leverage slice if possible
|
|
function( target, els ) {
|
|
push_native.apply( target, slice.call(els) );
|
|
} :
|
|
|
|
// Support: IE<9
|
|
// Otherwise append directly
|
|
function( target, els ) {
|
|
var j = target.length,
|
|
i = 0;
|
|
// Can't trust NodeList.length
|
|
while ( (target[j++] = els[i++]) ) {}
|
|
target.length = j - 1;
|
|
}
|
|
};
|
|
}
|
|
|
|
function Sizzle( selector, context, results, seed ) {
|
|
var match, elem, m, nodeType,
|
|
// QSA vars
|
|
i, groups, old, nid, newContext, newSelector;
|
|
|
|
if ( ( context ? context.ownerDocument || context : preferredDoc ) !== document ) {
|
|
setDocument( context );
|
|
}
|
|
|
|
context = context || document;
|
|
results = results || [];
|
|
nodeType = context.nodeType;
|
|
|
|
if ( typeof selector !== "string" || !selector ||
|
|
nodeType !== 1 && nodeType !== 9 && nodeType !== 11 ) {
|
|
|
|
return results;
|
|
}
|
|
|
|
if ( !seed && documentIsHTML ) {
|
|
|
|
// Try to shortcut find operations when possible (e.g., not under DocumentFragment)
|
|
if ( nodeType !== 11 && (match = rquickExpr.exec( selector )) ) {
|
|
// Speed-up: Sizzle("#ID")
|
|
if ( (m = match[1]) ) {
|
|
if ( nodeType === 9 ) {
|
|
elem = context.getElementById( m );
|
|
// Check parentNode to catch when Blackberry 4.6 returns
|
|
// nodes that are no longer in the document (jQuery #6963)
|
|
if ( elem && elem.parentNode ) {
|
|
// Handle the case where IE, Opera, and Webkit return items
|
|
// by name instead of ID
|
|
if ( elem.id === m ) {
|
|
results.push( elem );
|
|
return results;
|
|
}
|
|
} else {
|
|
return results;
|
|
}
|
|
} else {
|
|
// Context is not a document
|
|
if ( context.ownerDocument && (elem = context.ownerDocument.getElementById( m )) &&
|
|
contains( context, elem ) && elem.id === m ) {
|
|
results.push( elem );
|
|
return results;
|
|
}
|
|
}
|
|
|
|
// Speed-up: Sizzle("TAG")
|
|
} else if ( match[2] ) {
|
|
push.apply( results, context.getElementsByTagName( selector ) );
|
|
return results;
|
|
|
|
// Speed-up: Sizzle(".CLASS")
|
|
} else if ( (m = match[3]) && support.getElementsByClassName ) {
|
|
push.apply( results, context.getElementsByClassName( m ) );
|
|
return results;
|
|
}
|
|
}
|
|
|
|
// QSA path
|
|
if ( support.qsa && (!rbuggyQSA || !rbuggyQSA.test( selector )) ) {
|
|
nid = old = expando;
|
|
newContext = context;
|
|
newSelector = nodeType !== 1 && selector;
|
|
|
|
// qSA works strangely on Element-rooted queries
|
|
// We can work around this by specifying an extra ID on the root
|
|
// and working up from there (Thanks to Andrew Dupont for the technique)
|
|
// IE 8 doesn't work on object elements
|
|
if ( nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) {
|
|
groups = tokenize( selector );
|
|
|
|
if ( (old = context.getAttribute("id")) ) {
|
|
nid = old.replace( rescape, "\\$&" );
|
|
} else {
|
|
context.setAttribute( "id", nid );
|
|
}
|
|
nid = "[id='" + nid + "'] ";
|
|
|
|
i = groups.length;
|
|
while ( i-- ) {
|
|
groups[i] = nid + toSelector( groups[i] );
|
|
}
|
|
newContext = rsibling.test( selector ) && testContext( context.parentNode ) || context;
|
|
newSelector = groups.join(",");
|
|
}
|
|
|
|
if ( newSelector ) {
|
|
try {
|
|
push.apply( results,
|
|
newContext.querySelectorAll( newSelector )
|
|
);
|
|
return results;
|
|
} catch(qsaError) {
|
|
} finally {
|
|
if ( !old ) {
|
|
context.removeAttribute("id");
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
// All others
|
|
return select( selector.replace( rtrim, "$1" ), context, results, seed );
|
|
}
|
|
|
|
/**
|
|
* Create key-value caches of limited size
|
|
* @returns {Function(string, Object)} Returns the Object data after storing it on itself with
|
|
* property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength)
|
|
* deleting the oldest entry
|
|
*/
|
|
function createCache() {
|
|
var keys = [];
|
|
|
|
function cache( key, value ) {
|
|
// Use (key + " ") to avoid collision with native prototype properties (see Issue #157)
|
|
if ( keys.push( key + " " ) > Expr.cacheLength ) {
|
|
// Only keep the most recent entries
|
|
delete cache[ keys.shift() ];
|
|
}
|
|
return (cache[ key + " " ] = value);
|
|
}
|
|
return cache;
|
|
}
|
|
|
|
/**
|
|
* Mark a function for special use by Sizzle
|
|
* @param {Function} fn The function to mark
|
|
*/
|
|
function markFunction( fn ) {
|
|
fn[ expando ] = true;
|
|
return fn;
|
|
}
|
|
|
|
/**
|
|
* Support testing using an element
|
|
* @param {Function} fn Passed the created div and expects a boolean result
|
|
*/
|
|
function assert( fn ) {
|
|
var div = document.createElement("div");
|
|
|
|
try {
|
|
return !!fn( div );
|
|
} catch (e) {
|
|
return false;
|
|
} finally {
|
|
// Remove from its parent by default
|
|
if ( div.parentNode ) {
|
|
div.parentNode.removeChild( div );
|
|
}
|
|
// release memory in IE
|
|
div = null;
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Adds the same handler for all of the specified attrs
|
|
* @param {String} attrs Pipe-separated list of attributes
|
|
* @param {Function} handler The method that will be applied
|
|
*/
|
|
function addHandle( attrs, handler ) {
|
|
var arr = attrs.split("|"),
|
|
i = attrs.length;
|
|
|
|
while ( i-- ) {
|
|
Expr.attrHandle[ arr[i] ] = handler;
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Checks document order of two siblings
|
|
* @param {Element} a
|
|
* @param {Element} b
|
|
* @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b
|
|
*/
|
|
function siblingCheck( a, b ) {
|
|
var cur = b && a,
|
|
diff = cur && a.nodeType === 1 && b.nodeType === 1 &&
|
|
( ~b.sourceIndex || MAX_NEGATIVE ) -
|
|
( ~a.sourceIndex || MAX_NEGATIVE );
|
|
|
|
// Use IE sourceIndex if available on both nodes
|
|
if ( diff ) {
|
|
return diff;
|
|
}
|
|
|
|
// Check if b follows a
|
|
if ( cur ) {
|
|
while ( (cur = cur.nextSibling) ) {
|
|
if ( cur === b ) {
|
|
return -1;
|
|
}
|
|
}
|
|
}
|
|
|
|
return a ? 1 : -1;
|
|
}
|
|
|
|
/**
|
|
* Returns a function to use in pseudos for input types
|
|
* @param {String} type
|
|
*/
|
|
function createInputPseudo( type ) {
|
|
return function( elem ) {
|
|
var name = elem.nodeName.toLowerCase();
|
|
return name === "input" && elem.type === type;
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Returns a function to use in pseudos for buttons
|
|
* @param {String} type
|
|
*/
|
|
function createButtonPseudo( type ) {
|
|
return function( elem ) {
|
|
var name = elem.nodeName.toLowerCase();
|
|
return (name === "input" || name === "button") && elem.type === type;
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Returns a function to use in pseudos for positionals
|
|
* @param {Function} fn
|
|
*/
|
|
function createPositionalPseudo( fn ) {
|
|
return markFunction(function( argument ) {
|
|
argument = +argument;
|
|
return markFunction(function( seed, matches ) {
|
|
var j,
|
|
matchIndexes = fn( [], seed.length, argument ),
|
|
i = matchIndexes.length;
|
|
|
|
// Match elements found at the specified indexes
|
|
while ( i-- ) {
|
|
if ( seed[ (j = matchIndexes[i]) ] ) {
|
|
seed[j] = !(matches[j] = seed[j]);
|
|
}
|
|
}
|
|
});
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Checks a node for validity as a Sizzle context
|
|
* @param {Element|Object=} context
|
|
* @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value
|
|
*/
|
|
function testContext( context ) {
|
|
return context && typeof context.getElementsByTagName !== "undefined" && context;
|
|
}
|
|
|
|
// Expose support vars for convenience
|
|
support = Sizzle.support = {};
|
|
|
|
/**
|
|
* Detects XML nodes
|
|
* @param {Element|Object} elem An element or a document
|
|
* @returns {Boolean} True iff elem is a non-HTML XML node
|
|
*/
|
|
isXML = Sizzle.isXML = function( elem ) {
|
|
// documentElement is verified for cases where it doesn't yet exist
|
|
// (such as loading iframes in IE - #4833)
|
|
var documentElement = elem && (elem.ownerDocument || elem).documentElement;
|
|
return documentElement ? documentElement.nodeName !== "HTML" : false;
|
|
};
|
|
|
|
/**
|
|
* Sets document-related variables once based on the current document
|
|
* @param {Element|Object} [doc] An element or document object to use to set the document
|
|
* @returns {Object} Returns the current document
|
|
*/
|
|
setDocument = Sizzle.setDocument = function( node ) {
|
|
var hasCompare, parent,
|
|
doc = node ? node.ownerDocument || node : preferredDoc;
|
|
|
|
// If no document and documentElement is available, return
|
|
if ( doc === document || doc.nodeType !== 9 || !doc.documentElement ) {
|
|
return document;
|
|
}
|
|
|
|
// Set our document
|
|
document = doc;
|
|
docElem = doc.documentElement;
|
|
parent = doc.defaultView;
|
|
|
|
// Support: IE>8
|
|
// If iframe document is assigned to "document" variable and if iframe has been reloaded,
|
|
// IE will throw "permission denied" error when accessing "document" variable, see jQuery #13936
|
|
// IE6-8 do not support the defaultView property so parent will be undefined
|
|
if ( parent && parent !== parent.top ) {
|
|
// IE11 does not have attachEvent, so all must suffer
|
|
if ( parent.addEventListener ) {
|
|
parent.addEventListener( "unload", unloadHandler, false );
|
|
} else if ( parent.attachEvent ) {
|
|
parent.attachEvent( "onunload", unloadHandler );
|
|
}
|
|
}
|
|
|
|
/* Support tests
|
|
---------------------------------------------------------------------- */
|
|
documentIsHTML = !isXML( doc );
|
|
|
|
/* Attributes
|
|
---------------------------------------------------------------------- */
|
|
|
|
// Support: IE<8
|
|
// Verify that getAttribute really returns attributes and not properties
|
|
// (excepting IE8 booleans)
|
|
support.attributes = assert(function( div ) {
|
|
div.className = "i";
|
|
return !div.getAttribute("className");
|
|
});
|
|
|
|
/* getElement(s)By*
|
|
---------------------------------------------------------------------- */
|
|
|
|
// Check if getElementsByTagName("*") returns only elements
|
|
support.getElementsByTagName = assert(function( div ) {
|
|
div.appendChild( doc.createComment("") );
|
|
return !div.getElementsByTagName("*").length;
|
|
});
|
|
|
|
// Support: IE<9
|
|
support.getElementsByClassName = rnative.test( doc.getElementsByClassName );
|
|
|
|
// Support: IE<10
|
|
// Check if getElementById returns elements by name
|
|
// The broken getElementById methods don't pick up programatically-set names,
|
|
// so use a roundabout getElementsByName test
|
|
support.getById = assert(function( div ) {
|
|
docElem.appendChild( div ).id = expando;
|
|
return !doc.getElementsByName || !doc.getElementsByName( expando ).length;
|
|
});
|
|
|
|
// ID find and filter
|
|
if ( support.getById ) {
|
|
Expr.find["ID"] = function( id, context ) {
|
|
if ( typeof context.getElementById !== "undefined" && documentIsHTML ) {
|
|
var m = context.getElementById( id );
|
|
// Check parentNode to catch when Blackberry 4.6 returns
|
|
// nodes that are no longer in the document #6963
|
|
return m && m.parentNode ? [ m ] : [];
|
|
}
|
|
};
|
|
Expr.filter["ID"] = function( id ) {
|
|
var attrId = id.replace( runescape, funescape );
|
|
return function( elem ) {
|
|
return elem.getAttribute("id") === attrId;
|
|
};
|
|
};
|
|
} else {
|
|
// Support: IE6/7
|
|
// getElementById is not reliable as a find shortcut
|
|
delete Expr.find["ID"];
|
|
|
|
Expr.filter["ID"] = function( id ) {
|
|
var attrId = id.replace( runescape, funescape );
|
|
return function( elem ) {
|
|
var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id");
|
|
return node && node.value === attrId;
|
|
};
|
|
};
|
|
}
|
|
|
|
// Tag
|
|
Expr.find["TAG"] = support.getElementsByTagName ?
|
|
function( tag, context ) {
|
|
if ( typeof context.getElementsByTagName !== "undefined" ) {
|
|
return context.getElementsByTagName( tag );
|
|
|
|
// DocumentFragment nodes don't have gEBTN
|
|
} else if ( support.qsa ) {
|
|
return context.querySelectorAll( tag );
|
|
}
|
|
} :
|
|
|
|
function( tag, context ) {
|
|
var elem,
|
|
tmp = [],
|
|
i = 0,
|
|
// By happy coincidence, a (broken) gEBTN appears on DocumentFragment nodes too
|
|
results = context.getElementsByTagName( tag );
|
|
|
|
// Filter out possible comments
|
|
if ( tag === "*" ) {
|
|
while ( (elem = results[i++]) ) {
|
|
if ( elem.nodeType === 1 ) {
|
|
tmp.push( elem );
|
|
}
|
|
}
|
|
|
|
return tmp;
|
|
}
|
|
return results;
|
|
};
|
|
|
|
// Class
|
|
Expr.find["CLASS"] = support.getElementsByClassName && function( className, context ) {
|
|
if ( documentIsHTML ) {
|
|
return context.getElementsByClassName( className );
|
|
}
|
|
};
|
|
|
|
/* QSA/matchesSelector
|
|
---------------------------------------------------------------------- */
|
|
|
|
// QSA and matchesSelector support
|
|
|
|
// matchesSelector(:active) reports false when true (IE9/Opera 11.5)
|
|
rbuggyMatches = [];
|
|
|
|
// qSa(:focus) reports false when true (Chrome 21)
|
|
// We allow this because of a bug in IE8/9 that throws an error
|
|
// whenever `document.activeElement` is accessed on an iframe
|
|
// So, we allow :focus to pass through QSA all the time to avoid the IE error
|
|
// See http://bugs.jquery.com/ticket/13378
|
|
rbuggyQSA = [];
|
|
|
|
if ( (support.qsa = rnative.test( doc.querySelectorAll )) ) {
|
|
// Build QSA regex
|
|
// Regex strategy adopted from Diego Perini
|
|
assert(function( div ) {
|
|
// Select is set to empty string on purpose
|
|
// This is to test IE's treatment of not explicitly
|
|
// setting a boolean content attribute,
|
|
// since its presence should be enough
|
|
// http://bugs.jquery.com/ticket/12359
|
|
docElem.appendChild( div ).innerHTML = "<a id='" + expando + "'></a>" +
|
|
"<select id='" + expando + "-\f]' msallowcapture=''>" +
|
|
"<option selected=''></option></select>";
|
|
|
|
// Support: IE8, Opera 11-12.16
|
|
// Nothing should be selected when empty strings follow ^= or $= or *=
|
|
// The test attribute must be unknown in Opera but "safe" for WinRT
|
|
// http://msdn.microsoft.com/en-us/library/ie/hh465388.aspx#attribute_section
|
|
if ( div.querySelectorAll("[msallowcapture^='']").length ) {
|
|
rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:''|\"\")" );
|
|
}
|
|
|
|
// Support: IE8
|
|
// Boolean attributes and "value" are not treated correctly
|
|
if ( !div.querySelectorAll("[selected]").length ) {
|
|
rbuggyQSA.push( "\\[" + whitespace + "*(?:value|" + booleans + ")" );
|
|
}
|
|
|
|
// Support: Chrome<29, Android<4.2+, Safari<7.0+, iOS<7.0+, PhantomJS<1.9.7+
|
|
if ( !div.querySelectorAll( "[id~=" + expando + "-]" ).length ) {
|
|
rbuggyQSA.push("~=");
|
|
}
|
|
|
|
// Webkit/Opera - :checked should return selected option elements
|
|
// http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
|
|
// IE8 throws error here and will not see later tests
|
|
if ( !div.querySelectorAll(":checked").length ) {
|
|
rbuggyQSA.push(":checked");
|
|
}
|
|
|
|
// Support: Safari 8+, iOS 8+
|
|
// https://bugs.webkit.org/show_bug.cgi?id=136851
|
|
// In-page `selector#id sibing-combinator selector` fails
|
|
if ( !div.querySelectorAll( "a#" + expando + "+*" ).length ) {
|
|
rbuggyQSA.push(".#.+[+~]");
|
|
}
|
|
});
|
|
|
|
assert(function( div ) {
|
|
// Support: Windows 8 Native Apps
|
|
// The type and name attributes are restricted during .innerHTML assignment
|
|
var input = doc.createElement("input");
|
|
input.setAttribute( "type", "hidden" );
|
|
div.appendChild( input ).setAttribute( "name", "D" );
|
|
|
|
// Support: IE8
|
|
// Enforce case-sensitivity of name attribute
|
|
if ( div.querySelectorAll("[name=d]").length ) {
|
|
rbuggyQSA.push( "name" + whitespace + "*[*^$|!~]?=" );
|
|
}
|
|
|
|
// FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled)
|
|
// IE8 throws error here and will not see later tests
|
|
if ( !div.querySelectorAll(":enabled").length ) {
|
|
rbuggyQSA.push( ":enabled", ":disabled" );
|
|
}
|
|
|
|
// Opera 10-11 does not throw on post-comma invalid pseudos
|
|
div.querySelectorAll("*,:x");
|
|
rbuggyQSA.push(",.*:");
|
|
});
|
|
}
|
|
|
|
if ( (support.matchesSelector = rnative.test( (matches = docElem.matches ||
|
|
docElem.webkitMatchesSelector ||
|
|
docElem.mozMatchesSelector ||
|
|
docElem.oMatchesSelector ||
|
|
docElem.msMatchesSelector) )) ) {
|
|
|
|
assert(function( div ) {
|
|
// Check to see if it's possible to do matchesSelector
|
|
// on a disconnected node (IE 9)
|
|
support.disconnectedMatch = matches.call( div, "div" );
|
|
|
|
// This should fail with an exception
|
|
// Gecko does not error, returns false instead
|
|
matches.call( div, "[s!='']:x" );
|
|
rbuggyMatches.push( "!=", pseudos );
|
|
});
|
|
}
|
|
|
|
rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join("|") );
|
|
rbuggyMatches = rbuggyMatches.length && new RegExp( rbuggyMatches.join("|") );
|
|
|
|
/* Contains
|
|
---------------------------------------------------------------------- */
|
|
hasCompare = rnative.test( docElem.compareDocumentPosition );
|
|
|
|
// Element contains another
|
|
// Purposefully does not implement inclusive descendent
|
|
// As in, an element does not contain itself
|
|
contains = hasCompare || rnative.test( docElem.contains ) ?
|
|
function( a, b ) {
|
|
var adown = a.nodeType === 9 ? a.documentElement : a,
|
|
bup = b && b.parentNode;
|
|
return a === bup || !!( bup && bup.nodeType === 1 && (
|
|
adown.contains ?
|
|
adown.contains( bup ) :
|
|
a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16
|
|
));
|
|
} :
|
|
function( a, b ) {
|
|
if ( b ) {
|
|
while ( (b = b.parentNode) ) {
|
|
if ( b === a ) {
|
|
return true;
|
|
}
|
|
}
|
|
}
|
|
return false;
|
|
};
|
|
|
|
/* Sorting
|
|
---------------------------------------------------------------------- */
|
|
|
|
// Document order sorting
|
|
sortOrder = hasCompare ?
|
|
function( a, b ) {
|
|
|
|
// Flag for duplicate removal
|
|
if ( a === b ) {
|
|
hasDuplicate = true;
|
|
return 0;
|
|
}
|
|
|
|
// Sort on method existence if only one input has compareDocumentPosition
|
|
var compare = !a.compareDocumentPosition - !b.compareDocumentPosition;
|
|
if ( compare ) {
|
|
return compare;
|
|
}
|
|
|
|
// Calculate position if both inputs belong to the same document
|
|
compare = ( a.ownerDocument || a ) === ( b.ownerDocument || b ) ?
|
|
a.compareDocumentPosition( b ) :
|
|
|
|
// Otherwise we know they are disconnected
|
|
1;
|
|
|
|
// Disconnected nodes
|
|
if ( compare & 1 ||
|
|
(!support.sortDetached && b.compareDocumentPosition( a ) === compare) ) {
|
|
|
|
// Choose the first element that is related to our preferred document
|
|
if ( a === doc || a.ownerDocument === preferredDoc && contains(preferredDoc, a) ) {
|
|
return -1;
|
|
}
|
|
if ( b === doc || b.ownerDocument === preferredDoc && contains(preferredDoc, b) ) {
|
|
return 1;
|
|
}
|
|
|
|
// Maintain original order
|
|
return sortInput ?
|
|
( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) :
|
|
0;
|
|
}
|
|
|
|
return compare & 4 ? -1 : 1;
|
|
} :
|
|
function( a, b ) {
|
|
// Exit early if the nodes are identical
|
|
if ( a === b ) {
|
|
hasDuplicate = true;
|
|
return 0;
|
|
}
|
|
|
|
var cur,
|
|
i = 0,
|
|
aup = a.parentNode,
|
|
bup = b.parentNode,
|
|
ap = [ a ],
|
|
bp = [ b ];
|
|
|
|
// Parentless nodes are either documents or disconnected
|
|
if ( !aup || !bup ) {
|
|
return a === doc ? -1 :
|
|
b === doc ? 1 :
|
|
aup ? -1 :
|
|
bup ? 1 :
|
|
sortInput ?
|
|
( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) :
|
|
0;
|
|
|
|
// If the nodes are siblings, we can do a quick check
|
|
} else if ( aup === bup ) {
|
|
return siblingCheck( a, b );
|
|
}
|
|
|
|
// Otherwise we need full lists of their ancestors for comparison
|
|
cur = a;
|
|
while ( (cur = cur.parentNode) ) {
|
|
ap.unshift( cur );
|
|
}
|
|
cur = b;
|
|
while ( (cur = cur.parentNode) ) {
|
|
bp.unshift( cur );
|
|
}
|
|
|
|
// Walk down the tree looking for a discrepancy
|
|
while ( ap[i] === bp[i] ) {
|
|
i++;
|
|
}
|
|
|
|
return i ?
|
|
// Do a sibling check if the nodes have a common ancestor
|
|
siblingCheck( ap[i], bp[i] ) :
|
|
|
|
// Otherwise nodes in our document sort first
|
|
ap[i] === preferredDoc ? -1 :
|
|
bp[i] === preferredDoc ? 1 :
|
|
0;
|
|
};
|
|
|
|
return doc;
|
|
};
|
|
|
|
Sizzle.matches = function( expr, elements ) {
|
|
return Sizzle( expr, null, null, elements );
|
|
};
|
|
|
|
Sizzle.matchesSelector = function( elem, expr ) {
|
|
// Set document vars if needed
|
|
if ( ( elem.ownerDocument || elem ) !== document ) {
|
|
setDocument( elem );
|
|
}
|
|
|
|
// Make sure that attribute selectors are quoted
|
|
expr = expr.replace( rattributeQuotes, "='$1']" );
|
|
|
|
if ( support.matchesSelector && documentIsHTML &&
|
|
( !rbuggyMatches || !rbuggyMatches.test( expr ) ) &&
|
|
( !rbuggyQSA || !rbuggyQSA.test( expr ) ) ) {
|
|
|
|
try {
|
|
var ret = matches.call( elem, expr );
|
|
|
|
// IE 9's matchesSelector returns false on disconnected nodes
|
|
if ( ret || support.disconnectedMatch ||
|
|
// As well, disconnected nodes are said to be in a document
|
|
// fragment in IE 9
|
|
elem.document && elem.document.nodeType !== 11 ) {
|
|
return ret;
|
|
}
|
|
} catch (e) {}
|
|
}
|
|
|
|
return Sizzle( expr, document, null, [ elem ] ).length > 0;
|
|
};
|
|
|
|
Sizzle.contains = function( context, elem ) {
|
|
// Set document vars if needed
|
|
if ( ( context.ownerDocument || context ) !== document ) {
|
|
setDocument( context );
|
|
}
|
|
return contains( context, elem );
|
|
};
|
|
|
|
Sizzle.attr = function( elem, name ) {
|
|
// Set document vars if needed
|
|
if ( ( elem.ownerDocument || elem ) !== document ) {
|
|
setDocument( elem );
|
|
}
|
|
|
|
var fn = Expr.attrHandle[ name.toLowerCase() ],
|
|
// Don't get fooled by Object.prototype properties (jQuery #13807)
|
|
val = fn && hasOwn.call( Expr.attrHandle, name.toLowerCase() ) ?
|
|
fn( elem, name, !documentIsHTML ) :
|
|
undefined;
|
|
|
|
return val !== undefined ?
|
|
val :
|
|
support.attributes || !documentIsHTML ?
|
|
elem.getAttribute( name ) :
|
|
(val = elem.getAttributeNode(name)) && val.specified ?
|
|
val.value :
|
|
null;
|
|
};
|
|
|
|
Sizzle.error = function( msg ) {
|
|
throw new Error( "Syntax error, unrecognized expression: " + msg );
|
|
};
|
|
|
|
/**
|
|
* Document sorting and removing duplicates
|
|
* @param {ArrayLike} results
|
|
*/
|
|
Sizzle.uniqueSort = function( results ) {
|
|
var elem,
|
|
duplicates = [],
|
|
j = 0,
|
|
i = 0;
|
|
|
|
// Unless we *know* we can detect duplicates, assume their presence
|
|
hasDuplicate = !support.detectDuplicates;
|
|
sortInput = !support.sortStable && results.slice( 0 );
|
|
results.sort( sortOrder );
|
|
|
|
if ( hasDuplicate ) {
|
|
while ( (elem = results[i++]) ) {
|
|
if ( elem === results[ i ] ) {
|
|
j = duplicates.push( i );
|
|
}
|
|
}
|
|
while ( j-- ) {
|
|
results.splice( duplicates[ j ], 1 );
|
|
}
|
|
}
|
|
|
|
// Clear input after sorting to release objects
|
|
// See https://github.com/jquery/sizzle/pull/225
|
|
sortInput = null;
|
|
|
|
return results;
|
|
};
|
|
|
|
/**
|
|
* Utility function for retrieving the text value of an array of DOM nodes
|
|
* @param {Array|Element} elem
|
|
*/
|
|
getText = Sizzle.getText = function( elem ) {
|
|
var node,
|
|
ret = "",
|
|
i = 0,
|
|
nodeType = elem.nodeType;
|
|
|
|
if ( !nodeType ) {
|
|
// If no nodeType, this is expected to be an array
|
|
while ( (node = elem[i++]) ) {
|
|
// Do not traverse comment nodes
|
|
ret += getText( node );
|
|
}
|
|
} else if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) {
|
|
// Use textContent for elements
|
|
// innerText usage removed for consistency of new lines (jQuery #11153)
|
|
if ( typeof elem.textContent === "string" ) {
|
|
return elem.textContent;
|
|
} else {
|
|
// Traverse its children
|
|
for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {
|
|
ret += getText( elem );
|
|
}
|
|
}
|
|
} else if ( nodeType === 3 || nodeType === 4 ) {
|
|
return elem.nodeValue;
|
|
}
|
|
// Do not include comment or processing instruction nodes
|
|
|
|
return ret;
|
|
};
|
|
|
|
Expr = Sizzle.selectors = {
|
|
|
|
// Can be adjusted by the user
|
|
cacheLength: 50,
|
|
|
|
createPseudo: markFunction,
|
|
|
|
match: matchExpr,
|
|
|
|
attrHandle: {},
|
|
|
|
find: {},
|
|
|
|
relative: {
|
|
">": { dir: "parentNode", first: true },
|
|
" ": { dir: "parentNode" },
|
|
"+": { dir: "previousSibling", first: true },
|
|
"~": { dir: "previousSibling" }
|
|
},
|
|
|
|
preFilter: {
|
|
"ATTR": function( match ) {
|
|
match[1] = match[1].replace( runescape, funescape );
|
|
|
|
// Move the given value to match[3] whether quoted or unquoted
|
|
match[3] = ( match[3] || match[4] || match[5] || "" ).replace( runescape, funescape );
|
|
|
|
if ( match[2] === "~=" ) {
|
|
match[3] = " " + match[3] + " ";
|
|
}
|
|
|
|
return match.slice( 0, 4 );
|
|
},
|
|
|
|
"CHILD": function( match ) {
|
|
/* matches from matchExpr["CHILD"]
|
|
1 type (only|nth|...)
|
|
2 what (child|of-type)
|
|
3 argument (even|odd|\d*|\d*n([+-]\d+)?|...)
|
|
4 xn-component of xn+y argument ([+-]?\d*n|)
|
|
5 sign of xn-component
|
|
6 x of xn-component
|
|
7 sign of y-component
|
|
8 y of y-component
|
|
*/
|
|
match[1] = match[1].toLowerCase();
|
|
|
|
if ( match[1].slice( 0, 3 ) === "nth" ) {
|
|
// nth-* requires argument
|
|
if ( !match[3] ) {
|
|
Sizzle.error( match[0] );
|
|
}
|
|
|
|
// numeric x and y parameters for Expr.filter.CHILD
|
|
// remember that false/true cast respectively to 0/1
|
|
match[4] = +( match[4] ? match[5] + (match[6] || 1) : 2 * ( match[3] === "even" || match[3] === "odd" ) );
|
|
match[5] = +( ( match[7] + match[8] ) || match[3] === "odd" );
|
|
|
|
// other types prohibit arguments
|
|
} else if ( match[3] ) {
|
|
Sizzle.error( match[0] );
|
|
}
|
|
|
|
return match;
|
|
},
|
|
|
|
"PSEUDO": function( match ) {
|
|
var excess,
|
|
unquoted = !match[6] && match[2];
|
|
|
|
if ( matchExpr["CHILD"].test( match[0] ) ) {
|
|
return null;
|
|
}
|
|
|
|
// Accept quoted arguments as-is
|
|
if ( match[3] ) {
|
|
match[2] = match[4] || match[5] || "";
|
|
|
|
// Strip excess characters from unquoted arguments
|
|
} else if ( unquoted && rpseudo.test( unquoted ) &&
|
|
// Get excess from tokenize (recursively)
|
|
(excess = tokenize( unquoted, true )) &&
|
|
// advance to the next closing parenthesis
|
|
(excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length) ) {
|
|
|
|
// excess is a negative index
|
|
match[0] = match[0].slice( 0, excess );
|
|
match[2] = unquoted.slice( 0, excess );
|
|
}
|
|
|
|
// Return only captures needed by the pseudo filter method (type and argument)
|
|
return match.slice( 0, 3 );
|
|
}
|
|
},
|
|
|
|
filter: {
|
|
|
|
"TAG": function( nodeNameSelector ) {
|
|
var nodeName = nodeNameSelector.replace( runescape, funescape ).toLowerCase();
|
|
return nodeNameSelector === "*" ?
|
|
function() { return true; } :
|
|
function( elem ) {
|
|
return elem.nodeName && elem.nodeName.toLowerCase() === nodeName;
|
|
};
|
|
},
|
|
|
|
"CLASS": function( className ) {
|
|
var pattern = classCache[ className + " " ];
|
|
|
|
return pattern ||
|
|
(pattern = new RegExp( "(^|" + whitespace + ")" + className + "(" + whitespace + "|$)" )) &&
|
|
classCache( className, function( elem ) {
|
|
return pattern.test( typeof elem.className === "string" && elem.className || typeof elem.getAttribute !== "undefined" && elem.getAttribute("class") || "" );
|
|
});
|
|
},
|
|
|
|
"ATTR": function( name, operator, check ) {
|
|
return function( elem ) {
|
|
var result = Sizzle.attr( elem, name );
|
|
|
|
if ( result == null ) {
|
|
return operator === "!=";
|
|
}
|
|
if ( !operator ) {
|
|
return true;
|
|
}
|
|
|
|
result += "";
|
|
|
|
return operator === "=" ? result === check :
|
|
operator === "!=" ? result !== check :
|
|
operator === "^=" ? check && result.indexOf( check ) === 0 :
|
|
operator === "*=" ? check && result.indexOf( check ) > -1 :
|
|
operator === "$=" ? check && result.slice( -check.length ) === check :
|
|
operator === "~=" ? ( " " + result.replace( rwhitespace, " " ) + " " ).indexOf( check ) > -1 :
|
|
operator === "|=" ? result === check || result.slice( 0, check.length + 1 ) === check + "-" :
|
|
false;
|
|
};
|
|
},
|
|
|
|
"CHILD": function( type, what, argument, first, last ) {
|
|
var simple = type.slice( 0, 3 ) !== "nth",
|
|
forward = type.slice( -4 ) !== "last",
|
|
ofType = what === "of-type";
|
|
|
|
return first === 1 && last === 0 ?
|
|
|
|
// Shortcut for :nth-*(n)
|
|
function( elem ) {
|
|
return !!elem.parentNode;
|
|
} :
|
|
|
|
function( elem, context, xml ) {
|
|
var cache, outerCache, node, diff, nodeIndex, start,
|
|
dir = simple !== forward ? "nextSibling" : "previousSibling",
|
|
parent = elem.parentNode,
|
|
name = ofType && elem.nodeName.toLowerCase(),
|
|
useCache = !xml && !ofType;
|
|
|
|
if ( parent ) {
|
|
|
|
// :(first|last|only)-(child|of-type)
|
|
if ( simple ) {
|
|
while ( dir ) {
|
|
node = elem;
|
|
while ( (node = node[ dir ]) ) {
|
|
if ( ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1 ) {
|
|
return false;
|
|
}
|
|
}
|
|
// Reverse direction for :only-* (if we haven't yet done so)
|
|
start = dir = type === "only" && !start && "nextSibling";
|
|
}
|
|
return true;
|
|
}
|
|
|
|
start = [ forward ? parent.firstChild : parent.lastChild ];
|
|
|
|
// non-xml :nth-child(...) stores cache data on `parent`
|
|
if ( forward && useCache ) {
|
|
// Seek `elem` from a previously-cached index
|
|
outerCache = parent[ expando ] || (parent[ expando ] = {});
|
|
cache = outerCache[ type ] || [];
|
|
nodeIndex = cache[0] === dirruns && cache[1];
|
|
diff = cache[0] === dirruns && cache[2];
|
|
node = nodeIndex && parent.childNodes[ nodeIndex ];
|
|
|
|
while ( (node = ++nodeIndex && node && node[ dir ] ||
|
|
|
|
// Fallback to seeking `elem` from the start
|
|
(diff = nodeIndex = 0) || start.pop()) ) {
|
|
|
|
// When found, cache indexes on `parent` and break
|
|
if ( node.nodeType === 1 && ++diff && node === elem ) {
|
|
outerCache[ type ] = [ dirruns, nodeIndex, diff ];
|
|
break;
|
|
}
|
|
}
|
|
|
|
// Use previously-cached element index if available
|
|
} else if ( useCache && (cache = (elem[ expando ] || (elem[ expando ] = {}))[ type ]) && cache[0] === dirruns ) {
|
|
diff = cache[1];
|
|
|
|
// xml :nth-child(...) or :nth-last-child(...) or :nth(-last)?-of-type(...)
|
|
} else {
|
|
// Use the same loop as above to seek `elem` from the start
|
|
while ( (node = ++nodeIndex && node && node[ dir ] ||
|
|
(diff = nodeIndex = 0) || start.pop()) ) {
|
|
|
|
if ( ( ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1 ) && ++diff ) {
|
|
// Cache the index of each encountered element
|
|
if ( useCache ) {
|
|
(node[ expando ] || (node[ expando ] = {}))[ type ] = [ dirruns, diff ];
|
|
}
|
|
|
|
if ( node === elem ) {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
// Incorporate the offset, then check against cycle size
|
|
diff -= last;
|
|
return diff === first || ( diff % first === 0 && diff / first >= 0 );
|
|
}
|
|
};
|
|
},
|
|
|
|
"PSEUDO": function( pseudo, argument ) {
|
|
// pseudo-class names are case-insensitive
|
|
// http://www.w3.org/TR/selectors/#pseudo-classes
|
|
// Prioritize by case sensitivity in case custom pseudos are added with uppercase letters
|
|
// Remember that setFilters inherits from pseudos
|
|
var args,
|
|
fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] ||
|
|
Sizzle.error( "unsupported pseudo: " + pseudo );
|
|
|
|
// The user may use createPseudo to indicate that
|
|
// arguments are needed to create the filter function
|
|
// just as Sizzle does
|
|
if ( fn[ expando ] ) {
|
|
return fn( argument );
|
|
}
|
|
|
|
// But maintain support for old signatures
|
|
if ( fn.length > 1 ) {
|
|
args = [ pseudo, pseudo, "", argument ];
|
|
return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ?
|
|
markFunction(function( seed, matches ) {
|
|
var idx,
|
|
matched = fn( seed, argument ),
|
|
i = matched.length;
|
|
while ( i-- ) {
|
|
idx = indexOf( seed, matched[i] );
|
|
seed[ idx ] = !( matches[ idx ] = matched[i] );
|
|
}
|
|
}) :
|
|
function( elem ) {
|
|
return fn( elem, 0, args );
|
|
};
|
|
}
|
|
|
|
return fn;
|
|
}
|
|
},
|
|
|
|
pseudos: {
|
|
// Potentially complex pseudos
|
|
"not": markFunction(function( selector ) {
|
|
// Trim the selector passed to compile
|
|
// to avoid treating leading and trailing
|
|
// spaces as combinators
|
|
var input = [],
|
|
results = [],
|
|
matcher = compile( selector.replace( rtrim, "$1" ) );
|
|
|
|
return matcher[ expando ] ?
|
|
markFunction(function( seed, matches, context, xml ) {
|
|
var elem,
|
|
unmatched = matcher( seed, null, xml, [] ),
|
|
i = seed.length;
|
|
|
|
// Match elements unmatched by `matcher`
|
|
while ( i-- ) {
|
|
if ( (elem = unmatched[i]) ) {
|
|
seed[i] = !(matches[i] = elem);
|
|
}
|
|
}
|
|
}) :
|
|
function( elem, context, xml ) {
|
|
input[0] = elem;
|
|
matcher( input, null, xml, results );
|
|
// Don't keep the element (issue #299)
|
|
input[0] = null;
|
|
return !results.pop();
|
|
};
|
|
}),
|
|
|
|
"has": markFunction(function( selector ) {
|
|
return function( elem ) {
|
|
return Sizzle( selector, elem ).length > 0;
|
|
};
|
|
}),
|
|
|
|
"contains": markFunction(function( text ) {
|
|
text = text.replace( runescape, funescape );
|
|
return function( elem ) {
|
|
return ( elem.textContent || elem.innerText || getText( elem ) ).indexOf( text ) > -1;
|
|
};
|
|
}),
|
|
|
|
// "Whether an element is represented by a :lang() selector
|
|
// is based solely on the element's language value
|
|
// being equal to the identifier C,
|
|
// or beginning with the identifier C immediately followed by "-".
|
|
// The matching of C against the element's language value is performed case-insensitively.
|
|
// The identifier C does not have to be a valid language name."
|
|
// http://www.w3.org/TR/selectors/#lang-pseudo
|
|
"lang": markFunction( function( lang ) {
|
|
// lang value must be a valid identifier
|
|
if ( !ridentifier.test(lang || "") ) {
|
|
Sizzle.error( "unsupported lang: " + lang );
|
|
}
|
|
lang = lang.replace( runescape, funescape ).toLowerCase();
|
|
return function( elem ) {
|
|
var elemLang;
|
|
do {
|
|
if ( (elemLang = documentIsHTML ?
|
|
elem.lang :
|
|
elem.getAttribute("xml:lang") || elem.getAttribute("lang")) ) {
|
|
|
|
elemLang = elemLang.toLowerCase();
|
|
return elemLang === lang || elemLang.indexOf( lang + "-" ) === 0;
|
|
}
|
|
} while ( (elem = elem.parentNode) && elem.nodeType === 1 );
|
|
return false;
|
|
};
|
|
}),
|
|
|
|
// Miscellaneous
|
|
"target": function( elem ) {
|
|
var hash = window.location && window.location.hash;
|
|
return hash && hash.slice( 1 ) === elem.id;
|
|
},
|
|
|
|
"root": function( elem ) {
|
|
return elem === docElem;
|
|
},
|
|
|
|
"focus": function( elem ) {
|
|
return elem === document.activeElement && (!document.hasFocus || document.hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex);
|
|
},
|
|
|
|
// Boolean properties
|
|
"enabled": function( elem ) {
|
|
return elem.disabled === false;
|
|
},
|
|
|
|
"disabled": function( elem ) {
|
|
return elem.disabled === true;
|
|
},
|
|
|
|
"checked": function( elem ) {
|
|
// In CSS3, :checked should return both checked and selected elements
|
|
// http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
|
|
var nodeName = elem.nodeName.toLowerCase();
|
|
return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected);
|
|
},
|
|
|
|
"selected": function( elem ) {
|
|
// Accessing this property makes selected-by-default
|
|
// options in Safari work properly
|
|
if ( elem.parentNode ) {
|
|
elem.parentNode.selectedIndex;
|
|
}
|
|
|
|
return elem.selected === true;
|
|
},
|
|
|
|
// Contents
|
|
"empty": function( elem ) {
|
|
// http://www.w3.org/TR/selectors/#empty-pseudo
|
|
// :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5),
|
|
// but not by others (comment: 8; processing instruction: 7; etc.)
|
|
// nodeType < 6 works because attributes (2) do not appear as children
|
|
for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {
|
|
if ( elem.nodeType < 6 ) {
|
|
return false;
|
|
}
|
|
}
|
|
return true;
|
|
},
|
|
|
|
"parent": function( elem ) {
|
|
return !Expr.pseudos["empty"]( elem );
|
|
},
|
|
|
|
// Element/input types
|
|
"header": function( elem ) {
|
|
return rheader.test( elem.nodeName );
|
|
},
|
|
|
|
"input": function( elem ) {
|
|
return rinputs.test( elem.nodeName );
|
|
},
|
|
|
|
"button": function( elem ) {
|
|
var name = elem.nodeName.toLowerCase();
|
|
return name === "input" && elem.type === "button" || name === "button";
|
|
},
|
|
|
|
"text": function( elem ) {
|
|
var attr;
|
|
return elem.nodeName.toLowerCase() === "input" &&
|
|
elem.type === "text" &&
|
|
|
|
// Support: IE<8
|
|
// New HTML5 attribute values (e.g., "search") appear with elem.type === "text"
|
|
( (attr = elem.getAttribute("type")) == null || attr.toLowerCase() === "text" );
|
|
},
|
|
|
|
// Position-in-collection
|
|
"first": createPositionalPseudo(function() {
|
|
return [ 0 ];
|
|
}),
|
|
|
|
"last": createPositionalPseudo(function( matchIndexes, length ) {
|
|
return [ length - 1 ];
|
|
}),
|
|
|
|
"eq": createPositionalPseudo(function( matchIndexes, length, argument ) {
|
|
return [ argument < 0 ? argument + length : argument ];
|
|
}),
|
|
|
|
"even": createPositionalPseudo(function( matchIndexes, length ) {
|
|
var i = 0;
|
|
for ( ; i < length; i += 2 ) {
|
|
matchIndexes.push( i );
|
|
}
|
|
return matchIndexes;
|
|
}),
|
|
|
|
"odd": createPositionalPseudo(function( matchIndexes, length ) {
|
|
var i = 1;
|
|
for ( ; i < length; i += 2 ) {
|
|
matchIndexes.push( i );
|
|
}
|
|
return matchIndexes;
|
|
}),
|
|
|
|
"lt": createPositionalPseudo(function( matchIndexes, length, argument ) {
|
|
var i = argument < 0 ? argument + length : argument;
|
|
for ( ; --i >= 0; ) {
|
|
matchIndexes.push( i );
|
|
}
|
|
return matchIndexes;
|
|
}),
|
|
|
|
"gt": createPositionalPseudo(function( matchIndexes, length, argument ) {
|
|
var i = argument < 0 ? argument + length : argument;
|
|
for ( ; ++i < length; ) {
|
|
matchIndexes.push( i );
|
|
}
|
|
return matchIndexes;
|
|
})
|
|
}
|
|
};
|
|
|
|
Expr.pseudos["nth"] = Expr.pseudos["eq"];
|
|
|
|
// Add button/input type pseudos
|
|
for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) {
|
|
Expr.pseudos[ i ] = createInputPseudo( i );
|
|
}
|
|
for ( i in { submit: true, reset: true } ) {
|
|
Expr.pseudos[ i ] = createButtonPseudo( i );
|
|
}
|
|
|
|
// Easy API for creating new setFilters
|
|
function setFilters() {}
|
|
setFilters.prototype = Expr.filters = Expr.pseudos;
|
|
Expr.setFilters = new setFilters();
|
|
|
|
tokenize = Sizzle.tokenize = function( selector, parseOnly ) {
|
|
var matched, match, tokens, type,
|
|
soFar, groups, preFilters,
|
|
cached = tokenCache[ selector + " " ];
|
|
|
|
if ( cached ) {
|
|
return parseOnly ? 0 : cached.slice( 0 );
|
|
}
|
|
|
|
soFar = selector;
|
|
groups = [];
|
|
preFilters = Expr.preFilter;
|
|
|
|
while ( soFar ) {
|
|
|
|
// Comma and first run
|
|
if ( !matched || (match = rcomma.exec( soFar )) ) {
|
|
if ( match ) {
|
|
// Don't consume trailing commas as valid
|
|
soFar = soFar.slice( match[0].length ) || soFar;
|
|
}
|
|
groups.push( (tokens = []) );
|
|
}
|
|
|
|
matched = false;
|
|
|
|
// Combinators
|
|
if ( (match = rcombinators.exec( soFar )) ) {
|
|
matched = match.shift();
|
|
tokens.push({
|
|
value: matched,
|
|
// Cast descendant combinators to space
|
|
type: match[0].replace( rtrim, " " )
|
|
});
|
|
soFar = soFar.slice( matched.length );
|
|
}
|
|
|
|
// Filters
|
|
for ( type in Expr.filter ) {
|
|
if ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] ||
|
|
(match = preFilters[ type ]( match ))) ) {
|
|
matched = match.shift();
|
|
tokens.push({
|
|
value: matched,
|
|
type: type,
|
|
matches: match
|
|
});
|
|
soFar = soFar.slice( matched.length );
|
|
}
|
|
}
|
|
|
|
if ( !matched ) {
|
|
break;
|
|
}
|
|
}
|
|
|
|
// Return the length of the invalid excess
|
|
// if we're just parsing
|
|
// Otherwise, throw an error or return tokens
|
|
return parseOnly ?
|
|
soFar.length :
|
|
soFar ?
|
|
Sizzle.error( selector ) :
|
|
// Cache the tokens
|
|
tokenCache( selector, groups ).slice( 0 );
|
|
};
|
|
|
|
function toSelector( tokens ) {
|
|
var i = 0,
|
|
len = tokens.length,
|
|
selector = "";
|
|
for ( ; i < len; i++ ) {
|
|
selector += tokens[i].value;
|
|
}
|
|
return selector;
|
|
}
|
|
|
|
function addCombinator( matcher, combinator, base ) {
|
|
var dir = combinator.dir,
|
|
checkNonElements = base && dir === "parentNode",
|
|
doneName = done++;
|
|
|
|
return combinator.first ?
|
|
// Check against closest ancestor/preceding element
|
|
function( elem, context, xml ) {
|
|
while ( (elem = elem[ dir ]) ) {
|
|
if ( elem.nodeType === 1 || checkNonElements ) {
|
|
return matcher( elem, context, xml );
|
|
}
|
|
}
|
|
} :
|
|
|
|
// Check against all ancestor/preceding elements
|
|
function( elem, context, xml ) {
|
|
var oldCache, outerCache,
|
|
newCache = [ dirruns, doneName ];
|
|
|
|
// We can't set arbitrary data on XML nodes, so they don't benefit from dir caching
|
|
if ( xml ) {
|
|
while ( (elem = elem[ dir ]) ) {
|
|
if ( elem.nodeType === 1 || checkNonElements ) {
|
|
if ( matcher( elem, context, xml ) ) {
|
|
return true;
|
|
}
|
|
}
|
|
}
|
|
} else {
|
|
while ( (elem = elem[ dir ]) ) {
|
|
if ( elem.nodeType === 1 || checkNonElements ) {
|
|
outerCache = elem[ expando ] || (elem[ expando ] = {});
|
|
if ( (oldCache = outerCache[ dir ]) &&
|
|
oldCache[ 0 ] === dirruns && oldCache[ 1 ] === doneName ) {
|
|
|
|
// Assign to newCache so results back-propagate to previous elements
|
|
return (newCache[ 2 ] = oldCache[ 2 ]);
|
|
} else {
|
|
// Reuse newcache so results back-propagate to previous elements
|
|
outerCache[ dir ] = newCache;
|
|
|
|
// A match means we're done; a fail means we have to keep checking
|
|
if ( (newCache[ 2 ] = matcher( elem, context, xml )) ) {
|
|
return true;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
};
|
|
}
|
|
|
|
function elementMatcher( matchers ) {
|
|
return matchers.length > 1 ?
|
|
function( elem, context, xml ) {
|
|
var i = matchers.length;
|
|
while ( i-- ) {
|
|
if ( !matchers[i]( elem, context, xml ) ) {
|
|
return false;
|
|
}
|
|
}
|
|
return true;
|
|
} :
|
|
matchers[0];
|
|
}
|
|
|
|
function multipleContexts( selector, contexts, results ) {
|
|
var i = 0,
|
|
len = contexts.length;
|
|
for ( ; i < len; i++ ) {
|
|
Sizzle( selector, contexts[i], results );
|
|
}
|
|
return results;
|
|
}
|
|
|
|
function condense( unmatched, map, filter, context, xml ) {
|
|
var elem,
|
|
newUnmatched = [],
|
|
i = 0,
|
|
len = unmatched.length,
|
|
mapped = map != null;
|
|
|
|
for ( ; i < len; i++ ) {
|
|
if ( (elem = unmatched[i]) ) {
|
|
if ( !filter || filter( elem, context, xml ) ) {
|
|
newUnmatched.push( elem );
|
|
if ( mapped ) {
|
|
map.push( i );
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
return newUnmatched;
|
|
}
|
|
|
|
function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) {
|
|
if ( postFilter && !postFilter[ expando ] ) {
|
|
postFilter = setMatcher( postFilter );
|
|
}
|
|
if ( postFinder && !postFinder[ expando ] ) {
|
|
postFinder = setMatcher( postFinder, postSelector );
|
|
}
|
|
return markFunction(function( seed, results, context, xml ) {
|
|
var temp, i, elem,
|
|
preMap = [],
|
|
postMap = [],
|
|
preexisting = results.length,
|
|
|
|
// Get initial elements from seed or context
|
|
elems = seed || multipleContexts( selector || "*", context.nodeType ? [ context ] : context, [] ),
|
|
|
|
// Prefilter to get matcher input, preserving a map for seed-results synchronization
|
|
matcherIn = preFilter && ( seed || !selector ) ?
|
|
condense( elems, preMap, preFilter, context, xml ) :
|
|
elems,
|
|
|
|
matcherOut = matcher ?
|
|
// If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results,
|
|
postFinder || ( seed ? preFilter : preexisting || postFilter ) ?
|
|
|
|
// ...intermediate processing is necessary
|
|
[] :
|
|
|
|
// ...otherwise use results directly
|
|
results :
|
|
matcherIn;
|
|
|
|
// Find primary matches
|
|
if ( matcher ) {
|
|
matcher( matcherIn, matcherOut, context, xml );
|
|
}
|
|
|
|
// Apply postFilter
|
|
if ( postFilter ) {
|
|
temp = condense( matcherOut, postMap );
|
|
postFilter( temp, [], context, xml );
|
|
|
|
// Un-match failing elements by moving them back to matcherIn
|
|
i = temp.length;
|
|
while ( i-- ) {
|
|
if ( (elem = temp[i]) ) {
|
|
matcherOut[ postMap[i] ] = !(matcherIn[ postMap[i] ] = elem);
|
|
}
|
|
}
|
|
}
|
|
|
|
if ( seed ) {
|
|
if ( postFinder || preFilter ) {
|
|
if ( postFinder ) {
|
|
// Get the final matcherOut by condensing this intermediate into postFinder contexts
|
|
temp = [];
|
|
i = matcherOut.length;
|
|
while ( i-- ) {
|
|
if ( (elem = matcherOut[i]) ) {
|
|
// Restore matcherIn since elem is not yet a final match
|
|
temp.push( (matcherIn[i] = elem) );
|
|
}
|
|
}
|
|
postFinder( null, (matcherOut = []), temp, xml );
|
|
}
|
|
|
|
// Move matched elements from seed to results to keep them synchronized
|
|
i = matcherOut.length;
|
|
while ( i-- ) {
|
|
if ( (elem = matcherOut[i]) &&
|
|
(temp = postFinder ? indexOf( seed, elem ) : preMap[i]) > -1 ) {
|
|
|
|
seed[temp] = !(results[temp] = elem);
|
|
}
|
|
}
|
|
}
|
|
|
|
// Add elements to results, through postFinder if defined
|
|
} else {
|
|
matcherOut = condense(
|
|
matcherOut === results ?
|
|
matcherOut.splice( preexisting, matcherOut.length ) :
|
|
matcherOut
|
|
);
|
|
if ( postFinder ) {
|
|
postFinder( null, results, matcherOut, xml );
|
|
} else {
|
|
push.apply( results, matcherOut );
|
|
}
|
|
}
|
|
});
|
|
}
|
|
|
|
function matcherFromTokens( tokens ) {
|
|
var checkContext, matcher, j,
|
|
len = tokens.length,
|
|
leadingRelative = Expr.relative[ tokens[0].type ],
|
|
implicitRelative = leadingRelative || Expr.relative[" "],
|
|
i = leadingRelative ? 1 : 0,
|
|
|
|
// The foundational matcher ensures that elements are reachable from top-level context(s)
|
|
matchContext = addCombinator( function( elem ) {
|
|
return elem === checkContext;
|
|
}, implicitRelative, true ),
|
|
matchAnyContext = addCombinator( function( elem ) {
|
|
return indexOf( checkContext, elem ) > -1;
|
|
}, implicitRelative, true ),
|
|
matchers = [ function( elem, context, xml ) {
|
|
var ret = ( !leadingRelative && ( xml || context !== outermostContext ) ) || (
|
|
(checkContext = context).nodeType ?
|
|
matchContext( elem, context, xml ) :
|
|
matchAnyContext( elem, context, xml ) );
|
|
// Avoid hanging onto element (issue #299)
|
|
checkContext = null;
|
|
return ret;
|
|
} ];
|
|
|
|
for ( ; i < len; i++ ) {
|
|
if ( (matcher = Expr.relative[ tokens[i].type ]) ) {
|
|
matchers = [ addCombinator(elementMatcher( matchers ), matcher) ];
|
|
} else {
|
|
matcher = Expr.filter[ tokens[i].type ].apply( null, tokens[i].matches );
|
|
|
|
// Return special upon seeing a positional matcher
|
|
if ( matcher[ expando ] ) {
|
|
// Find the next relative operator (if any) for proper handling
|
|
j = ++i;
|
|
for ( ; j < len; j++ ) {
|
|
if ( Expr.relative[ tokens[j].type ] ) {
|
|
break;
|
|
}
|
|
}
|
|
return setMatcher(
|
|
i > 1 && elementMatcher( matchers ),
|
|
i > 1 && toSelector(
|
|
// If the preceding token was a descendant combinator, insert an implicit any-element `*`
|
|
tokens.slice( 0, i - 1 ).concat({ value: tokens[ i - 2 ].type === " " ? "*" : "" })
|
|
).replace( rtrim, "$1" ),
|
|
matcher,
|
|
i < j && matcherFromTokens( tokens.slice( i, j ) ),
|
|
j < len && matcherFromTokens( (tokens = tokens.slice( j )) ),
|
|
j < len && toSelector( tokens )
|
|
);
|
|
}
|
|
matchers.push( matcher );
|
|
}
|
|
}
|
|
|
|
return elementMatcher( matchers );
|
|
}
|
|
|
|
function matcherFromGroupMatchers( elementMatchers, setMatchers ) {
|
|
var bySet = setMatchers.length > 0,
|
|
byElement = elementMatchers.length > 0,
|
|
superMatcher = function( seed, context, xml, results, outermost ) {
|
|
var elem, j, matcher,
|
|
matchedCount = 0,
|
|
i = "0",
|
|
unmatched = seed && [],
|
|
setMatched = [],
|
|
contextBackup = outermostContext,
|
|
// We must always have either seed elements or outermost context
|
|
elems = seed || byElement && Expr.find["TAG"]( "*", outermost ),
|
|
// Use integer dirruns iff this is the outermost matcher
|
|
dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.random() || 0.1),
|
|
len = elems.length;
|
|
|
|
if ( outermost ) {
|
|
outermostContext = context !== document && context;
|
|
}
|
|
|
|
// Add elements passing elementMatchers directly to results
|
|
// Keep `i` a string if there are no elements so `matchedCount` will be "00" below
|
|
// Support: IE<9, Safari
|
|
// Tolerate NodeList properties (IE: "length"; Safari: <number>) matching elements by id
|
|
for ( ; i !== len && (elem = elems[i]) != null; i++ ) {
|
|
if ( byElement && elem ) {
|
|
j = 0;
|
|
while ( (matcher = elementMatchers[j++]) ) {
|
|
if ( matcher( elem, context, xml ) ) {
|
|
results.push( elem );
|
|
break;
|
|
}
|
|
}
|
|
if ( outermost ) {
|
|
dirruns = dirrunsUnique;
|
|
}
|
|
}
|
|
|
|
// Track unmatched elements for set filters
|
|
if ( bySet ) {
|
|
// They will have gone through all possible matchers
|
|
if ( (elem = !matcher && elem) ) {
|
|
matchedCount--;
|
|
}
|
|
|
|
// Lengthen the array for every element, matched or not
|
|
if ( seed ) {
|
|
unmatched.push( elem );
|
|
}
|
|
}
|
|
}
|
|
|
|
// Apply set filters to unmatched elements
|
|
matchedCount += i;
|
|
if ( bySet && i !== matchedCount ) {
|
|
j = 0;
|
|
while ( (matcher = setMatchers[j++]) ) {
|
|
matcher( unmatched, setMatched, context, xml );
|
|
}
|
|
|
|
if ( seed ) {
|
|
// Reintegrate element matches to eliminate the need for sorting
|
|
if ( matchedCount > 0 ) {
|
|
while ( i-- ) {
|
|
if ( !(unmatched[i] || setMatched[i]) ) {
|
|
setMatched[i] = pop.call( results );
|
|
}
|
|
}
|
|
}
|
|
|
|
// Discard index placeholder values to get only actual matches
|
|
setMatched = condense( setMatched );
|
|
}
|
|
|
|
// Add matches to results
|
|
push.apply( results, setMatched );
|
|
|
|
// Seedless set matches succeeding multiple successful matchers stipulate sorting
|
|
if ( outermost && !seed && setMatched.length > 0 &&
|
|
( matchedCount + setMatchers.length ) > 1 ) {
|
|
|
|
Sizzle.uniqueSort( results );
|
|
}
|
|
}
|
|
|
|
// Override manipulation of globals by nested matchers
|
|
if ( outermost ) {
|
|
dirruns = dirrunsUnique;
|
|
outermostContext = contextBackup;
|
|
}
|
|
|
|
return unmatched;
|
|
};
|
|
|
|
return bySet ?
|
|
markFunction( superMatcher ) :
|
|
superMatcher;
|
|
}
|
|
|
|
compile = Sizzle.compile = function( selector, match /* Internal Use Only */ ) {
|
|
var i,
|
|
setMatchers = [],
|
|
elementMatchers = [],
|
|
cached = compilerCache[ selector + " " ];
|
|
|
|
if ( !cached ) {
|
|
// Generate a function of recursive functions that can be used to check each element
|
|
if ( !match ) {
|
|
match = tokenize( selector );
|
|
}
|
|
i = match.length;
|
|
while ( i-- ) {
|
|
cached = matcherFromTokens( match[i] );
|
|
if ( cached[ expando ] ) {
|
|
setMatchers.push( cached );
|
|
} else {
|
|
elementMatchers.push( cached );
|
|
}
|
|
}
|
|
|
|
// Cache the compiled function
|
|
cached = compilerCache( selector, matcherFromGroupMatchers( elementMatchers, setMatchers ) );
|
|
|
|
// Save selector and tokenization
|
|
cached.selector = selector;
|
|
}
|
|
return cached;
|
|
};
|
|
|
|
/**
|
|
* A low-level selection function that works with Sizzle's compiled
|
|
* selector functions
|
|
* @param {String|Function} selector A selector or a pre-compiled
|
|
* selector function built with Sizzle.compile
|
|
* @param {Element} context
|
|
* @param {Array} [results]
|
|
* @param {Array} [seed] A set of elements to match against
|
|
*/
|
|
select = Sizzle.select = function( selector, context, results, seed ) {
|
|
var i, tokens, token, type, find,
|
|
compiled = typeof selector === "function" && selector,
|
|
match = !seed && tokenize( (selector = compiled.selector || selector) );
|
|
|
|
results = results || [];
|
|
|
|
// Try to minimize operations if there is no seed and only one group
|
|
if ( match.length === 1 ) {
|
|
|
|
// Take a shortcut and set the context if the root selector is an ID
|
|
tokens = match[0] = match[0].slice( 0 );
|
|
if ( tokens.length > 2 && (token = tokens[0]).type === "ID" &&
|
|
support.getById && context.nodeType === 9 && documentIsHTML &&
|
|
Expr.relative[ tokens[1].type ] ) {
|
|
|
|
context = ( Expr.find["ID"]( token.matches[0].replace(runescape, funescape), context ) || [] )[0];
|
|
if ( !context ) {
|
|
return results;
|
|
|
|
// Precompiled matchers will still verify ancestry, so step up a level
|
|
} else if ( compiled ) {
|
|
context = context.parentNode;
|
|
}
|
|
|
|
selector = selector.slice( tokens.shift().value.length );
|
|
}
|
|
|
|
// Fetch a seed set for right-to-left matching
|
|
i = matchExpr["needsContext"].test( selector ) ? 0 : tokens.length;
|
|
while ( i-- ) {
|
|
token = tokens[i];
|
|
|
|
// Abort if we hit a combinator
|
|
if ( Expr.relative[ (type = token.type) ] ) {
|
|
break;
|
|
}
|
|
if ( (find = Expr.find[ type ]) ) {
|
|
// Search, expanding context for leading sibling combinators
|
|
if ( (seed = find(
|
|
token.matches[0].replace( runescape, funescape ),
|
|
rsibling.test( tokens[0].type ) && testContext( context.parentNode ) || context
|
|
)) ) {
|
|
|
|
// If seed is empty or no tokens remain, we can return early
|
|
tokens.splice( i, 1 );
|
|
selector = seed.length && toSelector( tokens );
|
|
if ( !selector ) {
|
|
push.apply( results, seed );
|
|
return results;
|
|
}
|
|
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
// Compile and execute a filtering function if one is not provided
|
|
// Provide `match` to avoid retokenization if we modified the selector above
|
|
( compiled || compile( selector, match ) )(
|
|
seed,
|
|
context,
|
|
!documentIsHTML,
|
|
results,
|
|
rsibling.test( selector ) && testContext( context.parentNode ) || context
|
|
);
|
|
return results;
|
|
};
|
|
|
|
// One-time assignments
|
|
|
|
// Sort stability
|
|
support.sortStable = expando.split("").sort( sortOrder ).join("") === expando;
|
|
|
|
// Support: Chrome 14-35+
|
|
// Always assume duplicates if they aren't passed to the comparison function
|
|
support.detectDuplicates = !!hasDuplicate;
|
|
|
|
// Initialize against the default document
|
|
setDocument();
|
|
|
|
// Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27)
|
|
// Detached nodes confoundingly follow *each other*
|
|
support.sortDetached = assert(function( div1 ) {
|
|
// Should return 1, but returns 4 (following)
|
|
return div1.compareDocumentPosition( document.createElement("div") ) & 1;
|
|
});
|
|
|
|
// Support: IE<8
|
|
// Prevent attribute/property "interpolation"
|
|
// http://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx
|
|
if ( !assert(function( div ) {
|
|
div.innerHTML = "<a href='#'></a>";
|
|
return div.firstChild.getAttribute("href") === "#" ;
|
|
}) ) {
|
|
addHandle( "type|href|height|width", function( elem, name, isXML ) {
|
|
if ( !isXML ) {
|
|
return elem.getAttribute( name, name.toLowerCase() === "type" ? 1 : 2 );
|
|
}
|
|
});
|
|
}
|
|
|
|
// Support: IE<9
|
|
// Use defaultValue in place of getAttribute("value")
|
|
if ( !support.attributes || !assert(function( div ) {
|
|
div.innerHTML = "<input/>";
|
|
div.firstChild.setAttribute( "value", "" );
|
|
return div.firstChild.getAttribute( "value" ) === "";
|
|
}) ) {
|
|
addHandle( "value", function( elem, name, isXML ) {
|
|
if ( !isXML && elem.nodeName.toLowerCase() === "input" ) {
|
|
return elem.defaultValue;
|
|
}
|
|
});
|
|
}
|
|
|
|
// Support: IE<9
|
|
// Use getAttributeNode to fetch booleans when getAttribute lies
|
|
if ( !assert(function( div ) {
|
|
return div.getAttribute("disabled") == null;
|
|
}) ) {
|
|
addHandle( booleans, function( elem, name, isXML ) {
|
|
var val;
|
|
if ( !isXML ) {
|
|
return elem[ name ] === true ? name.toLowerCase() :
|
|
(val = elem.getAttributeNode( name )) && val.specified ?
|
|
val.value :
|
|
null;
|
|
}
|
|
});
|
|
}
|
|
|
|
return Sizzle;
|
|
|
|
})( window );
|
|
|
|
|
|
|
|
jQuery.find = Sizzle;
|
|
jQuery.expr = Sizzle.selectors;
|
|
jQuery.expr[":"] = jQuery.expr.pseudos;
|
|
jQuery.unique = Sizzle.uniqueSort;
|
|
jQuery.text = Sizzle.getText;
|
|
jQuery.isXMLDoc = Sizzle.isXML;
|
|
jQuery.contains = Sizzle.contains;
|
|
|
|
|
|
|
|
var rneedsContext = jQuery.expr.match.needsContext;
|
|
|
|
var rsingleTag = (/^<(\w+)\s*\/?>(?:<\/\1>|)$/);
|
|
|
|
|
|
|
|
var risSimple = /^.[^:#\[\.,]*$/;
|
|
|
|
// Implement the identical functionality for filter and not
|
|
function winnow( elements, qualifier, not ) {
|
|
if ( jQuery.isFunction( qualifier ) ) {
|
|
return jQuery.grep( elements, function( elem, i ) {
|
|
/* jshint -W018 */
|
|
return !!qualifier.call( elem, i, elem ) !== not;
|
|
});
|
|
|
|
}
|
|
|
|
if ( qualifier.nodeType ) {
|
|
return jQuery.grep( elements, function( elem ) {
|
|
return ( elem === qualifier ) !== not;
|
|
});
|
|
|
|
}
|
|
|
|
if ( typeof qualifier === "string" ) {
|
|
if ( risSimple.test( qualifier ) ) {
|
|
return jQuery.filter( qualifier, elements, not );
|
|
}
|
|
|
|
qualifier = jQuery.filter( qualifier, elements );
|
|
}
|
|
|
|
return jQuery.grep( elements, function( elem ) {
|
|
return ( indexOf.call( qualifier, elem ) >= 0 ) !== not;
|
|
});
|
|
}
|
|
|
|
jQuery.filter = function( expr, elems, not ) {
|
|
var elem = elems[ 0 ];
|
|
|
|
if ( not ) {
|
|
expr = ":not(" + expr + ")";
|
|
}
|
|
|
|
return elems.length === 1 && elem.nodeType === 1 ?
|
|
jQuery.find.matchesSelector( elem, expr ) ? [ elem ] : [] :
|
|
jQuery.find.matches( expr, jQuery.grep( elems, function( elem ) {
|
|
return elem.nodeType === 1;
|
|
}));
|
|
};
|
|
|
|
jQuery.fn.extend({
|
|
find: function( selector ) {
|
|
var i,
|
|
len = this.length,
|
|
ret = [],
|
|
self = this;
|
|
|
|
if ( typeof selector !== "string" ) {
|
|
return this.pushStack( jQuery( selector ).filter(function() {
|
|
for ( i = 0; i < len; i++ ) {
|
|
if ( jQuery.contains( self[ i ], this ) ) {
|
|
return true;
|
|
}
|
|
}
|
|
}) );
|
|
}
|
|
|
|
for ( i = 0; i < len; i++ ) {
|
|
jQuery.find( selector, self[ i ], ret );
|
|
}
|
|
|
|
// Needed because $( selector, context ) becomes $( context ).find( selector )
|
|
ret = this.pushStack( len > 1 ? jQuery.unique( ret ) : ret );
|
|
ret.selector = this.selector ? this.selector + " " + selector : selector;
|
|
return ret;
|
|
},
|
|
filter: function( selector ) {
|
|
return this.pushStack( winnow(this, selector || [], false) );
|
|
},
|
|
not: function( selector ) {
|
|
return this.pushStack( winnow(this, selector || [], true) );
|
|
},
|
|
is: function( selector ) {
|
|
return !!winnow(
|
|
this,
|
|
|
|
// If this is a positional/relative selector, check membership in the returned set
|
|
// so $("p:first").is("p:last") won't return true for a doc with two "p".
|
|
typeof selector === "string" && rneedsContext.test( selector ) ?
|
|
jQuery( selector ) :
|
|
selector || [],
|
|
false
|
|
).length;
|
|
}
|
|
});
|
|
|
|
|
|
// Initialize a jQuery object
|
|
|
|
|
|
// A central reference to the root jQuery(document)
|
|
var rootjQuery,
|
|
|
|
// A simple way to check for HTML strings
|
|
// Prioritize #id over <tag> to avoid XSS via location.hash (#9521)
|
|
// Strict HTML recognition (#11290: must start with <)
|
|
rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]*))$/,
|
|
|
|
init = jQuery.fn.init = function( selector, context ) {
|
|
var match, elem;
|
|
|
|
// HANDLE: $(""), $(null), $(undefined), $(false)
|
|
if ( !selector ) {
|
|
return this;
|
|
}
|
|
|
|
// Handle HTML strings
|
|
if ( typeof selector === "string" ) {
|
|
if ( selector[0] === "<" && selector[ selector.length - 1 ] === ">" && selector.length >= 3 ) {
|
|
// Assume that strings that start and end with <> are HTML and skip the regex check
|
|
match = [ null, selector, null ];
|
|
|
|
} else {
|
|
match = rquickExpr.exec( selector );
|
|
}
|
|
|
|
// Match html or make sure no context is specified for #id
|
|
if ( match && (match[1] || !context) ) {
|
|
|
|
// HANDLE: $(html) -> $(array)
|
|
if ( match[1] ) {
|
|
context = context instanceof jQuery ? context[0] : context;
|
|
|
|
// Option to run scripts is true for back-compat
|
|
// Intentionally let the error be thrown if parseHTML is not present
|
|
jQuery.merge( this, jQuery.parseHTML(
|
|
match[1],
|
|
context && context.nodeType ? context.ownerDocument || context : document,
|
|
true
|
|
) );
|
|
|
|
// HANDLE: $(html, props)
|
|
if ( rsingleTag.test( match[1] ) && jQuery.isPlainObject( context ) ) {
|
|
for ( match in context ) {
|
|
// Properties of context are called as methods if possible
|
|
if ( jQuery.isFunction( this[ match ] ) ) {
|
|
this[ match ]( context[ match ] );
|
|
|
|
// ...and otherwise set as attributes
|
|
} else {
|
|
this.attr( match, context[ match ] );
|
|
}
|
|
}
|
|
}
|
|
|
|
return this;
|
|
|
|
// HANDLE: $(#id)
|
|
} else {
|
|
elem = document.getElementById( match[2] );
|
|
|
|
// Support: Blackberry 4.6
|
|
// gEBID returns nodes no longer in the document (#6963)
|
|
if ( elem && elem.parentNode ) {
|
|
// Inject the element directly into the jQuery object
|
|
this.length = 1;
|
|
this[0] = elem;
|
|
}
|
|
|
|
this.context = document;
|
|
this.selector = selector;
|
|
return this;
|
|
}
|
|
|
|
// HANDLE: $(expr, $(...))
|
|
} else if ( !context || context.jquery ) {
|
|
return ( context || rootjQuery ).find( selector );
|
|
|
|
// HANDLE: $(expr, context)
|
|
// (which is just equivalent to: $(context).find(expr)
|
|
} else {
|
|
return this.constructor( context ).find( selector );
|
|
}
|
|
|
|
// HANDLE: $(DOMElement)
|
|
} else if ( selector.nodeType ) {
|
|
this.context = this[0] = selector;
|
|
this.length = 1;
|
|
return this;
|
|
|
|
// HANDLE: $(function)
|
|
// Shortcut for document ready
|
|
} else if ( jQuery.isFunction( selector ) ) {
|
|
return typeof rootjQuery.ready !== "undefined" ?
|
|
rootjQuery.ready( selector ) :
|
|
// Execute immediately if ready is not present
|
|
selector( jQuery );
|
|
}
|
|
|
|
if ( selector.selector !== undefined ) {
|
|
this.selector = selector.selector;
|
|
this.context = selector.context;
|
|
}
|
|
|
|
return jQuery.makeArray( selector, this );
|
|
};
|
|
|
|
// Give the init function the jQuery prototype for later instantiation
|
|
init.prototype = jQuery.fn;
|
|
|
|
// Initialize central reference
|
|
rootjQuery = jQuery( document );
|
|
|
|
|
|
var rparentsprev = /^(?:parents|prev(?:Until|All))/,
|
|
// Methods guaranteed to produce a unique set when starting from a unique set
|
|
guaranteedUnique = {
|
|
children: true,
|
|
contents: true,
|
|
next: true,
|
|
prev: true
|
|
};
|
|
|
|
jQuery.extend({
|
|
dir: function( elem, dir, until ) {
|
|
var matched = [],
|
|
truncate = until !== undefined;
|
|
|
|
while ( (elem = elem[ dir ]) && elem.nodeType !== 9 ) {
|
|
if ( elem.nodeType === 1 ) {
|
|
if ( truncate && jQuery( elem ).is( until ) ) {
|
|
break;
|
|
}
|
|
matched.push( elem );
|
|
}
|
|
}
|
|
return matched;
|
|
},
|
|
|
|
sibling: function( n, elem ) {
|
|
var matched = [];
|
|
|
|
for ( ; n; n = n.nextSibling ) {
|
|
if ( n.nodeType === 1 && n !== elem ) {
|
|
matched.push( n );
|
|
}
|
|
}
|
|
|
|
return matched;
|
|
}
|
|
});
|
|
|
|
jQuery.fn.extend({
|
|
has: function( target ) {
|
|
var targets = jQuery( target, this ),
|
|
l = targets.length;
|
|
|
|
return this.filter(function() {
|
|
var i = 0;
|
|
for ( ; i < l; i++ ) {
|
|
if ( jQuery.contains( this, targets[i] ) ) {
|
|
return true;
|
|
}
|
|
}
|
|
});
|
|
},
|
|
|
|
closest: function( selectors, context ) {
|
|
var cur,
|
|
i = 0,
|
|
l = this.length,
|
|
matched = [],
|
|
pos = rneedsContext.test( selectors ) || typeof selectors !== "string" ?
|
|
jQuery( selectors, context || this.context ) :
|
|
0;
|
|
|
|
for ( ; i < l; i++ ) {
|
|
for ( cur = this[i]; cur && cur !== context; cur = cur.parentNode ) {
|
|
// Always skip document fragments
|
|
if ( cur.nodeType < 11 && (pos ?
|
|
pos.index(cur) > -1 :
|
|
|
|
// Don't pass non-elements to Sizzle
|
|
cur.nodeType === 1 &&
|
|
jQuery.find.matchesSelector(cur, selectors)) ) {
|
|
|
|
matched.push( cur );
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
|
|
return this.pushStack( matched.length > 1 ? jQuery.unique( matched ) : matched );
|
|
},
|
|
|
|
// Determine the position of an element within the set
|
|
index: function( elem ) {
|
|
|
|
// No argument, return index in parent
|
|
if ( !elem ) {
|
|
return ( this[ 0 ] && this[ 0 ].parentNode ) ? this.first().prevAll().length : -1;
|
|
}
|
|
|
|
// Index in selector
|
|
if ( typeof elem === "string" ) {
|
|
return indexOf.call( jQuery( elem ), this[ 0 ] );
|
|
}
|
|
|
|
// Locate the position of the desired element
|
|
return indexOf.call( this,
|
|
|
|
// If it receives a jQuery object, the first element is used
|
|
elem.jquery ? elem[ 0 ] : elem
|
|
);
|
|
},
|
|
|
|
add: function( selector, context ) {
|
|
return this.pushStack(
|
|
jQuery.unique(
|
|
jQuery.merge( this.get(), jQuery( selector, context ) )
|
|
)
|
|
);
|
|
},
|
|
|
|
addBack: function( selector ) {
|
|
return this.add( selector == null ?
|
|
this.prevObject : this.prevObject.filter(selector)
|
|
);
|
|
}
|
|
});
|
|
|
|
function sibling( cur, dir ) {
|
|
while ( (cur = cur[dir]) && cur.nodeType !== 1 ) {}
|
|
return cur;
|
|
}
|
|
|
|
jQuery.each({
|
|
parent: function( elem ) {
|
|
var parent = elem.parentNode;
|
|
return parent && parent.nodeType !== 11 ? parent : null;
|
|
},
|
|
parents: function( elem ) {
|
|
return jQuery.dir( elem, "parentNode" );
|
|
},
|
|
parentsUntil: function( elem, i, until ) {
|
|
return jQuery.dir( elem, "parentNode", until );
|
|
},
|
|
next: function( elem ) {
|
|
return sibling( elem, "nextSibling" );
|
|
},
|
|
prev: function( elem ) {
|
|
return sibling( elem, "previousSibling" );
|
|
},
|
|
nextAll: function( elem ) {
|
|
return jQuery.dir( elem, "nextSibling" );
|
|
},
|
|
prevAll: function( elem ) {
|
|
return jQuery.dir( elem, "previousSibling" );
|
|
},
|
|
nextUntil: function( elem, i, until ) {
|
|
return jQuery.dir( elem, "nextSibling", until );
|
|
},
|
|
prevUntil: function( elem, i, until ) {
|
|
return jQuery.dir( elem, "previousSibling", until );
|
|
},
|
|
siblings: function( elem ) {
|
|
return jQuery.sibling( ( elem.parentNode || {} ).firstChild, elem );
|
|
},
|
|
children: function( elem ) {
|
|
return jQuery.sibling( elem.firstChild );
|
|
},
|
|
contents: function( elem ) {
|
|
return elem.contentDocument || jQuery.merge( [], elem.childNodes );
|
|
}
|
|
}, function( name, fn ) {
|
|
jQuery.fn[ name ] = function( until, selector ) {
|
|
var matched = jQuery.map( this, fn, until );
|
|
|
|
if ( name.slice( -5 ) !== "Until" ) {
|
|
selector = until;
|
|
}
|
|
|
|
if ( selector && typeof selector === "string" ) {
|
|
matched = jQuery.filter( selector, matched );
|
|
}
|
|
|
|
if ( this.length > 1 ) {
|
|
// Remove duplicates
|
|
if ( !guaranteedUnique[ name ] ) {
|
|
jQuery.unique( matched );
|
|
}
|
|
|
|
// Reverse order for parents* and prev-derivatives
|
|
if ( rparentsprev.test( name ) ) {
|
|
matched.reverse();
|
|
}
|
|
}
|
|
|
|
return this.pushStack( matched );
|
|
};
|
|
});
|
|
var rnotwhite = (/\S+/g);
|
|
|
|
|
|
|
|
// String to Object options format cache
|
|
var optionsCache = {};
|
|
|
|
// Convert String-formatted options into Object-formatted ones and store in cache
|
|
function createOptions( options ) {
|
|
var object = optionsCache[ options ] = {};
|
|
jQuery.each( options.match( rnotwhite ) || [], function( _, flag ) {
|
|
object[ flag ] = true;
|
|
});
|
|
return object;
|
|
}
|
|
|
|
/*
|
|
* Create a callback list using the following parameters:
|
|
*
|
|
* options: an optional list of space-separated options that will change how
|
|
* the callback list behaves or a more traditional option object
|
|
*
|
|
* By default a callback list will act like an event callback list and can be
|
|
* "fired" multiple times.
|
|
*
|
|
* Possible options:
|
|
*
|
|
* once: will ensure the callback list can only be fired once (like a Deferred)
|
|
*
|
|
* memory: will keep track of previous values and will call any callback added
|
|
* after the list has been fired right away with the latest "memorized"
|
|
* values (like a Deferred)
|
|
*
|
|
* unique: will ensure a callback can only be added once (no duplicate in the list)
|
|
*
|
|
* stopOnFalse: interrupt callings when a callback returns false
|
|
*
|
|
*/
|
|
jQuery.Callbacks = function( options ) {
|
|
|
|
// Convert options from String-formatted to Object-formatted if needed
|
|
// (we check in cache first)
|
|
options = typeof options === "string" ?
|
|
( optionsCache[ options ] || createOptions( options ) ) :
|
|
jQuery.extend( {}, options );
|
|
|
|
var // Last fire value (for non-forgettable lists)
|
|
memory,
|
|
// Flag to know if list was already fired
|
|
fired,
|
|
// Flag to know if list is currently firing
|
|
firing,
|
|
// First callback to fire (used internally by add and fireWith)
|
|
firingStart,
|
|
// End of the loop when firing
|
|
firingLength,
|
|
// Index of currently firing callback (modified by remove if needed)
|
|
firingIndex,
|
|
// Actual callback list
|
|
list = [],
|
|
// Stack of fire calls for repeatable lists
|
|
stack = !options.once && [],
|
|
// Fire callbacks
|
|
fire = function( data ) {
|
|
memory = options.memory && data;
|
|
fired = true;
|
|
firingIndex = firingStart || 0;
|
|
firingStart = 0;
|
|
firingLength = list.length;
|
|
firing = true;
|
|
for ( ; list && firingIndex < firingLength; firingIndex++ ) {
|
|
if ( list[ firingIndex ].apply( data[ 0 ], data[ 1 ] ) === false && options.stopOnFalse ) {
|
|
memory = false; // To prevent further calls using add
|
|
break;
|
|
}
|
|
}
|
|
firing = false;
|
|
if ( list ) {
|
|
if ( stack ) {
|
|
if ( stack.length ) {
|
|
fire( stack.shift() );
|
|
}
|
|
} else if ( memory ) {
|
|
list = [];
|
|
} else {
|
|
self.disable();
|
|
}
|
|
}
|
|
},
|
|
// Actual Callbacks object
|
|
self = {
|
|
// Add a callback or a collection of callbacks to the list
|
|
add: function() {
|
|
if ( list ) {
|
|
// First, we save the current length
|
|
var start = list.length;
|
|
(function add( args ) {
|
|
jQuery.each( args, function( _, arg ) {
|
|
var type = jQuery.type( arg );
|
|
if ( type === "function" ) {
|
|
if ( !options.unique || !self.has( arg ) ) {
|
|
list.push( arg );
|
|
}
|
|
} else if ( arg && arg.length && type !== "string" ) {
|
|
// Inspect recursively
|
|
add( arg );
|
|
}
|
|
});
|
|
})( arguments );
|
|
// Do we need to add the callbacks to the
|
|
// current firing batch?
|
|
if ( firing ) {
|
|
firingLength = list.length;
|
|
// With memory, if we're not firing then
|
|
// we should call right away
|
|
} else if ( memory ) {
|
|
firingStart = start;
|
|
fire( memory );
|
|
}
|
|
}
|
|
return this;
|
|
},
|
|
// Remove a callback from the list
|
|
remove: function() {
|
|
if ( list ) {
|
|
jQuery.each( arguments, function( _, arg ) {
|
|
var index;
|
|
while ( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) {
|
|
list.splice( index, 1 );
|
|
// Handle firing indexes
|
|
if ( firing ) {
|
|
if ( index <= firingLength ) {
|
|
firingLength--;
|
|
}
|
|
if ( index <= firingIndex ) {
|
|
firingIndex--;
|
|
}
|
|
}
|
|
}
|
|
});
|
|
}
|
|
return this;
|
|
},
|
|
// Check if a given callback is in the list.
|
|
// If no argument is given, return whether or not list has callbacks attached.
|
|
has: function( fn ) {
|
|
return fn ? jQuery.inArray( fn, list ) > -1 : !!( list && list.length );
|
|
},
|
|
// Remove all callbacks from the list
|
|
empty: function() {
|
|
list = [];
|
|
firingLength = 0;
|
|
return this;
|
|
},
|
|
// Have the list do nothing anymore
|
|
disable: function() {
|
|
list = stack = memory = undefined;
|
|
return this;
|
|
},
|
|
// Is it disabled?
|
|
disabled: function() {
|
|
return !list;
|
|
},
|
|
// Lock the list in its current state
|
|
lock: function() {
|
|
stack = undefined;
|
|
if ( !memory ) {
|
|
self.disable();
|
|
}
|
|
return this;
|
|
},
|
|
// Is it locked?
|
|
locked: function() {
|
|
return !stack;
|
|
},
|
|
// Call all callbacks with the given context and arguments
|
|
fireWith: function( context, args ) {
|
|
if ( list && ( !fired || stack ) ) {
|
|
args = args || [];
|
|
args = [ context, args.slice ? args.slice() : args ];
|
|
if ( firing ) {
|
|
stack.push( args );
|
|
} else {
|
|
fire( args );
|
|
}
|
|
}
|
|
return this;
|
|
},
|
|
// Call all the callbacks with the given arguments
|
|
fire: function() {
|
|
self.fireWith( this, arguments );
|
|
return this;
|
|
},
|
|
// To know if the callbacks have already been called at least once
|
|
fired: function() {
|
|
return !!fired;
|
|
}
|
|
};
|
|
|
|
return self;
|
|
};
|
|
|
|
|
|
jQuery.extend({
|
|
|
|
Deferred: function( func ) {
|
|
var tuples = [
|
|
// action, add listener, listener list, final state
|
|
[ "resolve", "done", jQuery.Callbacks("once memory"), "resolved" ],
|
|
[ "reject", "fail", jQuery.Callbacks("once memory"), "rejected" ],
|
|
[ "notify", "progress", jQuery.Callbacks("memory") ]
|
|
],
|
|
state = "pending",
|
|
promise = {
|
|
state: function() {
|
|
return state;
|
|
},
|
|
always: function() {
|
|
deferred.done( arguments ).fail( arguments );
|
|
return this;
|
|
},
|
|
then: function( /* fnDone, fnFail, fnProgress */ ) {
|
|
var fns = arguments;
|
|
return jQuery.Deferred(function( newDefer ) {
|
|
jQuery.each( tuples, function( i, tuple ) {
|
|
var fn = jQuery.isFunction( fns[ i ] ) && fns[ i ];
|
|
// deferred[ done | fail | progress ] for forwarding actions to newDefer
|
|
deferred[ tuple[1] ](function() {
|
|
var returned = fn && fn.apply( this, arguments );
|
|
if ( returned && jQuery.isFunction( returned.promise ) ) {
|
|
returned.promise()
|
|
.done( newDefer.resolve )
|
|
.fail( newDefer.reject )
|
|
.progress( newDefer.notify );
|
|
} else {
|
|
newDefer[ tuple[ 0 ] + "With" ]( this === promise ? newDefer.promise() : this, fn ? [ returned ] : arguments );
|
|
}
|
|
});
|
|
});
|
|
fns = null;
|
|
}).promise();
|
|
},
|
|
// Get a promise for this deferred
|
|
// If obj is provided, the promise aspect is added to the object
|
|
promise: function( obj ) {
|
|
return obj != null ? jQuery.extend( obj, promise ) : promise;
|
|
}
|
|
},
|
|
deferred = {};
|
|
|
|
// Keep pipe for back-compat
|
|
promise.pipe = promise.then;
|
|
|
|
// Add list-specific methods
|
|
jQuery.each( tuples, function( i, tuple ) {
|
|
var list = tuple[ 2 ],
|
|
stateString = tuple[ 3 ];
|
|
|
|
// promise[ done | fail | progress ] = list.add
|
|
promise[ tuple[1] ] = list.add;
|
|
|
|
// Handle state
|
|
if ( stateString ) {
|
|
list.add(function() {
|
|
// state = [ resolved | rejected ]
|
|
state = stateString;
|
|
|
|
// [ reject_list | resolve_list ].disable; progress_list.lock
|
|
}, tuples[ i ^ 1 ][ 2 ].disable, tuples[ 2 ][ 2 ].lock );
|
|
}
|
|
|
|
// deferred[ resolve | reject | notify ]
|
|
deferred[ tuple[0] ] = function() {
|
|
deferred[ tuple[0] + "With" ]( this === deferred ? promise : this, arguments );
|
|
return this;
|
|
};
|
|
deferred[ tuple[0] + "With" ] = list.fireWith;
|
|
});
|
|
|
|
// Make the deferred a promise
|
|
promise.promise( deferred );
|
|
|
|
// Call given func if any
|
|
if ( func ) {
|
|
func.call( deferred, deferred );
|
|
}
|
|
|
|
// All done!
|
|
return deferred;
|
|
},
|
|
|
|
// Deferred helper
|
|
when: function( subordinate /* , ..., subordinateN */ ) {
|
|
var i = 0,
|
|
resolveValues = slice.call( arguments ),
|
|
length = resolveValues.length,
|
|
|
|
// the count of uncompleted subordinates
|
|
remaining = length !== 1 || ( subordinate && jQuery.isFunction( subordinate.promise ) ) ? length : 0,
|
|
|
|
// the master Deferred. If resolveValues consist of only a single Deferred, just use that.
|
|
deferred = remaining === 1 ? subordinate : jQuery.Deferred(),
|
|
|
|
// Update function for both resolve and progress values
|
|
updateFunc = function( i, contexts, values ) {
|
|
return function( value ) {
|
|
contexts[ i ] = this;
|
|
values[ i ] = arguments.length > 1 ? slice.call( arguments ) : value;
|
|
if ( values === progressValues ) {
|
|
deferred.notifyWith( contexts, values );
|
|
} else if ( !( --remaining ) ) {
|
|
deferred.resolveWith( contexts, values );
|
|
}
|
|
};
|
|
},
|
|
|
|
progressValues, progressContexts, resolveContexts;
|
|
|
|
// Add listeners to Deferred subordinates; treat others as resolved
|
|
if ( length > 1 ) {
|
|
progressValues = new Array( length );
|
|
progressContexts = new Array( length );
|
|
resolveContexts = new Array( length );
|
|
for ( ; i < length; i++ ) {
|
|
if ( resolveValues[ i ] && jQuery.isFunction( resolveValues[ i ].promise ) ) {
|
|
resolveValues[ i ].promise()
|
|
.done( updateFunc( i, resolveContexts, resolveValues ) )
|
|
.fail( deferred.reject )
|
|
.progress( updateFunc( i, progressContexts, progressValues ) );
|
|
} else {
|
|
--remaining;
|
|
}
|
|
}
|
|
}
|
|
|
|
// If we're not waiting on anything, resolve the master
|
|
if ( !remaining ) {
|
|
deferred.resolveWith( resolveContexts, resolveValues );
|
|
}
|
|
|
|
return deferred.promise();
|
|
}
|
|
});
|
|
|
|
|
|
// The deferred used on DOM ready
|
|
var readyList;
|
|
|
|
jQuery.fn.ready = function( fn ) {
|
|
// Add the callback
|
|
jQuery.ready.promise().done( fn );
|
|
|
|
return this;
|
|
};
|
|
|
|
jQuery.extend({
|
|
// Is the DOM ready to be used? Set to true once it occurs.
|
|
isReady: false,
|
|
|
|
// A counter to track how many items to wait for before
|
|
// the ready event fires. See #6781
|
|
readyWait: 1,
|
|
|
|
// Hold (or release) the ready event
|
|
holdReady: function( hold ) {
|
|
if ( hold ) {
|
|
jQuery.readyWait++;
|
|
} else {
|
|
jQuery.ready( true );
|
|
}
|
|
},
|
|
|
|
// Handle when the DOM is ready
|
|
ready: function( wait ) {
|
|
|
|
// Abort if there are pending holds or we're already ready
|
|
if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) {
|
|
return;
|
|
}
|
|
|
|
// Remember that the DOM is ready
|
|
jQuery.isReady = true;
|
|
|
|
// If a normal DOM Ready event fired, decrement, and wait if need be
|
|
if ( wait !== true && --jQuery.readyWait > 0 ) {
|
|
return;
|
|
}
|
|
|
|
// If there are functions bound, to execute
|
|
readyList.resolveWith( document, [ jQuery ] );
|
|
|
|
// Trigger any bound ready events
|
|
if ( jQuery.fn.triggerHandler ) {
|
|
jQuery( document ).triggerHandler( "ready" );
|
|
jQuery( document ).off( "ready" );
|
|
}
|
|
}
|
|
});
|
|
|
|
/**
|
|
* The ready event handler and self cleanup method
|
|
*/
|
|
function completed() {
|
|
document.removeEventListener( "DOMContentLoaded", completed, false );
|
|
window.removeEventListener( "load", completed, false );
|
|
jQuery.ready();
|
|
}
|
|
|
|
jQuery.ready.promise = function( obj ) {
|
|
if ( !readyList ) {
|
|
|
|
readyList = jQuery.Deferred();
|
|
|
|
// Catch cases where $(document).ready() is called after the browser event has already occurred.
|
|
// We once tried to use readyState "interactive" here, but it caused issues like the one
|
|
// discovered by ChrisS here: http://bugs.jquery.com/ticket/12282#comment:15
|
|
if ( document.readyState === "complete" ) {
|
|
// Handle it asynchronously to allow scripts the opportunity to delay ready
|
|
setTimeout( jQuery.ready );
|
|
|
|
} else {
|
|
|
|
// Use the handy event callback
|
|
document.addEventListener( "DOMContentLoaded", completed, false );
|
|
|
|
// A fallback to window.onload, that will always work
|
|
window.addEventListener( "load", completed, false );
|
|
}
|
|
}
|
|
return readyList.promise( obj );
|
|
};
|
|
|
|
// Kick off the DOM ready check even if the user does not
|
|
jQuery.ready.promise();
|
|
|
|
|
|
|
|
|
|
// Multifunctional method to get and set values of a collection
|
|
// The value/s can optionally be executed if it's a function
|
|
var access = jQuery.access = function( elems, fn, key, value, chainable, emptyGet, raw ) {
|
|
var i = 0,
|
|
len = elems.length,
|
|
bulk = key == null;
|
|
|
|
// Sets many values
|
|
if ( jQuery.type( key ) === "object" ) {
|
|
chainable = true;
|
|
for ( i in key ) {
|
|
jQuery.access( elems, fn, i, key[i], true, emptyGet, raw );
|
|
}
|
|
|
|
// Sets one value
|
|
} else if ( value !== undefined ) {
|
|
chainable = true;
|
|
|
|
if ( !jQuery.isFunction( value ) ) {
|
|
raw = true;
|
|
}
|
|
|
|
if ( bulk ) {
|
|
// Bulk operations run against the entire set
|
|
if ( raw ) {
|
|
fn.call( elems, value );
|
|
fn = null;
|
|
|
|
// ...except when executing function values
|
|
} else {
|
|
bulk = fn;
|
|
fn = function( elem, key, value ) {
|
|
return bulk.call( jQuery( elem ), value );
|
|
};
|
|
}
|
|
}
|
|
|
|
if ( fn ) {
|
|
for ( ; i < len; i++ ) {
|
|
fn( elems[i], key, raw ? value : value.call( elems[i], i, fn( elems[i], key ) ) );
|
|
}
|
|
}
|
|
}
|
|
|
|
return chainable ?
|
|
elems :
|
|
|
|
// Gets
|
|
bulk ?
|
|
fn.call( elems ) :
|
|
len ? fn( elems[0], key ) : emptyGet;
|
|
};
|
|
|
|
|
|
/**
|
|
* Determines whether an object can have data
|
|
*/
|
|
jQuery.acceptData = function( owner ) {
|
|
// Accepts only:
|
|
// - Node
|
|
// - Node.ELEMENT_NODE
|
|
// - Node.DOCUMENT_NODE
|
|
// - Object
|
|
// - Any
|
|
/* jshint -W018 */
|
|
return owner.nodeType === 1 || owner.nodeType === 9 || !( +owner.nodeType );
|
|
};
|
|
|
|
|
|
function Data() {
|
|
// Support: Android<4,
|
|
// Old WebKit does not have Object.preventExtensions/freeze method,
|
|
// return new empty object instead with no [[set]] accessor
|
|
Object.defineProperty( this.cache = {}, 0, {
|
|
get: function() {
|
|
return {};
|
|
}
|
|
});
|
|
|
|
this.expando = jQuery.expando + Data.uid++;
|
|
}
|
|
|
|
Data.uid = 1;
|
|
Data.accepts = jQuery.acceptData;
|
|
|
|
Data.prototype = {
|
|
key: function( owner ) {
|
|
// We can accept data for non-element nodes in modern browsers,
|
|
// but we should not, see #8335.
|
|
// Always return the key for a frozen object.
|
|
if ( !Data.accepts( owner ) ) {
|
|
return 0;
|
|
}
|
|
|
|
var descriptor = {},
|
|
// Check if the owner object already has a cache key
|
|
unlock = owner[ this.expando ];
|
|
|
|
// If not, create one
|
|
if ( !unlock ) {
|
|
unlock = Data.uid++;
|
|
|
|
// Secure it in a non-enumerable, non-writable property
|
|
try {
|
|
descriptor[ this.expando ] = { value: unlock };
|
|
Object.defineProperties( owner, descriptor );
|
|
|
|
// Support: Android<4
|
|
// Fallback to a less secure definition
|
|
} catch ( e ) {
|
|
descriptor[ this.expando ] = unlock;
|
|
jQuery.extend( owner, descriptor );
|
|
}
|
|
}
|
|
|
|
// Ensure the cache object
|
|
if ( !this.cache[ unlock ] ) {
|
|
this.cache[ unlock ] = {};
|
|
}
|
|
|
|
return unlock;
|
|
},
|
|
set: function( owner, data, value ) {
|
|
var prop,
|
|
// There may be an unlock assigned to this node,
|
|
// if there is no entry for this "owner", create one inline
|
|
// and set the unlock as though an owner entry had always existed
|
|
unlock = this.key( owner ),
|
|
cache = this.cache[ unlock ];
|
|
|
|
// Handle: [ owner, key, value ] args
|
|
if ( typeof data === "string" ) {
|
|
cache[ data ] = value;
|
|
|
|
// Handle: [ owner, { properties } ] args
|
|
} else {
|
|
// Fresh assignments by object are shallow copied
|
|
if ( jQuery.isEmptyObject( cache ) ) {
|
|
jQuery.extend( this.cache[ unlock ], data );
|
|
// Otherwise, copy the properties one-by-one to the cache object
|
|
} else {
|
|
for ( prop in data ) {
|
|
cache[ prop ] = data[ prop ];
|
|
}
|
|
}
|
|
}
|
|
return cache;
|
|
},
|
|
get: function( owner, key ) {
|
|
// Either a valid cache is found, or will be created.
|
|
// New caches will be created and the unlock returned,
|
|
// allowing direct access to the newly created
|
|
// empty data object. A valid owner object must be provided.
|
|
var cache = this.cache[ this.key( owner ) ];
|
|
|
|
return key === undefined ?
|
|
cache : cache[ key ];
|
|
},
|
|
access: function( owner, key, value ) {
|
|
var stored;
|
|
// In cases where either:
|
|
//
|
|
// 1. No key was specified
|
|
// 2. A string key was specified, but no value provided
|
|
//
|
|
// Take the "read" path and allow the get method to determine
|
|
// which value to return, respectively either:
|
|
//
|
|
// 1. The entire cache object
|
|
// 2. The data stored at the key
|
|
//
|
|
if ( key === undefined ||
|
|
((key && typeof key === "string") && value === undefined) ) {
|
|
|
|
stored = this.get( owner, key );
|
|
|
|
return stored !== undefined ?
|
|
stored : this.get( owner, jQuery.camelCase(key) );
|
|
}
|
|
|
|
// [*]When the key is not a string, or both a key and value
|
|
// are specified, set or extend (existing objects) with either:
|
|
//
|
|
// 1. An object of properties
|
|
// 2. A key and value
|
|
//
|
|
this.set( owner, key, value );
|
|
|
|
// Since the "set" path can have two possible entry points
|
|
// return the expected data based on which path was taken[*]
|
|
return value !== undefined ? value : key;
|
|
},
|
|
remove: function( owner, key ) {
|
|
var i, name, camel,
|
|
unlock = this.key( owner ),
|
|
cache = this.cache[ unlock ];
|
|
|
|
if ( key === undefined ) {
|
|
this.cache[ unlock ] = {};
|
|
|
|
} else {
|
|
// Support array or space separated string of keys
|
|
if ( jQuery.isArray( key ) ) {
|
|
// If "name" is an array of keys...
|
|
// When data is initially created, via ("key", "val") signature,
|
|
// keys will be converted to camelCase.
|
|
// Since there is no way to tell _how_ a key was added, remove
|
|
// both plain key and camelCase key. #12786
|
|
// This will only penalize the array argument path.
|
|
name = key.concat( key.map( jQuery.camelCase ) );
|
|
} else {
|
|
camel = jQuery.camelCase( key );
|
|
// Try the string as a key before any manipulation
|
|
if ( key in cache ) {
|
|
name = [ key, camel ];
|
|
} else {
|
|
// If a key with the spaces exists, use it.
|
|
// Otherwise, create an array by matching non-whitespace
|
|
name = camel;
|
|
name = name in cache ?
|
|
[ name ] : ( name.match( rnotwhite ) || [] );
|
|
}
|
|
}
|
|
|
|
i = name.length;
|
|
while ( i-- ) {
|
|
delete cache[ name[ i ] ];
|
|
}
|
|
}
|
|
},
|
|
hasData: function( owner ) {
|
|
return !jQuery.isEmptyObject(
|
|
this.cache[ owner[ this.expando ] ] || {}
|
|
);
|
|
},
|
|
discard: function( owner ) {
|
|
if ( owner[ this.expando ] ) {
|
|
delete this.cache[ owner[ this.expando ] ];
|
|
}
|
|
}
|
|
};
|
|
var data_priv = new Data();
|
|
|
|
var data_user = new Data();
|
|
|
|
|
|
|
|
// Implementation Summary
|
|
//
|
|
// 1. Enforce API surface and semantic compatibility with 1.9.x branch
|
|
// 2. Improve the module's maintainability by reducing the storage
|
|
// paths to a single mechanism.
|
|
// 3. Use the same single mechanism to support "private" and "user" data.
|
|
// 4. _Never_ expose "private" data to user code (TODO: Drop _data, _removeData)
|
|
// 5. Avoid exposing implementation details on user objects (eg. expando properties)
|
|
// 6. Provide a clear path for implementation upgrade to WeakMap in 2014
|
|
|
|
var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,
|
|
rmultiDash = /([A-Z])/g;
|
|
|
|
function dataAttr( elem, key, data ) {
|
|
var name;
|
|
|
|
// If nothing was found internally, try to fetch any
|
|
// data from the HTML5 data-* attribute
|
|
if ( data === undefined && elem.nodeType === 1 ) {
|
|
name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase();
|
|
data = elem.getAttribute( name );
|
|
|
|
if ( typeof data === "string" ) {
|
|
try {
|
|
data = data === "true" ? true :
|
|
data === "false" ? false :
|
|
data === "null" ? null :
|
|
// Only convert to a number if it doesn't change the string
|
|
+data + "" === data ? +data :
|
|
rbrace.test( data ) ? jQuery.parseJSON( data ) :
|
|
data;
|
|
} catch( e ) {}
|
|
|
|
// Make sure we set the data so it isn't changed later
|
|
data_user.set( elem, key, data );
|
|
} else {
|
|
data = undefined;
|
|
}
|
|
}
|
|
return data;
|
|
}
|
|
|
|
jQuery.extend({
|
|
hasData: function( elem ) {
|
|
return data_user.hasData( elem ) || data_priv.hasData( elem );
|
|
},
|
|
|
|
data: function( elem, name, data ) {
|
|
return data_user.access( elem, name, data );
|
|
},
|
|
|
|
removeData: function( elem, name ) {
|
|
data_user.remove( elem, name );
|
|
},
|
|
|
|
// TODO: Now that all calls to _data and _removeData have been replaced
|
|
// with direct calls to data_priv methods, these can be deprecated.
|
|
_data: function( elem, name, data ) {
|
|
return data_priv.access( elem, name, data );
|
|
},
|
|
|
|
_removeData: function( elem, name ) {
|
|
data_priv.remove( elem, name );
|
|
}
|
|
});
|
|
|
|
jQuery.fn.extend({
|
|
data: function( key, value ) {
|
|
var i, name, data,
|
|
elem = this[ 0 ],
|
|
attrs = elem && elem.attributes;
|
|
|
|
// Gets all values
|
|
if ( key === undefined ) {
|
|
if ( this.length ) {
|
|
data = data_user.get( elem );
|
|
|
|
if ( elem.nodeType === 1 && !data_priv.get( elem, "hasDataAttrs" ) ) {
|
|
i = attrs.length;
|
|
while ( i-- ) {
|
|
|
|
// Support: IE11+
|
|
// The attrs elements can be null (#14894)
|
|
if ( attrs[ i ] ) {
|
|
name = attrs[ i ].name;
|
|
if ( name.indexOf( "data-" ) === 0 ) {
|
|
name = jQuery.camelCase( name.slice(5) );
|
|
dataAttr( elem, name, data[ name ] );
|
|
}
|
|
}
|
|
}
|
|
data_priv.set( elem, "hasDataAttrs", true );
|
|
}
|
|
}
|
|
|
|
return data;
|
|
}
|
|
|
|
// Sets multiple values
|
|
if ( typeof key === "object" ) {
|
|
return this.each(function() {
|
|
data_user.set( this, key );
|
|
});
|
|
}
|
|
|
|
return access( this, function( value ) {
|
|
var data,
|
|
camelKey = jQuery.camelCase( key );
|
|
|
|
// The calling jQuery object (element matches) is not empty
|
|
// (and therefore has an element appears at this[ 0 ]) and the
|
|
// `value` parameter was not undefined. An empty jQuery object
|
|
// will result in `undefined` for elem = this[ 0 ] which will
|
|
// throw an exception if an attempt to read a data cache is made.
|
|
if ( elem && value === undefined ) {
|
|
// Attempt to get data from the cache
|
|
// with the key as-is
|
|
data = data_user.get( elem, key );
|
|
if ( data !== undefined ) {
|
|
return data;
|
|
}
|
|
|
|
// Attempt to get data from the cache
|
|
// with the key camelized
|
|
data = data_user.get( elem, camelKey );
|
|
if ( data !== undefined ) {
|
|
return data;
|
|
}
|
|
|
|
// Attempt to "discover" the data in
|
|
// HTML5 custom data-* attrs
|
|
data = dataAttr( elem, camelKey, undefined );
|
|
if ( data !== undefined ) {
|
|
return data;
|
|
}
|
|
|
|
// We tried really hard, but the data doesn't exist.
|
|
return;
|
|
}
|
|
|
|
// Set the data...
|
|
this.each(function() {
|
|
// First, attempt to store a copy or reference of any
|
|
// data that might've been store with a camelCased key.
|
|
var data = data_user.get( this, camelKey );
|
|
|
|
// For HTML5 data-* attribute interop, we have to
|
|
// store property names with dashes in a camelCase form.
|
|
// This might not apply to all properties...*
|
|
data_user.set( this, camelKey, value );
|
|
|
|
// *... In the case of properties that might _actually_
|
|
// have dashes, we need to also store a copy of that
|
|
// unchanged property.
|
|
if ( key.indexOf("-") !== -1 && data !== undefined ) {
|
|
data_user.set( this, key, value );
|
|
}
|
|
});
|
|
}, null, value, arguments.length > 1, null, true );
|
|
},
|
|
|
|
removeData: function( key ) {
|
|
return this.each(function() {
|
|
data_user.remove( this, key );
|
|
});
|
|
}
|
|
});
|
|
|
|
|
|
jQuery.extend({
|
|
queue: function( elem, type, data ) {
|
|
var queue;
|
|
|
|
if ( elem ) {
|
|
type = ( type || "fx" ) + "queue";
|
|
queue = data_priv.get( elem, type );
|
|
|
|
// Speed up dequeue by getting out quickly if this is just a lookup
|
|
if ( data ) {
|
|
if ( !queue || jQuery.isArray( data ) ) {
|
|
queue = data_priv.access( elem, type, jQuery.makeArray(data) );
|
|
} else {
|
|
queue.push( data );
|
|
}
|
|
}
|
|
return queue || [];
|
|
}
|
|
},
|
|
|
|
dequeue: function( elem, type ) {
|
|
type = type || "fx";
|
|
|
|
var queue = jQuery.queue( elem, type ),
|
|
startLength = queue.length,
|
|
fn = queue.shift(),
|
|
hooks = jQuery._queueHooks( elem, type ),
|
|
next = function() {
|
|
jQuery.dequeue( elem, type );
|
|
};
|
|
|
|
// If the fx queue is dequeued, always remove the progress sentinel
|
|
if ( fn === "inprogress" ) {
|
|
fn = queue.shift();
|
|
startLength--;
|
|
}
|
|
|
|
if ( fn ) {
|
|
|
|
// Add a progress sentinel to prevent the fx queue from being
|
|
// automatically dequeued
|
|
if ( type === "fx" ) {
|
|
queue.unshift( "inprogress" );
|
|
}
|
|
|
|
// Clear up the last queue stop function
|
|
delete hooks.stop;
|
|
fn.call( elem, next, hooks );
|
|
}
|
|
|
|
if ( !startLength && hooks ) {
|
|
hooks.empty.fire();
|
|
}
|
|
},
|
|
|
|
// Not public - generate a queueHooks object, or return the current one
|
|
_queueHooks: function( elem, type ) {
|
|
var key = type + "queueHooks";
|
|
return data_priv.get( elem, key ) || data_priv.access( elem, key, {
|
|
empty: jQuery.Callbacks("once memory").add(function() {
|
|
data_priv.remove( elem, [ type + "queue", key ] );
|
|
})
|
|
});
|
|
}
|
|
});
|
|
|
|
jQuery.fn.extend({
|
|
queue: function( type, data ) {
|
|
var setter = 2;
|
|
|
|
if ( typeof type !== "string" ) {
|
|
data = type;
|
|
type = "fx";
|
|
setter--;
|
|
}
|
|
|
|
if ( arguments.length < setter ) {
|
|
return jQuery.queue( this[0], type );
|
|
}
|
|
|
|
return data === undefined ?
|
|
this :
|
|
this.each(function() {
|
|
var queue = jQuery.queue( this, type, data );
|
|
|
|
// Ensure a hooks for this queue
|
|
jQuery._queueHooks( this, type );
|
|
|
|
if ( type === "fx" && queue[0] !== "inprogress" ) {
|
|
jQuery.dequeue( this, type );
|
|
}
|
|
});
|
|
},
|
|
dequeue: function( type ) {
|
|
return this.each(function() {
|
|
jQuery.dequeue( this, type );
|
|
});
|
|
},
|
|
clearQueue: function( type ) {
|
|
return this.queue( type || "fx", [] );
|
|
},
|
|
// Get a promise resolved when queues of a certain type
|
|
// are emptied (fx is the type by default)
|
|
promise: function( type, obj ) {
|
|
var tmp,
|
|
count = 1,
|
|
defer = jQuery.Deferred(),
|
|
elements = this,
|
|
i = this.length,
|
|
resolve = function() {
|
|
if ( !( --count ) ) {
|
|
defer.resolveWith( elements, [ elements ] );
|
|
}
|
|
};
|
|
|
|
if ( typeof type !== "string" ) {
|
|
obj = type;
|
|
type = undefined;
|
|
}
|
|
type = type || "fx";
|
|
|
|
while ( i-- ) {
|
|
tmp = data_priv.get( elements[ i ], type + "queueHooks" );
|
|
if ( tmp && tmp.empty ) {
|
|
count++;
|
|
tmp.empty.add( resolve );
|
|
}
|
|
}
|
|
resolve();
|
|
return defer.promise( obj );
|
|
}
|
|
});
|
|
var pnum = (/[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/).source;
|
|
|
|
var cssExpand = [ "Top", "Right", "Bottom", "Left" ];
|
|
|
|
var isHidden = function( elem, el ) {
|
|
// isHidden might be called from jQuery#filter function;
|
|
// in that case, element will be second argument
|
|
elem = el || elem;
|
|
return jQuery.css( elem, "display" ) === "none" || !jQuery.contains( elem.ownerDocument, elem );
|
|
};
|
|
|
|
var rcheckableType = (/^(?:checkbox|radio)$/i);
|
|
|
|
|
|
|
|
(function() {
|
|
var fragment = document.createDocumentFragment(),
|
|
div = fragment.appendChild( document.createElement( "div" ) ),
|
|
input = document.createElement( "input" );
|
|
|
|
// Support: Safari<=5.1
|
|
// Check state lost if the name is set (#11217)
|
|
// Support: Windows Web Apps (WWA)
|
|
// `name` and `type` must use .setAttribute for WWA (#14901)
|
|
input.setAttribute( "type", "radio" );
|
|
input.setAttribute( "checked", "checked" );
|
|
input.setAttribute( "name", "t" );
|
|
|
|
div.appendChild( input );
|
|
|
|
// Support: Safari<=5.1, Android<4.2
|
|
// Older WebKit doesn't clone checked state correctly in fragments
|
|
support.checkClone = div.cloneNode( true ).cloneNode( true ).lastChild.checked;
|
|
|
|
// Support: IE<=11+
|
|
// Make sure textarea (and checkbox) defaultValue is properly cloned
|
|
div.innerHTML = "<textarea>x</textarea>";
|
|
support.noCloneChecked = !!div.cloneNode( true ).lastChild.defaultValue;
|
|
})();
|
|
var strundefined = typeof undefined;
|
|
|
|
|
|
|
|
support.focusinBubbles = "onfocusin" in window;
|
|
|
|
|
|
var
|
|
rkeyEvent = /^key/,
|
|
rmouseEvent = /^(?:mouse|pointer|contextmenu)|click/,
|
|
rfocusMorph = /^(?:focusinfocus|focusoutblur)$/,
|
|
rtypenamespace = /^([^.]*)(?:\.(.+)|)$/;
|
|
|
|
function returnTrue() {
|
|
return true;
|
|
}
|
|
|
|
function returnFalse() {
|
|
return false;
|
|
}
|
|
|
|
function safeActiveElement() {
|
|
try {
|
|
return document.activeElement;
|
|
} catch ( err ) { }
|
|
}
|
|
|
|
/*
|
|
* Helper functions for managing events -- not part of the public interface.
|
|
* Props to Dean Edwards' addEvent library for many of the ideas.
|
|
*/
|
|
jQuery.event = {
|
|
|
|
global: {},
|
|
|
|
add: function( elem, types, handler, data, selector ) {
|
|
|
|
var handleObjIn, eventHandle, tmp,
|
|
events, t, handleObj,
|
|
special, handlers, type, namespaces, origType,
|
|
elemData = data_priv.get( elem );
|
|
|
|
// Don't attach events to noData or text/comment nodes (but allow plain objects)
|
|
if ( !elemData ) {
|
|
return;
|
|
}
|
|
|
|
// Caller can pass in an object of custom data in lieu of the handler
|
|
if ( handler.handler ) {
|
|
handleObjIn = handler;
|
|
handler = handleObjIn.handler;
|
|
selector = handleObjIn.selector;
|
|
}
|
|
|
|
// Make sure that the handler has a unique ID, used to find/remove it later
|
|
if ( !handler.guid ) {
|
|
handler.guid = jQuery.guid++;
|
|
}
|
|
|
|
// Init the element's event structure and main handler, if this is the first
|
|
if ( !(events = elemData.events) ) {
|
|
events = elemData.events = {};
|
|
}
|
|
if ( !(eventHandle = elemData.handle) ) {
|
|
eventHandle = elemData.handle = function( e ) {
|
|
// Discard the second event of a jQuery.event.trigger() and
|
|
// when an event is called after a page has unloaded
|
|
return typeof jQuery !== strundefined && jQuery.event.triggered !== e.type ?
|
|
jQuery.event.dispatch.apply( elem, arguments ) : undefined;
|
|
};
|
|
}
|
|
|
|
// Handle multiple events separated by a space
|
|
types = ( types || "" ).match( rnotwhite ) || [ "" ];
|
|
t = types.length;
|
|
while ( t-- ) {
|
|
tmp = rtypenamespace.exec( types[t] ) || [];
|
|
type = origType = tmp[1];
|
|
namespaces = ( tmp[2] || "" ).split( "." ).sort();
|
|
|
|
// There *must* be a type, no attaching namespace-only handlers
|
|
if ( !type ) {
|
|
continue;
|
|
}
|
|
|
|
// If event changes its type, use the special event handlers for the changed type
|
|
special = jQuery.event.special[ type ] || {};
|
|
|
|
// If selector defined, determine special event api type, otherwise given type
|
|
type = ( selector ? special.delegateType : special.bindType ) || type;
|
|
|
|
// Update special based on newly reset type
|
|
special = jQuery.event.special[ type ] || {};
|
|
|
|
// handleObj is passed to all event handlers
|
|
handleObj = jQuery.extend({
|
|
type: type,
|
|
origType: origType,
|
|
data: data,
|
|
handler: handler,
|
|
guid: handler.guid,
|
|
selector: selector,
|
|
needsContext: selector && jQuery.expr.match.needsContext.test( selector ),
|
|
namespace: namespaces.join(".")
|
|
}, handleObjIn );
|
|
|
|
// Init the event handler queue if we're the first
|
|
if ( !(handlers = events[ type ]) ) {
|
|
handlers = events[ type ] = [];
|
|
handlers.delegateCount = 0;
|
|
|
|
// Only use addEventListener if the special events handler returns false
|
|
if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) {
|
|
if ( elem.addEventListener ) {
|
|
elem.addEventListener( type, eventHandle, false );
|
|
}
|
|
}
|
|
}
|
|
|
|
if ( special.add ) {
|
|
special.add.call( elem, handleObj );
|
|
|
|
if ( !handleObj.handler.guid ) {
|
|
handleObj.handler.guid = handler.guid;
|
|
}
|
|
}
|
|
|
|
// Add to the element's handler list, delegates in front
|
|
if ( selector ) {
|
|
handlers.splice( handlers.delegateCount++, 0, handleObj );
|
|
} else {
|
|
handlers.push( handleObj );
|
|
}
|
|
|
|
// Keep track of which events have ever been used, for event optimization
|
|
jQuery.event.global[ type ] = true;
|
|
}
|
|
|
|
},
|
|
|
|
// Detach an event or set of events from an element
|
|
remove: function( elem, types, handler, selector, mappedTypes ) {
|
|
|
|
var j, origCount, tmp,
|
|
events, t, handleObj,
|
|
special, handlers, type, namespaces, origType,
|
|
elemData = data_priv.hasData( elem ) && data_priv.get( elem );
|
|
|
|
if ( !elemData || !(events = elemData.events) ) {
|
|
return;
|
|
}
|
|
|
|
// Once for each type.namespace in types; type may be omitted
|
|
types = ( types || "" ).match( rnotwhite ) || [ "" ];
|
|
t = types.length;
|
|
while ( t-- ) {
|
|
tmp = rtypenamespace.exec( types[t] ) || [];
|
|
type = origType = tmp[1];
|
|
namespaces = ( tmp[2] || "" ).split( "." ).sort();
|
|
|
|
// Unbind all events (on this namespace, if provided) for the element
|
|
if ( !type ) {
|
|
for ( type in events ) {
|
|
jQuery.event.remove( elem, type + types[ t ], handler, selector, true );
|
|
}
|
|
continue;
|
|
}
|
|
|
|
special = jQuery.event.special[ type ] || {};
|
|
type = ( selector ? special.delegateType : special.bindType ) || type;
|
|
handlers = events[ type ] || [];
|
|
tmp = tmp[2] && new RegExp( "(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)" );
|
|
|
|
// Remove matching events
|
|
origCount = j = handlers.length;
|
|
while ( j-- ) {
|
|
handleObj = handlers[ j ];
|
|
|
|
if ( ( mappedTypes || origType === handleObj.origType ) &&
|
|
( !handler || handler.guid === handleObj.guid ) &&
|
|
( !tmp || tmp.test( handleObj.namespace ) ) &&
|
|
( !selector || selector === handleObj.selector || selector === "**" && handleObj.selector ) ) {
|
|
handlers.splice( j, 1 );
|
|
|
|
if ( handleObj.selector ) {
|
|
handlers.delegateCount--;
|
|
}
|
|
if ( special.remove ) {
|
|
special.remove.call( elem, handleObj );
|
|
}
|
|
}
|
|
}
|
|
|
|
// Remove generic event handler if we removed something and no more handlers exist
|
|
// (avoids potential for endless recursion during removal of special event handlers)
|
|
if ( origCount && !handlers.length ) {
|
|
if ( !special.teardown || special.teardown.call( elem, namespaces, elemData.handle ) === false ) {
|
|
jQuery.removeEvent( elem, type, elemData.handle );
|
|
}
|
|
|
|
delete events[ type ];
|
|
}
|
|
}
|
|
|
|
// Remove the expando if it's no longer used
|
|
if ( jQuery.isEmptyObject( events ) ) {
|
|
delete elemData.handle;
|
|
data_priv.remove( elem, "events" );
|
|
}
|
|
},
|
|
|
|
trigger: function( event, data, elem, onlyHandlers ) {
|
|
|
|
var i, cur, tmp, bubbleType, ontype, handle, special,
|
|
eventPath = [ elem || document ],
|
|
type = hasOwn.call( event, "type" ) ? event.type : event,
|
|
namespaces = hasOwn.call( event, "namespace" ) ? event.namespace.split(".") : [];
|
|
|
|
cur = tmp = elem = elem || document;
|
|
|
|
// Don't do events on text and comment nodes
|
|
if ( elem.nodeType === 3 || elem.nodeType === 8 ) {
|
|
return;
|
|
}
|
|
|
|
// focus/blur morphs to focusin/out; ensure we're not firing them right now
|
|
if ( rfocusMorph.test( type + jQuery.event.triggered ) ) {
|
|
return;
|
|
}
|
|
|
|
if ( type.indexOf(".") >= 0 ) {
|
|
// Namespaced trigger; create a regexp to match event type in handle()
|
|
namespaces = type.split(".");
|
|
type = namespaces.shift();
|
|
namespaces.sort();
|
|
}
|
|
ontype = type.indexOf(":") < 0 && "on" + type;
|
|
|
|
// Caller can pass in a jQuery.Event object, Object, or just an event type string
|
|
event = event[ jQuery.expando ] ?
|
|
event :
|
|
new jQuery.Event( type, typeof event === "object" && event );
|
|
|
|
// Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true)
|
|
event.isTrigger = onlyHandlers ? 2 : 3;
|
|
event.namespace = namespaces.join(".");
|
|
event.namespace_re = event.namespace ?
|
|
new RegExp( "(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)" ) :
|
|
null;
|
|
|
|
// Clean up the event in case it is being reused
|
|
event.result = undefined;
|
|
if ( !event.target ) {
|
|
event.target = elem;
|
|
}
|
|
|
|
// Clone any incoming data and prepend the event, creating the handler arg list
|
|
data = data == null ?
|
|
[ event ] :
|
|
jQuery.makeArray( data, [ event ] );
|
|
|
|
// Allow special events to draw outside the lines
|
|
special = jQuery.event.special[ type ] || {};
|
|
if ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) {
|
|
return;
|
|
}
|
|
|
|
// Determine event propagation path in advance, per W3C events spec (#9951)
|
|
// Bubble up to document, then to window; watch for a global ownerDocument var (#9724)
|
|
if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) {
|
|
|
|
bubbleType = special.delegateType || type;
|
|
if ( !rfocusMorph.test( bubbleType + type ) ) {
|
|
cur = cur.parentNode;
|
|
}
|
|
for ( ; cur; cur = cur.parentNode ) {
|
|
eventPath.push( cur );
|
|
tmp = cur;
|
|
}
|
|
|
|
// Only add window if we got to document (e.g., not plain obj or detached DOM)
|
|
if ( tmp === (elem.ownerDocument || document) ) {
|
|
eventPath.push( tmp.defaultView || tmp.parentWindow || window );
|
|
}
|
|
}
|
|
|
|
// Fire handlers on the event path
|
|
i = 0;
|
|
while ( (cur = eventPath[i++]) && !event.isPropagationStopped() ) {
|
|
|
|
event.type = i > 1 ?
|
|
bubbleType :
|
|
special.bindType || type;
|
|
|
|
// jQuery handler
|
|
handle = ( data_priv.get( cur, "events" ) || {} )[ event.type ] && data_priv.get( cur, "handle" );
|
|
if ( handle ) {
|
|
handle.apply( cur, data );
|
|
}
|
|
|
|
// Native handler
|
|
handle = ontype && cur[ ontype ];
|
|
if ( handle && handle.apply && jQuery.acceptData( cur ) ) {
|
|
event.result = handle.apply( cur, data );
|
|
if ( event.result === false ) {
|
|
event.preventDefault();
|
|
}
|
|
}
|
|
}
|
|
event.type = type;
|
|
|
|
// If nobody prevented the default action, do it now
|
|
if ( !onlyHandlers && !event.isDefaultPrevented() ) {
|
|
|
|
if ( (!special._default || special._default.apply( eventPath.pop(), data ) === false) &&
|
|
jQuery.acceptData( elem ) ) {
|
|
|
|
// Call a native DOM method on the target with the same name name as the event.
|
|
// Don't do default actions on window, that's where global variables be (#6170)
|
|
if ( ontype && jQuery.isFunction( elem[ type ] ) && !jQuery.isWindow( elem ) ) {
|
|
|
|
// Don't re-trigger an onFOO event when we call its FOO() method
|
|
tmp = elem[ ontype ];
|
|
|
|
if ( tmp ) {
|
|
elem[ ontype ] = null;
|
|
}
|
|
|
|
// Prevent re-triggering of the same event, since we already bubbled it above
|
|
jQuery.event.triggered = type;
|
|
elem[ type ]();
|
|
jQuery.event.triggered = undefined;
|
|
|
|
if ( tmp ) {
|
|
elem[ ontype ] = tmp;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
return event.result;
|
|
},
|
|
|
|
dispatch: function( event ) {
|
|
|
|
// Make a writable jQuery.Event from the native event object
|
|
event = jQuery.event.fix( event );
|
|
|
|
var i, j, ret, matched, handleObj,
|
|
handlerQueue = [],
|
|
args = slice.call( arguments ),
|
|
handlers = ( data_priv.get( this, "events" ) || {} )[ event.type ] || [],
|
|
special = jQuery.event.special[ event.type ] || {};
|
|
|
|
// Use the fix-ed jQuery.Event rather than the (read-only) native event
|
|
args[0] = event;
|
|
event.delegateTarget = this;
|
|
|
|
// Call the preDispatch hook for the mapped type, and let it bail if desired
|
|
if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) {
|
|
return;
|
|
}
|
|
|
|
// Determine handlers
|
|
handlerQueue = jQuery.event.handlers.call( this, event, handlers );
|
|
|
|
// Run delegates first; they may want to stop propagation beneath us
|
|
i = 0;
|
|
while ( (matched = handlerQueue[ i++ ]) && !event.isPropagationStopped() ) {
|
|
event.currentTarget = matched.elem;
|
|
|
|
j = 0;
|
|
while ( (handleObj = matched.handlers[ j++ ]) && !event.isImmediatePropagationStopped() ) {
|
|
|
|
// Triggered event must either 1) have no namespace, or 2) have namespace(s)
|
|
// a subset or equal to those in the bound event (both can have no namespace).
|
|
if ( !event.namespace_re || event.namespace_re.test( handleObj.namespace ) ) {
|
|
|
|
event.handleObj = handleObj;
|
|
event.data = handleObj.data;
|
|
|
|
ret = ( (jQuery.event.special[ handleObj.origType ] || {}).handle || handleObj.handler )
|
|
.apply( matched.elem, args );
|
|
|
|
if ( ret !== undefined ) {
|
|
if ( (event.result = ret) === false ) {
|
|
event.preventDefault();
|
|
event.stopPropagation();
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
// Call the postDispatch hook for the mapped type
|
|
if ( special.postDispatch ) {
|
|
special.postDispatch.call( this, event );
|
|
}
|
|
|
|
return event.result;
|
|
},
|
|
|
|
handlers: function( event, handlers ) {
|
|
var i, matches, sel, handleObj,
|
|
handlerQueue = [],
|
|
delegateCount = handlers.delegateCount,
|
|
cur = event.target;
|
|
|
|
// Find delegate handlers
|
|
// Black-hole SVG <use> instance trees (#13180)
|
|
// Avoid non-left-click bubbling in Firefox (#3861)
|
|
if ( delegateCount && cur.nodeType && (!event.button || event.type !== "click") ) {
|
|
|
|
for ( ; cur !== this; cur = cur.parentNode || this ) {
|
|
|
|
// Don't process clicks on disabled elements (#6911, #8165, #11382, #11764)
|
|
if ( cur.disabled !== true || event.type !== "click" ) {
|
|
matches = [];
|
|
for ( i = 0; i < delegateCount; i++ ) {
|
|
handleObj = handlers[ i ];
|
|
|
|
// Don't conflict with Object.prototype properties (#13203)
|
|
sel = handleObj.selector + " ";
|
|
|
|
if ( matches[ sel ] === undefined ) {
|
|
matches[ sel ] = handleObj.needsContext ?
|
|
jQuery( sel, this ).index( cur ) >= 0 :
|
|
jQuery.find( sel, this, null, [ cur ] ).length;
|
|
}
|
|
if ( matches[ sel ] ) {
|
|
matches.push( handleObj );
|
|
}
|
|
}
|
|
if ( matches.length ) {
|
|
handlerQueue.push({ elem: cur, handlers: matches });
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
// Add the remaining (directly-bound) handlers
|
|
if ( delegateCount < handlers.length ) {
|
|
handlerQueue.push({ elem: this, handlers: handlers.slice( delegateCount ) });
|
|
}
|
|
|
|
return handlerQueue;
|
|
},
|
|
|
|
// Includes some event props shared by KeyEvent and MouseEvent
|
|
props: "altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),
|
|
|
|
fixHooks: {},
|
|
|
|
keyHooks: {
|
|
props: "char charCode key keyCode".split(" "),
|
|
filter: function( event, original ) {
|
|
|
|
// Add which for key events
|
|
if ( event.which == null ) {
|
|
event.which = original.charCode != null ? original.charCode : original.keyCode;
|
|
}
|
|
|
|
return event;
|
|
}
|
|
},
|
|
|
|
mouseHooks: {
|
|
props: "button buttons clientX clientY offsetX offsetY pageX pageY screenX screenY toElement".split(" "),
|
|
filter: function( event, original ) {
|
|
var eventDoc, doc, body,
|
|
button = original.button;
|
|
|
|
// Calculate pageX/Y if missing and clientX/Y available
|
|
if ( event.pageX == null && original.clientX != null ) {
|
|
eventDoc = event.target.ownerDocument || document;
|
|
doc = eventDoc.documentElement;
|
|
body = eventDoc.body;
|
|
|
|
event.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 );
|
|
event.pageY = original.clientY + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - ( doc && doc.clientTop || body && body.clientTop || 0 );
|
|
}
|
|
|
|
// Add which for click: 1 === left; 2 === middle; 3 === right
|
|
// Note: button is not normalized, so don't use it
|
|
if ( !event.which && button !== undefined ) {
|
|
event.which = ( button & 1 ? 1 : ( button & 2 ? 3 : ( button & 4 ? 2 : 0 ) ) );
|
|
}
|
|
|
|
return event;
|
|
}
|
|
},
|
|
|
|
fix: function( event ) {
|
|
if ( event[ jQuery.expando ] ) {
|
|
return event;
|
|
}
|
|
|
|
// Create a writable copy of the event object and normalize some properties
|
|
var i, prop, copy,
|
|
type = event.type,
|
|
originalEvent = event,
|
|
fixHook = this.fixHooks[ type ];
|
|
|
|
if ( !fixHook ) {
|
|
this.fixHooks[ type ] = fixHook =
|
|
rmouseEvent.test( type ) ? this.mouseHooks :
|
|
rkeyEvent.test( type ) ? this.keyHooks :
|
|
{};
|
|
}
|
|
copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props;
|
|
|
|
event = new jQuery.Event( originalEvent );
|
|
|
|
i = copy.length;
|
|
while ( i-- ) {
|
|
prop = copy[ i ];
|
|
event[ prop ] = originalEvent[ prop ];
|
|
}
|
|
|
|
// Support: Cordova 2.5 (WebKit) (#13255)
|
|
// All events should have a target; Cordova deviceready doesn't
|
|
if ( !event.target ) {
|
|
event.target = document;
|
|
}
|
|
|
|
// Support: Safari 6.0+, Chrome<28
|
|
// Target should not be a text node (#504, #13143)
|
|
if ( event.target.nodeType === 3 ) {
|
|
event.target = event.target.parentNode;
|
|
}
|
|
|
|
return fixHook.filter ? fixHook.filter( event, originalEvent ) : event;
|
|
},
|
|
|
|
special: {
|
|
load: {
|
|
// Prevent triggered image.load events from bubbling to window.load
|
|
noBubble: true
|
|
},
|
|
focus: {
|
|
// Fire native event if possible so blur/focus sequence is correct
|
|
trigger: function() {
|
|
if ( this !== safeActiveElement() && this.focus ) {
|
|
this.focus();
|
|
return false;
|
|
}
|
|
},
|
|
delegateType: "focusin"
|
|
},
|
|
blur: {
|
|
trigger: function() {
|
|
if ( this === safeActiveElement() && this.blur ) {
|
|
this.blur();
|
|
return false;
|
|
}
|
|
},
|
|
delegateType: "focusout"
|
|
},
|
|
click: {
|
|
// For checkbox, fire native event so checked state will be right
|
|
trigger: function() {
|
|
if ( this.type === "checkbox" && this.click && jQuery.nodeName( this, "input" ) ) {
|
|
this.click();
|
|
return false;
|
|
}
|
|
},
|
|
|
|
// For cross-browser consistency, don't fire native .click() on links
|
|
_default: function( event ) {
|
|
return jQuery.nodeName( event.target, "a" );
|
|
}
|
|
},
|
|
|
|
beforeunload: {
|
|
postDispatch: function( event ) {
|
|
|
|
// Support: Firefox 20+
|
|
// Firefox doesn't alert if the returnValue field is not set.
|
|
if ( event.result !== undefined && event.originalEvent ) {
|
|
event.originalEvent.returnValue = event.result;
|
|
}
|
|
}
|
|
}
|
|
},
|
|
|
|
simulate: function( type, elem, event, bubble ) {
|
|
// Piggyback on a donor event to simulate a different one.
|
|
// Fake originalEvent to avoid donor's stopPropagation, but if the
|
|
// simulated event prevents default then we do the same on the donor.
|
|
var e = jQuery.extend(
|
|
new jQuery.Event(),
|
|
event,
|
|
{
|
|
type: type,
|
|
isSimulated: true,
|
|
originalEvent: {}
|
|
}
|
|
);
|
|
if ( bubble ) {
|
|
jQuery.event.trigger( e, null, elem );
|
|
} else {
|
|
jQuery.event.dispatch.call( elem, e );
|
|
}
|
|
if ( e.isDefaultPrevented() ) {
|
|
event.preventDefault();
|
|
}
|
|
}
|
|
};
|
|
|
|
jQuery.removeEvent = function( elem, type, handle ) {
|
|
if ( elem.removeEventListener ) {
|
|
elem.removeEventListener( type, handle, false );
|
|
}
|
|
};
|
|
|
|
jQuery.Event = function( src, props ) {
|
|
// Allow instantiation without the 'new' keyword
|
|
if ( !(this instanceof jQuery.Event) ) {
|
|
return new jQuery.Event( src, props );
|
|
}
|
|
|
|
// Event object
|
|
if ( src && src.type ) {
|
|
this.originalEvent = src;
|
|
this.type = src.type;
|
|
|
|
// Events bubbling up the document may have been marked as prevented
|
|
// by a handler lower down the tree; reflect the correct value.
|
|
this.isDefaultPrevented = src.defaultPrevented ||
|
|
src.defaultPrevented === undefined &&
|
|
// Support: Android<4.0
|
|
src.returnValue === false ?
|
|
returnTrue :
|
|
returnFalse;
|
|
|
|
// Event type
|
|
} else {
|
|
this.type = src;
|
|
}
|
|
|
|
// Put explicitly provided properties onto the event object
|
|
if ( props ) {
|
|
jQuery.extend( this, props );
|
|
}
|
|
|
|
// Create a timestamp if incoming event doesn't have one
|
|
this.timeStamp = src && src.timeStamp || jQuery.now();
|
|
|
|
// Mark it as fixed
|
|
this[ jQuery.expando ] = true;
|
|
};
|
|
|
|
// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
|
|
// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
|
|
jQuery.Event.prototype = {
|
|
isDefaultPrevented: returnFalse,
|
|
isPropagationStopped: returnFalse,
|
|
isImmediatePropagationStopped: returnFalse,
|
|
|
|
preventDefault: function() {
|
|
var e = this.originalEvent;
|
|
|
|
this.isDefaultPrevented = returnTrue;
|
|
|
|
if ( e && e.preventDefault ) {
|
|
e.preventDefault();
|
|
}
|
|
},
|
|
stopPropagation: function() {
|
|
var e = this.originalEvent;
|
|
|
|
this.isPropagationStopped = returnTrue;
|
|
|
|
if ( e && e.stopPropagation ) {
|
|
e.stopPropagation();
|
|
}
|
|
},
|
|
stopImmediatePropagation: function() {
|
|
var e = this.originalEvent;
|
|
|
|
this.isImmediatePropagationStopped = returnTrue;
|
|
|
|
if ( e && e.stopImmediatePropagation ) {
|
|
e.stopImmediatePropagation();
|
|
}
|
|
|
|
this.stopPropagation();
|
|
}
|
|
};
|
|
|
|
// Create mouseenter/leave events using mouseover/out and event-time checks
|
|
// Support: Chrome 15+
|
|
jQuery.each({
|
|
mouseenter: "mouseover",
|
|
mouseleave: "mouseout",
|
|
pointerenter: "pointerover",
|
|
pointerleave: "pointerout"
|
|
}, function( orig, fix ) {
|
|
jQuery.event.special[ orig ] = {
|
|
delegateType: fix,
|
|
bindType: fix,
|
|
|
|
handle: function( event ) {
|
|
var ret,
|
|
target = this,
|
|
related = event.relatedTarget,
|
|
handleObj = event.handleObj;
|
|
|
|
// For mousenter/leave call the handler if related is outside the target.
|
|
// NB: No relatedTarget if the mouse left/entered the browser window
|
|
if ( !related || (related !== target && !jQuery.contains( target, related )) ) {
|
|
event.type = handleObj.origType;
|
|
ret = handleObj.handler.apply( this, arguments );
|
|
event.type = fix;
|
|
}
|
|
return ret;
|
|
}
|
|
};
|
|
});
|
|
|
|
// Support: Firefox, Chrome, Safari
|
|
// Create "bubbling" focus and blur events
|
|
if ( !support.focusinBubbles ) {
|
|
jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) {
|
|
|
|
// Attach a single capturing handler on the document while someone wants focusin/focusout
|
|
var handler = function( event ) {
|
|
jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ), true );
|
|
};
|
|
|
|
jQuery.event.special[ fix ] = {
|
|
setup: function() {
|
|
var doc = this.ownerDocument || this,
|
|
attaches = data_priv.access( doc, fix );
|
|
|
|
if ( !attaches ) {
|
|
doc.addEventListener( orig, handler, true );
|
|
}
|
|
data_priv.access( doc, fix, ( attaches || 0 ) + 1 );
|
|
},
|
|
teardown: function() {
|
|
var doc = this.ownerDocument || this,
|
|
attaches = data_priv.access( doc, fix ) - 1;
|
|
|
|
if ( !attaches ) {
|
|
doc.removeEventListener( orig, handler, true );
|
|
data_priv.remove( doc, fix );
|
|
|
|
} else {
|
|
data_priv.access( doc, fix, attaches );
|
|
}
|
|
}
|
|
};
|
|
});
|
|
}
|
|
|
|
jQuery.fn.extend({
|
|
|
|
on: function( types, selector, data, fn, /*INTERNAL*/ one ) {
|
|
var origFn, type;
|
|
|
|
// Types can be a map of types/handlers
|
|
if ( typeof types === "object" ) {
|
|
// ( types-Object, selector, data )
|
|
if ( typeof selector !== "string" ) {
|
|
// ( types-Object, data )
|
|
data = data || selector;
|
|
selector = undefined;
|
|
}
|
|
for ( type in types ) {
|
|
this.on( type, selector, data, types[ type ], one );
|
|
}
|
|
return this;
|
|
}
|
|
|
|
if ( data == null && fn == null ) {
|
|
// ( types, fn )
|
|
fn = selector;
|
|
data = selector = undefined;
|
|
} else if ( fn == null ) {
|
|
if ( typeof selector === "string" ) {
|
|
// ( types, selector, fn )
|
|
fn = data;
|
|
data = undefined;
|
|
} else {
|
|
// ( types, data, fn )
|
|
fn = data;
|
|
data = selector;
|
|
selector = undefined;
|
|
}
|
|
}
|
|
if ( fn === false ) {
|
|
fn = returnFalse;
|
|
} else if ( !fn ) {
|
|
return this;
|
|
}
|
|
|
|
if ( one === 1 ) {
|
|
origFn = fn;
|
|
fn = function( event ) {
|
|
// Can use an empty set, since event contains the info
|
|
jQuery().off( event );
|
|
return origFn.apply( this, arguments );
|
|
};
|
|
// Use same guid so caller can remove using origFn
|
|
fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ );
|
|
}
|
|
return this.each( function() {
|
|
jQuery.event.add( this, types, fn, data, selector );
|
|
});
|
|
},
|
|
one: function( types, selector, data, fn ) {
|
|
return this.on( types, selector, data, fn, 1 );
|
|
},
|
|
off: function( types, selector, fn ) {
|
|
var handleObj, type;
|
|
if ( types && types.preventDefault && types.handleObj ) {
|
|
// ( event ) dispatched jQuery.Event
|
|
handleObj = types.handleObj;
|
|
jQuery( types.delegateTarget ).off(
|
|
handleObj.namespace ? handleObj.origType + "." + handleObj.namespace : handleObj.origType,
|
|
handleObj.selector,
|
|
handleObj.handler
|
|
);
|
|
return this;
|
|
}
|
|
if ( typeof types === "object" ) {
|
|
// ( types-object [, selector] )
|
|
for ( type in types ) {
|
|
this.off( type, selector, types[ type ] );
|
|
}
|
|
return this;
|
|
}
|
|
if ( selector === false || typeof selector === "function" ) {
|
|
// ( types [, fn] )
|
|
fn = selector;
|
|
selector = undefined;
|
|
}
|
|
if ( fn === false ) {
|
|
fn = returnFalse;
|
|
}
|
|
return this.each(function() {
|
|
jQuery.event.remove( this, types, fn, selector );
|
|
});
|
|
},
|
|
|
|
trigger: function( type, data ) {
|
|
return this.each(function() {
|
|
jQuery.event.trigger( type, data, this );
|
|
});
|
|
},
|
|
triggerHandler: function( type, data ) {
|
|
var elem = this[0];
|
|
if ( elem ) {
|
|
return jQuery.event.trigger( type, data, elem, true );
|
|
}
|
|
}
|
|
});
|
|
|
|
|
|
var
|
|
rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi,
|
|
rtagName = /<([\w:]+)/,
|
|
rhtml = /<|&#?\w+;/,
|
|
rnoInnerhtml = /<(?:script|style|link)/i,
|
|
// checked="checked" or checked
|
|
rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i,
|
|
rscriptType = /^$|\/(?:java|ecma)script/i,
|
|
rscriptTypeMasked = /^true\/(.*)/,
|
|
rcleanScript = /^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g,
|
|
|
|
// We have to close these tags to support XHTML (#13200)
|
|
wrapMap = {
|
|
|
|
// Support: IE9
|
|
option: [ 1, "<select multiple='multiple'>", "</select>" ],
|
|
|
|
thead: [ 1, "<table>", "</table>" ],
|
|
col: [ 2, "<table><colgroup>", "</colgroup></table>" ],
|
|
tr: [ 2, "<table><tbody>", "</tbody></table>" ],
|
|
td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ],
|
|
|
|
_default: [ 0, "", "" ]
|
|
};
|
|
|
|
// Support: IE9
|
|
wrapMap.optgroup = wrapMap.option;
|
|
|
|
wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
|
|
wrapMap.th = wrapMap.td;
|
|
|
|
// Support: 1.x compatibility
|
|
// Manipulating tables requires a tbody
|
|
function manipulationTarget( elem, content ) {
|
|
return jQuery.nodeName( elem, "table" ) &&
|
|
jQuery.nodeName( content.nodeType !== 11 ? content : content.firstChild, "tr" ) ?
|
|
|
|
elem.getElementsByTagName("tbody")[0] ||
|
|
elem.appendChild( elem.ownerDocument.createElement("tbody") ) :
|
|
elem;
|
|
}
|
|
|
|
// Replace/restore the type attribute of script elements for safe DOM manipulation
|
|
function disableScript( elem ) {
|
|
elem.type = (elem.getAttribute("type") !== null) + "/" + elem.type;
|
|
return elem;
|
|
}
|
|
function restoreScript( elem ) {
|
|
var match = rscriptTypeMasked.exec( elem.type );
|
|
|
|
if ( match ) {
|
|
elem.type = match[ 1 ];
|
|
} else {
|
|
elem.removeAttribute("type");
|
|
}
|
|
|
|
return elem;
|
|
}
|
|
|
|
// Mark scripts as having already been evaluated
|
|
function setGlobalEval( elems, refElements ) {
|
|
var i = 0,
|
|
l = elems.length;
|
|
|
|
for ( ; i < l; i++ ) {
|
|
data_priv.set(
|
|
elems[ i ], "globalEval", !refElements || data_priv.get( refElements[ i ], "globalEval" )
|
|
);
|
|
}
|
|
}
|
|
|
|
function cloneCopyEvent( src, dest ) {
|
|
var i, l, type, pdataOld, pdataCur, udataOld, udataCur, events;
|
|
|
|
if ( dest.nodeType !== 1 ) {
|
|
return;
|
|
}
|
|
|
|
// 1. Copy private data: events, handlers, etc.
|
|
if ( data_priv.hasData( src ) ) {
|
|
pdataOld = data_priv.access( src );
|
|
pdataCur = data_priv.set( dest, pdataOld );
|
|
events = pdataOld.events;
|
|
|
|
if ( events ) {
|
|
delete pdataCur.handle;
|
|
pdataCur.events = {};
|
|
|
|
for ( type in events ) {
|
|
for ( i = 0, l = events[ type ].length; i < l; i++ ) {
|
|
jQuery.event.add( dest, type, events[ type ][ i ] );
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
// 2. Copy user data
|
|
if ( data_user.hasData( src ) ) {
|
|
udataOld = data_user.access( src );
|
|
udataCur = jQuery.extend( {}, udataOld );
|
|
|
|
data_user.set( dest, udataCur );
|
|
}
|
|
}
|
|
|
|
function getAll( context, tag ) {
|
|
var ret = context.getElementsByTagName ? context.getElementsByTagName( tag || "*" ) :
|
|
context.querySelectorAll ? context.querySelectorAll( tag || "*" ) :
|
|
[];
|
|
|
|
return tag === undefined || tag && jQuery.nodeName( context, tag ) ?
|
|
jQuery.merge( [ context ], ret ) :
|
|
ret;
|
|
}
|
|
|
|
// Fix IE bugs, see support tests
|
|
function fixInput( src, dest ) {
|
|
var nodeName = dest.nodeName.toLowerCase();
|
|
|
|
// Fails to persist the checked state of a cloned checkbox or radio button.
|
|
if ( nodeName === "input" && rcheckableType.test( src.type ) ) {
|
|
dest.checked = src.checked;
|
|
|
|
// Fails to return the selected option to the default selected state when cloning options
|
|
} else if ( nodeName === "input" || nodeName === "textarea" ) {
|
|
dest.defaultValue = src.defaultValue;
|
|
}
|
|
}
|
|
|
|
jQuery.extend({
|
|
clone: function( elem, dataAndEvents, deepDataAndEvents ) {
|
|
var i, l, srcElements, destElements,
|
|
clone = elem.cloneNode( true ),
|
|
inPage = jQuery.contains( elem.ownerDocument, elem );
|
|
|
|
// Fix IE cloning issues
|
|
if ( !support.noCloneChecked && ( elem.nodeType === 1 || elem.nodeType === 11 ) &&
|
|
!jQuery.isXMLDoc( elem ) ) {
|
|
|
|
// We eschew Sizzle here for performance reasons: http://jsperf.com/getall-vs-sizzle/2
|
|
destElements = getAll( clone );
|
|
srcElements = getAll( elem );
|
|
|
|
for ( i = 0, l = srcElements.length; i < l; i++ ) {
|
|
fixInput( srcElements[ i ], destElements[ i ] );
|
|
}
|
|
}
|
|
|
|
// Copy the events from the original to the clone
|
|
if ( dataAndEvents ) {
|
|
if ( deepDataAndEvents ) {
|
|
srcElements = srcElements || getAll( elem );
|
|
destElements = destElements || getAll( clone );
|
|
|
|
for ( i = 0, l = srcElements.length; i < l; i++ ) {
|
|
cloneCopyEvent( srcElements[ i ], destElements[ i ] );
|
|
}
|
|
} else {
|
|
cloneCopyEvent( elem, clone );
|
|
}
|
|
}
|
|
|
|
// Preserve script evaluation history
|
|
destElements = getAll( clone, "script" );
|
|
if ( destElements.length > 0 ) {
|
|
setGlobalEval( destElements, !inPage && getAll( elem, "script" ) );
|
|
}
|
|
|
|
// Return the cloned set
|
|
return clone;
|
|
},
|
|
|
|
buildFragment: function( elems, context, scripts, selection ) {
|
|
var elem, tmp, tag, wrap, contains, j,
|
|
fragment = context.createDocumentFragment(),
|
|
nodes = [],
|
|
i = 0,
|
|
l = elems.length;
|
|
|
|
for ( ; i < l; i++ ) {
|
|
elem = elems[ i ];
|
|
|
|
if ( elem || elem === 0 ) {
|
|
|
|
// Add nodes directly
|
|
if ( jQuery.type( elem ) === "object" ) {
|
|
// Support: QtWebKit, PhantomJS
|
|
// push.apply(_, arraylike) throws on ancient WebKit
|
|
jQuery.merge( nodes, elem.nodeType ? [ elem ] : elem );
|
|
|
|
// Convert non-html into a text node
|
|
} else if ( !rhtml.test( elem ) ) {
|
|
nodes.push( context.createTextNode( elem ) );
|
|
|
|
// Convert html into DOM nodes
|
|
} else {
|
|
tmp = tmp || fragment.appendChild( context.createElement("div") );
|
|
|
|
// Deserialize a standard representation
|
|
tag = ( rtagName.exec( elem ) || [ "", "" ] )[ 1 ].toLowerCase();
|
|
wrap = wrapMap[ tag ] || wrapMap._default;
|
|
tmp.innerHTML = wrap[ 1 ] + elem.replace( rxhtmlTag, "<$1></$2>" ) + wrap[ 2 ];
|
|
|
|
// Descend through wrappers to the right content
|
|
j = wrap[ 0 ];
|
|
while ( j-- ) {
|
|
tmp = tmp.lastChild;
|
|
}
|
|
|
|
// Support: QtWebKit, PhantomJS
|
|
// push.apply(_, arraylike) throws on ancient WebKit
|
|
jQuery.merge( nodes, tmp.childNodes );
|
|
|
|
// Remember the top-level container
|
|
tmp = fragment.firstChild;
|
|
|
|
// Ensure the created nodes are orphaned (#12392)
|
|
tmp.textContent = "";
|
|
}
|
|
}
|
|
}
|
|
|
|
// Remove wrapper from fragment
|
|
fragment.textContent = "";
|
|
|
|
i = 0;
|
|
while ( (elem = nodes[ i++ ]) ) {
|
|
|
|
// #4087 - If origin and destination elements are the same, and this is
|
|
// that element, do not do anything
|
|
if ( selection && jQuery.inArray( elem, selection ) !== -1 ) {
|
|
continue;
|
|
}
|
|
|
|
contains = jQuery.contains( elem.ownerDocument, elem );
|
|
|
|
// Append to fragment
|
|
tmp = getAll( fragment.appendChild( elem ), "script" );
|
|
|
|
// Preserve script evaluation history
|
|
if ( contains ) {
|
|
setGlobalEval( tmp );
|
|
}
|
|
|
|
// Capture executables
|
|
if ( scripts ) {
|
|
j = 0;
|
|
while ( (elem = tmp[ j++ ]) ) {
|
|
if ( rscriptType.test( elem.type || "" ) ) {
|
|
scripts.push( elem );
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
return fragment;
|
|
},
|
|
|
|
cleanData: function( elems ) {
|
|
var data, elem, type, key,
|
|
special = jQuery.event.special,
|
|
i = 0;
|
|
|
|
for ( ; (elem = elems[ i ]) !== undefined; i++ ) {
|
|
if ( jQuery.acceptData( elem ) ) {
|
|
key = elem[ data_priv.expando ];
|
|
|
|
if ( key && (data = data_priv.cache[ key ]) ) {
|
|
if ( data.events ) {
|
|
for ( type in data.events ) {
|
|
if ( special[ type ] ) {
|
|
jQuery.event.remove( elem, type );
|
|
|
|
// This is a shortcut to avoid jQuery.event.remove's overhead
|
|
} else {
|
|
jQuery.removeEvent( elem, type, data.handle );
|
|
}
|
|
}
|
|
}
|
|
if ( data_priv.cache[ key ] ) {
|
|
// Discard any remaining `private` data
|
|
delete data_priv.cache[ key ];
|
|
}
|
|
}
|
|
}
|
|
// Discard any remaining `user` data
|
|
delete data_user.cache[ elem[ data_user.expando ] ];
|
|
}
|
|
}
|
|
});
|
|
|
|
jQuery.fn.extend({
|
|
text: function( value ) {
|
|
return access( this, function( value ) {
|
|
return value === undefined ?
|
|
jQuery.text( this ) :
|
|
this.empty().each(function() {
|
|
if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {
|
|
this.textContent = value;
|
|
}
|
|
});
|
|
}, null, value, arguments.length );
|
|
},
|
|
|
|
append: function() {
|
|
return this.domManip( arguments, function( elem ) {
|
|
if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {
|
|
var target = manipulationTarget( this, elem );
|
|
target.appendChild( elem );
|
|
}
|
|
});
|
|
},
|
|
|
|
prepend: function() {
|
|
return this.domManip( arguments, function( elem ) {
|
|
if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {
|
|
var target = manipulationTarget( this, elem );
|
|
target.insertBefore( elem, target.firstChild );
|
|
}
|
|
});
|
|
},
|
|
|
|
before: function() {
|
|
return this.domManip( arguments, function( elem ) {
|
|
if ( this.parentNode ) {
|
|
this.parentNode.insertBefore( elem, this );
|
|
}
|
|
});
|
|
},
|
|
|
|
after: function() {
|
|
return this.domManip( arguments, function( elem ) {
|
|
if ( this.parentNode ) {
|
|
this.parentNode.insertBefore( elem, this.nextSibling );
|
|
}
|
|
});
|
|
},
|
|
|
|
remove: function( selector, keepData /* Internal Use Only */ ) {
|
|
var elem,
|
|
elems = selector ? jQuery.filter( selector, this ) : this,
|
|
i = 0;
|
|
|
|
for ( ; (elem = elems[i]) != null; i++ ) {
|
|
if ( !keepData && elem.nodeType === 1 ) {
|
|
jQuery.cleanData( getAll( elem ) );
|
|
}
|
|
|
|
if ( elem.parentNode ) {
|
|
if ( keepData && jQuery.contains( elem.ownerDocument, elem ) ) {
|
|
setGlobalEval( getAll( elem, "script" ) );
|
|
}
|
|
elem.parentNode.removeChild( elem );
|
|
}
|
|
}
|
|
|
|
return this;
|
|
},
|
|
|
|
empty: function() {
|
|
var elem,
|
|
i = 0;
|
|
|
|
for ( ; (elem = this[i]) != null; i++ ) {
|
|
if ( elem.nodeType === 1 ) {
|
|
|
|
// Prevent memory leaks
|
|
jQuery.cleanData( getAll( elem, false ) );
|
|
|
|
// Remove any remaining nodes
|
|
elem.textContent = "";
|
|
}
|
|
}
|
|
|
|
return this;
|
|
},
|
|
|
|
clone: function( dataAndEvents, deepDataAndEvents ) {
|
|
dataAndEvents = dataAndEvents == null ? false : dataAndEvents;
|
|
deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;
|
|
|
|
return this.map(function() {
|
|
return jQuery.clone( this, dataAndEvents, deepDataAndEvents );
|
|
});
|
|
},
|
|
|
|
html: function( value ) {
|
|
return access( this, function( value ) {
|
|
var elem = this[ 0 ] || {},
|
|
i = 0,
|
|
l = this.length;
|
|
|
|
if ( value === undefined && elem.nodeType === 1 ) {
|
|
return elem.innerHTML;
|
|
}
|
|
|
|
// See if we can take a shortcut and just use innerHTML
|
|
if ( typeof value === "string" && !rnoInnerhtml.test( value ) &&
|
|
!wrapMap[ ( rtagName.exec( value ) || [ "", "" ] )[ 1 ].toLowerCase() ] ) {
|
|
|
|
value = value.replace( rxhtmlTag, "<$1></$2>" );
|
|
|
|
try {
|
|
for ( ; i < l; i++ ) {
|
|
elem = this[ i ] || {};
|
|
|
|
// Remove element nodes and prevent memory leaks
|
|
if ( elem.nodeType === 1 ) {
|
|
jQuery.cleanData( getAll( elem, false ) );
|
|
elem.innerHTML = value;
|
|
}
|
|
}
|
|
|
|
elem = 0;
|
|
|
|
// If using innerHTML throws an exception, use the fallback method
|
|
} catch( e ) {}
|
|
}
|
|
|
|
if ( elem ) {
|
|
this.empty().append( value );
|
|
}
|
|
}, null, value, arguments.length );
|
|
},
|
|
|
|
replaceWith: function() {
|
|
var arg = arguments[ 0 ];
|
|
|
|
// Make the changes, replacing each context element with the new content
|
|
this.domManip( arguments, function( elem ) {
|
|
arg = this.parentNode;
|
|
|
|
jQuery.cleanData( getAll( this ) );
|
|
|
|
if ( arg ) {
|
|
arg.replaceChild( elem, this );
|
|
}
|
|
});
|
|
|
|
// Force removal if there was no new content (e.g., from empty arguments)
|
|
return arg && (arg.length || arg.nodeType) ? this : this.remove();
|
|
},
|
|
|
|
detach: function( selector ) {
|
|
return this.remove( selector, true );
|
|
},
|
|
|
|
domManip: function( args, callback ) {
|
|
|
|
// Flatten any nested arrays
|
|
args = concat.apply( [], args );
|
|
|
|
var fragment, first, scripts, hasScripts, node, doc,
|
|
i = 0,
|
|
l = this.length,
|
|
set = this,
|
|
iNoClone = l - 1,
|
|
value = args[ 0 ],
|
|
isFunction = jQuery.isFunction( value );
|
|
|
|
// We can't cloneNode fragments that contain checked, in WebKit
|
|
if ( isFunction ||
|
|
( l > 1 && typeof value === "string" &&
|
|
!support.checkClone && rchecked.test( value ) ) ) {
|
|
return this.each(function( index ) {
|
|
var self = set.eq( index );
|
|
if ( isFunction ) {
|
|
args[ 0 ] = value.call( this, index, self.html() );
|
|
}
|
|
self.domManip( args, callback );
|
|
});
|
|
}
|
|
|
|
if ( l ) {
|
|
fragment = jQuery.buildFragment( args, this[ 0 ].ownerDocument, false, this );
|
|
first = fragment.firstChild;
|
|
|
|
if ( fragment.childNodes.length === 1 ) {
|
|
fragment = first;
|
|
}
|
|
|
|
if ( first ) {
|
|
scripts = jQuery.map( getAll( fragment, "script" ), disableScript );
|
|
hasScripts = scripts.length;
|
|
|
|
// Use the original fragment for the last item instead of the first because it can end up
|
|
// being emptied incorrectly in certain situations (#8070).
|
|
for ( ; i < l; i++ ) {
|
|
node = fragment;
|
|
|
|
if ( i !== iNoClone ) {
|
|
node = jQuery.clone( node, true, true );
|
|
|
|
// Keep references to cloned scripts for later restoration
|
|
if ( hasScripts ) {
|
|
// Support: QtWebKit
|
|
// jQuery.merge because push.apply(_, arraylike) throws
|
|
jQuery.merge( scripts, getAll( node, "script" ) );
|
|
}
|
|
}
|
|
|
|
callback.call( this[ i ], node, i );
|
|
}
|
|
|
|
if ( hasScripts ) {
|
|
doc = scripts[ scripts.length - 1 ].ownerDocument;
|
|
|
|
// Reenable scripts
|
|
jQuery.map( scripts, restoreScript );
|
|
|
|
// Evaluate executable scripts on first document insertion
|
|
for ( i = 0; i < hasScripts; i++ ) {
|
|
node = scripts[ i ];
|
|
if ( rscriptType.test( node.type || "" ) &&
|
|
!data_priv.access( node, "globalEval" ) && jQuery.contains( doc, node ) ) {
|
|
|
|
if ( node.src ) {
|
|
// Optional AJAX dependency, but won't run scripts if not present
|
|
if ( jQuery._evalUrl ) {
|
|
jQuery._evalUrl( node.src );
|
|
}
|
|
} else {
|
|
jQuery.globalEval( node.textContent.replace( rcleanScript, "" ) );
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
return this;
|
|
}
|
|
});
|
|
|
|
jQuery.each({
|
|
appendTo: "append",
|
|
prependTo: "prepend",
|
|
insertBefore: "before",
|
|
insertAfter: "after",
|
|
replaceAll: "replaceWith"
|
|
}, function( name, original ) {
|
|
jQuery.fn[ name ] = function( selector ) {
|
|
var elems,
|
|
ret = [],
|
|
insert = jQuery( selector ),
|
|
last = insert.length - 1,
|
|
i = 0;
|
|
|
|
for ( ; i <= last; i++ ) {
|
|
elems = i === last ? this : this.clone( true );
|
|
jQuery( insert[ i ] )[ original ]( elems );
|
|
|
|
// Support: QtWebKit
|
|
// .get() because push.apply(_, arraylike) throws
|
|
push.apply( ret, elems.get() );
|
|
}
|
|
|
|
return this.pushStack( ret );
|
|
};
|
|
});
|
|
|
|
|
|
var iframe,
|
|
elemdisplay = {};
|
|
|
|
/**
|
|
* Retrieve the actual display of a element
|
|
* @param {String} name nodeName of the element
|
|
* @param {Object} doc Document object
|
|
*/
|
|
// Called only from within defaultDisplay
|
|
function actualDisplay( name, doc ) {
|
|
var style,
|
|
elem = jQuery( doc.createElement( name ) ).appendTo( doc.body ),
|
|
|
|
// getDefaultComputedStyle might be reliably used only on attached element
|
|
display = window.getDefaultComputedStyle && ( style = window.getDefaultComputedStyle( elem[ 0 ] ) ) ?
|
|
|
|
// Use of this method is a temporary fix (more like optimization) until something better comes along,
|
|
// since it was removed from specification and supported only in FF
|
|
style.display : jQuery.css( elem[ 0 ], "display" );
|
|
|
|
// We don't have any data stored on the element,
|
|
// so use "detach" method as fast way to get rid of the element
|
|
elem.detach();
|
|
|
|
return display;
|
|
}
|
|
|
|
/**
|
|
* Try to determine the default display value of an element
|
|
* @param {String} nodeName
|
|
*/
|
|
function defaultDisplay( nodeName ) {
|
|
var doc = document,
|
|
display = elemdisplay[ nodeName ];
|
|
|
|
if ( !display ) {
|
|
display = actualDisplay( nodeName, doc );
|
|
|
|
// If the simple way fails, read from inside an iframe
|
|
if ( display === "none" || !display ) {
|
|
|
|
// Use the already-created iframe if possible
|
|
iframe = (iframe || jQuery( "<iframe frameborder='0' width='0' height='0'/>" )).appendTo( doc.documentElement );
|
|
|
|
// Always write a new HTML skeleton so Webkit and Firefox don't choke on reuse
|
|
doc = iframe[ 0 ].contentDocument;
|
|
|
|
// Support: IE
|
|
doc.write();
|
|
doc.close();
|
|
|
|
display = actualDisplay( nodeName, doc );
|
|
iframe.detach();
|
|
}
|
|
|
|
// Store the correct default display
|
|
elemdisplay[ nodeName ] = display;
|
|
}
|
|
|
|
return display;
|
|
}
|
|
var rmargin = (/^margin/);
|
|
|
|
var rnumnonpx = new RegExp( "^(" + pnum + ")(?!px)[a-z%]+$", "i" );
|
|
|
|
var getStyles = function( elem ) {
|
|
// Support: IE<=11+, Firefox<=30+ (#15098, #14150)
|
|
// IE throws on elements created in popups
|
|
// FF meanwhile throws on frame elements through "defaultView.getComputedStyle"
|
|
if ( elem.ownerDocument.defaultView.opener ) {
|
|
return elem.ownerDocument.defaultView.getComputedStyle( elem, null );
|
|
}
|
|
|
|
return window.getComputedStyle( elem, null );
|
|
};
|
|
|
|
|
|
|
|
function curCSS( elem, name, computed ) {
|
|
var width, minWidth, maxWidth, ret,
|
|
style = elem.style;
|
|
|
|
computed = computed || getStyles( elem );
|
|
|
|
// Support: IE9
|
|
// getPropertyValue is only needed for .css('filter') (#12537)
|
|
if ( computed ) {
|
|
ret = computed.getPropertyValue( name ) || computed[ name ];
|
|
}
|
|
|
|
if ( computed ) {
|
|
|
|
if ( ret === "" && !jQuery.contains( elem.ownerDocument, elem ) ) {
|
|
ret = jQuery.style( elem, name );
|
|
}
|
|
|
|
// Support: iOS < 6
|
|
// A tribute to the "awesome hack by Dean Edwards"
|
|
// iOS < 6 (at least) returns percentage for a larger set of values, but width seems to be reliably pixels
|
|
// this is against the CSSOM draft spec: http://dev.w3.org/csswg/cssom/#resolved-values
|
|
if ( rnumnonpx.test( ret ) && rmargin.test( name ) ) {
|
|
|
|
// Remember the original values
|
|
width = style.width;
|
|
minWidth = style.minWidth;
|
|
maxWidth = style.maxWidth;
|
|
|
|
// Put in the new values to get a computed value out
|
|
style.minWidth = style.maxWidth = style.width = ret;
|
|
ret = computed.width;
|
|
|
|
// Revert the changed values
|
|
style.width = width;
|
|
style.minWidth = minWidth;
|
|
style.maxWidth = maxWidth;
|
|
}
|
|
}
|
|
|
|
return ret !== undefined ?
|
|
// Support: IE
|
|
// IE returns zIndex value as an integer.
|
|
ret + "" :
|
|
ret;
|
|
}
|
|
|
|
|
|
function addGetHookIf( conditionFn, hookFn ) {
|
|
// Define the hook, we'll check on the first run if it's really needed.
|
|
return {
|
|
get: function() {
|
|
if ( conditionFn() ) {
|
|
// Hook not needed (or it's not possible to use it due
|
|
// to missing dependency), remove it.
|
|
delete this.get;
|
|
return;
|
|
}
|
|
|
|
// Hook needed; redefine it so that the support test is not executed again.
|
|
return (this.get = hookFn).apply( this, arguments );
|
|
}
|
|
};
|
|
}
|
|
|
|
|
|
(function() {
|
|
var pixelPositionVal, boxSizingReliableVal,
|
|
docElem = document.documentElement,
|
|
container = document.createElement( "div" ),
|
|
div = document.createElement( "div" );
|
|
|
|
if ( !div.style ) {
|
|
return;
|
|
}
|
|
|
|
// Support: IE9-11+
|
|
// Style of cloned element affects source element cloned (#8908)
|
|
div.style.backgroundClip = "content-box";
|
|
div.cloneNode( true ).style.backgroundClip = "";
|
|
support.clearCloneStyle = div.style.backgroundClip === "content-box";
|
|
|
|
container.style.cssText = "border:0;width:0;height:0;top:0;left:-9999px;margin-top:1px;" +
|
|
"position:absolute";
|
|
container.appendChild( div );
|
|
|
|
// Executing both pixelPosition & boxSizingReliable tests require only one layout
|
|
// so they're executed at the same time to save the second computation.
|
|
function computePixelPositionAndBoxSizingReliable() {
|
|
div.style.cssText =
|
|
// Support: Firefox<29, Android 2.3
|
|
// Vendor-prefix box-sizing
|
|
"-webkit-box-sizing:border-box;-moz-box-sizing:border-box;" +
|
|
"box-sizing:border-box;display:block;margin-top:1%;top:1%;" +
|
|
"border:1px;padding:1px;width:4px;position:absolute";
|
|
div.innerHTML = "";
|
|
docElem.appendChild( container );
|
|
|
|
var divStyle = window.getComputedStyle( div, null );
|
|
pixelPositionVal = divStyle.top !== "1%";
|
|
boxSizingReliableVal = divStyle.width === "4px";
|
|
|
|
docElem.removeChild( container );
|
|
}
|
|
|
|
// Support: node.js jsdom
|
|
// Don't assume that getComputedStyle is a property of the global object
|
|
if ( window.getComputedStyle ) {
|
|
jQuery.extend( support, {
|
|
pixelPosition: function() {
|
|
|
|
// This test is executed only once but we still do memoizing
|
|
// since we can use the boxSizingReliable pre-computing.
|
|
// No need to check if the test was already performed, though.
|
|
computePixelPositionAndBoxSizingReliable();
|
|
return pixelPositionVal;
|
|
},
|
|
boxSizingReliable: function() {
|
|
if ( boxSizingReliableVal == null ) {
|
|
computePixelPositionAndBoxSizingReliable();
|
|
}
|
|
return boxSizingReliableVal;
|
|
},
|
|
reliableMarginRight: function() {
|
|
|
|
// Support: Android 2.3
|
|
// Check if div with explicit width and no margin-right incorrectly
|
|
// gets computed margin-right based on width of container. (#3333)
|
|
// WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right
|
|
// This support function is only executed once so no memoizing is needed.
|
|
var ret,
|
|
marginDiv = div.appendChild( document.createElement( "div" ) );
|
|
|
|
// Reset CSS: box-sizing; display; margin; border; padding
|
|
marginDiv.style.cssText = div.style.cssText =
|
|
// Support: Firefox<29, Android 2.3
|
|
// Vendor-prefix box-sizing
|
|
"-webkit-box-sizing:content-box;-moz-box-sizing:content-box;" +
|
|
"box-sizing:content-box;display:block;margin:0;border:0;padding:0";
|
|
marginDiv.style.marginRight = marginDiv.style.width = "0";
|
|
div.style.width = "1px";
|
|
docElem.appendChild( container );
|
|
|
|
ret = !parseFloat( window.getComputedStyle( marginDiv, null ).marginRight );
|
|
|
|
docElem.removeChild( container );
|
|
div.removeChild( marginDiv );
|
|
|
|
return ret;
|
|
}
|
|
});
|
|
}
|
|
})();
|
|
|
|
|
|
// A method for quickly swapping in/out CSS properties to get correct calculations.
|
|
jQuery.swap = function( elem, options, callback, args ) {
|
|
var ret, name,
|
|
old = {};
|
|
|
|
// Remember the old values, and insert the new ones
|
|
for ( name in options ) {
|
|
old[ name ] = elem.style[ name ];
|
|
elem.style[ name ] = options[ name ];
|
|
}
|
|
|
|
ret = callback.apply( elem, args || [] );
|
|
|
|
// Revert the old values
|
|
for ( name in options ) {
|
|
elem.style[ name ] = old[ name ];
|
|
}
|
|
|
|
return ret;
|
|
};
|
|
|
|
|
|
var
|
|
// Swappable if display is none or starts with table except "table", "table-cell", or "table-caption"
|
|
// See here for display values: https://developer.mozilla.org/en-US/docs/CSS/display
|
|
rdisplayswap = /^(none|table(?!-c[ea]).+)/,
|
|
rnumsplit = new RegExp( "^(" + pnum + ")(.*)$", "i" ),
|
|
rrelNum = new RegExp( "^([+-])=(" + pnum + ")", "i" ),
|
|
|
|
cssShow = { position: "absolute", visibility: "hidden", display: "block" },
|
|
cssNormalTransform = {
|
|
letterSpacing: "0",
|
|
fontWeight: "400"
|
|
},
|
|
|
|
cssPrefixes = [ "Webkit", "O", "Moz", "ms" ];
|
|
|
|
// Return a css property mapped to a potentially vendor prefixed property
|
|
function vendorPropName( style, name ) {
|
|
|
|
// Shortcut for names that are not vendor prefixed
|
|
if ( name in style ) {
|
|
return name;
|
|
}
|
|
|
|
// Check for vendor prefixed names
|
|
var capName = name[0].toUpperCase() + name.slice(1),
|
|
origName = name,
|
|
i = cssPrefixes.length;
|
|
|
|
while ( i-- ) {
|
|
name = cssPrefixes[ i ] + capName;
|
|
if ( name in style ) {
|
|
return name;
|
|
}
|
|
}
|
|
|
|
return origName;
|
|
}
|
|
|
|
function setPositiveNumber( elem, value, subtract ) {
|
|
var matches = rnumsplit.exec( value );
|
|
return matches ?
|
|
// Guard against undefined "subtract", e.g., when used as in cssHooks
|
|
Math.max( 0, matches[ 1 ] - ( subtract || 0 ) ) + ( matches[ 2 ] || "px" ) :
|
|
value;
|
|
}
|
|
|
|
function augmentWidthOrHeight( elem, name, extra, isBorderBox, styles ) {
|
|
var i = extra === ( isBorderBox ? "border" : "content" ) ?
|
|
// If we already have the right measurement, avoid augmentation
|
|
4 :
|
|
// Otherwise initialize for horizontal or vertical properties
|
|
name === "width" ? 1 : 0,
|
|
|
|
val = 0;
|
|
|
|
for ( ; i < 4; i += 2 ) {
|
|
// Both box models exclude margin, so add it if we want it
|
|
if ( extra === "margin" ) {
|
|
val += jQuery.css( elem, extra + cssExpand[ i ], true, styles );
|
|
}
|
|
|
|
if ( isBorderBox ) {
|
|
// border-box includes padding, so remove it if we want content
|
|
if ( extra === "content" ) {
|
|
val -= jQuery.css( elem, "padding" + cssExpand[ i ], true, styles );
|
|
}
|
|
|
|
// At this point, extra isn't border nor margin, so remove border
|
|
if ( extra !== "margin" ) {
|
|
val -= jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles );
|
|
}
|
|
} else {
|
|
// At this point, extra isn't content, so add padding
|
|
val += jQuery.css( elem, "padding" + cssExpand[ i ], true, styles );
|
|
|
|
// At this point, extra isn't content nor padding, so add border
|
|
if ( extra !== "padding" ) {
|
|
val += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles );
|
|
}
|
|
}
|
|
}
|
|
|
|
return val;
|
|
}
|
|
|
|
function getWidthOrHeight( elem, name, extra ) {
|
|
|
|
// Start with offset property, which is equivalent to the border-box value
|
|
var valueIsBorderBox = true,
|
|
val = name === "width" ? elem.offsetWidth : elem.offsetHeight,
|
|
styles = getStyles( elem ),
|
|
isBorderBox = jQuery.css( elem, "boxSizing", false, styles ) === "border-box";
|
|
|
|
// Some non-html elements return undefined for offsetWidth, so check for null/undefined
|
|
// svg - https://bugzilla.mozilla.org/show_bug.cgi?id=649285
|
|
// MathML - https://bugzilla.mozilla.org/show_bug.cgi?id=491668
|
|
if ( val <= 0 || val == null ) {
|
|
// Fall back to computed then uncomputed css if necessary
|
|
val = curCSS( elem, name, styles );
|
|
if ( val < 0 || val == null ) {
|
|
val = elem.style[ name ];
|
|
}
|
|
|
|
// Computed unit is not pixels. Stop here and return.
|
|
if ( rnumnonpx.test(val) ) {
|
|
return val;
|
|
}
|
|
|
|
// Check for style in case a browser which returns unreliable values
|
|
// for getComputedStyle silently falls back to the reliable elem.style
|
|
valueIsBorderBox = isBorderBox &&
|
|
( support.boxSizingReliable() || val === elem.style[ name ] );
|
|
|
|
// Normalize "", auto, and prepare for extra
|
|
val = parseFloat( val ) || 0;
|
|
}
|
|
|
|
// Use the active box-sizing model to add/subtract irrelevant styles
|
|
return ( val +
|
|
augmentWidthOrHeight(
|
|
elem,
|
|
name,
|
|
extra || ( isBorderBox ? "border" : "content" ),
|
|
valueIsBorderBox,
|
|
styles
|
|
)
|
|
) + "px";
|
|
}
|
|
|
|
function showHide( elements, show ) {
|
|
var display, elem, hidden,
|
|
values = [],
|
|
index = 0,
|
|
length = elements.length;
|
|
|
|
for ( ; index < length; index++ ) {
|
|
elem = elements[ index ];
|
|
if ( !elem.style ) {
|
|
continue;
|
|
}
|
|
|
|
values[ index ] = data_priv.get( elem, "olddisplay" );
|
|
display = elem.style.display;
|
|
if ( show ) {
|
|
// Reset the inline display of this element to learn if it is
|
|
// being hidden by cascaded rules or not
|
|
if ( !values[ index ] && display === "none" ) {
|
|
elem.style.display = "";
|
|
}
|
|
|
|
// Set elements which have been overridden with display: none
|
|
// in a stylesheet to whatever the default browser style is
|
|
// for such an element
|
|
if ( elem.style.display === "" && isHidden( elem ) ) {
|
|
values[ index ] = data_priv.access( elem, "olddisplay", defaultDisplay(elem.nodeName) );
|
|
}
|
|
} else {
|
|
hidden = isHidden( elem );
|
|
|
|
if ( display !== "none" || !hidden ) {
|
|
data_priv.set( elem, "olddisplay", hidden ? display : jQuery.css( elem, "display" ) );
|
|
}
|
|
}
|
|
}
|
|
|
|
// Set the display of most of the elements in a second loop
|
|
// to avoid the constant reflow
|
|
for ( index = 0; index < length; index++ ) {
|
|
elem = elements[ index ];
|
|
if ( !elem.style ) {
|
|
continue;
|
|
}
|
|
if ( !show || elem.style.display === "none" || elem.style.display === "" ) {
|
|
elem.style.display = show ? values[ index ] || "" : "none";
|
|
}
|
|
}
|
|
|
|
return elements;
|
|
}
|
|
|
|
jQuery.extend({
|
|
|
|
// Add in style property hooks for overriding the default
|
|
// behavior of getting and setting a style property
|
|
cssHooks: {
|
|
opacity: {
|
|
get: function( elem, computed ) {
|
|
if ( computed ) {
|
|
|
|
// We should always get a number back from opacity
|
|
var ret = curCSS( elem, "opacity" );
|
|
return ret === "" ? "1" : ret;
|
|
}
|
|
}
|
|
}
|
|
},
|
|
|
|
// Don't automatically add "px" to these possibly-unitless properties
|
|
cssNumber: {
|
|
"columnCount": true,
|
|
"fillOpacity": true,
|
|
"flexGrow": true,
|
|
"flexShrink": true,
|
|
"fontWeight": true,
|
|
"lineHeight": true,
|
|
"opacity": true,
|
|
"order": true,
|
|
"orphans": true,
|
|
"widows": true,
|
|
"zIndex": true,
|
|
"zoom": true
|
|
},
|
|
|
|
// Add in properties whose names you wish to fix before
|
|
// setting or getting the value
|
|
cssProps: {
|
|
"float": "cssFloat"
|
|
},
|
|
|
|
// Get and set the style property on a DOM Node
|
|
style: function( elem, name, value, extra ) {
|
|
|
|
// Don't set styles on text and comment nodes
|
|
if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) {
|
|
return;
|
|
}
|
|
|
|
// Make sure that we're working with the right name
|
|
var ret, type, hooks,
|
|
origName = jQuery.camelCase( name ),
|
|
style = elem.style;
|
|
|
|
name = jQuery.cssProps[ origName ] || ( jQuery.cssProps[ origName ] = vendorPropName( style, origName ) );
|
|
|
|
// Gets hook for the prefixed version, then unprefixed version
|
|
hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ];
|
|
|
|
// Check if we're setting a value
|
|
if ( value !== undefined ) {
|
|
type = typeof value;
|
|
|
|
// Convert "+=" or "-=" to relative numbers (#7345)
|
|
if ( type === "string" && (ret = rrelNum.exec( value )) ) {
|
|
value = ( ret[1] + 1 ) * ret[2] + parseFloat( jQuery.css( elem, name ) );
|
|
// Fixes bug #9237
|
|
type = "number";
|
|
}
|
|
|
|
// Make sure that null and NaN values aren't set (#7116)
|
|
if ( value == null || value !== value ) {
|
|
return;
|
|
}
|
|
|
|
// If a number, add 'px' to the (except for certain CSS properties)
|
|
if ( type === "number" && !jQuery.cssNumber[ origName ] ) {
|
|
value += "px";
|
|
}
|
|
|
|
// Support: IE9-11+
|
|
// background-* props affect original clone's values
|
|
if ( !support.clearCloneStyle && value === "" && name.indexOf( "background" ) === 0 ) {
|
|
style[ name ] = "inherit";
|
|
}
|
|
|
|
// If a hook was provided, use that value, otherwise just set the specified value
|
|
if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value, extra )) !== undefined ) {
|
|
style[ name ] = value;
|
|
}
|
|
|
|
} else {
|
|
// If a hook was provided get the non-computed value from there
|
|
if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) {
|
|
return ret;
|
|
}
|
|
|
|
// Otherwise just get the value from the style object
|
|
return style[ name ];
|
|
}
|
|
},
|
|
|
|
css: function( elem, name, extra, styles ) {
|
|
var val, num, hooks,
|
|
origName = jQuery.camelCase( name );
|
|
|
|
// Make sure that we're working with the right name
|
|
name = jQuery.cssProps[ origName ] || ( jQuery.cssProps[ origName ] = vendorPropName( elem.style, origName ) );
|
|
|
|
// Try prefixed name followed by the unprefixed name
|
|
hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ];
|
|
|
|
// If a hook was provided get the computed value from there
|
|
if ( hooks && "get" in hooks ) {
|
|
val = hooks.get( elem, true, extra );
|
|
}
|
|
|
|
// Otherwise, if a way to get the computed value exists, use that
|
|
if ( val === undefined ) {
|
|
val = curCSS( elem, name, styles );
|
|
}
|
|
|
|
// Convert "normal" to computed value
|
|
if ( val === "normal" && name in cssNormalTransform ) {
|
|
val = cssNormalTransform[ name ];
|
|
}
|
|
|
|
// Make numeric if forced or a qualifier was provided and val looks numeric
|
|
if ( extra === "" || extra ) {
|
|
num = parseFloat( val );
|
|
return extra === true || jQuery.isNumeric( num ) ? num || 0 : val;
|
|
}
|
|
return val;
|
|
}
|
|
});
|
|
|
|
jQuery.each([ "height", "width" ], function( i, name ) {
|
|
jQuery.cssHooks[ name ] = {
|
|
get: function( elem, computed, extra ) {
|
|
if ( computed ) {
|
|
|
|
// Certain elements can have dimension info if we invisibly show them
|
|
// but it must have a current display style that would benefit
|
|
return rdisplayswap.test( jQuery.css( elem, "display" ) ) && elem.offsetWidth === 0 ?
|
|
jQuery.swap( elem, cssShow, function() {
|
|
return getWidthOrHeight( elem, name, extra );
|
|
}) :
|
|
getWidthOrHeight( elem, name, extra );
|
|
}
|
|
},
|
|
|
|
set: function( elem, value, extra ) {
|
|
var styles = extra && getStyles( elem );
|
|
return setPositiveNumber( elem, value, extra ?
|
|
augmentWidthOrHeight(
|
|
elem,
|
|
name,
|
|
extra,
|
|
jQuery.css( elem, "boxSizing", false, styles ) === "border-box",
|
|
styles
|
|
) : 0
|
|
);
|
|
}
|
|
};
|
|
});
|
|
|
|
// Support: Android 2.3
|
|
jQuery.cssHooks.marginRight = addGetHookIf( support.reliableMarginRight,
|
|
function( elem, computed ) {
|
|
if ( computed ) {
|
|
return jQuery.swap( elem, { "display": "inline-block" },
|
|
curCSS, [ elem, "marginRight" ] );
|
|
}
|
|
}
|
|
);
|
|
|
|
// These hooks are used by animate to expand properties
|
|
jQuery.each({
|
|
margin: "",
|
|
padding: "",
|
|
border: "Width"
|
|
}, function( prefix, suffix ) {
|
|
jQuery.cssHooks[ prefix + suffix ] = {
|
|
expand: function( value ) {
|
|
var i = 0,
|
|
expanded = {},
|
|
|
|
// Assumes a single number if not a string
|
|
parts = typeof value === "string" ? value.split(" ") : [ value ];
|
|
|
|
for ( ; i < 4; i++ ) {
|
|
expanded[ prefix + cssExpand[ i ] + suffix ] =
|
|
parts[ i ] || parts[ i - 2 ] || parts[ 0 ];
|
|
}
|
|
|
|
return expanded;
|
|
}
|
|
};
|
|
|
|
if ( !rmargin.test( prefix ) ) {
|
|
jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber;
|
|
}
|
|
});
|
|
|
|
jQuery.fn.extend({
|
|
css: function( name, value ) {
|
|
return access( this, function( elem, name, value ) {
|
|
var styles, len,
|
|
map = {},
|
|
i = 0;
|
|
|
|
if ( jQuery.isArray( name ) ) {
|
|
styles = getStyles( elem );
|
|
len = name.length;
|
|
|
|
for ( ; i < len; i++ ) {
|
|
map[ name[ i ] ] = jQuery.css( elem, name[ i ], false, styles );
|
|
}
|
|
|
|
return map;
|
|
}
|
|
|
|
return value !== undefined ?
|
|
jQuery.style( elem, name, value ) :
|
|
jQuery.css( elem, name );
|
|
}, name, value, arguments.length > 1 );
|
|
},
|
|
show: function() {
|
|
return showHide( this, true );
|
|
},
|
|
hide: function() {
|
|
return showHide( this );
|
|
},
|
|
toggle: function( state ) {
|
|
if ( typeof state === "boolean" ) {
|
|
return state ? this.show() : this.hide();
|
|
}
|
|
|
|
return this.each(function() {
|
|
if ( isHidden( this ) ) {
|
|
jQuery( this ).show();
|
|
} else {
|
|
jQuery( this ).hide();
|
|
}
|
|
});
|
|
}
|
|
});
|
|
|
|
|
|
function Tween( elem, options, prop, end, easing ) {
|
|
return new Tween.prototype.init( elem, options, prop, end, easing );
|
|
}
|
|
jQuery.Tween = Tween;
|
|
|
|
Tween.prototype = {
|
|
constructor: Tween,
|
|
init: function( elem, options, prop, end, easing, unit ) {
|
|
this.elem = elem;
|
|
this.prop = prop;
|
|
this.easing = easing || "swing";
|
|
this.options = options;
|
|
this.start = this.now = this.cur();
|
|
this.end = end;
|
|
this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" );
|
|
},
|
|
cur: function() {
|
|
var hooks = Tween.propHooks[ this.prop ];
|
|
|
|
return hooks && hooks.get ?
|
|
hooks.get( this ) :
|
|
Tween.propHooks._default.get( this );
|
|
},
|
|
run: function( percent ) {
|
|
var eased,
|
|
hooks = Tween.propHooks[ this.prop ];
|
|
|
|
if ( this.options.duration ) {
|
|
this.pos = eased = jQuery.easing[ this.easing ](
|
|
percent, this.options.duration * percent, 0, 1, this.options.duration
|
|
);
|
|
} else {
|
|
this.pos = eased = percent;
|
|
}
|
|
this.now = ( this.end - this.start ) * eased + this.start;
|
|
|
|
if ( this.options.step ) {
|
|
this.options.step.call( this.elem, this.now, this );
|
|
}
|
|
|
|
if ( hooks && hooks.set ) {
|
|
hooks.set( this );
|
|
} else {
|
|
Tween.propHooks._default.set( this );
|
|
}
|
|
return this;
|
|
}
|
|
};
|
|
|
|
Tween.prototype.init.prototype = Tween.prototype;
|
|
|
|
Tween.propHooks = {
|
|
_default: {
|
|
get: function( tween ) {
|
|
var result;
|
|
|
|
if ( tween.elem[ tween.prop ] != null &&
|
|
(!tween.elem.style || tween.elem.style[ tween.prop ] == null) ) {
|
|
return tween.elem[ tween.prop ];
|
|
}
|
|
|
|
// Passing an empty string as a 3rd parameter to .css will automatically
|
|
// attempt a parseFloat and fallback to a string if the parse fails.
|
|
// Simple values such as "10px" are parsed to Float;
|
|
// complex values such as "rotate(1rad)" are returned as-is.
|
|
result = jQuery.css( tween.elem, tween.prop, "" );
|
|
// Empty strings, null, undefined and "auto" are converted to 0.
|
|
return !result || result === "auto" ? 0 : result;
|
|
},
|
|
set: function( tween ) {
|
|
// Use step hook for back compat.
|
|
// Use cssHook if its there.
|
|
// Use .style if available and use plain properties where available.
|
|
if ( jQuery.fx.step[ tween.prop ] ) {
|
|
jQuery.fx.step[ tween.prop ]( tween );
|
|
} else if ( tween.elem.style && ( tween.elem.style[ jQuery.cssProps[ tween.prop ] ] != null || jQuery.cssHooks[ tween.prop ] ) ) {
|
|
jQuery.style( tween.elem, tween.prop, tween.now + tween.unit );
|
|
} else {
|
|
tween.elem[ tween.prop ] = tween.now;
|
|
}
|
|
}
|
|
}
|
|
};
|
|
|
|
// Support: IE9
|
|
// Panic based approach to setting things on disconnected nodes
|
|
Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = {
|
|
set: function( tween ) {
|
|
if ( tween.elem.nodeType && tween.elem.parentNode ) {
|
|
tween.elem[ tween.prop ] = tween.now;
|
|
}
|
|
}
|
|
};
|
|
|
|
jQuery.easing = {
|
|
linear: function( p ) {
|
|
return p;
|
|
},
|
|
swing: function( p ) {
|
|
return 0.5 - Math.cos( p * Math.PI ) / 2;
|
|
}
|
|
};
|
|
|
|
jQuery.fx = Tween.prototype.init;
|
|
|
|
// Back Compat <1.8 extension point
|
|
jQuery.fx.step = {};
|
|
|
|
|
|
|
|
|
|
var
|
|
fxNow, timerId,
|
|
rfxtypes = /^(?:toggle|show|hide)$/,
|
|
rfxnum = new RegExp( "^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i" ),
|
|
rrun = /queueHooks$/,
|
|
animationPrefilters = [ defaultPrefilter ],
|
|
tweeners = {
|
|
"*": [ function( prop, value ) {
|
|
var tween = this.createTween( prop, value ),
|
|
target = tween.cur(),
|
|
parts = rfxnum.exec( value ),
|
|
unit = parts && parts[ 3 ] || ( jQuery.cssNumber[ prop ] ? "" : "px" ),
|
|
|
|
// Starting value computation is required for potential unit mismatches
|
|
start = ( jQuery.cssNumber[ prop ] || unit !== "px" && +target ) &&
|
|
rfxnum.exec( jQuery.css( tween.elem, prop ) ),
|
|
scale = 1,
|
|
maxIterations = 20;
|
|
|
|
if ( start && start[ 3 ] !== unit ) {
|
|
// Trust units reported by jQuery.css
|
|
unit = unit || start[ 3 ];
|
|
|
|
// Make sure we update the tween properties later on
|
|
parts = parts || [];
|
|
|
|
// Iteratively approximate from a nonzero starting point
|
|
start = +target || 1;
|
|
|
|
do {
|
|
// If previous iteration zeroed out, double until we get *something*.
|
|
// Use string for doubling so we don't accidentally see scale as unchanged below
|
|
scale = scale || ".5";
|
|
|
|
// Adjust and apply
|
|
start = start / scale;
|
|
jQuery.style( tween.elem, prop, start + unit );
|
|
|
|
// Update scale, tolerating zero or NaN from tween.cur(),
|
|
// break the loop if scale is unchanged or perfect, or if we've just had enough
|
|
} while ( scale !== (scale = tween.cur() / target) && scale !== 1 && --maxIterations );
|
|
}
|
|
|
|
// Update tween properties
|
|
if ( parts ) {
|
|
start = tween.start = +start || +target || 0;
|
|
tween.unit = unit;
|
|
// If a +=/-= token was provided, we're doing a relative animation
|
|
tween.end = parts[ 1 ] ?
|
|
start + ( parts[ 1 ] + 1 ) * parts[ 2 ] :
|
|
+parts[ 2 ];
|
|
}
|
|
|
|
return tween;
|
|
} ]
|
|
};
|
|
|
|
// Animations created synchronously will run synchronously
|
|
function createFxNow() {
|
|
setTimeout(function() {
|
|
fxNow = undefined;
|
|
});
|
|
return ( fxNow = jQuery.now() );
|
|
}
|
|
|
|
// Generate parameters to create a standard animation
|
|
function genFx( type, includeWidth ) {
|
|
var which,
|
|
i = 0,
|
|
attrs = { height: type };
|
|
|
|
// If we include width, step value is 1 to do all cssExpand values,
|
|
// otherwise step value is 2 to skip over Left and Right
|
|
includeWidth = includeWidth ? 1 : 0;
|
|
for ( ; i < 4 ; i += 2 - includeWidth ) {
|
|
which = cssExpand[ i ];
|
|
attrs[ "margin" + which ] = attrs[ "padding" + which ] = type;
|
|
}
|
|
|
|
if ( includeWidth ) {
|
|
attrs.opacity = attrs.width = type;
|
|
}
|
|
|
|
return attrs;
|
|
}
|
|
|
|
function createTween( value, prop, animation ) {
|
|
var tween,
|
|
collection = ( tweeners[ prop ] || [] ).concat( tweeners[ "*" ] ),
|
|
index = 0,
|
|
length = collection.length;
|
|
for ( ; index < length; index++ ) {
|
|
if ( (tween = collection[ index ].call( animation, prop, value )) ) {
|
|
|
|
// We're done with this property
|
|
return tween;
|
|
}
|
|
}
|
|
}
|
|
|
|
function defaultPrefilter( elem, props, opts ) {
|
|
/* jshint validthis: true */
|
|
var prop, value, toggle, tween, hooks, oldfire, display, checkDisplay,
|
|
anim = this,
|
|
orig = {},
|
|
style = elem.style,
|
|
hidden = elem.nodeType && isHidden( elem ),
|
|
dataShow = data_priv.get( elem, "fxshow" );
|
|
|
|
// Handle queue: false promises
|
|
if ( !opts.queue ) {
|
|
hooks = jQuery._queueHooks( elem, "fx" );
|
|
if ( hooks.unqueued == null ) {
|
|
hooks.unqueued = 0;
|
|
oldfire = hooks.empty.fire;
|
|
hooks.empty.fire = function() {
|
|
if ( !hooks.unqueued ) {
|
|
oldfire();
|
|
}
|
|
};
|
|
}
|
|
hooks.unqueued++;
|
|
|
|
anim.always(function() {
|
|
// Ensure the complete handler is called before this completes
|
|
anim.always(function() {
|
|
hooks.unqueued--;
|
|
if ( !jQuery.queue( elem, "fx" ).length ) {
|
|
hooks.empty.fire();
|
|
}
|
|
});
|
|
});
|
|
}
|
|
|
|
// Height/width overflow pass
|
|
if ( elem.nodeType === 1 && ( "height" in props || "width" in props ) ) {
|
|
// Make sure that nothing sneaks out
|
|
// Record all 3 overflow attributes because IE9-10 do not
|
|
// change the overflow attribute when overflowX and
|
|
// overflowY are set to the same value
|
|
opts.overflow = [ style.overflow, style.overflowX, style.overflowY ];
|
|
|
|
// Set display property to inline-block for height/width
|
|
// animations on inline elements that are having width/height animated
|
|
display = jQuery.css( elem, "display" );
|
|
|
|
// Test default display if display is currently "none"
|
|
checkDisplay = display === "none" ?
|
|
data_priv.get( elem, "olddisplay" ) || defaultDisplay( elem.nodeName ) : display;
|
|
|
|
if ( checkDisplay === "inline" && jQuery.css( elem, "float" ) === "none" ) {
|
|
style.display = "inline-block";
|
|
}
|
|
}
|
|
|
|
if ( opts.overflow ) {
|
|
style.overflow = "hidden";
|
|
anim.always(function() {
|
|
style.overflow = opts.overflow[ 0 ];
|
|
style.overflowX = opts.overflow[ 1 ];
|
|
style.overflowY = opts.overflow[ 2 ];
|
|
});
|
|
}
|
|
|
|
// show/hide pass
|
|
for ( prop in props ) {
|
|
value = props[ prop ];
|
|
if ( rfxtypes.exec( value ) ) {
|
|
delete props[ prop ];
|
|
toggle = toggle || value === "toggle";
|
|
if ( value === ( hidden ? "hide" : "show" ) ) {
|
|
|
|
// If there is dataShow left over from a stopped hide or show and we are going to proceed with show, we should pretend to be hidden
|
|
if ( value === "show" && dataShow && dataShow[ prop ] !== undefined ) {
|
|
hidden = true;
|
|
} else {
|
|
continue;
|
|
}
|
|
}
|
|
orig[ prop ] = dataShow && dataShow[ prop ] || jQuery.style( elem, prop );
|
|
|
|
// Any non-fx value stops us from restoring the original display value
|
|
} else {
|
|
display = undefined;
|
|
}
|
|
}
|
|
|
|
if ( !jQuery.isEmptyObject( orig ) ) {
|
|
if ( dataShow ) {
|
|
if ( "hidden" in dataShow ) {
|
|
hidden = dataShow.hidden;
|
|
}
|
|
} else {
|
|
dataShow = data_priv.access( elem, "fxshow", {} );
|
|
}
|
|
|
|
// Store state if its toggle - enables .stop().toggle() to "reverse"
|
|
if ( toggle ) {
|
|
dataShow.hidden = !hidden;
|
|
}
|
|
if ( hidden ) {
|
|
jQuery( elem ).show();
|
|
} else {
|
|
anim.done(function() {
|
|
jQuery( elem ).hide();
|
|
});
|
|
}
|
|
anim.done(function() {
|
|
var prop;
|
|
|
|
data_priv.remove( elem, "fxshow" );
|
|
for ( prop in orig ) {
|
|
jQuery.style( elem, prop, orig[ prop ] );
|
|
}
|
|
});
|
|
for ( prop in orig ) {
|
|
tween = createTween( hidden ? dataShow[ prop ] : 0, prop, anim );
|
|
|
|
if ( !( prop in dataShow ) ) {
|
|
dataShow[ prop ] = tween.start;
|
|
if ( hidden ) {
|
|
tween.end = tween.start;
|
|
tween.start = prop === "width" || prop === "height" ? 1 : 0;
|
|
}
|
|
}
|
|
}
|
|
|
|
// If this is a noop like .hide().hide(), restore an overwritten display value
|
|
} else if ( (display === "none" ? defaultDisplay( elem.nodeName ) : display) === "inline" ) {
|
|
style.display = display;
|
|
}
|
|
}
|
|
|
|
function propFilter( props, specialEasing ) {
|
|
var index, name, easing, value, hooks;
|
|
|
|
// camelCase, specialEasing and expand cssHook pass
|
|
for ( index in props ) {
|
|
name = jQuery.camelCase( index );
|
|
easing = specialEasing[ name ];
|
|
value = props[ index ];
|
|
if ( jQuery.isArray( value ) ) {
|
|
easing = value[ 1 ];
|
|
value = props[ index ] = value[ 0 ];
|
|
}
|
|
|
|
if ( index !== name ) {
|
|
props[ name ] = value;
|
|
delete props[ index ];
|
|
}
|
|
|
|
hooks = jQuery.cssHooks[ name ];
|
|
if ( hooks && "expand" in hooks ) {
|
|
value = hooks.expand( value );
|
|
delete props[ name ];
|
|
|
|
// Not quite $.extend, this won't overwrite existing keys.
|
|
// Reusing 'index' because we have the correct "name"
|
|
for ( index in value ) {
|
|
if ( !( index in props ) ) {
|
|
props[ index ] = value[ index ];
|
|
specialEasing[ index ] = easing;
|
|
}
|
|
}
|
|
} else {
|
|
specialEasing[ name ] = easing;
|
|
}
|
|
}
|
|
}
|
|
|
|
function Animation( elem, properties, options ) {
|
|
var result,
|
|
stopped,
|
|
index = 0,
|
|
length = animationPrefilters.length,
|
|
deferred = jQuery.Deferred().always( function() {
|
|
// Don't match elem in the :animated selector
|
|
delete tick.elem;
|
|
}),
|
|
tick = function() {
|
|
if ( stopped ) {
|
|
return false;
|
|
}
|
|
var currentTime = fxNow || createFxNow(),
|
|
remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ),
|
|
// Support: Android 2.3
|
|
// Archaic crash bug won't allow us to use `1 - ( 0.5 || 0 )` (#12497)
|
|
temp = remaining / animation.duration || 0,
|
|
percent = 1 - temp,
|
|
index = 0,
|
|
length = animation.tweens.length;
|
|
|
|
for ( ; index < length ; index++ ) {
|
|
animation.tweens[ index ].run( percent );
|
|
}
|
|
|
|
deferred.notifyWith( elem, [ animation, percent, remaining ]);
|
|
|
|
if ( percent < 1 && length ) {
|
|
return remaining;
|
|
} else {
|
|
deferred.resolveWith( elem, [ animation ] );
|
|
return false;
|
|
}
|
|
},
|
|
animation = deferred.promise({
|
|
elem: elem,
|
|
props: jQuery.extend( {}, properties ),
|
|
opts: jQuery.extend( true, { specialEasing: {} }, options ),
|
|
originalProperties: properties,
|
|
originalOptions: options,
|
|
startTime: fxNow || createFxNow(),
|
|
duration: options.duration,
|
|
tweens: [],
|
|
createTween: function( prop, end ) {
|
|
var tween = jQuery.Tween( elem, animation.opts, prop, end,
|
|
animation.opts.specialEasing[ prop ] || animation.opts.easing );
|
|
animation.tweens.push( tween );
|
|
return tween;
|
|
},
|
|
stop: function( gotoEnd ) {
|
|
var index = 0,
|
|
// If we are going to the end, we want to run all the tweens
|
|
// otherwise we skip this part
|
|
length = gotoEnd ? animation.tweens.length : 0;
|
|
if ( stopped ) {
|
|
return this;
|
|
}
|
|
stopped = true;
|
|
for ( ; index < length ; index++ ) {
|
|
animation.tweens[ index ].run( 1 );
|
|
}
|
|
|
|
// Resolve when we played the last frame; otherwise, reject
|
|
if ( gotoEnd ) {
|
|
deferred.resolveWith( elem, [ animation, gotoEnd ] );
|
|
} else {
|
|
deferred.rejectWith( elem, [ animation, gotoEnd ] );
|
|
}
|
|
return this;
|
|
}
|
|
}),
|
|
props = animation.props;
|
|
|
|
propFilter( props, animation.opts.specialEasing );
|
|
|
|
for ( ; index < length ; index++ ) {
|
|
result = animationPrefilters[ index ].call( animation, elem, props, animation.opts );
|
|
if ( result ) {
|
|
return result;
|
|
}
|
|
}
|
|
|
|
jQuery.map( props, createTween, animation );
|
|
|
|
if ( jQuery.isFunction( animation.opts.start ) ) {
|
|
animation.opts.start.call( elem, animation );
|
|
}
|
|
|
|
jQuery.fx.timer(
|
|
jQuery.extend( tick, {
|
|
elem: elem,
|
|
anim: animation,
|
|
queue: animation.opts.queue
|
|
})
|
|
);
|
|
|
|
// attach callbacks from options
|
|
return animation.progress( animation.opts.progress )
|
|
.done( animation.opts.done, animation.opts.complete )
|
|
.fail( animation.opts.fail )
|
|
.always( animation.opts.always );
|
|
}
|
|
|
|
jQuery.Animation = jQuery.extend( Animation, {
|
|
|
|
tweener: function( props, callback ) {
|
|
if ( jQuery.isFunction( props ) ) {
|
|
callback = props;
|
|
props = [ "*" ];
|
|
} else {
|
|
props = props.split(" ");
|
|
}
|
|
|
|
var prop,
|
|
index = 0,
|
|
length = props.length;
|
|
|
|
for ( ; index < length ; index++ ) {
|
|
prop = props[ index ];
|
|
tweeners[ prop ] = tweeners[ prop ] || [];
|
|
tweeners[ prop ].unshift( callback );
|
|
}
|
|
},
|
|
|
|
prefilter: function( callback, prepend ) {
|
|
if ( prepend ) {
|
|
animationPrefilters.unshift( callback );
|
|
} else {
|
|
animationPrefilters.push( callback );
|
|
}
|
|
}
|
|
});
|
|
|
|
jQuery.speed = function( speed, easing, fn ) {
|
|
var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : {
|
|
complete: fn || !fn && easing ||
|
|
jQuery.isFunction( speed ) && speed,
|
|
duration: speed,
|
|
easing: fn && easing || easing && !jQuery.isFunction( easing ) && easing
|
|
};
|
|
|
|
opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration :
|
|
opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[ opt.duration ] : jQuery.fx.speeds._default;
|
|
|
|
// Normalize opt.queue - true/undefined/null -> "fx"
|
|
if ( opt.queue == null || opt.queue === true ) {
|
|
opt.queue = "fx";
|
|
}
|
|
|
|
// Queueing
|
|
opt.old = opt.complete;
|
|
|
|
opt.complete = function() {
|
|
if ( jQuery.isFunction( opt.old ) ) {
|
|
opt.old.call( this );
|
|
}
|
|
|
|
if ( opt.queue ) {
|
|
jQuery.dequeue( this, opt.queue );
|
|
}
|
|
};
|
|
|
|
return opt;
|
|
};
|
|
|
|
jQuery.fn.extend({
|
|
fadeTo: function( speed, to, easing, callback ) {
|
|
|
|
// Show any hidden elements after setting opacity to 0
|
|
return this.filter( isHidden ).css( "opacity", 0 ).show()
|
|
|
|
// Animate to the value specified
|
|
.end().animate({ opacity: to }, speed, easing, callback );
|
|
},
|
|
animate: function( prop, speed, easing, callback ) {
|
|
var empty = jQuery.isEmptyObject( prop ),
|
|
optall = jQuery.speed( speed, easing, callback ),
|
|
doAnimation = function() {
|
|
// Operate on a copy of prop so per-property easing won't be lost
|
|
var anim = Animation( this, jQuery.extend( {}, prop ), optall );
|
|
|
|
// Empty animations, or finishing resolves immediately
|
|
if ( empty || data_priv.get( this, "finish" ) ) {
|
|
anim.stop( true );
|
|
}
|
|
};
|
|
doAnimation.finish = doAnimation;
|
|
|
|
return empty || optall.queue === false ?
|
|
this.each( doAnimation ) :
|
|
this.queue( optall.queue, doAnimation );
|
|
},
|
|
stop: function( type, clearQueue, gotoEnd ) {
|
|
var stopQueue = function( hooks ) {
|
|
var stop = hooks.stop;
|
|
delete hooks.stop;
|
|
stop( gotoEnd );
|
|
};
|
|
|
|
if ( typeof type !== "string" ) {
|
|
gotoEnd = clearQueue;
|
|
clearQueue = type;
|
|
type = undefined;
|
|
}
|
|
if ( clearQueue && type !== false ) {
|
|
this.queue( type || "fx", [] );
|
|
}
|
|
|
|
return this.each(function() {
|
|
var dequeue = true,
|
|
index = type != null && type + "queueHooks",
|
|
timers = jQuery.timers,
|
|
data = data_priv.get( this );
|
|
|
|
if ( index ) {
|
|
if ( data[ index ] && data[ index ].stop ) {
|
|
stopQueue( data[ index ] );
|
|
}
|
|
} else {
|
|
for ( index in data ) {
|
|
if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) {
|
|
stopQueue( data[ index ] );
|
|
}
|
|
}
|
|
}
|
|
|
|
for ( index = timers.length; index--; ) {
|
|
if ( timers[ index ].elem === this && (type == null || timers[ index ].queue === type) ) {
|
|
timers[ index ].anim.stop( gotoEnd );
|
|
dequeue = false;
|
|
timers.splice( index, 1 );
|
|
}
|
|
}
|
|
|
|
// Start the next in the queue if the last step wasn't forced.
|
|
// Timers currently will call their complete callbacks, which
|
|
// will dequeue but only if they were gotoEnd.
|
|
if ( dequeue || !gotoEnd ) {
|
|
jQuery.dequeue( this, type );
|
|
}
|
|
});
|
|
},
|
|
finish: function( type ) {
|
|
if ( type !== false ) {
|
|
type = type || "fx";
|
|
}
|
|
return this.each(function() {
|
|
var index,
|
|
data = data_priv.get( this ),
|
|
queue = data[ type + "queue" ],
|
|
hooks = data[ type + "queueHooks" ],
|
|
timers = jQuery.timers,
|
|
length = queue ? queue.length : 0;
|
|
|
|
// Enable finishing flag on private data
|
|
data.finish = true;
|
|
|
|
// Empty the queue first
|
|
jQuery.queue( this, type, [] );
|
|
|
|
if ( hooks && hooks.stop ) {
|
|
hooks.stop.call( this, true );
|
|
}
|
|
|
|
// Look for any active animations, and finish them
|
|
for ( index = timers.length; index--; ) {
|
|
if ( timers[ index ].elem === this && timers[ index ].queue === type ) {
|
|
timers[ index ].anim.stop( true );
|
|
timers.splice( index, 1 );
|
|
}
|
|
}
|
|
|
|
// Look for any animations in the old queue and finish them
|
|
for ( index = 0; index < length; index++ ) {
|
|
if ( queue[ index ] && queue[ index ].finish ) {
|
|
queue[ index ].finish.call( this );
|
|
}
|
|
}
|
|
|
|
// Turn off finishing flag
|
|
delete data.finish;
|
|
});
|
|
}
|
|
});
|
|
|
|
jQuery.each([ "toggle", "show", "hide" ], function( i, name ) {
|
|
var cssFn = jQuery.fn[ name ];
|
|
jQuery.fn[ name ] = function( speed, easing, callback ) {
|
|
return speed == null || typeof speed === "boolean" ?
|
|
cssFn.apply( this, arguments ) :
|
|
this.animate( genFx( name, true ), speed, easing, callback );
|
|
};
|
|
});
|
|
|
|
// Generate shortcuts for custom animations
|
|
jQuery.each({
|
|
slideDown: genFx("show"),
|
|
slideUp: genFx("hide"),
|
|
slideToggle: genFx("toggle"),
|
|
fadeIn: { opacity: "show" },
|
|
fadeOut: { opacity: "hide" },
|
|
fadeToggle: { opacity: "toggle" }
|
|
}, function( name, props ) {
|
|
jQuery.fn[ name ] = function( speed, easing, callback ) {
|
|
return this.animate( props, speed, easing, callback );
|
|
};
|
|
});
|
|
|
|
jQuery.timers = [];
|
|
jQuery.fx.tick = function() {
|
|
var timer,
|
|
i = 0,
|
|
timers = jQuery.timers;
|
|
|
|
fxNow = jQuery.now();
|
|
|
|
for ( ; i < timers.length; i++ ) {
|
|
timer = timers[ i ];
|
|
// Checks the timer has not already been removed
|
|
if ( !timer() && timers[ i ] === timer ) {
|
|
timers.splice( i--, 1 );
|
|
}
|
|
}
|
|
|
|
if ( !timers.length ) {
|
|
jQuery.fx.stop();
|
|
}
|
|
fxNow = undefined;
|
|
};
|
|
|
|
jQuery.fx.timer = function( timer ) {
|
|
jQuery.timers.push( timer );
|
|
if ( timer() ) {
|
|
jQuery.fx.start();
|
|
} else {
|
|
jQuery.timers.pop();
|
|
}
|
|
};
|
|
|
|
jQuery.fx.interval = 13;
|
|
|
|
jQuery.fx.start = function() {
|
|
if ( !timerId ) {
|
|
timerId = setInterval( jQuery.fx.tick, jQuery.fx.interval );
|
|
}
|
|
};
|
|
|
|
jQuery.fx.stop = function() {
|
|
clearInterval( timerId );
|
|
timerId = null;
|
|
};
|
|
|
|
jQuery.fx.speeds = {
|
|
slow: 600,
|
|
fast: 200,
|
|
// Default speed
|
|
_default: 400
|
|
};
|
|
|
|
|
|
// Based off of the plugin by Clint Helfers, with permission.
|
|
// http://blindsignals.com/index.php/2009/07/jquery-delay/
|
|
jQuery.fn.delay = function( time, type ) {
|
|
time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time;
|
|
type = type || "fx";
|
|
|
|
return this.queue( type, function( next, hooks ) {
|
|
var timeout = setTimeout( next, time );
|
|
hooks.stop = function() {
|
|
clearTimeout( timeout );
|
|
};
|
|
});
|
|
};
|
|
|
|
|
|
(function() {
|
|
var input = document.createElement( "input" ),
|
|
select = document.createElement( "select" ),
|
|
opt = select.appendChild( document.createElement( "option" ) );
|
|
|
|
input.type = "checkbox";
|
|
|
|
// Support: iOS<=5.1, Android<=4.2+
|
|
// Default value for a checkbox should be "on"
|
|
support.checkOn = input.value !== "";
|
|
|
|
// Support: IE<=11+
|
|
// Must access selectedIndex to make default options select
|
|
support.optSelected = opt.selected;
|
|
|
|
// Support: Android<=2.3
|
|
// Options inside disabled selects are incorrectly marked as disabled
|
|
select.disabled = true;
|
|
support.optDisabled = !opt.disabled;
|
|
|
|
// Support: IE<=11+
|
|
// An input loses its value after becoming a radio
|
|
input = document.createElement( "input" );
|
|
input.value = "t";
|
|
input.type = "radio";
|
|
support.radioValue = input.value === "t";
|
|
})();
|
|
|
|
|
|
var nodeHook, boolHook,
|
|
attrHandle = jQuery.expr.attrHandle;
|
|
|
|
jQuery.fn.extend({
|
|
attr: function( name, value ) {
|
|
return access( this, jQuery.attr, name, value, arguments.length > 1 );
|
|
},
|
|
|
|
removeAttr: function( name ) {
|
|
return this.each(function() {
|
|
jQuery.removeAttr( this, name );
|
|
});
|
|
}
|
|
});
|
|
|
|
jQuery.extend({
|
|
attr: function( elem, name, value ) {
|
|
var hooks, ret,
|
|
nType = elem.nodeType;
|
|
|
|
// don't get/set attributes on text, comment and attribute nodes
|
|
if ( !elem || nType === 3 || nType === 8 || nType === 2 ) {
|
|
return;
|
|
}
|
|
|
|
// Fallback to prop when attributes are not supported
|
|
if ( typeof elem.getAttribute === strundefined ) {
|
|
return jQuery.prop( elem, name, value );
|
|
}
|
|
|
|
// All attributes are lowercase
|
|
// Grab necessary hook if one is defined
|
|
if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) {
|
|
name = name.toLowerCase();
|
|
hooks = jQuery.attrHooks[ name ] ||
|
|
( jQuery.expr.match.bool.test( name ) ? boolHook : nodeHook );
|
|
}
|
|
|
|
if ( value !== undefined ) {
|
|
|
|
if ( value === null ) {
|
|
jQuery.removeAttr( elem, name );
|
|
|
|
} else if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) {
|
|
return ret;
|
|
|
|
} else {
|
|
elem.setAttribute( name, value + "" );
|
|
return value;
|
|
}
|
|
|
|
} else if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) {
|
|
return ret;
|
|
|
|
} else {
|
|
ret = jQuery.find.attr( elem, name );
|
|
|
|
// Non-existent attributes return null, we normalize to undefined
|
|
return ret == null ?
|
|
undefined :
|
|
ret;
|
|
}
|
|
},
|
|
|
|
removeAttr: function( elem, value ) {
|
|
var name, propName,
|
|
i = 0,
|
|
attrNames = value && value.match( rnotwhite );
|
|
|
|
if ( attrNames && elem.nodeType === 1 ) {
|
|
while ( (name = attrNames[i++]) ) {
|
|
propName = jQuery.propFix[ name ] || name;
|
|
|
|
// Boolean attributes get special treatment (#10870)
|
|
if ( jQuery.expr.match.bool.test( name ) ) {
|
|
// Set corresponding property to false
|
|
elem[ propName ] = false;
|
|
}
|
|
|
|
elem.removeAttribute( name );
|
|
}
|
|
}
|
|
},
|
|
|
|
attrHooks: {
|
|
type: {
|
|
set: function( elem, value ) {
|
|
if ( !support.radioValue && value === "radio" &&
|
|
jQuery.nodeName( elem, "input" ) ) {
|
|
var val = elem.value;
|
|
elem.setAttribute( "type", value );
|
|
if ( val ) {
|
|
elem.value = val;
|
|
}
|
|
return value;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
});
|
|
|
|
// Hooks for boolean attributes
|
|
boolHook = {
|
|
set: function( elem, value, name ) {
|
|
if ( value === false ) {
|
|
// Remove boolean attributes when set to false
|
|
jQuery.removeAttr( elem, name );
|
|
} else {
|
|
elem.setAttribute( name, name );
|
|
}
|
|
return name;
|
|
}
|
|
};
|
|
jQuery.each( jQuery.expr.match.bool.source.match( /\w+/g ), function( i, name ) {
|
|
var getter = attrHandle[ name ] || jQuery.find.attr;
|
|
|
|
attrHandle[ name ] = function( elem, name, isXML ) {
|
|
var ret, handle;
|
|
if ( !isXML ) {
|
|
// Avoid an infinite loop by temporarily removing this function from the getter
|
|
handle = attrHandle[ name ];
|
|
attrHandle[ name ] = ret;
|
|
ret = getter( elem, name, isXML ) != null ?
|
|
name.toLowerCase() :
|
|
null;
|
|
attrHandle[ name ] = handle;
|
|
}
|
|
return ret;
|
|
};
|
|
});
|
|
|
|
|
|
|
|
|
|
var rfocusable = /^(?:input|select|textarea|button)$/i;
|
|
|
|
jQuery.fn.extend({
|
|
prop: function( name, value ) {
|
|
return access( this, jQuery.prop, name, value, arguments.length > 1 );
|
|
},
|
|
|
|
removeProp: function( name ) {
|
|
return this.each(function() {
|
|
delete this[ jQuery.propFix[ name ] || name ];
|
|
});
|
|
}
|
|
});
|
|
|
|
jQuery.extend({
|
|
propFix: {
|
|
"for": "htmlFor",
|
|
"class": "className"
|
|
},
|
|
|
|
prop: function( elem, name, value ) {
|
|
var ret, hooks, notxml,
|
|
nType = elem.nodeType;
|
|
|
|
// Don't get/set properties on text, comment and attribute nodes
|
|
if ( !elem || nType === 3 || nType === 8 || nType === 2 ) {
|
|
return;
|
|
}
|
|
|
|
notxml = nType !== 1 || !jQuery.isXMLDoc( elem );
|
|
|
|
if ( notxml ) {
|
|
// Fix name and attach hooks
|
|
name = jQuery.propFix[ name ] || name;
|
|
hooks = jQuery.propHooks[ name ];
|
|
}
|
|
|
|
if ( value !== undefined ) {
|
|
return hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ?
|
|
ret :
|
|
( elem[ name ] = value );
|
|
|
|
} else {
|
|
return hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ?
|
|
ret :
|
|
elem[ name ];
|
|
}
|
|
},
|
|
|
|
propHooks: {
|
|
tabIndex: {
|
|
get: function( elem ) {
|
|
return elem.hasAttribute( "tabindex" ) || rfocusable.test( elem.nodeName ) || elem.href ?
|
|
elem.tabIndex :
|
|
-1;
|
|
}
|
|
}
|
|
}
|
|
});
|
|
|
|
if ( !support.optSelected ) {
|
|
jQuery.propHooks.selected = {
|
|
get: function( elem ) {
|
|
var parent = elem.parentNode;
|
|
if ( parent && parent.parentNode ) {
|
|
parent.parentNode.selectedIndex;
|
|
}
|
|
return null;
|
|
}
|
|
};
|
|
}
|
|
|
|
jQuery.each([
|
|
"tabIndex",
|
|
"readOnly",
|
|
"maxLength",
|
|
"cellSpacing",
|
|
"cellPadding",
|
|
"rowSpan",
|
|
"colSpan",
|
|
"useMap",
|
|
"frameBorder",
|
|
"contentEditable"
|
|
], function() {
|
|
jQuery.propFix[ this.toLowerCase() ] = this;
|
|
});
|
|
|
|
|
|
|
|
|
|
var rclass = /[\t\r\n\f]/g;
|
|
|
|
jQuery.fn.extend({
|
|
addClass: function( value ) {
|
|
var classes, elem, cur, clazz, j, finalValue,
|
|
proceed = typeof value === "string" && value,
|
|
i = 0,
|
|
len = this.length;
|
|
|
|
if ( jQuery.isFunction( value ) ) {
|
|
return this.each(function( j ) {
|
|
jQuery( this ).addClass( value.call( this, j, this.className ) );
|
|
});
|
|
}
|
|
|
|
if ( proceed ) {
|
|
// The disjunction here is for better compressibility (see removeClass)
|
|
classes = ( value || "" ).match( rnotwhite ) || [];
|
|
|
|
for ( ; i < len; i++ ) {
|
|
elem = this[ i ];
|
|
cur = elem.nodeType === 1 && ( elem.className ?
|
|
( " " + elem.className + " " ).replace( rclass, " " ) :
|
|
" "
|
|
);
|
|
|
|
if ( cur ) {
|
|
j = 0;
|
|
while ( (clazz = classes[j++]) ) {
|
|
if ( cur.indexOf( " " + clazz + " " ) < 0 ) {
|
|
cur += clazz + " ";
|
|
}
|
|
}
|
|
|
|
// only assign if different to avoid unneeded rendering.
|
|
finalValue = jQuery.trim( cur );
|
|
if ( elem.className !== finalValue ) {
|
|
elem.className = finalValue;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
return this;
|
|
},
|
|
|
|
removeClass: function( value ) {
|
|
var classes, elem, cur, clazz, j, finalValue,
|
|
proceed = arguments.length === 0 || typeof value === "string" && value,
|
|
i = 0,
|
|
len = this.length;
|
|
|
|
if ( jQuery.isFunction( value ) ) {
|
|
return this.each(function( j ) {
|
|
jQuery( this ).removeClass( value.call( this, j, this.className ) );
|
|
});
|
|
}
|
|
if ( proceed ) {
|
|
classes = ( value || "" ).match( rnotwhite ) || [];
|
|
|
|
for ( ; i < len; i++ ) {
|
|
elem = this[ i ];
|
|
// This expression is here for better compressibility (see addClass)
|
|
cur = elem.nodeType === 1 && ( elem.className ?
|
|
( " " + elem.className + " " ).replace( rclass, " " ) :
|
|
""
|
|
);
|
|
|
|
if ( cur ) {
|
|
j = 0;
|
|
while ( (clazz = classes[j++]) ) {
|
|
// Remove *all* instances
|
|
while ( cur.indexOf( " " + clazz + " " ) >= 0 ) {
|
|
cur = cur.replace( " " + clazz + " ", " " );
|
|
}
|
|
}
|
|
|
|
// Only assign if different to avoid unneeded rendering.
|
|
finalValue = value ? jQuery.trim( cur ) : "";
|
|
if ( elem.className !== finalValue ) {
|
|
elem.className = finalValue;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
return this;
|
|
},
|
|
|
|
toggleClass: function( value, stateVal ) {
|
|
var type = typeof value;
|
|
|
|
if ( typeof stateVal === "boolean" && type === "string" ) {
|
|
return stateVal ? this.addClass( value ) : this.removeClass( value );
|
|
}
|
|
|
|
if ( jQuery.isFunction( value ) ) {
|
|
return this.each(function( i ) {
|
|
jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal );
|
|
});
|
|
}
|
|
|
|
return this.each(function() {
|
|
if ( type === "string" ) {
|
|
// Toggle individual class names
|
|
var className,
|
|
i = 0,
|
|
self = jQuery( this ),
|
|
classNames = value.match( rnotwhite ) || [];
|
|
|
|
while ( (className = classNames[ i++ ]) ) {
|
|
// Check each className given, space separated list
|
|
if ( self.hasClass( className ) ) {
|
|
self.removeClass( className );
|
|
} else {
|
|
self.addClass( className );
|
|
}
|
|
}
|
|
|
|
// Toggle whole class name
|
|
} else if ( type === strundefined || type === "boolean" ) {
|
|
if ( this.className ) {
|
|
// store className if set
|
|
data_priv.set( this, "__className__", this.className );
|
|
}
|
|
|
|
// If the element has a class name or if we're passed `false`,
|
|
// then remove the whole classname (if there was one, the above saved it).
|
|
// Otherwise bring back whatever was previously saved (if anything),
|
|
// falling back to the empty string if nothing was stored.
|
|
this.className = this.className || value === false ? "" : data_priv.get( this, "__className__" ) || "";
|
|
}
|
|
});
|
|
},
|
|
|
|
hasClass: function( selector ) {
|
|
var className = " " + selector + " ",
|
|
i = 0,
|
|
l = this.length;
|
|
for ( ; i < l; i++ ) {
|
|
if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) >= 0 ) {
|
|
return true;
|
|
}
|
|
}
|
|
|
|
return false;
|
|
}
|
|
});
|
|
|
|
|
|
|
|
|
|
var rreturn = /\r/g;
|
|
|
|
jQuery.fn.extend({
|
|
val: function( value ) {
|
|
var hooks, ret, isFunction,
|
|
elem = this[0];
|
|
|
|
if ( !arguments.length ) {
|
|
if ( elem ) {
|
|
hooks = jQuery.valHooks[ elem.type ] || jQuery.valHooks[ elem.nodeName.toLowerCase() ];
|
|
|
|
if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) {
|
|
return ret;
|
|
}
|
|
|
|
ret = elem.value;
|
|
|
|
return typeof ret === "string" ?
|
|
// Handle most common string cases
|
|
ret.replace(rreturn, "") :
|
|
// Handle cases where value is null/undef or number
|
|
ret == null ? "" : ret;
|
|
}
|
|
|
|
return;
|
|
}
|
|
|
|
isFunction = jQuery.isFunction( value );
|
|
|
|
return this.each(function( i ) {
|
|
var val;
|
|
|
|
if ( this.nodeType !== 1 ) {
|
|
return;
|
|
}
|
|
|
|
if ( isFunction ) {
|
|
val = value.call( this, i, jQuery( this ).val() );
|
|
} else {
|
|
val = value;
|
|
}
|
|
|
|
// Treat null/undefined as ""; convert numbers to string
|
|
if ( val == null ) {
|
|
val = "";
|
|
|
|
} else if ( typeof val === "number" ) {
|
|
val += "";
|
|
|
|
} else if ( jQuery.isArray( val ) ) {
|
|
val = jQuery.map( val, function( value ) {
|
|
return value == null ? "" : value + "";
|
|
});
|
|
}
|
|
|
|
hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ];
|
|
|
|
// If set returns undefined, fall back to normal setting
|
|
if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) {
|
|
this.value = val;
|
|
}
|
|
});
|
|
}
|
|
});
|
|
|
|
jQuery.extend({
|
|
valHooks: {
|
|
option: {
|
|
get: function( elem ) {
|
|
var val = jQuery.find.attr( elem, "value" );
|
|
return val != null ?
|
|
val :
|
|
// Support: IE10-11+
|
|
// option.text throws exceptions (#14686, #14858)
|
|
jQuery.trim( jQuery.text( elem ) );
|
|
}
|
|
},
|
|
select: {
|
|
get: function( elem ) {
|
|
var value, option,
|
|
options = elem.options,
|
|
index = elem.selectedIndex,
|
|
one = elem.type === "select-one" || index < 0,
|
|
values = one ? null : [],
|
|
max = one ? index + 1 : options.length,
|
|
i = index < 0 ?
|
|
max :
|
|
one ? index : 0;
|
|
|
|
// Loop through all the selected options
|
|
for ( ; i < max; i++ ) {
|
|
option = options[ i ];
|
|
|
|
// IE6-9 doesn't update selected after form reset (#2551)
|
|
if ( ( option.selected || i === index ) &&
|
|
// Don't return options that are disabled or in a disabled optgroup
|
|
( support.optDisabled ? !option.disabled : option.getAttribute( "disabled" ) === null ) &&
|
|
( !option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" ) ) ) {
|
|
|
|
// Get the specific value for the option
|
|
value = jQuery( option ).val();
|
|
|
|
// We don't need an array for one selects
|
|
if ( one ) {
|
|
return value;
|
|
}
|
|
|
|
// Multi-Selects return an array
|
|
values.push( value );
|
|
}
|
|
}
|
|
|
|
return values;
|
|
},
|
|
|
|
set: function( elem, value ) {
|
|
var optionSet, option,
|
|
options = elem.options,
|
|
values = jQuery.makeArray( value ),
|
|
i = options.length;
|
|
|
|
while ( i-- ) {
|
|
option = options[ i ];
|
|
if ( (option.selected = jQuery.inArray( option.value, values ) >= 0) ) {
|
|
optionSet = true;
|
|
}
|
|
}
|
|
|
|
// Force browsers to behave consistently when non-matching value is set
|
|
if ( !optionSet ) {
|
|
elem.selectedIndex = -1;
|
|
}
|
|
return values;
|
|
}
|
|
}
|
|
}
|
|
});
|
|
|
|
// Radios and checkboxes getter/setter
|
|
jQuery.each([ "radio", "checkbox" ], function() {
|
|
jQuery.valHooks[ this ] = {
|
|
set: function( elem, value ) {
|
|
if ( jQuery.isArray( value ) ) {
|
|
return ( elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0 );
|
|
}
|
|
}
|
|
};
|
|
if ( !support.checkOn ) {
|
|
jQuery.valHooks[ this ].get = function( elem ) {
|
|
return elem.getAttribute("value") === null ? "on" : elem.value;
|
|
};
|
|
}
|
|
});
|
|
|
|
|
|
|
|
|
|
// Return jQuery for attributes-only inclusion
|
|
|
|
|
|
jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " +
|
|
"mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
|
|
"change select submit keydown keypress keyup error contextmenu").split(" "), function( i, name ) {
|
|
|
|
// Handle event binding
|
|
jQuery.fn[ name ] = function( data, fn ) {
|
|
return arguments.length > 0 ?
|
|
this.on( name, null, data, fn ) :
|
|
this.trigger( name );
|
|
};
|
|
});
|
|
|
|
jQuery.fn.extend({
|
|
hover: function( fnOver, fnOut ) {
|
|
return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver );
|
|
},
|
|
|
|
bind: function( types, data, fn ) {
|
|
return this.on( types, null, data, fn );
|
|
},
|
|
unbind: function( types, fn ) {
|
|
return this.off( types, null, fn );
|
|
},
|
|
|
|
delegate: function( selector, types, data, fn ) {
|
|
return this.on( types, selector, data, fn );
|
|
},
|
|
undelegate: function( selector, types, fn ) {
|
|
// ( namespace ) or ( selector, types [, fn] )
|
|
return arguments.length === 1 ? this.off( selector, "**" ) : this.off( types, selector || "**", fn );
|
|
}
|
|
});
|
|
|
|
|
|
var nonce = jQuery.now();
|
|
|
|
var rquery = (/\?/);
|
|
|
|
|
|
|
|
// Support: Android 2.3
|
|
// Workaround failure to string-cast null input
|
|
jQuery.parseJSON = function( data ) {
|
|
return JSON.parse( data + "" );
|
|
};
|
|
|
|
|
|
// Cross-browser xml parsing
|
|
jQuery.parseXML = function( data ) {
|
|
var xml, tmp;
|
|
if ( !data || typeof data !== "string" ) {
|
|
return null;
|
|
}
|
|
|
|
// Support: IE9
|
|
try {
|
|
tmp = new DOMParser();
|
|
xml = tmp.parseFromString( data, "text/xml" );
|
|
} catch ( e ) {
|
|
xml = undefined;
|
|
}
|
|
|
|
if ( !xml || xml.getElementsByTagName( "parsererror" ).length ) {
|
|
jQuery.error( "Invalid XML: " + data );
|
|
}
|
|
return xml;
|
|
};
|
|
|
|
|
|
var
|
|
rhash = /#.*$/,
|
|
rts = /([?&])_=[^&]*/,
|
|
rheaders = /^(.*?):[ \t]*([^\r\n]*)$/mg,
|
|
// #7653, #8125, #8152: local protocol detection
|
|
rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/,
|
|
rnoContent = /^(?:GET|HEAD)$/,
|
|
rprotocol = /^\/\//,
|
|
rurl = /^([\w.+-]+:)(?:\/\/(?:[^\/?#]*@|)([^\/?#:]*)(?::(\d+)|)|)/,
|
|
|
|
/* Prefilters
|
|
* 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example)
|
|
* 2) These are called:
|
|
* - BEFORE asking for a transport
|
|
* - AFTER param serialization (s.data is a string if s.processData is true)
|
|
* 3) key is the dataType
|
|
* 4) the catchall symbol "*" can be used
|
|
* 5) execution will start with transport dataType and THEN continue down to "*" if needed
|
|
*/
|
|
prefilters = {},
|
|
|
|
/* Transports bindings
|
|
* 1) key is the dataType
|
|
* 2) the catchall symbol "*" can be used
|
|
* 3) selection will start with transport dataType and THEN go to "*" if needed
|
|
*/
|
|
transports = {},
|
|
|
|
// Avoid comment-prolog char sequence (#10098); must appease lint and evade compression
|
|
allTypes = "*/".concat( "*" ),
|
|
|
|
// Document location
|
|
ajaxLocation = window.location.href,
|
|
|
|
// Segment location into parts
|
|
ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ) || [];
|
|
|
|
// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport
|
|
function addToPrefiltersOrTransports( structure ) {
|
|
|
|
// dataTypeExpression is optional and defaults to "*"
|
|
return function( dataTypeExpression, func ) {
|
|
|
|
if ( typeof dataTypeExpression !== "string" ) {
|
|
func = dataTypeExpression;
|
|
dataTypeExpression = "*";
|
|
}
|
|
|
|
var dataType,
|
|
i = 0,
|
|
dataTypes = dataTypeExpression.toLowerCase().match( rnotwhite ) || [];
|
|
|
|
if ( jQuery.isFunction( func ) ) {
|
|
// For each dataType in the dataTypeExpression
|
|
while ( (dataType = dataTypes[i++]) ) {
|
|
// Prepend if requested
|
|
if ( dataType[0] === "+" ) {
|
|
dataType = dataType.slice( 1 ) || "*";
|
|
(structure[ dataType ] = structure[ dataType ] || []).unshift( func );
|
|
|
|
// Otherwise append
|
|
} else {
|
|
(structure[ dataType ] = structure[ dataType ] || []).push( func );
|
|
}
|
|
}
|
|
}
|
|
};
|
|
}
|
|
|
|
// Base inspection function for prefilters and transports
|
|
function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR ) {
|
|
|
|
var inspected = {},
|
|
seekingTransport = ( structure === transports );
|
|
|
|
function inspect( dataType ) {
|
|
var selected;
|
|
inspected[ dataType ] = true;
|
|
jQuery.each( structure[ dataType ] || [], function( _, prefilterOrFactory ) {
|
|
var dataTypeOrTransport = prefilterOrFactory( options, originalOptions, jqXHR );
|
|
if ( typeof dataTypeOrTransport === "string" && !seekingTransport && !inspected[ dataTypeOrTransport ] ) {
|
|
options.dataTypes.unshift( dataTypeOrTransport );
|
|
inspect( dataTypeOrTransport );
|
|
return false;
|
|
} else if ( seekingTransport ) {
|
|
return !( selected = dataTypeOrTransport );
|
|
}
|
|
});
|
|
return selected;
|
|
}
|
|
|
|
return inspect( options.dataTypes[ 0 ] ) || !inspected[ "*" ] && inspect( "*" );
|
|
}
|
|
|
|
// A special extend for ajax options
|
|
// that takes "flat" options (not to be deep extended)
|
|
// Fixes #9887
|
|
function ajaxExtend( target, src ) {
|
|
var key, deep,
|
|
flatOptions = jQuery.ajaxSettings.flatOptions || {};
|
|
|
|
for ( key in src ) {
|
|
if ( src[ key ] !== undefined ) {
|
|
( flatOptions[ key ] ? target : ( deep || (deep = {}) ) )[ key ] = src[ key ];
|
|
}
|
|
}
|
|
if ( deep ) {
|
|
jQuery.extend( true, target, deep );
|
|
}
|
|
|
|
return target;
|
|
}
|
|
|
|
/* Handles responses to an ajax request:
|
|
* - finds the right dataType (mediates between content-type and expected dataType)
|
|
* - returns the corresponding response
|
|
*/
|
|
function ajaxHandleResponses( s, jqXHR, responses ) {
|
|
|
|
var ct, type, finalDataType, firstDataType,
|
|
contents = s.contents,
|
|
dataTypes = s.dataTypes;
|
|
|
|
// Remove auto dataType and get content-type in the process
|
|
while ( dataTypes[ 0 ] === "*" ) {
|
|
dataTypes.shift();
|
|
if ( ct === undefined ) {
|
|
ct = s.mimeType || jqXHR.getResponseHeader("Content-Type");
|
|
}
|
|
}
|
|
|
|
// Check if we're dealing with a known content-type
|
|
if ( ct ) {
|
|
for ( type in contents ) {
|
|
if ( contents[ type ] && contents[ type ].test( ct ) ) {
|
|
dataTypes.unshift( type );
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
|
|
// Check to see if we have a response for the expected dataType
|
|
if ( dataTypes[ 0 ] in responses ) {
|
|
finalDataType = dataTypes[ 0 ];
|
|
} else {
|
|
// Try convertible dataTypes
|
|
for ( type in responses ) {
|
|
if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) {
|
|
finalDataType = type;
|
|
break;
|
|
}
|
|
if ( !firstDataType ) {
|
|
firstDataType = type;
|
|
}
|
|
}
|
|
// Or just use first one
|
|
finalDataType = finalDataType || firstDataType;
|
|
}
|
|
|
|
// If we found a dataType
|
|
// We add the dataType to the list if needed
|
|
// and return the corresponding response
|
|
if ( finalDataType ) {
|
|
if ( finalDataType !== dataTypes[ 0 ] ) {
|
|
dataTypes.unshift( finalDataType );
|
|
}
|
|
return responses[ finalDataType ];
|
|
}
|
|
}
|
|
|
|
/* Chain conversions given the request and the original response
|
|
* Also sets the responseXXX fields on the jqXHR instance
|
|
*/
|
|
function ajaxConvert( s, response, jqXHR, isSuccess ) {
|
|
var conv2, current, conv, tmp, prev,
|
|
converters = {},
|
|
// Work with a copy of dataTypes in case we need to modify it for conversion
|
|
dataTypes = s.dataTypes.slice();
|
|
|
|
// Create converters map with lowercased keys
|
|
if ( dataTypes[ 1 ] ) {
|
|
for ( conv in s.converters ) {
|
|
converters[ conv.toLowerCase() ] = s.converters[ conv ];
|
|
}
|
|
}
|
|
|
|
current = dataTypes.shift();
|
|
|
|
// Convert to each sequential dataType
|
|
while ( current ) {
|
|
|
|
if ( s.responseFields[ current ] ) {
|
|
jqXHR[ s.responseFields[ current ] ] = response;
|
|
}
|
|
|
|
// Apply the dataFilter if provided
|
|
if ( !prev && isSuccess && s.dataFilter ) {
|
|
response = s.dataFilter( response, s.dataType );
|
|
}
|
|
|
|
prev = current;
|
|
current = dataTypes.shift();
|
|
|
|
if ( current ) {
|
|
|
|
// There's only work to do if current dataType is non-auto
|
|
if ( current === "*" ) {
|
|
|
|
current = prev;
|
|
|
|
// Convert response if prev dataType is non-auto and differs from current
|
|
} else if ( prev !== "*" && prev !== current ) {
|
|
|
|
// Seek a direct converter
|
|
conv = converters[ prev + " " + current ] || converters[ "* " + current ];
|
|
|
|
// If none found, seek a pair
|
|
if ( !conv ) {
|
|
for ( conv2 in converters ) {
|
|
|
|
// If conv2 outputs current
|
|
tmp = conv2.split( " " );
|
|
if ( tmp[ 1 ] === current ) {
|
|
|
|
// If prev can be converted to accepted input
|
|
conv = converters[ prev + " " + tmp[ 0 ] ] ||
|
|
converters[ "* " + tmp[ 0 ] ];
|
|
if ( conv ) {
|
|
// Condense equivalence converters
|
|
if ( conv === true ) {
|
|
conv = converters[ conv2 ];
|
|
|
|
// Otherwise, insert the intermediate dataType
|
|
} else if ( converters[ conv2 ] !== true ) {
|
|
current = tmp[ 0 ];
|
|
dataTypes.unshift( tmp[ 1 ] );
|
|
}
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
// Apply converter (if not an equivalence)
|
|
if ( conv !== true ) {
|
|
|
|
// Unless errors are allowed to bubble, catch and return them
|
|
if ( conv && s[ "throws" ] ) {
|
|
response = conv( response );
|
|
} else {
|
|
try {
|
|
response = conv( response );
|
|
} catch ( e ) {
|
|
return { state: "parsererror", error: conv ? e : "No conversion from " + prev + " to " + current };
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
return { state: "success", data: response };
|
|
}
|
|
|
|
jQuery.extend({
|
|
|
|
// Counter for holding the number of active queries
|
|
active: 0,
|
|
|
|
// Last-Modified header cache for next request
|
|
lastModified: {},
|
|
etag: {},
|
|
|
|
ajaxSettings: {
|
|
url: ajaxLocation,
|
|
type: "GET",
|
|
isLocal: rlocalProtocol.test( ajaxLocParts[ 1 ] ),
|
|
global: true,
|
|
processData: true,
|
|
async: true,
|
|
contentType: "application/x-www-form-urlencoded; charset=UTF-8",
|
|
/*
|
|
timeout: 0,
|
|
data: null,
|
|
dataType: null,
|
|
username: null,
|
|
password: null,
|
|
cache: null,
|
|
throws: false,
|
|
traditional: false,
|
|
headers: {},
|
|
*/
|
|
|
|
accepts: {
|
|
"*": allTypes,
|
|
text: "text/plain",
|
|
html: "text/html",
|
|
xml: "application/xml, text/xml",
|
|
json: "application/json, text/javascript"
|
|
},
|
|
|
|
contents: {
|
|
xml: /xml/,
|
|
html: /html/,
|
|
json: /json/
|
|
},
|
|
|
|
responseFields: {
|
|
xml: "responseXML",
|
|
text: "responseText",
|
|
json: "responseJSON"
|
|
},
|
|
|
|
// Data converters
|
|
// Keys separate source (or catchall "*") and destination types with a single space
|
|
converters: {
|
|
|
|
// Convert anything to text
|
|
"* text": String,
|
|
|
|
// Text to html (true = no transformation)
|
|
"text html": true,
|
|
|
|
// Evaluate text as a json expression
|
|
"text json": jQuery.parseJSON,
|
|
|
|
// Parse text as xml
|
|
"text xml": jQuery.parseXML
|
|
},
|
|
|
|
// For options that shouldn't be deep extended:
|
|
// you can add your own custom options here if
|
|
// and when you create one that shouldn't be
|
|
// deep extended (see ajaxExtend)
|
|
flatOptions: {
|
|
url: true,
|
|
context: true
|
|
}
|
|
},
|
|
|
|
// Creates a full fledged settings object into target
|
|
// with both ajaxSettings and settings fields.
|
|
// If target is omitted, writes into ajaxSettings.
|
|
ajaxSetup: function( target, settings ) {
|
|
return settings ?
|
|
|
|
// Building a settings object
|
|
ajaxExtend( ajaxExtend( target, jQuery.ajaxSettings ), settings ) :
|
|
|
|
// Extending ajaxSettings
|
|
ajaxExtend( jQuery.ajaxSettings, target );
|
|
},
|
|
|
|
ajaxPrefilter: addToPrefiltersOrTransports( prefilters ),
|
|
ajaxTransport: addToPrefiltersOrTransports( transports ),
|
|
|
|
// Main method
|
|
ajax: function( url, options ) {
|
|
|
|
// If url is an object, simulate pre-1.5 signature
|
|
if ( typeof url === "object" ) {
|
|
options = url;
|
|
url = undefined;
|
|
}
|
|
|
|
// Force options to be an object
|
|
options = options || {};
|
|
|
|
var transport,
|
|
// URL without anti-cache param
|
|
cacheURL,
|
|
// Response headers
|
|
responseHeadersString,
|
|
responseHeaders,
|
|
// timeout handle
|
|
timeoutTimer,
|
|
// Cross-domain detection vars
|
|
parts,
|
|
// To know if global events are to be dispatched
|
|
fireGlobals,
|
|
// Loop variable
|
|
i,
|
|
// Create the final options object
|
|
s = jQuery.ajaxSetup( {}, options ),
|
|
// Callbacks context
|
|
callbackContext = s.context || s,
|
|
// Context for global events is callbackContext if it is a DOM node or jQuery collection
|
|
globalEventContext = s.context && ( callbackContext.nodeType || callbackContext.jquery ) ?
|
|
jQuery( callbackContext ) :
|
|
jQuery.event,
|
|
// Deferreds
|
|
deferred = jQuery.Deferred(),
|
|
completeDeferred = jQuery.Callbacks("once memory"),
|
|
// Status-dependent callbacks
|
|
statusCode = s.statusCode || {},
|
|
// Headers (they are sent all at once)
|
|
requestHeaders = {},
|
|
requestHeadersNames = {},
|
|
// The jqXHR state
|
|
state = 0,
|
|
// Default abort message
|
|
strAbort = "canceled",
|
|
// Fake xhr
|
|
jqXHR = {
|
|
readyState: 0,
|
|
|
|
// Builds headers hashtable if needed
|
|
getResponseHeader: function( key ) {
|
|
var match;
|
|
if ( state === 2 ) {
|
|
if ( !responseHeaders ) {
|
|
responseHeaders = {};
|
|
while ( (match = rheaders.exec( responseHeadersString )) ) {
|
|
responseHeaders[ match[1].toLowerCase() ] = match[ 2 ];
|
|
}
|
|
}
|
|
match = responseHeaders[ key.toLowerCase() ];
|
|
}
|
|
return match == null ? null : match;
|
|
},
|
|
|
|
// Raw string
|
|
getAllResponseHeaders: function() {
|
|
return state === 2 ? responseHeadersString : null;
|
|
},
|
|
|
|
// Caches the header
|
|
setRequestHeader: function( name, value ) {
|
|
var lname = name.toLowerCase();
|
|
if ( !state ) {
|
|
name = requestHeadersNames[ lname ] = requestHeadersNames[ lname ] || name;
|
|
requestHeaders[ name ] = value;
|
|
}
|
|
return this;
|
|
},
|
|
|
|
// Overrides response content-type header
|
|
overrideMimeType: function( type ) {
|
|
if ( !state ) {
|
|
s.mimeType = type;
|
|
}
|
|
return this;
|
|
},
|
|
|
|
// Status-dependent callbacks
|
|
statusCode: function( map ) {
|
|
var code;
|
|
if ( map ) {
|
|
if ( state < 2 ) {
|
|
for ( code in map ) {
|
|
// Lazy-add the new callback in a way that preserves old ones
|
|
statusCode[ code ] = [ statusCode[ code ], map[ code ] ];
|
|
}
|
|
} else {
|
|
// Execute the appropriate callbacks
|
|
jqXHR.always( map[ jqXHR.status ] );
|
|
}
|
|
}
|
|
return this;
|
|
},
|
|
|
|
// Cancel the request
|
|
abort: function( statusText ) {
|
|
var finalText = statusText || strAbort;
|
|
if ( transport ) {
|
|
transport.abort( finalText );
|
|
}
|
|
done( 0, finalText );
|
|
return this;
|
|
}
|
|
};
|
|
|
|
// Attach deferreds
|
|
deferred.promise( jqXHR ).complete = completeDeferred.add;
|
|
jqXHR.success = jqXHR.done;
|
|
jqXHR.error = jqXHR.fail;
|
|
|
|
// Remove hash character (#7531: and string promotion)
|
|
// Add protocol if not provided (prefilters might expect it)
|
|
// Handle falsy url in the settings object (#10093: consistency with old signature)
|
|
// We also use the url parameter if available
|
|
s.url = ( ( url || s.url || ajaxLocation ) + "" ).replace( rhash, "" )
|
|
.replace( rprotocol, ajaxLocParts[ 1 ] + "//" );
|
|
|
|
// Alias method option to type as per ticket #12004
|
|
s.type = options.method || options.type || s.method || s.type;
|
|
|
|
// Extract dataTypes list
|
|
s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().match( rnotwhite ) || [ "" ];
|
|
|
|
// A cross-domain request is in order when we have a protocol:host:port mismatch
|
|
if ( s.crossDomain == null ) {
|
|
parts = rurl.exec( s.url.toLowerCase() );
|
|
s.crossDomain = !!( parts &&
|
|
( parts[ 1 ] !== ajaxLocParts[ 1 ] || parts[ 2 ] !== ajaxLocParts[ 2 ] ||
|
|
( parts[ 3 ] || ( parts[ 1 ] === "http:" ? "80" : "443" ) ) !==
|
|
( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? "80" : "443" ) ) )
|
|
);
|
|
}
|
|
|
|
// Convert data if not already a string
|
|
if ( s.data && s.processData && typeof s.data !== "string" ) {
|
|
s.data = jQuery.param( s.data, s.traditional );
|
|
}
|
|
|
|
// Apply prefilters
|
|
inspectPrefiltersOrTransports( prefilters, s, options, jqXHR );
|
|
|
|
// If request was aborted inside a prefilter, stop there
|
|
if ( state === 2 ) {
|
|
return jqXHR;
|
|
}
|
|
|
|
// We can fire global events as of now if asked to
|
|
// Don't fire events if jQuery.event is undefined in an AMD-usage scenario (#15118)
|
|
fireGlobals = jQuery.event && s.global;
|
|
|
|
// Watch for a new set of requests
|
|
if ( fireGlobals && jQuery.active++ === 0 ) {
|
|
jQuery.event.trigger("ajaxStart");
|
|
}
|
|
|
|
// Uppercase the type
|
|
s.type = s.type.toUpperCase();
|
|
|
|
// Determine if request has content
|
|
s.hasContent = !rnoContent.test( s.type );
|
|
|
|
// Save the URL in case we're toying with the If-Modified-Since
|
|
// and/or If-None-Match header later on
|
|
cacheURL = s.url;
|
|
|
|
// More options handling for requests with no content
|
|
if ( !s.hasContent ) {
|
|
|
|
// If data is available, append data to url
|
|
if ( s.data ) {
|
|
cacheURL = ( s.url += ( rquery.test( cacheURL ) ? "&" : "?" ) + s.data );
|
|
// #9682: remove data so that it's not used in an eventual retry
|
|
delete s.data;
|
|
}
|
|
|
|
// Add anti-cache in url if needed
|
|
if ( s.cache === false ) {
|
|
s.url = rts.test( cacheURL ) ?
|
|
|
|
// If there is already a '_' parameter, set its value
|
|
cacheURL.replace( rts, "$1_=" + nonce++ ) :
|
|
|
|
// Otherwise add one to the end
|
|
cacheURL + ( rquery.test( cacheURL ) ? "&" : "?" ) + "_=" + nonce++;
|
|
}
|
|
}
|
|
|
|
// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
|
|
if ( s.ifModified ) {
|
|
if ( jQuery.lastModified[ cacheURL ] ) {
|
|
jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ cacheURL ] );
|
|
}
|
|
if ( jQuery.etag[ cacheURL ] ) {
|
|
jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ cacheURL ] );
|
|
}
|
|
}
|
|
|
|
// Set the correct header, if data is being sent
|
|
if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) {
|
|
jqXHR.setRequestHeader( "Content-Type", s.contentType );
|
|
}
|
|
|
|
// Set the Accepts header for the server, depending on the dataType
|
|
jqXHR.setRequestHeader(
|
|
"Accept",
|
|
s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ?
|
|
s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) :
|
|
s.accepts[ "*" ]
|
|
);
|
|
|
|
// Check for headers option
|
|
for ( i in s.headers ) {
|
|
jqXHR.setRequestHeader( i, s.headers[ i ] );
|
|
}
|
|
|
|
// Allow custom headers/mimetypes and early abort
|
|
if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) {
|
|
// Abort if not done already and return
|
|
return jqXHR.abort();
|
|
}
|
|
|
|
// Aborting is no longer a cancellation
|
|
strAbort = "abort";
|
|
|
|
// Install callbacks on deferreds
|
|
for ( i in { success: 1, error: 1, complete: 1 } ) {
|
|
jqXHR[ i ]( s[ i ] );
|
|
}
|
|
|
|
// Get transport
|
|
transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR );
|
|
|
|
// If no transport, we auto-abort
|
|
if ( !transport ) {
|
|
done( -1, "No Transport" );
|
|
} else {
|
|
jqXHR.readyState = 1;
|
|
|
|
// Send global event
|
|
if ( fireGlobals ) {
|
|
globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] );
|
|
}
|
|
// Timeout
|
|
if ( s.async && s.timeout > 0 ) {
|
|
timeoutTimer = setTimeout(function() {
|
|
jqXHR.abort("timeout");
|
|
}, s.timeout );
|
|
}
|
|
|
|
try {
|
|
state = 1;
|
|
transport.send( requestHeaders, done );
|
|
} catch ( e ) {
|
|
// Propagate exception as error if not done
|
|
if ( state < 2 ) {
|
|
done( -1, e );
|
|
// Simply rethrow otherwise
|
|
} else {
|
|
throw e;
|
|
}
|
|
}
|
|
}
|
|
|
|
// Callback for when everything is done
|
|
function done( status, nativeStatusText, responses, headers ) {
|
|
var isSuccess, success, error, response, modified,
|
|
statusText = nativeStatusText;
|
|
|
|
// Called once
|
|
if ( state === 2 ) {
|
|
return;
|
|
}
|
|
|
|
// State is "done" now
|
|
state = 2;
|
|
|
|
// Clear timeout if it exists
|
|
if ( timeoutTimer ) {
|
|
clearTimeout( timeoutTimer );
|
|
}
|
|
|
|
// Dereference transport for early garbage collection
|
|
// (no matter how long the jqXHR object will be used)
|
|
transport = undefined;
|
|
|
|
// Cache response headers
|
|
responseHeadersString = headers || "";
|
|
|
|
// Set readyState
|
|
jqXHR.readyState = status > 0 ? 4 : 0;
|
|
|
|
// Determine if successful
|
|
isSuccess = status >= 200 && status < 300 || status === 304;
|
|
|
|
// Get response data
|
|
if ( responses ) {
|
|
response = ajaxHandleResponses( s, jqXHR, responses );
|
|
}
|
|
|
|
// Convert no matter what (that way responseXXX fields are always set)
|
|
response = ajaxConvert( s, response, jqXHR, isSuccess );
|
|
|
|
// If successful, handle type chaining
|
|
if ( isSuccess ) {
|
|
|
|
// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
|
|
if ( s.ifModified ) {
|
|
modified = jqXHR.getResponseHeader("Last-Modified");
|
|
if ( modified ) {
|
|
jQuery.lastModified[ cacheURL ] = modified;
|
|
}
|
|
modified = jqXHR.getResponseHeader("etag");
|
|
if ( modified ) {
|
|
jQuery.etag[ cacheURL ] = modified;
|
|
}
|
|
}
|
|
|
|
// if no content
|
|
if ( status === 204 || s.type === "HEAD" ) {
|
|
statusText = "nocontent";
|
|
|
|
// if not modified
|
|
} else if ( status === 304 ) {
|
|
statusText = "notmodified";
|
|
|
|
// If we have data, let's convert it
|
|
} else {
|
|
statusText = response.state;
|
|
success = response.data;
|
|
error = response.error;
|
|
isSuccess = !error;
|
|
}
|
|
} else {
|
|
// Extract error from statusText and normalize for non-aborts
|
|
error = statusText;
|
|
if ( status || !statusText ) {
|
|
statusText = "error";
|
|
if ( status < 0 ) {
|
|
status = 0;
|
|
}
|
|
}
|
|
}
|
|
|
|
// Set data for the fake xhr object
|
|
jqXHR.status = status;
|
|
jqXHR.statusText = ( nativeStatusText || statusText ) + "";
|
|
|
|
// Success/Error
|
|
if ( isSuccess ) {
|
|
deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] );
|
|
} else {
|
|
deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] );
|
|
}
|
|
|
|
// Status-dependent callbacks
|
|
jqXHR.statusCode( statusCode );
|
|
statusCode = undefined;
|
|
|
|
if ( fireGlobals ) {
|
|
globalEventContext.trigger( isSuccess ? "ajaxSuccess" : "ajaxError",
|
|
[ jqXHR, s, isSuccess ? success : error ] );
|
|
}
|
|
|
|
// Complete
|
|
completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] );
|
|
|
|
if ( fireGlobals ) {
|
|
globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] );
|
|
// Handle the global AJAX counter
|
|
if ( !( --jQuery.active ) ) {
|
|
jQuery.event.trigger("ajaxStop");
|
|
}
|
|
}
|
|
}
|
|
|
|
return jqXHR;
|
|
},
|
|
|
|
getJSON: function( url, data, callback ) {
|
|
return jQuery.get( url, data, callback, "json" );
|
|
},
|
|
|
|
getScript: function( url, callback ) {
|
|
return jQuery.get( url, undefined, callback, "script" );
|
|
}
|
|
});
|
|
|
|
jQuery.each( [ "get", "post" ], function( i, method ) {
|
|
jQuery[ method ] = function( url, data, callback, type ) {
|
|
// Shift arguments if data argument was omitted
|
|
if ( jQuery.isFunction( data ) ) {
|
|
type = type || callback;
|
|
callback = data;
|
|
data = undefined;
|
|
}
|
|
|
|
return jQuery.ajax({
|
|
url: url,
|
|
type: method,
|
|
dataType: type,
|
|
data: data,
|
|
success: callback
|
|
});
|
|
};
|
|
});
|
|
|
|
|
|
jQuery._evalUrl = function( url ) {
|
|
return jQuery.ajax({
|
|
url: url,
|
|
type: "GET",
|
|
dataType: "script",
|
|
async: false,
|
|
global: false,
|
|
"throws": true
|
|
});
|
|
};
|
|
|
|
|
|
jQuery.fn.extend({
|
|
wrapAll: function( html ) {
|
|
var wrap;
|
|
|
|
if ( jQuery.isFunction( html ) ) {
|
|
return this.each(function( i ) {
|
|
jQuery( this ).wrapAll( html.call(this, i) );
|
|
});
|
|
}
|
|
|
|
if ( this[ 0 ] ) {
|
|
|
|
// The elements to wrap the target around
|
|
wrap = jQuery( html, this[ 0 ].ownerDocument ).eq( 0 ).clone( true );
|
|
|
|
if ( this[ 0 ].parentNode ) {
|
|
wrap.insertBefore( this[ 0 ] );
|
|
}
|
|
|
|
wrap.map(function() {
|
|
var elem = this;
|
|
|
|
while ( elem.firstElementChild ) {
|
|
elem = elem.firstElementChild;
|
|
}
|
|
|
|
return elem;
|
|
}).append( this );
|
|
}
|
|
|
|
return this;
|
|
},
|
|
|
|
wrapInner: function( html ) {
|
|
if ( jQuery.isFunction( html ) ) {
|
|
return this.each(function( i ) {
|
|
jQuery( this ).wrapInner( html.call(this, i) );
|
|
});
|
|
}
|
|
|
|
return this.each(function() {
|
|
var self = jQuery( this ),
|
|
contents = self.contents();
|
|
|
|
if ( contents.length ) {
|
|
contents.wrapAll( html );
|
|
|
|
} else {
|
|
self.append( html );
|
|
}
|
|
});
|
|
},
|
|
|
|
wrap: function( html ) {
|
|
var isFunction = jQuery.isFunction( html );
|
|
|
|
return this.each(function( i ) {
|
|
jQuery( this ).wrapAll( isFunction ? html.call(this, i) : html );
|
|
});
|
|
},
|
|
|
|
unwrap: function() {
|
|
return this.parent().each(function() {
|
|
if ( !jQuery.nodeName( this, "body" ) ) {
|
|
jQuery( this ).replaceWith( this.childNodes );
|
|
}
|
|
}).end();
|
|
}
|
|
});
|
|
|
|
|
|
jQuery.expr.filters.hidden = function( elem ) {
|
|
// Support: Opera <= 12.12
|
|
// Opera reports offsetWidths and offsetHeights less than zero on some elements
|
|
return elem.offsetWidth <= 0 && elem.offsetHeight <= 0;
|
|
};
|
|
jQuery.expr.filters.visible = function( elem ) {
|
|
return !jQuery.expr.filters.hidden( elem );
|
|
};
|
|
|
|
|
|
|
|
|
|
var r20 = /%20/g,
|
|
rbracket = /\[\]$/,
|
|
rCRLF = /\r?\n/g,
|
|
rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i,
|
|
rsubmittable = /^(?:input|select|textarea|keygen)/i;
|
|
|
|
function buildParams( prefix, obj, traditional, add ) {
|
|
var name;
|
|
|
|
if ( jQuery.isArray( obj ) ) {
|
|
// Serialize array item.
|
|
jQuery.each( obj, function( i, v ) {
|
|
if ( traditional || rbracket.test( prefix ) ) {
|
|
// Treat each array item as a scalar.
|
|
add( prefix, v );
|
|
|
|
} else {
|
|
// Item is non-scalar (array or object), encode its numeric index.
|
|
buildParams( prefix + "[" + ( typeof v === "object" ? i : "" ) + "]", v, traditional, add );
|
|
}
|
|
});
|
|
|
|
} else if ( !traditional && jQuery.type( obj ) === "object" ) {
|
|
// Serialize object item.
|
|
for ( name in obj ) {
|
|
buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add );
|
|
}
|
|
|
|
} else {
|
|
// Serialize scalar item.
|
|
add( prefix, obj );
|
|
}
|
|
}
|
|
|
|
// Serialize an array of form elements or a set of
|
|
// key/values into a query string
|
|
jQuery.param = function( a, traditional ) {
|
|
var prefix,
|
|
s = [],
|
|
add = function( key, value ) {
|
|
// If value is a function, invoke it and return its value
|
|
value = jQuery.isFunction( value ) ? value() : ( value == null ? "" : value );
|
|
s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value );
|
|
};
|
|
|
|
// Set traditional to true for jQuery <= 1.3.2 behavior.
|
|
if ( traditional === undefined ) {
|
|
traditional = jQuery.ajaxSettings && jQuery.ajaxSettings.traditional;
|
|
}
|
|
|
|
// If an array was passed in, assume that it is an array of form elements.
|
|
if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) {
|
|
// Serialize the form elements
|
|
jQuery.each( a, function() {
|
|
add( this.name, this.value );
|
|
});
|
|
|
|
} else {
|
|
// If traditional, encode the "old" way (the way 1.3.2 or older
|
|
// did it), otherwise encode params recursively.
|
|
for ( prefix in a ) {
|
|
buildParams( prefix, a[ prefix ], traditional, add );
|
|
}
|
|
}
|
|
|
|
// Return the resulting serialization
|
|
return s.join( "&" ).replace( r20, "+" );
|
|
};
|
|
|
|
jQuery.fn.extend({
|
|
serialize: function() {
|
|
return jQuery.param( this.serializeArray() );
|
|
},
|
|
serializeArray: function() {
|
|
return this.map(function() {
|
|
// Can add propHook for "elements" to filter or add form elements
|
|
var elements = jQuery.prop( this, "elements" );
|
|
return elements ? jQuery.makeArray( elements ) : this;
|
|
})
|
|
.filter(function() {
|
|
var type = this.type;
|
|
|
|
// Use .is( ":disabled" ) so that fieldset[disabled] works
|
|
return this.name && !jQuery( this ).is( ":disabled" ) &&
|
|
rsubmittable.test( this.nodeName ) && !rsubmitterTypes.test( type ) &&
|
|
( this.checked || !rcheckableType.test( type ) );
|
|
})
|
|
.map(function( i, elem ) {
|
|
var val = jQuery( this ).val();
|
|
|
|
return val == null ?
|
|
null :
|
|
jQuery.isArray( val ) ?
|
|
jQuery.map( val, function( val ) {
|
|
return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
|
|
}) :
|
|
{ name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
|
|
}).get();
|
|
}
|
|
});
|
|
|
|
|
|
jQuery.ajaxSettings.xhr = function() {
|
|
try {
|
|
return new XMLHttpRequest();
|
|
} catch( e ) {}
|
|
};
|
|
|
|
var xhrId = 0,
|
|
xhrCallbacks = {},
|
|
xhrSuccessStatus = {
|
|
// file protocol always yields status code 0, assume 200
|
|
0: 200,
|
|
// Support: IE9
|
|
// #1450: sometimes IE returns 1223 when it should be 204
|
|
1223: 204
|
|
},
|
|
xhrSupported = jQuery.ajaxSettings.xhr();
|
|
|
|
// Support: IE9
|
|
// Open requests must be manually aborted on unload (#5280)
|
|
// See https://support.microsoft.com/kb/2856746 for more info
|
|
if ( window.attachEvent ) {
|
|
window.attachEvent( "onunload", function() {
|
|
for ( var key in xhrCallbacks ) {
|
|
xhrCallbacks[ key ]();
|
|
}
|
|
});
|
|
}
|
|
|
|
support.cors = !!xhrSupported && ( "withCredentials" in xhrSupported );
|
|
support.ajax = xhrSupported = !!xhrSupported;
|
|
|
|
jQuery.ajaxTransport(function( options ) {
|
|
var callback;
|
|
|
|
// Cross domain only allowed if supported through XMLHttpRequest
|
|
if ( support.cors || xhrSupported && !options.crossDomain ) {
|
|
return {
|
|
send: function( headers, complete ) {
|
|
var i,
|
|
xhr = options.xhr(),
|
|
id = ++xhrId;
|
|
|
|
xhr.open( options.type, options.url, options.async, options.username, options.password );
|
|
|
|
// Apply custom fields if provided
|
|
if ( options.xhrFields ) {
|
|
for ( i in options.xhrFields ) {
|
|
xhr[ i ] = options.xhrFields[ i ];
|
|
}
|
|
}
|
|
|
|
// Override mime type if needed
|
|
if ( options.mimeType && xhr.overrideMimeType ) {
|
|
xhr.overrideMimeType( options.mimeType );
|
|
}
|
|
|
|
// X-Requested-With header
|
|
// For cross-domain requests, seeing as conditions for a preflight are
|
|
// akin to a jigsaw puzzle, we simply never set it to be sure.
|
|
// (it can always be set on a per-request basis or even using ajaxSetup)
|
|
// For same-domain requests, won't change header if already provided.
|
|
if ( !options.crossDomain && !headers["X-Requested-With"] ) {
|
|
headers["X-Requested-With"] = "XMLHttpRequest";
|
|
}
|
|
|
|
// Set headers
|
|
for ( i in headers ) {
|
|
xhr.setRequestHeader( i, headers[ i ] );
|
|
}
|
|
|
|
// Callback
|
|
callback = function( type ) {
|
|
return function() {
|
|
if ( callback ) {
|
|
delete xhrCallbacks[ id ];
|
|
callback = xhr.onload = xhr.onerror = null;
|
|
|
|
if ( type === "abort" ) {
|
|
xhr.abort();
|
|
} else if ( type === "error" ) {
|
|
complete(
|
|
// file: protocol always yields status 0; see #8605, #14207
|
|
xhr.status,
|
|
xhr.statusText
|
|
);
|
|
} else {
|
|
complete(
|
|
xhrSuccessStatus[ xhr.status ] || xhr.status,
|
|
xhr.statusText,
|
|
// Support: IE9
|
|
// Accessing binary-data responseText throws an exception
|
|
// (#11426)
|
|
typeof xhr.responseText === "string" ? {
|
|
text: xhr.responseText
|
|
} : undefined,
|
|
xhr.getAllResponseHeaders()
|
|
);
|
|
}
|
|
}
|
|
};
|
|
};
|
|
|
|
// Listen to events
|
|
xhr.onload = callback();
|
|
xhr.onerror = callback("error");
|
|
|
|
// Create the abort callback
|
|
callback = xhrCallbacks[ id ] = callback("abort");
|
|
|
|
try {
|
|
// Do send the request (this may raise an exception)
|
|
xhr.send( options.hasContent && options.data || null );
|
|
} catch ( e ) {
|
|
// #14683: Only rethrow if this hasn't been notified as an error yet
|
|
if ( callback ) {
|
|
throw e;
|
|
}
|
|
}
|
|
},
|
|
|
|
abort: function() {
|
|
if ( callback ) {
|
|
callback();
|
|
}
|
|
}
|
|
};
|
|
}
|
|
});
|
|
|
|
|
|
|
|
|
|
// Install script dataType
|
|
jQuery.ajaxSetup({
|
|
accepts: {
|
|
script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"
|
|
},
|
|
contents: {
|
|
script: /(?:java|ecma)script/
|
|
},
|
|
converters: {
|
|
"text script": function( text ) {
|
|
jQuery.globalEval( text );
|
|
return text;
|
|
}
|
|
}
|
|
});
|
|
|
|
// Handle cache's special case and crossDomain
|
|
jQuery.ajaxPrefilter( "script", function( s ) {
|
|
if ( s.cache === undefined ) {
|
|
s.cache = false;
|
|
}
|
|
if ( s.crossDomain ) {
|
|
s.type = "GET";
|
|
}
|
|
});
|
|
|
|
// Bind script tag hack transport
|
|
jQuery.ajaxTransport( "script", function( s ) {
|
|
// This transport only deals with cross domain requests
|
|
if ( s.crossDomain ) {
|
|
var script, callback;
|
|
return {
|
|
send: function( _, complete ) {
|
|
script = jQuery("<script>").prop({
|
|
async: true,
|
|
charset: s.scriptCharset,
|
|
src: s.url
|
|
}).on(
|
|
"load error",
|
|
callback = function( evt ) {
|
|
script.remove();
|
|
callback = null;
|
|
if ( evt ) {
|
|
complete( evt.type === "error" ? 404 : 200, evt.type );
|
|
}
|
|
}
|
|
);
|
|
document.head.appendChild( script[ 0 ] );
|
|
},
|
|
abort: function() {
|
|
if ( callback ) {
|
|
callback();
|
|
}
|
|
}
|
|
};
|
|
}
|
|
});
|
|
|
|
|
|
|
|
|
|
var oldCallbacks = [],
|
|
rjsonp = /(=)\?(?=&|$)|\?\?/;
|
|
|
|
// Default jsonp settings
|
|
jQuery.ajaxSetup({
|
|
jsonp: "callback",
|
|
jsonpCallback: function() {
|
|
var callback = oldCallbacks.pop() || ( jQuery.expando + "_" + ( nonce++ ) );
|
|
this[ callback ] = true;
|
|
return callback;
|
|
}
|
|
});
|
|
|
|
// Detect, normalize options and install callbacks for jsonp requests
|
|
jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) {
|
|
|
|
var callbackName, overwritten, responseContainer,
|
|
jsonProp = s.jsonp !== false && ( rjsonp.test( s.url ) ?
|
|
"url" :
|
|
typeof s.data === "string" && !( s.contentType || "" ).indexOf("application/x-www-form-urlencoded") && rjsonp.test( s.data ) && "data"
|
|
);
|
|
|
|
// Handle iff the expected data type is "jsonp" or we have a parameter to set
|
|
if ( jsonProp || s.dataTypes[ 0 ] === "jsonp" ) {
|
|
|
|
// Get callback name, remembering preexisting value associated with it
|
|
callbackName = s.jsonpCallback = jQuery.isFunction( s.jsonpCallback ) ?
|
|
s.jsonpCallback() :
|
|
s.jsonpCallback;
|
|
|
|
// Insert callback into url or form data
|
|
if ( jsonProp ) {
|
|
s[ jsonProp ] = s[ jsonProp ].replace( rjsonp, "$1" + callbackName );
|
|
} else if ( s.jsonp !== false ) {
|
|
s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.jsonp + "=" + callbackName;
|
|
}
|
|
|
|
// Use data converter to retrieve json after script execution
|
|
s.converters["script json"] = function() {
|
|
if ( !responseContainer ) {
|
|
jQuery.error( callbackName + " was not called" );
|
|
}
|
|
return responseContainer[ 0 ];
|
|
};
|
|
|
|
// force json dataType
|
|
s.dataTypes[ 0 ] = "json";
|
|
|
|
// Install callback
|
|
overwritten = window[ callbackName ];
|
|
window[ callbackName ] = function() {
|
|
responseContainer = arguments;
|
|
};
|
|
|
|
// Clean-up function (fires after converters)
|
|
jqXHR.always(function() {
|
|
// Restore preexisting value
|
|
window[ callbackName ] = overwritten;
|
|
|
|
// Save back as free
|
|
if ( s[ callbackName ] ) {
|
|
// make sure that re-using the options doesn't screw things around
|
|
s.jsonpCallback = originalSettings.jsonpCallback;
|
|
|
|
// save the callback name for future use
|
|
oldCallbacks.push( callbackName );
|
|
}
|
|
|
|
// Call if it was a function and we have a response
|
|
if ( responseContainer && jQuery.isFunction( overwritten ) ) {
|
|
overwritten( responseContainer[ 0 ] );
|
|
}
|
|
|
|
responseContainer = overwritten = undefined;
|
|
});
|
|
|
|
// Delegate to script
|
|
return "script";
|
|
}
|
|
});
|
|
|
|
|
|
|
|
|
|
// data: string of html
|
|
// context (optional): If specified, the fragment will be created in this context, defaults to document
|
|
// keepScripts (optional): If true, will include scripts passed in the html string
|
|
jQuery.parseHTML = function( data, context, keepScripts ) {
|
|
if ( !data || typeof data !== "string" ) {
|
|
return null;
|
|
}
|
|
if ( typeof context === "boolean" ) {
|
|
keepScripts = context;
|
|
context = false;
|
|
}
|
|
context = context || document;
|
|
|
|
var parsed = rsingleTag.exec( data ),
|
|
scripts = !keepScripts && [];
|
|
|
|
// Single tag
|
|
if ( parsed ) {
|
|
return [ context.createElement( parsed[1] ) ];
|
|
}
|
|
|
|
parsed = jQuery.buildFragment( [ data ], context, scripts );
|
|
|
|
if ( scripts && scripts.length ) {
|
|
jQuery( scripts ).remove();
|
|
}
|
|
|
|
return jQuery.merge( [], parsed.childNodes );
|
|
};
|
|
|
|
|
|
// Keep a copy of the old load method
|
|
var _load = jQuery.fn.load;
|
|
|
|
/**
|
|
* Load a url into a page
|
|
*/
|
|
jQuery.fn.load = function( url, params, callback ) {
|
|
if ( typeof url !== "string" && _load ) {
|
|
return _load.apply( this, arguments );
|
|
}
|
|
|
|
var selector, type, response,
|
|
self = this,
|
|
off = url.indexOf(" ");
|
|
|
|
if ( off >= 0 ) {
|
|
selector = jQuery.trim( url.slice( off ) );
|
|
url = url.slice( 0, off );
|
|
}
|
|
|
|
// If it's a function
|
|
if ( jQuery.isFunction( params ) ) {
|
|
|
|
// We assume that it's the callback
|
|
callback = params;
|
|
params = undefined;
|
|
|
|
// Otherwise, build a param string
|
|
} else if ( params && typeof params === "object" ) {
|
|
type = "POST";
|
|
}
|
|
|
|
// If we have elements to modify, make the request
|
|
if ( self.length > 0 ) {
|
|
jQuery.ajax({
|
|
url: url,
|
|
|
|
// if "type" variable is undefined, then "GET" method will be used
|
|
type: type,
|
|
dataType: "html",
|
|
data: params
|
|
}).done(function( responseText ) {
|
|
|
|
// Save response for use in complete callback
|
|
response = arguments;
|
|
|
|
self.html( selector ?
|
|
|
|
// If a selector was specified, locate the right elements in a dummy div
|
|
// Exclude scripts to avoid IE 'Permission Denied' errors
|
|
jQuery("<div>").append( jQuery.parseHTML( responseText ) ).find( selector ) :
|
|
|
|
// Otherwise use the full result
|
|
responseText );
|
|
|
|
}).complete( callback && function( jqXHR, status ) {
|
|
self.each( callback, response || [ jqXHR.responseText, status, jqXHR ] );
|
|
});
|
|
}
|
|
|
|
return this;
|
|
};
|
|
|
|
|
|
|
|
|
|
// Attach a bunch of functions for handling common AJAX events
|
|
jQuery.each( [ "ajaxStart", "ajaxStop", "ajaxComplete", "ajaxError", "ajaxSuccess", "ajaxSend" ], function( i, type ) {
|
|
jQuery.fn[ type ] = function( fn ) {
|
|
return this.on( type, fn );
|
|
};
|
|
});
|
|
|
|
|
|
|
|
|
|
jQuery.expr.filters.animated = function( elem ) {
|
|
return jQuery.grep(jQuery.timers, function( fn ) {
|
|
return elem === fn.elem;
|
|
}).length;
|
|
};
|
|
|
|
|
|
|
|
|
|
var docElem = window.document.documentElement;
|
|
|
|
/**
|
|
* Gets a window from an element
|
|
*/
|
|
function getWindow( elem ) {
|
|
return jQuery.isWindow( elem ) ? elem : elem.nodeType === 9 && elem.defaultView;
|
|
}
|
|
|
|
jQuery.offset = {
|
|
setOffset: function( elem, options, i ) {
|
|
var curPosition, curLeft, curCSSTop, curTop, curOffset, curCSSLeft, calculatePosition,
|
|
position = jQuery.css( elem, "position" ),
|
|
curElem = jQuery( elem ),
|
|
props = {};
|
|
|
|
// Set position first, in-case top/left are set even on static elem
|
|
if ( position === "static" ) {
|
|
elem.style.position = "relative";
|
|
}
|
|
|
|
curOffset = curElem.offset();
|
|
curCSSTop = jQuery.css( elem, "top" );
|
|
curCSSLeft = jQuery.css( elem, "left" );
|
|
calculatePosition = ( position === "absolute" || position === "fixed" ) &&
|
|
( curCSSTop + curCSSLeft ).indexOf("auto") > -1;
|
|
|
|
// Need to be able to calculate position if either
|
|
// top or left is auto and position is either absolute or fixed
|
|
if ( calculatePosition ) {
|
|
curPosition = curElem.position();
|
|
curTop = curPosition.top;
|
|
curLeft = curPosition.left;
|
|
|
|
} else {
|
|
curTop = parseFloat( curCSSTop ) || 0;
|
|
curLeft = parseFloat( curCSSLeft ) || 0;
|
|
}
|
|
|
|
if ( jQuery.isFunction( options ) ) {
|
|
options = options.call( elem, i, curOffset );
|
|
}
|
|
|
|
if ( options.top != null ) {
|
|
props.top = ( options.top - curOffset.top ) + curTop;
|
|
}
|
|
if ( options.left != null ) {
|
|
props.left = ( options.left - curOffset.left ) + curLeft;
|
|
}
|
|
|
|
if ( "using" in options ) {
|
|
options.using.call( elem, props );
|
|
|
|
} else {
|
|
curElem.css( props );
|
|
}
|
|
}
|
|
};
|
|
|
|
jQuery.fn.extend({
|
|
offset: function( options ) {
|
|
if ( arguments.length ) {
|
|
return options === undefined ?
|
|
this :
|
|
this.each(function( i ) {
|
|
jQuery.offset.setOffset( this, options, i );
|
|
});
|
|
}
|
|
|
|
var docElem, win,
|
|
elem = this[ 0 ],
|
|
box = { top: 0, left: 0 },
|
|
doc = elem && elem.ownerDocument;
|
|
|
|
if ( !doc ) {
|
|
return;
|
|
}
|
|
|
|
docElem = doc.documentElement;
|
|
|
|
// Make sure it's not a disconnected DOM node
|
|
if ( !jQuery.contains( docElem, elem ) ) {
|
|
return box;
|
|
}
|
|
|
|
// Support: BlackBerry 5, iOS 3 (original iPhone)
|
|
// If we don't have gBCR, just use 0,0 rather than error
|
|
if ( typeof elem.getBoundingClientRect !== strundefined ) {
|
|
box = elem.getBoundingClientRect();
|
|
}
|
|
win = getWindow( doc );
|
|
return {
|
|
top: box.top + win.pageYOffset - docElem.clientTop,
|
|
left: box.left + win.pageXOffset - docElem.clientLeft
|
|
};
|
|
},
|
|
|
|
position: function() {
|
|
if ( !this[ 0 ] ) {
|
|
return;
|
|
}
|
|
|
|
var offsetParent, offset,
|
|
elem = this[ 0 ],
|
|
parentOffset = { top: 0, left: 0 };
|
|
|
|
// Fixed elements are offset from window (parentOffset = {top:0, left: 0}, because it is its only offset parent
|
|
if ( jQuery.css( elem, "position" ) === "fixed" ) {
|
|
// Assume getBoundingClientRect is there when computed position is fixed
|
|
offset = elem.getBoundingClientRect();
|
|
|
|
} else {
|
|
// Get *real* offsetParent
|
|
offsetParent = this.offsetParent();
|
|
|
|
// Get correct offsets
|
|
offset = this.offset();
|
|
if ( !jQuery.nodeName( offsetParent[ 0 ], "html" ) ) {
|
|
parentOffset = offsetParent.offset();
|
|
}
|
|
|
|
// Add offsetParent borders
|
|
parentOffset.top += jQuery.css( offsetParent[ 0 ], "borderTopWidth", true );
|
|
parentOffset.left += jQuery.css( offsetParent[ 0 ], "borderLeftWidth", true );
|
|
}
|
|
|
|
// Subtract parent offsets and element margins
|
|
return {
|
|
top: offset.top - parentOffset.top - jQuery.css( elem, "marginTop", true ),
|
|
left: offset.left - parentOffset.left - jQuery.css( elem, "marginLeft", true )
|
|
};
|
|
},
|
|
|
|
offsetParent: function() {
|
|
return this.map(function() {
|
|
var offsetParent = this.offsetParent || docElem;
|
|
|
|
while ( offsetParent && ( !jQuery.nodeName( offsetParent, "html" ) && jQuery.css( offsetParent, "position" ) === "static" ) ) {
|
|
offsetParent = offsetParent.offsetParent;
|
|
}
|
|
|
|
return offsetParent || docElem;
|
|
});
|
|
}
|
|
});
|
|
|
|
// Create scrollLeft and scrollTop methods
|
|
jQuery.each( { scrollLeft: "pageXOffset", scrollTop: "pageYOffset" }, function( method, prop ) {
|
|
var top = "pageYOffset" === prop;
|
|
|
|
jQuery.fn[ method ] = function( val ) {
|
|
return access( this, function( elem, method, val ) {
|
|
var win = getWindow( elem );
|
|
|
|
if ( val === undefined ) {
|
|
return win ? win[ prop ] : elem[ method ];
|
|
}
|
|
|
|
if ( win ) {
|
|
win.scrollTo(
|
|
!top ? val : window.pageXOffset,
|
|
top ? val : window.pageYOffset
|
|
);
|
|
|
|
} else {
|
|
elem[ method ] = val;
|
|
}
|
|
}, method, val, arguments.length, null );
|
|
};
|
|
});
|
|
|
|
// Support: Safari<7+, Chrome<37+
|
|
// Add the top/left cssHooks using jQuery.fn.position
|
|
// Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084
|
|
// Blink bug: https://code.google.com/p/chromium/issues/detail?id=229280
|
|
// getComputedStyle returns percent when specified for top/left/bottom/right;
|
|
// rather than make the css module depend on the offset module, just check for it here
|
|
jQuery.each( [ "top", "left" ], function( i, prop ) {
|
|
jQuery.cssHooks[ prop ] = addGetHookIf( support.pixelPosition,
|
|
function( elem, computed ) {
|
|
if ( computed ) {
|
|
computed = curCSS( elem, prop );
|
|
// If curCSS returns percentage, fallback to offset
|
|
return rnumnonpx.test( computed ) ?
|
|
jQuery( elem ).position()[ prop ] + "px" :
|
|
computed;
|
|
}
|
|
}
|
|
);
|
|
});
|
|
|
|
|
|
// Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods
|
|
jQuery.each( { Height: "height", Width: "width" }, function( name, type ) {
|
|
jQuery.each( { padding: "inner" + name, content: type, "": "outer" + name }, function( defaultExtra, funcName ) {
|
|
// Margin is only for outerHeight, outerWidth
|
|
jQuery.fn[ funcName ] = function( margin, value ) {
|
|
var chainable = arguments.length && ( defaultExtra || typeof margin !== "boolean" ),
|
|
extra = defaultExtra || ( margin === true || value === true ? "margin" : "border" );
|
|
|
|
return access( this, function( elem, type, value ) {
|
|
var doc;
|
|
|
|
if ( jQuery.isWindow( elem ) ) {
|
|
// As of 5/8/2012 this will yield incorrect results for Mobile Safari, but there
|
|
// isn't a whole lot we can do. See pull request at this URL for discussion:
|
|
// https://github.com/jquery/jquery/pull/764
|
|
return elem.document.documentElement[ "client" + name ];
|
|
}
|
|
|
|
// Get document width or height
|
|
if ( elem.nodeType === 9 ) {
|
|
doc = elem.documentElement;
|
|
|
|
// Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height],
|
|
// whichever is greatest
|
|
return Math.max(
|
|
elem.body[ "scroll" + name ], doc[ "scroll" + name ],
|
|
elem.body[ "offset" + name ], doc[ "offset" + name ],
|
|
doc[ "client" + name ]
|
|
);
|
|
}
|
|
|
|
return value === undefined ?
|
|
// Get width or height on the element, requesting but not forcing parseFloat
|
|
jQuery.css( elem, type, extra ) :
|
|
|
|
// Set width or height on the element
|
|
jQuery.style( elem, type, value, extra );
|
|
}, type, chainable ? margin : undefined, chainable, null );
|
|
};
|
|
});
|
|
});
|
|
|
|
|
|
// The number of elements contained in the matched element set
|
|
jQuery.fn.size = function() {
|
|
return this.length;
|
|
};
|
|
|
|
jQuery.fn.andSelf = jQuery.fn.addBack;
|
|
|
|
|
|
|
|
|
|
// Register as a named AMD module, since jQuery can be concatenated with other
|
|
// files that may use define, but not via a proper concatenation script that
|
|
// understands anonymous AMD modules. A named AMD is safest and most robust
|
|
// way to register. Lowercase jquery is used because AMD module names are
|
|
// derived from file names, and jQuery is normally delivered in a lowercase
|
|
// file name. Do this after creating the global so that if an AMD module wants
|
|
// to call noConflict to hide this version of jQuery, it will work.
|
|
|
|
// Note that for maximum portability, libraries that are not jQuery should
|
|
// declare themselves as anonymous modules, and avoid setting a global if an
|
|
// AMD loader is present. jQuery is a special case. For more information, see
|
|
// https://github.com/jrburke/requirejs/wiki/Updating-existing-libraries#wiki-anon
|
|
|
|
if ( typeof define === "function" && define.amd ) {
|
|
define( "jquery", [], function() {
|
|
return jQuery;
|
|
});
|
|
}
|
|
|
|
|
|
|
|
|
|
var
|
|
// Map over jQuery in case of overwrite
|
|
_jQuery = window.jQuery,
|
|
|
|
// Map over the $ in case of overwrite
|
|
_$ = window.$;
|
|
|
|
jQuery.noConflict = function( deep ) {
|
|
if ( window.$ === jQuery ) {
|
|
window.$ = _$;
|
|
}
|
|
|
|
if ( deep && window.jQuery === jQuery ) {
|
|
window.jQuery = _jQuery;
|
|
}
|
|
|
|
return jQuery;
|
|
};
|
|
|
|
// Expose jQuery and $ identifiers, even in AMD
|
|
// (#7102#comment:10, https://github.com/jquery/jquery/pull/557)
|
|
// and CommonJS for browser emulators (#13566)
|
|
if ( typeof noGlobal === strundefined ) {
|
|
window.jQuery = window.$ = jQuery;
|
|
}
|
|
|
|
|
|
|
|
|
|
return jQuery;
|
|
|
|
}));
|
|
;
|
|
//! moment.js
|
|
//! version : 2.8.4
|
|
//! authors : Tim Wood, Iskren Chernev, Moment.js contributors
|
|
//! license : MIT
|
|
//! momentjs.com
|
|
|
|
(function (undefined) {
|
|
/************************************
|
|
Constants
|
|
************************************/
|
|
|
|
var moment,
|
|
VERSION = '2.8.4',
|
|
// the global-scope this is NOT the global object in Node.js
|
|
globalScope = typeof global !== 'undefined' ? global : this,
|
|
oldGlobalMoment,
|
|
round = Math.round,
|
|
hasOwnProperty = Object.prototype.hasOwnProperty,
|
|
i,
|
|
|
|
YEAR = 0,
|
|
MONTH = 1,
|
|
DATE = 2,
|
|
HOUR = 3,
|
|
MINUTE = 4,
|
|
SECOND = 5,
|
|
MILLISECOND = 6,
|
|
|
|
// internal storage for locale config files
|
|
locales = {},
|
|
|
|
// extra moment internal properties (plugins register props here)
|
|
momentProperties = [],
|
|
|
|
// check for nodeJS
|
|
hasModule = (typeof module !== 'undefined' && module && module.exports),
|
|
|
|
// ASP.NET json date format regex
|
|
aspNetJsonRegex = /^\/?Date\((\-?\d+)/i,
|
|
aspNetTimeSpanJsonRegex = /(\-)?(?:(\d*)\.)?(\d+)\:(\d+)(?:\:(\d+)\.?(\d{3})?)?/,
|
|
|
|
// from http://docs.closure-library.googlecode.com/git/closure_goog_date_date.js.source.html
|
|
// somewhat more in line with 4.4.3.2 2004 spec, but allows decimal anywhere
|
|
isoDurationRegex = /^(-)?P(?:(?:([0-9,.]*)Y)?(?:([0-9,.]*)M)?(?:([0-9,.]*)D)?(?:T(?:([0-9,.]*)H)?(?:([0-9,.]*)M)?(?:([0-9,.]*)S)?)?|([0-9,.]*)W)$/,
|
|
|
|
// format tokens
|
|
formattingTokens = /(\[[^\[]*\])|(\\)?(Mo|MM?M?M?|Do|DDDo|DD?D?D?|ddd?d?|do?|w[o|w]?|W[o|W]?|Q|YYYYYY|YYYYY|YYYY|YY|gg(ggg?)?|GG(GGG?)?|e|E|a|A|hh?|HH?|mm?|ss?|S{1,4}|x|X|zz?|ZZ?|.)/g,
|
|
localFormattingTokens = /(\[[^\[]*\])|(\\)?(LTS|LT|LL?L?L?|l{1,4})/g,
|
|
|
|
// parsing token regexes
|
|
parseTokenOneOrTwoDigits = /\d\d?/, // 0 - 99
|
|
parseTokenOneToThreeDigits = /\d{1,3}/, // 0 - 999
|
|
parseTokenOneToFourDigits = /\d{1,4}/, // 0 - 9999
|
|
parseTokenOneToSixDigits = /[+\-]?\d{1,6}/, // -999,999 - 999,999
|
|
parseTokenDigits = /\d+/, // nonzero number of digits
|
|
parseTokenWord = /[0-9]*['a-z\u00A0-\u05FF\u0700-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]+|[\u0600-\u06FF\/]+(\s*?[\u0600-\u06FF]+){1,2}/i, // any word (or two) characters or numbers including two/three word month in arabic.
|
|
parseTokenTimezone = /Z|[\+\-]\d\d:?\d\d/gi, // +00:00 -00:00 +0000 -0000 or Z
|
|
parseTokenT = /T/i, // T (ISO separator)
|
|
parseTokenOffsetMs = /[\+\-]?\d+/, // 1234567890123
|
|
parseTokenTimestampMs = /[\+\-]?\d+(\.\d{1,3})?/, // 123456789 123456789.123
|
|
|
|
//strict parsing regexes
|
|
parseTokenOneDigit = /\d/, // 0 - 9
|
|
parseTokenTwoDigits = /\d\d/, // 00 - 99
|
|
parseTokenThreeDigits = /\d{3}/, // 000 - 999
|
|
parseTokenFourDigits = /\d{4}/, // 0000 - 9999
|
|
parseTokenSixDigits = /[+-]?\d{6}/, // -999,999 - 999,999
|
|
parseTokenSignedNumber = /[+-]?\d+/, // -inf - inf
|
|
|
|
// iso 8601 regex
|
|
// 0000-00-00 0000-W00 or 0000-W00-0 + T + 00 or 00:00 or 00:00:00 or 00:00:00.000 + +00:00 or +0000 or +00)
|
|
isoRegex = /^\s*(?:[+-]\d{6}|\d{4})-(?:(\d\d-\d\d)|(W\d\d$)|(W\d\d-\d)|(\d\d\d))((T| )(\d\d(:\d\d(:\d\d(\.\d+)?)?)?)?([\+\-]\d\d(?::?\d\d)?|\s*Z)?)?$/,
|
|
|
|
isoFormat = 'YYYY-MM-DDTHH:mm:ssZ',
|
|
|
|
isoDates = [
|
|
['YYYYYY-MM-DD', /[+-]\d{6}-\d{2}-\d{2}/],
|
|
['YYYY-MM-DD', /\d{4}-\d{2}-\d{2}/],
|
|
['GGGG-[W]WW-E', /\d{4}-W\d{2}-\d/],
|
|
['GGGG-[W]WW', /\d{4}-W\d{2}/],
|
|
['YYYY-DDD', /\d{4}-\d{3}/]
|
|
],
|
|
|
|
// iso time formats and regexes
|
|
isoTimes = [
|
|
['HH:mm:ss.SSSS', /(T| )\d\d:\d\d:\d\d\.\d+/],
|
|
['HH:mm:ss', /(T| )\d\d:\d\d:\d\d/],
|
|
['HH:mm', /(T| )\d\d:\d\d/],
|
|
['HH', /(T| )\d\d/]
|
|
],
|
|
|
|
// timezone chunker '+10:00' > ['10', '00'] or '-1530' > ['-15', '30']
|
|
parseTimezoneChunker = /([\+\-]|\d\d)/gi,
|
|
|
|
// getter and setter names
|
|
proxyGettersAndSetters = 'Date|Hours|Minutes|Seconds|Milliseconds'.split('|'),
|
|
unitMillisecondFactors = {
|
|
'Milliseconds' : 1,
|
|
'Seconds' : 1e3,
|
|
'Minutes' : 6e4,
|
|
'Hours' : 36e5,
|
|
'Days' : 864e5,
|
|
'Months' : 2592e6,
|
|
'Years' : 31536e6
|
|
},
|
|
|
|
unitAliases = {
|
|
ms : 'millisecond',
|
|
s : 'second',
|
|
m : 'minute',
|
|
h : 'hour',
|
|
d : 'day',
|
|
D : 'date',
|
|
w : 'week',
|
|
W : 'isoWeek',
|
|
M : 'month',
|
|
Q : 'quarter',
|
|
y : 'year',
|
|
DDD : 'dayOfYear',
|
|
e : 'weekday',
|
|
E : 'isoWeekday',
|
|
gg: 'weekYear',
|
|
GG: 'isoWeekYear'
|
|
},
|
|
|
|
camelFunctions = {
|
|
dayofyear : 'dayOfYear',
|
|
isoweekday : 'isoWeekday',
|
|
isoweek : 'isoWeek',
|
|
weekyear : 'weekYear',
|
|
isoweekyear : 'isoWeekYear'
|
|
},
|
|
|
|
// format function strings
|
|
formatFunctions = {},
|
|
|
|
// default relative time thresholds
|
|
relativeTimeThresholds = {
|
|
s: 45, // seconds to minute
|
|
m: 45, // minutes to hour
|
|
h: 22, // hours to day
|
|
d: 26, // days to month
|
|
M: 11 // months to year
|
|
},
|
|
|
|
// tokens to ordinalize and pad
|
|
ordinalizeTokens = 'DDD w W M D d'.split(' '),
|
|
paddedTokens = 'M D H h m s w W'.split(' '),
|
|
|
|
formatTokenFunctions = {
|
|
M : function () {
|
|
return this.month() + 1;
|
|
},
|
|
MMM : function (format) {
|
|
return this.localeData().monthsShort(this, format);
|
|
},
|
|
MMMM : function (format) {
|
|
return this.localeData().months(this, format);
|
|
},
|
|
D : function () {
|
|
return this.date();
|
|
},
|
|
DDD : function () {
|
|
return this.dayOfYear();
|
|
},
|
|
d : function () {
|
|
return this.day();
|
|
},
|
|
dd : function (format) {
|
|
return this.localeData().weekdaysMin(this, format);
|
|
},
|
|
ddd : function (format) {
|
|
return this.localeData().weekdaysShort(this, format);
|
|
},
|
|
dddd : function (format) {
|
|
return this.localeData().weekdays(this, format);
|
|
},
|
|
w : function () {
|
|
return this.week();
|
|
},
|
|
W : function () {
|
|
return this.isoWeek();
|
|
},
|
|
YY : function () {
|
|
return leftZeroFill(this.year() % 100, 2);
|
|
},
|
|
YYYY : function () {
|
|
return leftZeroFill(this.year(), 4);
|
|
},
|
|
YYYYY : function () {
|
|
return leftZeroFill(this.year(), 5);
|
|
},
|
|
YYYYYY : function () {
|
|
var y = this.year(), sign = y >= 0 ? '+' : '-';
|
|
return sign + leftZeroFill(Math.abs(y), 6);
|
|
},
|
|
gg : function () {
|
|
return leftZeroFill(this.weekYear() % 100, 2);
|
|
},
|
|
gggg : function () {
|
|
return leftZeroFill(this.weekYear(), 4);
|
|
},
|
|
ggggg : function () {
|
|
return leftZeroFill(this.weekYear(), 5);
|
|
},
|
|
GG : function () {
|
|
return leftZeroFill(this.isoWeekYear() % 100, 2);
|
|
},
|
|
GGGG : function () {
|
|
return leftZeroFill(this.isoWeekYear(), 4);
|
|
},
|
|
GGGGG : function () {
|
|
return leftZeroFill(this.isoWeekYear(), 5);
|
|
},
|
|
e : function () {
|
|
return this.weekday();
|
|
},
|
|
E : function () {
|
|
return this.isoWeekday();
|
|
},
|
|
a : function () {
|
|
return this.localeData().meridiem(this.hours(), this.minutes(), true);
|
|
},
|
|
A : function () {
|
|
return this.localeData().meridiem(this.hours(), this.minutes(), false);
|
|
},
|
|
H : function () {
|
|
return this.hours();
|
|
},
|
|
h : function () {
|
|
return this.hours() % 12 || 12;
|
|
},
|
|
m : function () {
|
|
return this.minutes();
|
|
},
|
|
s : function () {
|
|
return this.seconds();
|
|
},
|
|
S : function () {
|
|
return toInt(this.milliseconds() / 100);
|
|
},
|
|
SS : function () {
|
|
return leftZeroFill(toInt(this.milliseconds() / 10), 2);
|
|
},
|
|
SSS : function () {
|
|
return leftZeroFill(this.milliseconds(), 3);
|
|
},
|
|
SSSS : function () {
|
|
return leftZeroFill(this.milliseconds(), 3);
|
|
},
|
|
Z : function () {
|
|
var a = -this.zone(),
|
|
b = '+';
|
|
if (a < 0) {
|
|
a = -a;
|
|
b = '-';
|
|
}
|
|
return b + leftZeroFill(toInt(a / 60), 2) + ':' + leftZeroFill(toInt(a) % 60, 2);
|
|
},
|
|
ZZ : function () {
|
|
var a = -this.zone(),
|
|
b = '+';
|
|
if (a < 0) {
|
|
a = -a;
|
|
b = '-';
|
|
}
|
|
return b + leftZeroFill(toInt(a / 60), 2) + leftZeroFill(toInt(a) % 60, 2);
|
|
},
|
|
z : function () {
|
|
return this.zoneAbbr();
|
|
},
|
|
zz : function () {
|
|
return this.zoneName();
|
|
},
|
|
x : function () {
|
|
return this.valueOf();
|
|
},
|
|
X : function () {
|
|
return this.unix();
|
|
},
|
|
Q : function () {
|
|
return this.quarter();
|
|
}
|
|
},
|
|
|
|
deprecations = {},
|
|
|
|
lists = ['months', 'monthsShort', 'weekdays', 'weekdaysShort', 'weekdaysMin'];
|
|
|
|
// Pick the first defined of two or three arguments. dfl comes from
|
|
// default.
|
|
function dfl(a, b, c) {
|
|
switch (arguments.length) {
|
|
case 2: return a != null ? a : b;
|
|
case 3: return a != null ? a : b != null ? b : c;
|
|
default: throw new Error('Implement me');
|
|
}
|
|
}
|
|
|
|
function hasOwnProp(a, b) {
|
|
return hasOwnProperty.call(a, b);
|
|
}
|
|
|
|
function defaultParsingFlags() {
|
|
// We need to deep clone this object, and es5 standard is not very
|
|
// helpful.
|
|
return {
|
|
empty : false,
|
|
unusedTokens : [],
|
|
unusedInput : [],
|
|
overflow : -2,
|
|
charsLeftOver : 0,
|
|
nullInput : false,
|
|
invalidMonth : null,
|
|
invalidFormat : false,
|
|
userInvalidated : false,
|
|
iso: false
|
|
};
|
|
}
|
|
|
|
function printMsg(msg) {
|
|
if (moment.suppressDeprecationWarnings === false &&
|
|
typeof console !== 'undefined' && console.warn) {
|
|
console.warn('Deprecation warning: ' + msg);
|
|
}
|
|
}
|
|
|
|
function deprecate(msg, fn) {
|
|
var firstTime = true;
|
|
return extend(function () {
|
|
if (firstTime) {
|
|
printMsg(msg);
|
|
firstTime = false;
|
|
}
|
|
return fn.apply(this, arguments);
|
|
}, fn);
|
|
}
|
|
|
|
function deprecateSimple(name, msg) {
|
|
if (!deprecations[name]) {
|
|
printMsg(msg);
|
|
deprecations[name] = true;
|
|
}
|
|
}
|
|
|
|
function padToken(func, count) {
|
|
return function (a) {
|
|
return leftZeroFill(func.call(this, a), count);
|
|
};
|
|
}
|
|
function ordinalizeToken(func, period) {
|
|
return function (a) {
|
|
return this.localeData().ordinal(func.call(this, a), period);
|
|
};
|
|
}
|
|
|
|
while (ordinalizeTokens.length) {
|
|
i = ordinalizeTokens.pop();
|
|
formatTokenFunctions[i + 'o'] = ordinalizeToken(formatTokenFunctions[i], i);
|
|
}
|
|
while (paddedTokens.length) {
|
|
i = paddedTokens.pop();
|
|
formatTokenFunctions[i + i] = padToken(formatTokenFunctions[i], 2);
|
|
}
|
|
formatTokenFunctions.DDDD = padToken(formatTokenFunctions.DDD, 3);
|
|
|
|
|
|
/************************************
|
|
Constructors
|
|
************************************/
|
|
|
|
function Locale() {
|
|
}
|
|
|
|
// Moment prototype object
|
|
function Moment(config, skipOverflow) {
|
|
if (skipOverflow !== false) {
|
|
checkOverflow(config);
|
|
}
|
|
copyConfig(this, config);
|
|
this._d = new Date(+config._d);
|
|
}
|
|
|
|
// Duration Constructor
|
|
function Duration(duration) {
|
|
var normalizedInput = normalizeObjectUnits(duration),
|
|
years = normalizedInput.year || 0,
|
|
quarters = normalizedInput.quarter || 0,
|
|
months = normalizedInput.month || 0,
|
|
weeks = normalizedInput.week || 0,
|
|
days = normalizedInput.day || 0,
|
|
hours = normalizedInput.hour || 0,
|
|
minutes = normalizedInput.minute || 0,
|
|
seconds = normalizedInput.second || 0,
|
|
milliseconds = normalizedInput.millisecond || 0;
|
|
|
|
// representation for dateAddRemove
|
|
this._milliseconds = +milliseconds +
|
|
seconds * 1e3 + // 1000
|
|
minutes * 6e4 + // 1000 * 60
|
|
hours * 36e5; // 1000 * 60 * 60
|
|
// Because of dateAddRemove treats 24 hours as different from a
|
|
// day when working around DST, we need to store them separately
|
|
this._days = +days +
|
|
weeks * 7;
|
|
// It is impossible translate months into days without knowing
|
|
// which months you are are talking about, so we have to store
|
|
// it separately.
|
|
this._months = +months +
|
|
quarters * 3 +
|
|
years * 12;
|
|
|
|
this._data = {};
|
|
|
|
this._locale = moment.localeData();
|
|
|
|
this._bubble();
|
|
}
|
|
|
|
/************************************
|
|
Helpers
|
|
************************************/
|
|
|
|
|
|
function extend(a, b) {
|
|
for (var i in b) {
|
|
if (hasOwnProp(b, i)) {
|
|
a[i] = b[i];
|
|
}
|
|
}
|
|
|
|
if (hasOwnProp(b, 'toString')) {
|
|
a.toString = b.toString;
|
|
}
|
|
|
|
if (hasOwnProp(b, 'valueOf')) {
|
|
a.valueOf = b.valueOf;
|
|
}
|
|
|
|
return a;
|
|
}
|
|
|
|
function copyConfig(to, from) {
|
|
var i, prop, val;
|
|
|
|
if (typeof from._isAMomentObject !== 'undefined') {
|
|
to._isAMomentObject = from._isAMomentObject;
|
|
}
|
|
if (typeof from._i !== 'undefined') {
|
|
to._i = from._i;
|
|
}
|
|
if (typeof from._f !== 'undefined') {
|
|
to._f = from._f;
|
|
}
|
|
if (typeof from._l !== 'undefined') {
|
|
to._l = from._l;
|
|
}
|
|
if (typeof from._strict !== 'undefined') {
|
|
to._strict = from._strict;
|
|
}
|
|
if (typeof from._tzm !== 'undefined') {
|
|
to._tzm = from._tzm;
|
|
}
|
|
if (typeof from._isUTC !== 'undefined') {
|
|
to._isUTC = from._isUTC;
|
|
}
|
|
if (typeof from._offset !== 'undefined') {
|
|
to._offset = from._offset;
|
|
}
|
|
if (typeof from._pf !== 'undefined') {
|
|
to._pf = from._pf;
|
|
}
|
|
if (typeof from._locale !== 'undefined') {
|
|
to._locale = from._locale;
|
|
}
|
|
|
|
if (momentProperties.length > 0) {
|
|
for (i in momentProperties) {
|
|
prop = momentProperties[i];
|
|
val = from[prop];
|
|
if (typeof val !== 'undefined') {
|
|
to[prop] = val;
|
|
}
|
|
}
|
|
}
|
|
|
|
return to;
|
|
}
|
|
|
|
function absRound(number) {
|
|
if (number < 0) {
|
|
return Math.ceil(number);
|
|
} else {
|
|
return Math.floor(number);
|
|
}
|
|
}
|
|
|
|
// left zero fill a number
|
|
// see http://jsperf.com/left-zero-filling for performance comparison
|
|
function leftZeroFill(number, targetLength, forceSign) {
|
|
var output = '' + Math.abs(number),
|
|
sign = number >= 0;
|
|
|
|
while (output.length < targetLength) {
|
|
output = '0' + output;
|
|
}
|
|
return (sign ? (forceSign ? '+' : '') : '-') + output;
|
|
}
|
|
|
|
function positiveMomentsDifference(base, other) {
|
|
var res = {milliseconds: 0, months: 0};
|
|
|
|
res.months = other.month() - base.month() +
|
|
(other.year() - base.year()) * 12;
|
|
if (base.clone().add(res.months, 'M').isAfter(other)) {
|
|
--res.months;
|
|
}
|
|
|
|
res.milliseconds = +other - +(base.clone().add(res.months, 'M'));
|
|
|
|
return res;
|
|
}
|
|
|
|
function momentsDifference(base, other) {
|
|
var res;
|
|
other = makeAs(other, base);
|
|
if (base.isBefore(other)) {
|
|
res = positiveMomentsDifference(base, other);
|
|
} else {
|
|
res = positiveMomentsDifference(other, base);
|
|
res.milliseconds = -res.milliseconds;
|
|
res.months = -res.months;
|
|
}
|
|
|
|
return res;
|
|
}
|
|
|
|
// TODO: remove 'name' arg after deprecation is removed
|
|
function createAdder(direction, name) {
|
|
return function (val, period) {
|
|
var dur, tmp;
|
|
//invert the arguments, but complain about it
|
|
if (period !== null && !isNaN(+period)) {
|
|
deprecateSimple(name, 'moment().' + name + '(period, number) is deprecated. Please use moment().' + name + '(number, period).');
|
|
tmp = val; val = period; period = tmp;
|
|
}
|
|
|
|
val = typeof val === 'string' ? +val : val;
|
|
dur = moment.duration(val, period);
|
|
addOrSubtractDurationFromMoment(this, dur, direction);
|
|
return this;
|
|
};
|
|
}
|
|
|
|
function addOrSubtractDurationFromMoment(mom, duration, isAdding, updateOffset) {
|
|
var milliseconds = duration._milliseconds,
|
|
days = duration._days,
|
|
months = duration._months;
|
|
updateOffset = updateOffset == null ? true : updateOffset;
|
|
|
|
if (milliseconds) {
|
|
mom._d.setTime(+mom._d + milliseconds * isAdding);
|
|
}
|
|
if (days) {
|
|
rawSetter(mom, 'Date', rawGetter(mom, 'Date') + days * isAdding);
|
|
}
|
|
if (months) {
|
|
rawMonthSetter(mom, rawGetter(mom, 'Month') + months * isAdding);
|
|
}
|
|
if (updateOffset) {
|
|
moment.updateOffset(mom, days || months);
|
|
}
|
|
}
|
|
|
|
// check if is an array
|
|
function isArray(input) {
|
|
return Object.prototype.toString.call(input) === '[object Array]';
|
|
}
|
|
|
|
function isDate(input) {
|
|
return Object.prototype.toString.call(input) === '[object Date]' ||
|
|
input instanceof Date;
|
|
}
|
|
|
|
// compare two arrays, return the number of differences
|
|
function compareArrays(array1, array2, dontConvert) {
|
|
var len = Math.min(array1.length, array2.length),
|
|
lengthDiff = Math.abs(array1.length - array2.length),
|
|
diffs = 0,
|
|
i;
|
|
for (i = 0; i < len; i++) {
|
|
if ((dontConvert && array1[i] !== array2[i]) ||
|
|
(!dontConvert && toInt(array1[i]) !== toInt(array2[i]))) {
|
|
diffs++;
|
|
}
|
|
}
|
|
return diffs + lengthDiff;
|
|
}
|
|
|
|
function normalizeUnits(units) {
|
|
if (units) {
|
|
var lowered = units.toLowerCase().replace(/(.)s$/, '$1');
|
|
units = unitAliases[units] || camelFunctions[lowered] || lowered;
|
|
}
|
|
return units;
|
|
}
|
|
|
|
function normalizeObjectUnits(inputObject) {
|
|
var normalizedInput = {},
|
|
normalizedProp,
|
|
prop;
|
|
|
|
for (prop in inputObject) {
|
|
if (hasOwnProp(inputObject, prop)) {
|
|
normalizedProp = normalizeUnits(prop);
|
|
if (normalizedProp) {
|
|
normalizedInput[normalizedProp] = inputObject[prop];
|
|
}
|
|
}
|
|
}
|
|
|
|
return normalizedInput;
|
|
}
|
|
|
|
function makeList(field) {
|
|
var count, setter;
|
|
|
|
if (field.indexOf('week') === 0) {
|
|
count = 7;
|
|
setter = 'day';
|
|
}
|
|
else if (field.indexOf('month') === 0) {
|
|
count = 12;
|
|
setter = 'month';
|
|
}
|
|
else {
|
|
return;
|
|
}
|
|
|
|
moment[field] = function (format, index) {
|
|
var i, getter,
|
|
method = moment._locale[field],
|
|
results = [];
|
|
|
|
if (typeof format === 'number') {
|
|
index = format;
|
|
format = undefined;
|
|
}
|
|
|
|
getter = function (i) {
|
|
var m = moment().utc().set(setter, i);
|
|
return method.call(moment._locale, m, format || '');
|
|
};
|
|
|
|
if (index != null) {
|
|
return getter(index);
|
|
}
|
|
else {
|
|
for (i = 0; i < count; i++) {
|
|
results.push(getter(i));
|
|
}
|
|
return results;
|
|
}
|
|
};
|
|
}
|
|
|
|
function toInt(argumentForCoercion) {
|
|
var coercedNumber = +argumentForCoercion,
|
|
value = 0;
|
|
|
|
if (coercedNumber !== 0 && isFinite(coercedNumber)) {
|
|
if (coercedNumber >= 0) {
|
|
value = Math.floor(coercedNumber);
|
|
} else {
|
|
value = Math.ceil(coercedNumber);
|
|
}
|
|
}
|
|
|
|
return value;
|
|
}
|
|
|
|
function daysInMonth(year, month) {
|
|
return new Date(Date.UTC(year, month + 1, 0)).getUTCDate();
|
|
}
|
|
|
|
function weeksInYear(year, dow, doy) {
|
|
return weekOfYear(moment([year, 11, 31 + dow - doy]), dow, doy).week;
|
|
}
|
|
|
|
function daysInYear(year) {
|
|
return isLeapYear(year) ? 366 : 365;
|
|
}
|
|
|
|
function isLeapYear(year) {
|
|
return (year % 4 === 0 && year % 100 !== 0) || year % 400 === 0;
|
|
}
|
|
|
|
function checkOverflow(m) {
|
|
var overflow;
|
|
if (m._a && m._pf.overflow === -2) {
|
|
overflow =
|
|
m._a[MONTH] < 0 || m._a[MONTH] > 11 ? MONTH :
|
|
m._a[DATE] < 1 || m._a[DATE] > daysInMonth(m._a[YEAR], m._a[MONTH]) ? DATE :
|
|
m._a[HOUR] < 0 || m._a[HOUR] > 24 ||
|
|
(m._a[HOUR] === 24 && (m._a[MINUTE] !== 0 ||
|
|
m._a[SECOND] !== 0 ||
|
|
m._a[MILLISECOND] !== 0)) ? HOUR :
|
|
m._a[MINUTE] < 0 || m._a[MINUTE] > 59 ? MINUTE :
|
|
m._a[SECOND] < 0 || m._a[SECOND] > 59 ? SECOND :
|
|
m._a[MILLISECOND] < 0 || m._a[MILLISECOND] > 999 ? MILLISECOND :
|
|
-1;
|
|
|
|
if (m._pf._overflowDayOfYear && (overflow < YEAR || overflow > DATE)) {
|
|
overflow = DATE;
|
|
}
|
|
|
|
m._pf.overflow = overflow;
|
|
}
|
|
}
|
|
|
|
function isValid(m) {
|
|
if (m._isValid == null) {
|
|
m._isValid = !isNaN(m._d.getTime()) &&
|
|
m._pf.overflow < 0 &&
|
|
!m._pf.empty &&
|
|
!m._pf.invalidMonth &&
|
|
!m._pf.nullInput &&
|
|
!m._pf.invalidFormat &&
|
|
!m._pf.userInvalidated;
|
|
|
|
if (m._strict) {
|
|
m._isValid = m._isValid &&
|
|
m._pf.charsLeftOver === 0 &&
|
|
m._pf.unusedTokens.length === 0 &&
|
|
m._pf.bigHour === undefined;
|
|
}
|
|
}
|
|
return m._isValid;
|
|
}
|
|
|
|
function normalizeLocale(key) {
|
|
return key ? key.toLowerCase().replace('_', '-') : key;
|
|
}
|
|
|
|
// pick the locale from the array
|
|
// try ['en-au', 'en-gb'] as 'en-au', 'en-gb', 'en', as in move through the list trying each
|
|
// substring from most specific to least, but move to the next array item if it's a more specific variant than the current root
|
|
function chooseLocale(names) {
|
|
var i = 0, j, next, locale, split;
|
|
|
|
while (i < names.length) {
|
|
split = normalizeLocale(names[i]).split('-');
|
|
j = split.length;
|
|
next = normalizeLocale(names[i + 1]);
|
|
next = next ? next.split('-') : null;
|
|
while (j > 0) {
|
|
locale = loadLocale(split.slice(0, j).join('-'));
|
|
if (locale) {
|
|
return locale;
|
|
}
|
|
if (next && next.length >= j && compareArrays(split, next, true) >= j - 1) {
|
|
//the next array item is better than a shallower substring of this one
|
|
break;
|
|
}
|
|
j--;
|
|
}
|
|
i++;
|
|
}
|
|
return null;
|
|
}
|
|
|
|
function loadLocale(name) {
|
|
var oldLocale = null;
|
|
if (!locales[name] && hasModule) {
|
|
try {
|
|
oldLocale = moment.locale();
|
|
require('./locale/' + name);
|
|
// because defineLocale currently also sets the global locale, we want to undo that for lazy loaded locales
|
|
moment.locale(oldLocale);
|
|
} catch (e) { }
|
|
}
|
|
return locales[name];
|
|
}
|
|
|
|
// Return a moment from input, that is local/utc/zone equivalent to model.
|
|
function makeAs(input, model) {
|
|
var res, diff;
|
|
if (model._isUTC) {
|
|
res = model.clone();
|
|
diff = (moment.isMoment(input) || isDate(input) ?
|
|
+input : +moment(input)) - (+res);
|
|
// Use low-level api, because this fn is low-level api.
|
|
res._d.setTime(+res._d + diff);
|
|
moment.updateOffset(res, false);
|
|
return res;
|
|
} else {
|
|
return moment(input).local();
|
|
}
|
|
}
|
|
|
|
/************************************
|
|
Locale
|
|
************************************/
|
|
|
|
|
|
extend(Locale.prototype, {
|
|
|
|
set : function (config) {
|
|
var prop, i;
|
|
for (i in config) {
|
|
prop = config[i];
|
|
if (typeof prop === 'function') {
|
|
this[i] = prop;
|
|
} else {
|
|
this['_' + i] = prop;
|
|
}
|
|
}
|
|
// Lenient ordinal parsing accepts just a number in addition to
|
|
// number + (possibly) stuff coming from _ordinalParseLenient.
|
|
this._ordinalParseLenient = new RegExp(this._ordinalParse.source + '|' + /\d{1,2}/.source);
|
|
},
|
|
|
|
_months : 'January_February_March_April_May_June_July_August_September_October_November_December'.split('_'),
|
|
months : function (m) {
|
|
return this._months[m.month()];
|
|
},
|
|
|
|
_monthsShort : 'Jan_Feb_Mar_Apr_May_Jun_Jul_Aug_Sep_Oct_Nov_Dec'.split('_'),
|
|
monthsShort : function (m) {
|
|
return this._monthsShort[m.month()];
|
|
},
|
|
|
|
monthsParse : function (monthName, format, strict) {
|
|
var i, mom, regex;
|
|
|
|
if (!this._monthsParse) {
|
|
this._monthsParse = [];
|
|
this._longMonthsParse = [];
|
|
this._shortMonthsParse = [];
|
|
}
|
|
|
|
for (i = 0; i < 12; i++) {
|
|
// make the regex if we don't have it already
|
|
mom = moment.utc([2000, i]);
|
|
if (strict && !this._longMonthsParse[i]) {
|
|
this._longMonthsParse[i] = new RegExp('^' + this.months(mom, '').replace('.', '') + '$', 'i');
|
|
this._shortMonthsParse[i] = new RegExp('^' + this.monthsShort(mom, '').replace('.', '') + '$', 'i');
|
|
}
|
|
if (!strict && !this._monthsParse[i]) {
|
|
regex = '^' + this.months(mom, '') + '|^' + this.monthsShort(mom, '');
|
|
this._monthsParse[i] = new RegExp(regex.replace('.', ''), 'i');
|
|
}
|
|
// test the regex
|
|
if (strict && format === 'MMMM' && this._longMonthsParse[i].test(monthName)) {
|
|
return i;
|
|
} else if (strict && format === 'MMM' && this._shortMonthsParse[i].test(monthName)) {
|
|
return i;
|
|
} else if (!strict && this._monthsParse[i].test(monthName)) {
|
|
return i;
|
|
}
|
|
}
|
|
},
|
|
|
|
_weekdays : 'Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday'.split('_'),
|
|
weekdays : function (m) {
|
|
return this._weekdays[m.day()];
|
|
},
|
|
|
|
_weekdaysShort : 'Sun_Mon_Tue_Wed_Thu_Fri_Sat'.split('_'),
|
|
weekdaysShort : function (m) {
|
|
return this._weekdaysShort[m.day()];
|
|
},
|
|
|
|
_weekdaysMin : 'Su_Mo_Tu_We_Th_Fr_Sa'.split('_'),
|
|
weekdaysMin : function (m) {
|
|
return this._weekdaysMin[m.day()];
|
|
},
|
|
|
|
weekdaysParse : function (weekdayName) {
|
|
var i, mom, regex;
|
|
|
|
if (!this._weekdaysParse) {
|
|
this._weekdaysParse = [];
|
|
}
|
|
|
|
for (i = 0; i < 7; i++) {
|
|
// make the regex if we don't have it already
|
|
if (!this._weekdaysParse[i]) {
|
|
mom = moment([2000, 1]).day(i);
|
|
regex = '^' + this.weekdays(mom, '') + '|^' + this.weekdaysShort(mom, '') + '|^' + this.weekdaysMin(mom, '');
|
|
this._weekdaysParse[i] = new RegExp(regex.replace('.', ''), 'i');
|
|
}
|
|
// test the regex
|
|
if (this._weekdaysParse[i].test(weekdayName)) {
|
|
return i;
|
|
}
|
|
}
|
|
},
|
|
|
|
_longDateFormat : {
|
|
LTS : 'h:mm:ss A',
|
|
LT : 'h:mm A',
|
|
L : 'MM/DD/YYYY',
|
|
LL : 'MMMM D, YYYY',
|
|
LLL : 'MMMM D, YYYY LT',
|
|
LLLL : 'dddd, MMMM D, YYYY LT'
|
|
},
|
|
longDateFormat : function (key) {
|
|
var output = this._longDateFormat[key];
|
|
if (!output && this._longDateFormat[key.toUpperCase()]) {
|
|
output = this._longDateFormat[key.toUpperCase()].replace(/MMMM|MM|DD|dddd/g, function (val) {
|
|
return val.slice(1);
|
|
});
|
|
this._longDateFormat[key] = output;
|
|
}
|
|
return output;
|
|
},
|
|
|
|
isPM : function (input) {
|
|
// IE8 Quirks Mode & IE7 Standards Mode do not allow accessing strings like arrays
|
|
// Using charAt should be more compatible.
|
|
return ((input + '').toLowerCase().charAt(0) === 'p');
|
|
},
|
|
|
|
_meridiemParse : /[ap]\.?m?\.?/i,
|
|
meridiem : function (hours, minutes, isLower) {
|
|
if (hours > 11) {
|
|
return isLower ? 'pm' : 'PM';
|
|
} else {
|
|
return isLower ? 'am' : 'AM';
|
|
}
|
|
},
|
|
|
|
_calendar : {
|
|
sameDay : '[Today at] LT',
|
|
nextDay : '[Tomorrow at] LT',
|
|
nextWeek : 'dddd [at] LT',
|
|
lastDay : '[Yesterday at] LT',
|
|
lastWeek : '[Last] dddd [at] LT',
|
|
sameElse : 'L'
|
|
},
|
|
calendar : function (key, mom, now) {
|
|
var output = this._calendar[key];
|
|
return typeof output === 'function' ? output.apply(mom, [now]) : output;
|
|
},
|
|
|
|
_relativeTime : {
|
|
future : 'in %s',
|
|
past : '%s ago',
|
|
s : 'a few seconds',
|
|
m : 'a minute',
|
|
mm : '%d minutes',
|
|
h : 'an hour',
|
|
hh : '%d hours',
|
|
d : 'a day',
|
|
dd : '%d days',
|
|
M : 'a month',
|
|
MM : '%d months',
|
|
y : 'a year',
|
|
yy : '%d years'
|
|
},
|
|
|
|
relativeTime : function (number, withoutSuffix, string, isFuture) {
|
|
var output = this._relativeTime[string];
|
|
return (typeof output === 'function') ?
|
|
output(number, withoutSuffix, string, isFuture) :
|
|
output.replace(/%d/i, number);
|
|
},
|
|
|
|
pastFuture : function (diff, output) {
|
|
var format = this._relativeTime[diff > 0 ? 'future' : 'past'];
|
|
return typeof format === 'function' ? format(output) : format.replace(/%s/i, output);
|
|
},
|
|
|
|
ordinal : function (number) {
|
|
return this._ordinal.replace('%d', number);
|
|
},
|
|
_ordinal : '%d',
|
|
_ordinalParse : /\d{1,2}/,
|
|
|
|
preparse : function (string) {
|
|
return string;
|
|
},
|
|
|
|
postformat : function (string) {
|
|
return string;
|
|
},
|
|
|
|
week : function (mom) {
|
|
return weekOfYear(mom, this._week.dow, this._week.doy).week;
|
|
},
|
|
|
|
_week : {
|
|
dow : 0, // Sunday is the first day of the week.
|
|
doy : 6 // The week that contains Jan 1st is the first week of the year.
|
|
},
|
|
|
|
_invalidDate: 'Invalid date',
|
|
invalidDate: function () {
|
|
return this._invalidDate;
|
|
}
|
|
});
|
|
|
|
/************************************
|
|
Formatting
|
|
************************************/
|
|
|
|
|
|
function removeFormattingTokens(input) {
|
|
if (input.match(/\[[\s\S]/)) {
|
|
return input.replace(/^\[|\]$/g, '');
|
|
}
|
|
return input.replace(/\\/g, '');
|
|
}
|
|
|
|
function makeFormatFunction(format) {
|
|
var array = format.match(formattingTokens), i, length;
|
|
|
|
for (i = 0, length = array.length; i < length; i++) {
|
|
if (formatTokenFunctions[array[i]]) {
|
|
array[i] = formatTokenFunctions[array[i]];
|
|
} else {
|
|
array[i] = removeFormattingTokens(array[i]);
|
|
}
|
|
}
|
|
|
|
return function (mom) {
|
|
var output = '';
|
|
for (i = 0; i < length; i++) {
|
|
output += array[i] instanceof Function ? array[i].call(mom, format) : array[i];
|
|
}
|
|
return output;
|
|
};
|
|
}
|
|
|
|
// format date using native date object
|
|
function formatMoment(m, format) {
|
|
if (!m.isValid()) {
|
|
return m.localeData().invalidDate();
|
|
}
|
|
|
|
format = expandFormat(format, m.localeData());
|
|
|
|
if (!formatFunctions[format]) {
|
|
formatFunctions[format] = makeFormatFunction(format);
|
|
}
|
|
|
|
return formatFunctions[format](m);
|
|
}
|
|
|
|
function expandFormat(format, locale) {
|
|
var i = 5;
|
|
|
|
function replaceLongDateFormatTokens(input) {
|
|
return locale.longDateFormat(input) || input;
|
|
}
|
|
|
|
localFormattingTokens.lastIndex = 0;
|
|
while (i >= 0 && localFormattingTokens.test(format)) {
|
|
format = format.replace(localFormattingTokens, replaceLongDateFormatTokens);
|
|
localFormattingTokens.lastIndex = 0;
|
|
i -= 1;
|
|
}
|
|
|
|
return format;
|
|
}
|
|
|
|
|
|
/************************************
|
|
Parsing
|
|
************************************/
|
|
|
|
|
|
// get the regex to find the next token
|
|
function getParseRegexForToken(token, config) {
|
|
var a, strict = config._strict;
|
|
switch (token) {
|
|
case 'Q':
|
|
return parseTokenOneDigit;
|
|
case 'DDDD':
|
|
return parseTokenThreeDigits;
|
|
case 'YYYY':
|
|
case 'GGGG':
|
|
case 'gggg':
|
|
return strict ? parseTokenFourDigits : parseTokenOneToFourDigits;
|
|
case 'Y':
|
|
case 'G':
|
|
case 'g':
|
|
return parseTokenSignedNumber;
|
|
case 'YYYYYY':
|
|
case 'YYYYY':
|
|
case 'GGGGG':
|
|
case 'ggggg':
|
|
return strict ? parseTokenSixDigits : parseTokenOneToSixDigits;
|
|
case 'S':
|
|
if (strict) {
|
|
return parseTokenOneDigit;
|
|
}
|
|
/* falls through */
|
|
case 'SS':
|
|
if (strict) {
|
|
return parseTokenTwoDigits;
|
|
}
|
|
/* falls through */
|
|
case 'SSS':
|
|
if (strict) {
|
|
return parseTokenThreeDigits;
|
|
}
|
|
/* falls through */
|
|
case 'DDD':
|
|
return parseTokenOneToThreeDigits;
|
|
case 'MMM':
|
|
case 'MMMM':
|
|
case 'dd':
|
|
case 'ddd':
|
|
case 'dddd':
|
|
return parseTokenWord;
|
|
case 'a':
|
|
case 'A':
|
|
return config._locale._meridiemParse;
|
|
case 'x':
|
|
return parseTokenOffsetMs;
|
|
case 'X':
|
|
return parseTokenTimestampMs;
|
|
case 'Z':
|
|
case 'ZZ':
|
|
return parseTokenTimezone;
|
|
case 'T':
|
|
return parseTokenT;
|
|
case 'SSSS':
|
|
return parseTokenDigits;
|
|
case 'MM':
|
|
case 'DD':
|
|
case 'YY':
|
|
case 'GG':
|
|
case 'gg':
|
|
case 'HH':
|
|
case 'hh':
|
|
case 'mm':
|
|
case 'ss':
|
|
case 'ww':
|
|
case 'WW':
|
|
return strict ? parseTokenTwoDigits : parseTokenOneOrTwoDigits;
|
|
case 'M':
|
|
case 'D':
|
|
case 'd':
|
|
case 'H':
|
|
case 'h':
|
|
case 'm':
|
|
case 's':
|
|
case 'w':
|
|
case 'W':
|
|
case 'e':
|
|
case 'E':
|
|
return parseTokenOneOrTwoDigits;
|
|
case 'Do':
|
|
return strict ? config._locale._ordinalParse : config._locale._ordinalParseLenient;
|
|
default :
|
|
a = new RegExp(regexpEscape(unescapeFormat(token.replace('\\', '')), 'i'));
|
|
return a;
|
|
}
|
|
}
|
|
|
|
function timezoneMinutesFromString(string) {
|
|
string = string || '';
|
|
var possibleTzMatches = (string.match(parseTokenTimezone) || []),
|
|
tzChunk = possibleTzMatches[possibleTzMatches.length - 1] || [],
|
|
parts = (tzChunk + '').match(parseTimezoneChunker) || ['-', 0, 0],
|
|
minutes = +(parts[1] * 60) + toInt(parts[2]);
|
|
|
|
return parts[0] === '+' ? -minutes : minutes;
|
|
}
|
|
|
|
// function to convert string input to date
|
|
function addTimeToArrayFromToken(token, input, config) {
|
|
var a, datePartArray = config._a;
|
|
|
|
switch (token) {
|
|
// QUARTER
|
|
case 'Q':
|
|
if (input != null) {
|
|
datePartArray[MONTH] = (toInt(input) - 1) * 3;
|
|
}
|
|
break;
|
|
// MONTH
|
|
case 'M' : // fall through to MM
|
|
case 'MM' :
|
|
if (input != null) {
|
|
datePartArray[MONTH] = toInt(input) - 1;
|
|
}
|
|
break;
|
|
case 'MMM' : // fall through to MMMM
|
|
case 'MMMM' :
|
|
a = config._locale.monthsParse(input, token, config._strict);
|
|
// if we didn't find a month name, mark the date as invalid.
|
|
if (a != null) {
|
|
datePartArray[MONTH] = a;
|
|
} else {
|
|
config._pf.invalidMonth = input;
|
|
}
|
|
break;
|
|
// DAY OF MONTH
|
|
case 'D' : // fall through to DD
|
|
case 'DD' :
|
|
if (input != null) {
|
|
datePartArray[DATE] = toInt(input);
|
|
}
|
|
break;
|
|
case 'Do' :
|
|
if (input != null) {
|
|
datePartArray[DATE] = toInt(parseInt(
|
|
input.match(/\d{1,2}/)[0], 10));
|
|
}
|
|
break;
|
|
// DAY OF YEAR
|
|
case 'DDD' : // fall through to DDDD
|
|
case 'DDDD' :
|
|
if (input != null) {
|
|
config._dayOfYear = toInt(input);
|
|
}
|
|
|
|
break;
|
|
// YEAR
|
|
case 'YY' :
|
|
datePartArray[YEAR] = moment.parseTwoDigitYear(input);
|
|
break;
|
|
case 'YYYY' :
|
|
case 'YYYYY' :
|
|
case 'YYYYYY' :
|
|
datePartArray[YEAR] = toInt(input);
|
|
break;
|
|
// AM / PM
|
|
case 'a' : // fall through to A
|
|
case 'A' :
|
|
config._isPm = config._locale.isPM(input);
|
|
break;
|
|
// HOUR
|
|
case 'h' : // fall through to hh
|
|
case 'hh' :
|
|
config._pf.bigHour = true;
|
|
/* falls through */
|
|
case 'H' : // fall through to HH
|
|
case 'HH' :
|
|
datePartArray[HOUR] = toInt(input);
|
|
break;
|
|
// MINUTE
|
|
case 'm' : // fall through to mm
|
|
case 'mm' :
|
|
datePartArray[MINUTE] = toInt(input);
|
|
break;
|
|
// SECOND
|
|
case 's' : // fall through to ss
|
|
case 'ss' :
|
|
datePartArray[SECOND] = toInt(input);
|
|
break;
|
|
// MILLISECOND
|
|
case 'S' :
|
|
case 'SS' :
|
|
case 'SSS' :
|
|
case 'SSSS' :
|
|
datePartArray[MILLISECOND] = toInt(('0.' + input) * 1000);
|
|
break;
|
|
// UNIX OFFSET (MILLISECONDS)
|
|
case 'x':
|
|
config._d = new Date(toInt(input));
|
|
break;
|
|
// UNIX TIMESTAMP WITH MS
|
|
case 'X':
|
|
config._d = new Date(parseFloat(input) * 1000);
|
|
break;
|
|
// TIMEZONE
|
|
case 'Z' : // fall through to ZZ
|
|
case 'ZZ' :
|
|
config._useUTC = true;
|
|
config._tzm = timezoneMinutesFromString(input);
|
|
break;
|
|
// WEEKDAY - human
|
|
case 'dd':
|
|
case 'ddd':
|
|
case 'dddd':
|
|
a = config._locale.weekdaysParse(input);
|
|
// if we didn't get a weekday name, mark the date as invalid
|
|
if (a != null) {
|
|
config._w = config._w || {};
|
|
config._w['d'] = a;
|
|
} else {
|
|
config._pf.invalidWeekday = input;
|
|
}
|
|
break;
|
|
// WEEK, WEEK DAY - numeric
|
|
case 'w':
|
|
case 'ww':
|
|
case 'W':
|
|
case 'WW':
|
|
case 'd':
|
|
case 'e':
|
|
case 'E':
|
|
token = token.substr(0, 1);
|
|
/* falls through */
|
|
case 'gggg':
|
|
case 'GGGG':
|
|
case 'GGGGG':
|
|
token = token.substr(0, 2);
|
|
if (input) {
|
|
config._w = config._w || {};
|
|
config._w[token] = toInt(input);
|
|
}
|
|
break;
|
|
case 'gg':
|
|
case 'GG':
|
|
config._w = config._w || {};
|
|
config._w[token] = moment.parseTwoDigitYear(input);
|
|
}
|
|
}
|
|
|
|
function dayOfYearFromWeekInfo(config) {
|
|
var w, weekYear, week, weekday, dow, doy, temp;
|
|
|
|
w = config._w;
|
|
if (w.GG != null || w.W != null || w.E != null) {
|
|
dow = 1;
|
|
doy = 4;
|
|
|
|
// TODO: We need to take the current isoWeekYear, but that depends on
|
|
// how we interpret now (local, utc, fixed offset). So create
|
|
// a now version of current config (take local/utc/offset flags, and
|
|
// create now).
|
|
weekYear = dfl(w.GG, config._a[YEAR], weekOfYear(moment(), 1, 4).year);
|
|
week = dfl(w.W, 1);
|
|
weekday = dfl(w.E, 1);
|
|
} else {
|
|
dow = config._locale._week.dow;
|
|
doy = config._locale._week.doy;
|
|
|
|
weekYear = dfl(w.gg, config._a[YEAR], weekOfYear(moment(), dow, doy).year);
|
|
week = dfl(w.w, 1);
|
|
|
|
if (w.d != null) {
|
|
// weekday -- low day numbers are considered next week
|
|
weekday = w.d;
|
|
if (weekday < dow) {
|
|
++week;
|
|
}
|
|
} else if (w.e != null) {
|
|
// local weekday -- counting starts from begining of week
|
|
weekday = w.e + dow;
|
|
} else {
|
|
// default to begining of week
|
|
weekday = dow;
|
|
}
|
|
}
|
|
temp = dayOfYearFromWeeks(weekYear, week, weekday, doy, dow);
|
|
|
|
config._a[YEAR] = temp.year;
|
|
config._dayOfYear = temp.dayOfYear;
|
|
}
|
|
|
|
// convert an array to a date.
|
|
// the array should mirror the parameters below
|
|
// note: all values past the year are optional and will default to the lowest possible value.
|
|
// [year, month, day , hour, minute, second, millisecond]
|
|
function dateFromConfig(config) {
|
|
var i, date, input = [], currentDate, yearToUse;
|
|
|
|
if (config._d) {
|
|
return;
|
|
}
|
|
|
|
currentDate = currentDateArray(config);
|
|
|
|
//compute day of the year from weeks and weekdays
|
|
if (config._w && config._a[DATE] == null && config._a[MONTH] == null) {
|
|
dayOfYearFromWeekInfo(config);
|
|
}
|
|
|
|
//if the day of the year is set, figure out what it is
|
|
if (config._dayOfYear) {
|
|
yearToUse = dfl(config._a[YEAR], currentDate[YEAR]);
|
|
|
|
if (config._dayOfYear > daysInYear(yearToUse)) {
|
|
config._pf._overflowDayOfYear = true;
|
|
}
|
|
|
|
date = makeUTCDate(yearToUse, 0, config._dayOfYear);
|
|
config._a[MONTH] = date.getUTCMonth();
|
|
config._a[DATE] = date.getUTCDate();
|
|
}
|
|
|
|
// Default to current date.
|
|
// * if no year, month, day of month are given, default to today
|
|
// * if day of month is given, default month and year
|
|
// * if month is given, default only year
|
|
// * if year is given, don't default anything
|
|
for (i = 0; i < 3 && config._a[i] == null; ++i) {
|
|
config._a[i] = input[i] = currentDate[i];
|
|
}
|
|
|
|
// Zero out whatever was not defaulted, including time
|
|
for (; i < 7; i++) {
|
|
config._a[i] = input[i] = (config._a[i] == null) ? (i === 2 ? 1 : 0) : config._a[i];
|
|
}
|
|
|
|
// Check for 24:00:00.000
|
|
if (config._a[HOUR] === 24 &&
|
|
config._a[MINUTE] === 0 &&
|
|
config._a[SECOND] === 0 &&
|
|
config._a[MILLISECOND] === 0) {
|
|
config._nextDay = true;
|
|
config._a[HOUR] = 0;
|
|
}
|
|
|
|
config._d = (config._useUTC ? makeUTCDate : makeDate).apply(null, input);
|
|
// Apply timezone offset from input. The actual zone can be changed
|
|
// with parseZone.
|
|
if (config._tzm != null) {
|
|
config._d.setUTCMinutes(config._d.getUTCMinutes() + config._tzm);
|
|
}
|
|
|
|
if (config._nextDay) {
|
|
config._a[HOUR] = 24;
|
|
}
|
|
}
|
|
|
|
function dateFromObject(config) {
|
|
var normalizedInput;
|
|
|
|
if (config._d) {
|
|
return;
|
|
}
|
|
|
|
normalizedInput = normalizeObjectUnits(config._i);
|
|
config._a = [
|
|
normalizedInput.year,
|
|
normalizedInput.month,
|
|
normalizedInput.day || normalizedInput.date,
|
|
normalizedInput.hour,
|
|
normalizedInput.minute,
|
|
normalizedInput.second,
|
|
normalizedInput.millisecond
|
|
];
|
|
|
|
dateFromConfig(config);
|
|
}
|
|
|
|
function currentDateArray(config) {
|
|
var now = new Date();
|
|
if (config._useUTC) {
|
|
return [
|
|
now.getUTCFullYear(),
|
|
now.getUTCMonth(),
|
|
now.getUTCDate()
|
|
];
|
|
} else {
|
|
return [now.getFullYear(), now.getMonth(), now.getDate()];
|
|
}
|
|
}
|
|
|
|
// date from string and format string
|
|
function makeDateFromStringAndFormat(config) {
|
|
if (config._f === moment.ISO_8601) {
|
|
parseISO(config);
|
|
return;
|
|
}
|
|
|
|
config._a = [];
|
|
config._pf.empty = true;
|
|
|
|
// This array is used to make a Date, either with `new Date` or `Date.UTC`
|
|
var string = '' + config._i,
|
|
i, parsedInput, tokens, token, skipped,
|
|
stringLength = string.length,
|
|
totalParsedInputLength = 0;
|
|
|
|
tokens = expandFormat(config._f, config._locale).match(formattingTokens) || [];
|
|
|
|
for (i = 0; i < tokens.length; i++) {
|
|
token = tokens[i];
|
|
parsedInput = (string.match(getParseRegexForToken(token, config)) || [])[0];
|
|
if (parsedInput) {
|
|
skipped = string.substr(0, string.indexOf(parsedInput));
|
|
if (skipped.length > 0) {
|
|
config._pf.unusedInput.push(skipped);
|
|
}
|
|
string = string.slice(string.indexOf(parsedInput) + parsedInput.length);
|
|
totalParsedInputLength += parsedInput.length;
|
|
}
|
|
// don't parse if it's not a known token
|
|
if (formatTokenFunctions[token]) {
|
|
if (parsedInput) {
|
|
config._pf.empty = false;
|
|
}
|
|
else {
|
|
config._pf.unusedTokens.push(token);
|
|
}
|
|
addTimeToArrayFromToken(token, parsedInput, config);
|
|
}
|
|
else if (config._strict && !parsedInput) {
|
|
config._pf.unusedTokens.push(token);
|
|
}
|
|
}
|
|
|
|
// add remaining unparsed input length to the string
|
|
config._pf.charsLeftOver = stringLength - totalParsedInputLength;
|
|
if (string.length > 0) {
|
|
config._pf.unusedInput.push(string);
|
|
}
|
|
|
|
// clear _12h flag if hour is <= 12
|
|
if (config._pf.bigHour === true && config._a[HOUR] <= 12) {
|
|
config._pf.bigHour = undefined;
|
|
}
|
|
// handle am pm
|
|
if (config._isPm && config._a[HOUR] < 12) {
|
|
config._a[HOUR] += 12;
|
|
}
|
|
// if is 12 am, change hours to 0
|
|
if (config._isPm === false && config._a[HOUR] === 12) {
|
|
config._a[HOUR] = 0;
|
|
}
|
|
dateFromConfig(config);
|
|
checkOverflow(config);
|
|
}
|
|
|
|
function unescapeFormat(s) {
|
|
return s.replace(/\\(\[)|\\(\])|\[([^\]\[]*)\]|\\(.)/g, function (matched, p1, p2, p3, p4) {
|
|
return p1 || p2 || p3 || p4;
|
|
});
|
|
}
|
|
|
|
// Code from http://stackoverflow.com/questions/3561493/is-there-a-regexp-escape-function-in-javascript
|
|
function regexpEscape(s) {
|
|
return s.replace(/[-\/\\^$*+?.()|[\]{}]/g, '\\$&');
|
|
}
|
|
|
|
// date from string and array of format strings
|
|
function makeDateFromStringAndArray(config) {
|
|
var tempConfig,
|
|
bestMoment,
|
|
|
|
scoreToBeat,
|
|
i,
|
|
currentScore;
|
|
|
|
if (config._f.length === 0) {
|
|
config._pf.invalidFormat = true;
|
|
config._d = new Date(NaN);
|
|
return;
|
|
}
|
|
|
|
for (i = 0; i < config._f.length; i++) {
|
|
currentScore = 0;
|
|
tempConfig = copyConfig({}, config);
|
|
if (config._useUTC != null) {
|
|
tempConfig._useUTC = config._useUTC;
|
|
}
|
|
tempConfig._pf = defaultParsingFlags();
|
|
tempConfig._f = config._f[i];
|
|
makeDateFromStringAndFormat(tempConfig);
|
|
|
|
if (!isValid(tempConfig)) {
|
|
continue;
|
|
}
|
|
|
|
// if there is any input that was not parsed add a penalty for that format
|
|
currentScore += tempConfig._pf.charsLeftOver;
|
|
|
|
//or tokens
|
|
currentScore += tempConfig._pf.unusedTokens.length * 10;
|
|
|
|
tempConfig._pf.score = currentScore;
|
|
|
|
if (scoreToBeat == null || currentScore < scoreToBeat) {
|
|
scoreToBeat = currentScore;
|
|
bestMoment = tempConfig;
|
|
}
|
|
}
|
|
|
|
extend(config, bestMoment || tempConfig);
|
|
}
|
|
|
|
// date from iso format
|
|
function parseISO(config) {
|
|
var i, l,
|
|
string = config._i,
|
|
match = isoRegex.exec(string);
|
|
|
|
if (match) {
|
|
config._pf.iso = true;
|
|
for (i = 0, l = isoDates.length; i < l; i++) {
|
|
if (isoDates[i][1].exec(string)) {
|
|
// match[5] should be 'T' or undefined
|
|
config._f = isoDates[i][0] + (match[6] || ' ');
|
|
break;
|
|
}
|
|
}
|
|
for (i = 0, l = isoTimes.length; i < l; i++) {
|
|
if (isoTimes[i][1].exec(string)) {
|
|
config._f += isoTimes[i][0];
|
|
break;
|
|
}
|
|
}
|
|
if (string.match(parseTokenTimezone)) {
|
|
config._f += 'Z';
|
|
}
|
|
makeDateFromStringAndFormat(config);
|
|
} else {
|
|
config._isValid = false;
|
|
}
|
|
}
|
|
|
|
// date from iso format or fallback
|
|
function makeDateFromString(config) {
|
|
parseISO(config);
|
|
if (config._isValid === false) {
|
|
delete config._isValid;
|
|
moment.createFromInputFallback(config);
|
|
}
|
|
}
|
|
|
|
function map(arr, fn) {
|
|
var res = [], i;
|
|
for (i = 0; i < arr.length; ++i) {
|
|
res.push(fn(arr[i], i));
|
|
}
|
|
return res;
|
|
}
|
|
|
|
function makeDateFromInput(config) {
|
|
var input = config._i, matched;
|
|
if (input === undefined) {
|
|
config._d = new Date();
|
|
} else if (isDate(input)) {
|
|
config._d = new Date(+input);
|
|
} else if ((matched = aspNetJsonRegex.exec(input)) !== null) {
|
|
config._d = new Date(+matched[1]);
|
|
} else if (typeof input === 'string') {
|
|
makeDateFromString(config);
|
|
} else if (isArray(input)) {
|
|
config._a = map(input.slice(0), function (obj) {
|
|
return parseInt(obj, 10);
|
|
});
|
|
dateFromConfig(config);
|
|
} else if (typeof(input) === 'object') {
|
|
dateFromObject(config);
|
|
} else if (typeof(input) === 'number') {
|
|
// from milliseconds
|
|
config._d = new Date(input);
|
|
} else {
|
|
moment.createFromInputFallback(config);
|
|
}
|
|
}
|
|
|
|
function makeDate(y, m, d, h, M, s, ms) {
|
|
//can't just apply() to create a date:
|
|
//http://stackoverflow.com/questions/181348/instantiating-a-javascript-object-by-calling-prototype-constructor-apply
|
|
var date = new Date(y, m, d, h, M, s, ms);
|
|
|
|
//the date constructor doesn't accept years < 1970
|
|
if (y < 1970) {
|
|
date.setFullYear(y);
|
|
}
|
|
return date;
|
|
}
|
|
|
|
function makeUTCDate(y) {
|
|
var date = new Date(Date.UTC.apply(null, arguments));
|
|
if (y < 1970) {
|
|
date.setUTCFullYear(y);
|
|
}
|
|
return date;
|
|
}
|
|
|
|
function parseWeekday(input, locale) {
|
|
if (typeof input === 'string') {
|
|
if (!isNaN(input)) {
|
|
input = parseInt(input, 10);
|
|
}
|
|
else {
|
|
input = locale.weekdaysParse(input);
|
|
if (typeof input !== 'number') {
|
|
return null;
|
|
}
|
|
}
|
|
}
|
|
return input;
|
|
}
|
|
|
|
/************************************
|
|
Relative Time
|
|
************************************/
|
|
|
|
|
|
// helper function for moment.fn.from, moment.fn.fromNow, and moment.duration.fn.humanize
|
|
function substituteTimeAgo(string, number, withoutSuffix, isFuture, locale) {
|
|
return locale.relativeTime(number || 1, !!withoutSuffix, string, isFuture);
|
|
}
|
|
|
|
function relativeTime(posNegDuration, withoutSuffix, locale) {
|
|
var duration = moment.duration(posNegDuration).abs(),
|
|
seconds = round(duration.as('s')),
|
|
minutes = round(duration.as('m')),
|
|
hours = round(duration.as('h')),
|
|
days = round(duration.as('d')),
|
|
months = round(duration.as('M')),
|
|
years = round(duration.as('y')),
|
|
|
|
args = seconds < relativeTimeThresholds.s && ['s', seconds] ||
|
|
minutes === 1 && ['m'] ||
|
|
minutes < relativeTimeThresholds.m && ['mm', minutes] ||
|
|
hours === 1 && ['h'] ||
|
|
hours < relativeTimeThresholds.h && ['hh', hours] ||
|
|
days === 1 && ['d'] ||
|
|
days < relativeTimeThresholds.d && ['dd', days] ||
|
|
months === 1 && ['M'] ||
|
|
months < relativeTimeThresholds.M && ['MM', months] ||
|
|
years === 1 && ['y'] || ['yy', years];
|
|
|
|
args[2] = withoutSuffix;
|
|
args[3] = +posNegDuration > 0;
|
|
args[4] = locale;
|
|
return substituteTimeAgo.apply({}, args);
|
|
}
|
|
|
|
|
|
/************************************
|
|
Week of Year
|
|
************************************/
|
|
|
|
|
|
// firstDayOfWeek 0 = sun, 6 = sat
|
|
// the day of the week that starts the week
|
|
// (usually sunday or monday)
|
|
// firstDayOfWeekOfYear 0 = sun, 6 = sat
|
|
// the first week is the week that contains the first
|
|
// of this day of the week
|
|
// (eg. ISO weeks use thursday (4))
|
|
function weekOfYear(mom, firstDayOfWeek, firstDayOfWeekOfYear) {
|
|
var end = firstDayOfWeekOfYear - firstDayOfWeek,
|
|
daysToDayOfWeek = firstDayOfWeekOfYear - mom.day(),
|
|
adjustedMoment;
|
|
|
|
|
|
if (daysToDayOfWeek > end) {
|
|
daysToDayOfWeek -= 7;
|
|
}
|
|
|
|
if (daysToDayOfWeek < end - 7) {
|
|
daysToDayOfWeek += 7;
|
|
}
|
|
|
|
adjustedMoment = moment(mom).add(daysToDayOfWeek, 'd');
|
|
return {
|
|
week: Math.ceil(adjustedMoment.dayOfYear() / 7),
|
|
year: adjustedMoment.year()
|
|
};
|
|
}
|
|
|
|
//http://en.wikipedia.org/wiki/ISO_week_date#Calculating_a_date_given_the_year.2C_week_number_and_weekday
|
|
function dayOfYearFromWeeks(year, week, weekday, firstDayOfWeekOfYear, firstDayOfWeek) {
|
|
var d = makeUTCDate(year, 0, 1).getUTCDay(), daysToAdd, dayOfYear;
|
|
|
|
d = d === 0 ? 7 : d;
|
|
weekday = weekday != null ? weekday : firstDayOfWeek;
|
|
daysToAdd = firstDayOfWeek - d + (d > firstDayOfWeekOfYear ? 7 : 0) - (d < firstDayOfWeek ? 7 : 0);
|
|
dayOfYear = 7 * (week - 1) + (weekday - firstDayOfWeek) + daysToAdd + 1;
|
|
|
|
return {
|
|
year: dayOfYear > 0 ? year : year - 1,
|
|
dayOfYear: dayOfYear > 0 ? dayOfYear : daysInYear(year - 1) + dayOfYear
|
|
};
|
|
}
|
|
|
|
/************************************
|
|
Top Level Functions
|
|
************************************/
|
|
|
|
function makeMoment(config) {
|
|
var input = config._i,
|
|
format = config._f,
|
|
res;
|
|
|
|
config._locale = config._locale || moment.localeData(config._l);
|
|
|
|
if (input === null || (format === undefined && input === '')) {
|
|
return moment.invalid({nullInput: true});
|
|
}
|
|
|
|
if (typeof input === 'string') {
|
|
config._i = input = config._locale.preparse(input);
|
|
}
|
|
|
|
if (moment.isMoment(input)) {
|
|
return new Moment(input, true);
|
|
} else if (format) {
|
|
if (isArray(format)) {
|
|
makeDateFromStringAndArray(config);
|
|
} else {
|
|
makeDateFromStringAndFormat(config);
|
|
}
|
|
} else {
|
|
makeDateFromInput(config);
|
|
}
|
|
|
|
res = new Moment(config);
|
|
if (res._nextDay) {
|
|
// Adding is smart enough around DST
|
|
res.add(1, 'd');
|
|
res._nextDay = undefined;
|
|
}
|
|
|
|
return res;
|
|
}
|
|
|
|
moment = function (input, format, locale, strict) {
|
|
var c;
|
|
|
|
if (typeof(locale) === 'boolean') {
|
|
strict = locale;
|
|
locale = undefined;
|
|
}
|
|
// object construction must be done this way.
|
|
// https://github.com/moment/moment/issues/1423
|
|
c = {};
|
|
c._isAMomentObject = true;
|
|
c._i = input;
|
|
c._f = format;
|
|
c._l = locale;
|
|
c._strict = strict;
|
|
c._isUTC = false;
|
|
c._pf = defaultParsingFlags();
|
|
|
|
return makeMoment(c);
|
|
};
|
|
|
|
moment.suppressDeprecationWarnings = false;
|
|
|
|
moment.createFromInputFallback = deprecate(
|
|
'moment construction falls back to js Date. This is ' +
|
|
'discouraged and will be removed in upcoming major ' +
|
|
'release. Please refer to ' +
|
|
'https://github.com/moment/moment/issues/1407 for more info.',
|
|
function (config) {
|
|
config._d = new Date(config._i + (config._useUTC ? ' UTC' : ''));
|
|
}
|
|
);
|
|
|
|
// Pick a moment m from moments so that m[fn](other) is true for all
|
|
// other. This relies on the function fn to be transitive.
|
|
//
|
|
// moments should either be an array of moment objects or an array, whose
|
|
// first element is an array of moment objects.
|
|
function pickBy(fn, moments) {
|
|
var res, i;
|
|
if (moments.length === 1 && isArray(moments[0])) {
|
|
moments = moments[0];
|
|
}
|
|
if (!moments.length) {
|
|
return moment();
|
|
}
|
|
res = moments[0];
|
|
for (i = 1; i < moments.length; ++i) {
|
|
if (moments[i][fn](res)) {
|
|
res = moments[i];
|
|
}
|
|
}
|
|
return res;
|
|
}
|
|
|
|
moment.min = function () {
|
|
var args = [].slice.call(arguments, 0);
|
|
|
|
return pickBy('isBefore', args);
|
|
};
|
|
|
|
moment.max = function () {
|
|
var args = [].slice.call(arguments, 0);
|
|
|
|
return pickBy('isAfter', args);
|
|
};
|
|
|
|
// creating with utc
|
|
moment.utc = function (input, format, locale, strict) {
|
|
var c;
|
|
|
|
if (typeof(locale) === 'boolean') {
|
|
strict = locale;
|
|
locale = undefined;
|
|
}
|
|
// object construction must be done this way.
|
|
// https://github.com/moment/moment/issues/1423
|
|
c = {};
|
|
c._isAMomentObject = true;
|
|
c._useUTC = true;
|
|
c._isUTC = true;
|
|
c._l = locale;
|
|
c._i = input;
|
|
c._f = format;
|
|
c._strict = strict;
|
|
c._pf = defaultParsingFlags();
|
|
|
|
return makeMoment(c).utc();
|
|
};
|
|
|
|
// creating with unix timestamp (in seconds)
|
|
moment.unix = function (input) {
|
|
return moment(input * 1000);
|
|
};
|
|
|
|
// duration
|
|
moment.duration = function (input, key) {
|
|
var duration = input,
|
|
// matching against regexp is expensive, do it on demand
|
|
match = null,
|
|
sign,
|
|
ret,
|
|
parseIso,
|
|
diffRes;
|
|
|
|
if (moment.isDuration(input)) {
|
|
duration = {
|
|
ms: input._milliseconds,
|
|
d: input._days,
|
|
M: input._months
|
|
};
|
|
} else if (typeof input === 'number') {
|
|
duration = {};
|
|
if (key) {
|
|
duration[key] = input;
|
|
} else {
|
|
duration.milliseconds = input;
|
|
}
|
|
} else if (!!(match = aspNetTimeSpanJsonRegex.exec(input))) {
|
|
sign = (match[1] === '-') ? -1 : 1;
|
|
duration = {
|
|
y: 0,
|
|
d: toInt(match[DATE]) * sign,
|
|
h: toInt(match[HOUR]) * sign,
|
|
m: toInt(match[MINUTE]) * sign,
|
|
s: toInt(match[SECOND]) * sign,
|
|
ms: toInt(match[MILLISECOND]) * sign
|
|
};
|
|
} else if (!!(match = isoDurationRegex.exec(input))) {
|
|
sign = (match[1] === '-') ? -1 : 1;
|
|
parseIso = function (inp) {
|
|
// We'd normally use ~~inp for this, but unfortunately it also
|
|
// converts floats to ints.
|
|
// inp may be undefined, so careful calling replace on it.
|
|
var res = inp && parseFloat(inp.replace(',', '.'));
|
|
// apply sign while we're at it
|
|
return (isNaN(res) ? 0 : res) * sign;
|
|
};
|
|
duration = {
|
|
y: parseIso(match[2]),
|
|
M: parseIso(match[3]),
|
|
d: parseIso(match[4]),
|
|
h: parseIso(match[5]),
|
|
m: parseIso(match[6]),
|
|
s: parseIso(match[7]),
|
|
w: parseIso(match[8])
|
|
};
|
|
} else if (typeof duration === 'object' &&
|
|
('from' in duration || 'to' in duration)) {
|
|
diffRes = momentsDifference(moment(duration.from), moment(duration.to));
|
|
|
|
duration = {};
|
|
duration.ms = diffRes.milliseconds;
|
|
duration.M = diffRes.months;
|
|
}
|
|
|
|
ret = new Duration(duration);
|
|
|
|
if (moment.isDuration(input) && hasOwnProp(input, '_locale')) {
|
|
ret._locale = input._locale;
|
|
}
|
|
|
|
return ret;
|
|
};
|
|
|
|
// version number
|
|
moment.version = VERSION;
|
|
|
|
// default format
|
|
moment.defaultFormat = isoFormat;
|
|
|
|
// constant that refers to the ISO standard
|
|
moment.ISO_8601 = function () {};
|
|
|
|
// Plugins that add properties should also add the key here (null value),
|
|
// so we can properly clone ourselves.
|
|
moment.momentProperties = momentProperties;
|
|
|
|
// This function will be called whenever a moment is mutated.
|
|
// It is intended to keep the offset in sync with the timezone.
|
|
moment.updateOffset = function () {};
|
|
|
|
// This function allows you to set a threshold for relative time strings
|
|
moment.relativeTimeThreshold = function (threshold, limit) {
|
|
if (relativeTimeThresholds[threshold] === undefined) {
|
|
return false;
|
|
}
|
|
if (limit === undefined) {
|
|
return relativeTimeThresholds[threshold];
|
|
}
|
|
relativeTimeThresholds[threshold] = limit;
|
|
return true;
|
|
};
|
|
|
|
moment.lang = deprecate(
|
|
'moment.lang is deprecated. Use moment.locale instead.',
|
|
function (key, value) {
|
|
return moment.locale(key, value);
|
|
}
|
|
);
|
|
|
|
// This function will load locale and then set the global locale. If
|
|
// no arguments are passed in, it will simply return the current global
|
|
// locale key.
|
|
moment.locale = function (key, values) {
|
|
var data;
|
|
if (key) {
|
|
if (typeof(values) !== 'undefined') {
|
|
data = moment.defineLocale(key, values);
|
|
}
|
|
else {
|
|
data = moment.localeData(key);
|
|
}
|
|
|
|
if (data) {
|
|
moment.duration._locale = moment._locale = data;
|
|
}
|
|
}
|
|
|
|
return moment._locale._abbr;
|
|
};
|
|
|
|
moment.defineLocale = function (name, values) {
|
|
if (values !== null) {
|
|
values.abbr = name;
|
|
if (!locales[name]) {
|
|
locales[name] = new Locale();
|
|
}
|
|
locales[name].set(values);
|
|
|
|
// backwards compat for now: also set the locale
|
|
moment.locale(name);
|
|
|
|
return locales[name];
|
|
} else {
|
|
// useful for testing
|
|
delete locales[name];
|
|
return null;
|
|
}
|
|
};
|
|
|
|
moment.langData = deprecate(
|
|
'moment.langData is deprecated. Use moment.localeData instead.',
|
|
function (key) {
|
|
return moment.localeData(key);
|
|
}
|
|
);
|
|
|
|
// returns locale data
|
|
moment.localeData = function (key) {
|
|
var locale;
|
|
|
|
if (key && key._locale && key._locale._abbr) {
|
|
key = key._locale._abbr;
|
|
}
|
|
|
|
if (!key) {
|
|
return moment._locale;
|
|
}
|
|
|
|
if (!isArray(key)) {
|
|
//short-circuit everything else
|
|
locale = loadLocale(key);
|
|
if (locale) {
|
|
return locale;
|
|
}
|
|
key = [key];
|
|
}
|
|
|
|
return chooseLocale(key);
|
|
};
|
|
|
|
// compare moment object
|
|
moment.isMoment = function (obj) {
|
|
return obj instanceof Moment ||
|
|
(obj != null && hasOwnProp(obj, '_isAMomentObject'));
|
|
};
|
|
|
|
// for typechecking Duration objects
|
|
moment.isDuration = function (obj) {
|
|
return obj instanceof Duration;
|
|
};
|
|
|
|
for (i = lists.length - 1; i >= 0; --i) {
|
|
makeList(lists[i]);
|
|
}
|
|
|
|
moment.normalizeUnits = function (units) {
|
|
return normalizeUnits(units);
|
|
};
|
|
|
|
moment.invalid = function (flags) {
|
|
var m = moment.utc(NaN);
|
|
if (flags != null) {
|
|
extend(m._pf, flags);
|
|
}
|
|
else {
|
|
m._pf.userInvalidated = true;
|
|
}
|
|
|
|
return m;
|
|
};
|
|
|
|
moment.parseZone = function () {
|
|
return moment.apply(null, arguments).parseZone();
|
|
};
|
|
|
|
moment.parseTwoDigitYear = function (input) {
|
|
return toInt(input) + (toInt(input) > 68 ? 1900 : 2000);
|
|
};
|
|
|
|
/************************************
|
|
Moment Prototype
|
|
************************************/
|
|
|
|
|
|
extend(moment.fn = Moment.prototype, {
|
|
|
|
clone : function () {
|
|
return moment(this);
|
|
},
|
|
|
|
valueOf : function () {
|
|
return +this._d + ((this._offset || 0) * 60000);
|
|
},
|
|
|
|
unix : function () {
|
|
return Math.floor(+this / 1000);
|
|
},
|
|
|
|
toString : function () {
|
|
return this.clone().locale('en').format('ddd MMM DD YYYY HH:mm:ss [GMT]ZZ');
|
|
},
|
|
|
|
toDate : function () {
|
|
return this._offset ? new Date(+this) : this._d;
|
|
},
|
|
|
|
toISOString : function () {
|
|
var m = moment(this).utc();
|
|
if (0 < m.year() && m.year() <= 9999) {
|
|
if ('function' === typeof Date.prototype.toISOString) {
|
|
// native implementation is ~50x faster, use it when we can
|
|
return this.toDate().toISOString();
|
|
} else {
|
|
return formatMoment(m, 'YYYY-MM-DD[T]HH:mm:ss.SSS[Z]');
|
|
}
|
|
} else {
|
|
return formatMoment(m, 'YYYYYY-MM-DD[T]HH:mm:ss.SSS[Z]');
|
|
}
|
|
},
|
|
|
|
toArray : function () {
|
|
var m = this;
|
|
return [
|
|
m.year(),
|
|
m.month(),
|
|
m.date(),
|
|
m.hours(),
|
|
m.minutes(),
|
|
m.seconds(),
|
|
m.milliseconds()
|
|
];
|
|
},
|
|
|
|
isValid : function () {
|
|
return isValid(this);
|
|
},
|
|
|
|
isDSTShifted : function () {
|
|
if (this._a) {
|
|
return this.isValid() && compareArrays(this._a, (this._isUTC ? moment.utc(this._a) : moment(this._a)).toArray()) > 0;
|
|
}
|
|
|
|
return false;
|
|
},
|
|
|
|
parsingFlags : function () {
|
|
return extend({}, this._pf);
|
|
},
|
|
|
|
invalidAt: function () {
|
|
return this._pf.overflow;
|
|
},
|
|
|
|
utc : function (keepLocalTime) {
|
|
return this.zone(0, keepLocalTime);
|
|
},
|
|
|
|
local : function (keepLocalTime) {
|
|
if (this._isUTC) {
|
|
this.zone(0, keepLocalTime);
|
|
this._isUTC = false;
|
|
|
|
if (keepLocalTime) {
|
|
this.add(this._dateTzOffset(), 'm');
|
|
}
|
|
}
|
|
return this;
|
|
},
|
|
|
|
format : function (inputString) {
|
|
var output = formatMoment(this, inputString || moment.defaultFormat);
|
|
return this.localeData().postformat(output);
|
|
},
|
|
|
|
add : createAdder(1, 'add'),
|
|
|
|
subtract : createAdder(-1, 'subtract'),
|
|
|
|
diff : function (input, units, asFloat) {
|
|
var that = makeAs(input, this),
|
|
zoneDiff = (this.zone() - that.zone()) * 6e4,
|
|
diff, output, daysAdjust;
|
|
|
|
units = normalizeUnits(units);
|
|
|
|
if (units === 'year' || units === 'month') {
|
|
// average number of days in the months in the given dates
|
|
diff = (this.daysInMonth() + that.daysInMonth()) * 432e5; // 24 * 60 * 60 * 1000 / 2
|
|
// difference in months
|
|
output = ((this.year() - that.year()) * 12) + (this.month() - that.month());
|
|
// adjust by taking difference in days, average number of days
|
|
// and dst in the given months.
|
|
daysAdjust = (this - moment(this).startOf('month')) -
|
|
(that - moment(that).startOf('month'));
|
|
// same as above but with zones, to negate all dst
|
|
daysAdjust -= ((this.zone() - moment(this).startOf('month').zone()) -
|
|
(that.zone() - moment(that).startOf('month').zone())) * 6e4;
|
|
output += daysAdjust / diff;
|
|
if (units === 'year') {
|
|
output = output / 12;
|
|
}
|
|
} else {
|
|
diff = (this - that);
|
|
output = units === 'second' ? diff / 1e3 : // 1000
|
|
units === 'minute' ? diff / 6e4 : // 1000 * 60
|
|
units === 'hour' ? diff / 36e5 : // 1000 * 60 * 60
|
|
units === 'day' ? (diff - zoneDiff) / 864e5 : // 1000 * 60 * 60 * 24, negate dst
|
|
units === 'week' ? (diff - zoneDiff) / 6048e5 : // 1000 * 60 * 60 * 24 * 7, negate dst
|
|
diff;
|
|
}
|
|
return asFloat ? output : absRound(output);
|
|
},
|
|
|
|
from : function (time, withoutSuffix) {
|
|
return moment.duration({to: this, from: time}).locale(this.locale()).humanize(!withoutSuffix);
|
|
},
|
|
|
|
fromNow : function (withoutSuffix) {
|
|
return this.from(moment(), withoutSuffix);
|
|
},
|
|
|
|
calendar : function (time) {
|
|
// We want to compare the start of today, vs this.
|
|
// Getting start-of-today depends on whether we're zone'd or not.
|
|
var now = time || moment(),
|
|
sod = makeAs(now, this).startOf('day'),
|
|
diff = this.diff(sod, 'days', true),
|
|
format = diff < -6 ? 'sameElse' :
|
|
diff < -1 ? 'lastWeek' :
|
|
diff < 0 ? 'lastDay' :
|
|
diff < 1 ? 'sameDay' :
|
|
diff < 2 ? 'nextDay' :
|
|
diff < 7 ? 'nextWeek' : 'sameElse';
|
|
return this.format(this.localeData().calendar(format, this, moment(now)));
|
|
},
|
|
|
|
isLeapYear : function () {
|
|
return isLeapYear(this.year());
|
|
},
|
|
|
|
isDST : function () {
|
|
return (this.zone() < this.clone().month(0).zone() ||
|
|
this.zone() < this.clone().month(5).zone());
|
|
},
|
|
|
|
day : function (input) {
|
|
var day = this._isUTC ? this._d.getUTCDay() : this._d.getDay();
|
|
if (input != null) {
|
|
input = parseWeekday(input, this.localeData());
|
|
return this.add(input - day, 'd');
|
|
} else {
|
|
return day;
|
|
}
|
|
},
|
|
|
|
month : makeAccessor('Month', true),
|
|
|
|
startOf : function (units) {
|
|
units = normalizeUnits(units);
|
|
// the following switch intentionally omits break keywords
|
|
// to utilize falling through the cases.
|
|
switch (units) {
|
|
case 'year':
|
|
this.month(0);
|
|
/* falls through */
|
|
case 'quarter':
|
|
case 'month':
|
|
this.date(1);
|
|
/* falls through */
|
|
case 'week':
|
|
case 'isoWeek':
|
|
case 'day':
|
|
this.hours(0);
|
|
/* falls through */
|
|
case 'hour':
|
|
this.minutes(0);
|
|
/* falls through */
|
|
case 'minute':
|
|
this.seconds(0);
|
|
/* falls through */
|
|
case 'second':
|
|
this.milliseconds(0);
|
|
/* falls through */
|
|
}
|
|
|
|
// weeks are a special case
|
|
if (units === 'week') {
|
|
this.weekday(0);
|
|
} else if (units === 'isoWeek') {
|
|
this.isoWeekday(1);
|
|
}
|
|
|
|
// quarters are also special
|
|
if (units === 'quarter') {
|
|
this.month(Math.floor(this.month() / 3) * 3);
|
|
}
|
|
|
|
return this;
|
|
},
|
|
|
|
endOf: function (units) {
|
|
units = normalizeUnits(units);
|
|
if (units === undefined || units === 'millisecond') {
|
|
return this;
|
|
}
|
|
return this.startOf(units).add(1, (units === 'isoWeek' ? 'week' : units)).subtract(1, 'ms');
|
|
},
|
|
|
|
isAfter: function (input, units) {
|
|
var inputMs;
|
|
units = normalizeUnits(typeof units !== 'undefined' ? units : 'millisecond');
|
|
if (units === 'millisecond') {
|
|
input = moment.isMoment(input) ? input : moment(input);
|
|
return +this > +input;
|
|
} else {
|
|
inputMs = moment.isMoment(input) ? +input : +moment(input);
|
|
return inputMs < +this.clone().startOf(units);
|
|
}
|
|
},
|
|
|
|
isBefore: function (input, units) {
|
|
var inputMs;
|
|
units = normalizeUnits(typeof units !== 'undefined' ? units : 'millisecond');
|
|
if (units === 'millisecond') {
|
|
input = moment.isMoment(input) ? input : moment(input);
|
|
return +this < +input;
|
|
} else {
|
|
inputMs = moment.isMoment(input) ? +input : +moment(input);
|
|
return +this.clone().endOf(units) < inputMs;
|
|
}
|
|
},
|
|
|
|
isSame: function (input, units) {
|
|
var inputMs;
|
|
units = normalizeUnits(units || 'millisecond');
|
|
if (units === 'millisecond') {
|
|
input = moment.isMoment(input) ? input : moment(input);
|
|
return +this === +input;
|
|
} else {
|
|
inputMs = +moment(input);
|
|
return +(this.clone().startOf(units)) <= inputMs && inputMs <= +(this.clone().endOf(units));
|
|
}
|
|
},
|
|
|
|
min: deprecate(
|
|
'moment().min is deprecated, use moment.min instead. https://github.com/moment/moment/issues/1548',
|
|
function (other) {
|
|
other = moment.apply(null, arguments);
|
|
return other < this ? this : other;
|
|
}
|
|
),
|
|
|
|
max: deprecate(
|
|
'moment().max is deprecated, use moment.max instead. https://github.com/moment/moment/issues/1548',
|
|
function (other) {
|
|
other = moment.apply(null, arguments);
|
|
return other > this ? this : other;
|
|
}
|
|
),
|
|
|
|
// keepLocalTime = true means only change the timezone, without
|
|
// affecting the local hour. So 5:31:26 +0300 --[zone(2, true)]-->
|
|
// 5:31:26 +0200 It is possible that 5:31:26 doesn't exist int zone
|
|
// +0200, so we adjust the time as needed, to be valid.
|
|
//
|
|
// Keeping the time actually adds/subtracts (one hour)
|
|
// from the actual represented time. That is why we call updateOffset
|
|
// a second time. In case it wants us to change the offset again
|
|
// _changeInProgress == true case, then we have to adjust, because
|
|
// there is no such time in the given timezone.
|
|
zone : function (input, keepLocalTime) {
|
|
var offset = this._offset || 0,
|
|
localAdjust;
|
|
if (input != null) {
|
|
if (typeof input === 'string') {
|
|
input = timezoneMinutesFromString(input);
|
|
}
|
|
if (Math.abs(input) < 16) {
|
|
input = input * 60;
|
|
}
|
|
if (!this._isUTC && keepLocalTime) {
|
|
localAdjust = this._dateTzOffset();
|
|
}
|
|
this._offset = input;
|
|
this._isUTC = true;
|
|
if (localAdjust != null) {
|
|
this.subtract(localAdjust, 'm');
|
|
}
|
|
if (offset !== input) {
|
|
if (!keepLocalTime || this._changeInProgress) {
|
|
addOrSubtractDurationFromMoment(this,
|
|
moment.duration(offset - input, 'm'), 1, false);
|
|
} else if (!this._changeInProgress) {
|
|
this._changeInProgress = true;
|
|
moment.updateOffset(this, true);
|
|
this._changeInProgress = null;
|
|
}
|
|
}
|
|
} else {
|
|
return this._isUTC ? offset : this._dateTzOffset();
|
|
}
|
|
return this;
|
|
},
|
|
|
|
zoneAbbr : function () {
|
|
return this._isUTC ? 'UTC' : '';
|
|
},
|
|
|
|
zoneName : function () {
|
|
return this._isUTC ? 'Coordinated Universal Time' : '';
|
|
},
|
|
|
|
parseZone : function () {
|
|
if (this._tzm) {
|
|
this.zone(this._tzm);
|
|
} else if (typeof this._i === 'string') {
|
|
this.zone(this._i);
|
|
}
|
|
return this;
|
|
},
|
|
|
|
hasAlignedHourOffset : function (input) {
|
|
if (!input) {
|
|
input = 0;
|
|
}
|
|
else {
|
|
input = moment(input).zone();
|
|
}
|
|
|
|
return (this.zone() - input) % 60 === 0;
|
|
},
|
|
|
|
daysInMonth : function () {
|
|
return daysInMonth(this.year(), this.month());
|
|
},
|
|
|
|
dayOfYear : function (input) {
|
|
var dayOfYear = round((moment(this).startOf('day') - moment(this).startOf('year')) / 864e5) + 1;
|
|
return input == null ? dayOfYear : this.add((input - dayOfYear), 'd');
|
|
},
|
|
|
|
quarter : function (input) {
|
|
return input == null ? Math.ceil((this.month() + 1) / 3) : this.month((input - 1) * 3 + this.month() % 3);
|
|
},
|
|
|
|
weekYear : function (input) {
|
|
var year = weekOfYear(this, this.localeData()._week.dow, this.localeData()._week.doy).year;
|
|
return input == null ? year : this.add((input - year), 'y');
|
|
},
|
|
|
|
isoWeekYear : function (input) {
|
|
var year = weekOfYear(this, 1, 4).year;
|
|
return input == null ? year : this.add((input - year), 'y');
|
|
},
|
|
|
|
week : function (input) {
|
|
var week = this.localeData().week(this);
|
|
return input == null ? week : this.add((input - week) * 7, 'd');
|
|
},
|
|
|
|
isoWeek : function (input) {
|
|
var week = weekOfYear(this, 1, 4).week;
|
|
return input == null ? week : this.add((input - week) * 7, 'd');
|
|
},
|
|
|
|
weekday : function (input) {
|
|
var weekday = (this.day() + 7 - this.localeData()._week.dow) % 7;
|
|
return input == null ? weekday : this.add(input - weekday, 'd');
|
|
},
|
|
|
|
isoWeekday : function (input) {
|
|
// behaves the same as moment#day except
|
|
// as a getter, returns 7 instead of 0 (1-7 range instead of 0-6)
|
|
// as a setter, sunday should belong to the previous week.
|
|
return input == null ? this.day() || 7 : this.day(this.day() % 7 ? input : input - 7);
|
|
},
|
|
|
|
isoWeeksInYear : function () {
|
|
return weeksInYear(this.year(), 1, 4);
|
|
},
|
|
|
|
weeksInYear : function () {
|
|
var weekInfo = this.localeData()._week;
|
|
return weeksInYear(this.year(), weekInfo.dow, weekInfo.doy);
|
|
},
|
|
|
|
get : function (units) {
|
|
units = normalizeUnits(units);
|
|
return this[units]();
|
|
},
|
|
|
|
set : function (units, value) {
|
|
units = normalizeUnits(units);
|
|
if (typeof this[units] === 'function') {
|
|
this[units](value);
|
|
}
|
|
return this;
|
|
},
|
|
|
|
// If passed a locale key, it will set the locale for this
|
|
// instance. Otherwise, it will return the locale configuration
|
|
// variables for this instance.
|
|
locale : function (key) {
|
|
var newLocaleData;
|
|
|
|
if (key === undefined) {
|
|
return this._locale._abbr;
|
|
} else {
|
|
newLocaleData = moment.localeData(key);
|
|
if (newLocaleData != null) {
|
|
this._locale = newLocaleData;
|
|
}
|
|
return this;
|
|
}
|
|
},
|
|
|
|
lang : deprecate(
|
|
'moment().lang() is deprecated. Instead, use moment().localeData() to get the language configuration. Use moment().locale() to change languages.',
|
|
function (key) {
|
|
if (key === undefined) {
|
|
return this.localeData();
|
|
} else {
|
|
return this.locale(key);
|
|
}
|
|
}
|
|
),
|
|
|
|
localeData : function () {
|
|
return this._locale;
|
|
},
|
|
|
|
_dateTzOffset : function () {
|
|
// On Firefox.24 Date#getTimezoneOffset returns a floating point.
|
|
// https://github.com/moment/moment/pull/1871
|
|
return Math.round(this._d.getTimezoneOffset() / 15) * 15;
|
|
}
|
|
});
|
|
|
|
function rawMonthSetter(mom, value) {
|
|
var dayOfMonth;
|
|
|
|
// TODO: Move this out of here!
|
|
if (typeof value === 'string') {
|
|
value = mom.localeData().monthsParse(value);
|
|
// TODO: Another silent failure?
|
|
if (typeof value !== 'number') {
|
|
return mom;
|
|
}
|
|
}
|
|
|
|
dayOfMonth = Math.min(mom.date(),
|
|
daysInMonth(mom.year(), value));
|
|
mom._d['set' + (mom._isUTC ? 'UTC' : '') + 'Month'](value, dayOfMonth);
|
|
return mom;
|
|
}
|
|
|
|
function rawGetter(mom, unit) {
|
|
return mom._d['get' + (mom._isUTC ? 'UTC' : '') + unit]();
|
|
}
|
|
|
|
function rawSetter(mom, unit, value) {
|
|
if (unit === 'Month') {
|
|
return rawMonthSetter(mom, value);
|
|
} else {
|
|
return mom._d['set' + (mom._isUTC ? 'UTC' : '') + unit](value);
|
|
}
|
|
}
|
|
|
|
function makeAccessor(unit, keepTime) {
|
|
return function (value) {
|
|
if (value != null) {
|
|
rawSetter(this, unit, value);
|
|
moment.updateOffset(this, keepTime);
|
|
return this;
|
|
} else {
|
|
return rawGetter(this, unit);
|
|
}
|
|
};
|
|
}
|
|
|
|
moment.fn.millisecond = moment.fn.milliseconds = makeAccessor('Milliseconds', false);
|
|
moment.fn.second = moment.fn.seconds = makeAccessor('Seconds', false);
|
|
moment.fn.minute = moment.fn.minutes = makeAccessor('Minutes', false);
|
|
// Setting the hour should keep the time, because the user explicitly
|
|
// specified which hour he wants. So trying to maintain the same hour (in
|
|
// a new timezone) makes sense. Adding/subtracting hours does not follow
|
|
// this rule.
|
|
moment.fn.hour = moment.fn.hours = makeAccessor('Hours', true);
|
|
// moment.fn.month is defined separately
|
|
moment.fn.date = makeAccessor('Date', true);
|
|
moment.fn.dates = deprecate('dates accessor is deprecated. Use date instead.', makeAccessor('Date', true));
|
|
moment.fn.year = makeAccessor('FullYear', true);
|
|
moment.fn.years = deprecate('years accessor is deprecated. Use year instead.', makeAccessor('FullYear', true));
|
|
|
|
// add plural methods
|
|
moment.fn.days = moment.fn.day;
|
|
moment.fn.months = moment.fn.month;
|
|
moment.fn.weeks = moment.fn.week;
|
|
moment.fn.isoWeeks = moment.fn.isoWeek;
|
|
moment.fn.quarters = moment.fn.quarter;
|
|
|
|
// add aliased format methods
|
|
moment.fn.toJSON = moment.fn.toISOString;
|
|
|
|
/************************************
|
|
Duration Prototype
|
|
************************************/
|
|
|
|
|
|
function daysToYears (days) {
|
|
// 400 years have 146097 days (taking into account leap year rules)
|
|
return days * 400 / 146097;
|
|
}
|
|
|
|
function yearsToDays (years) {
|
|
// years * 365 + absRound(years / 4) -
|
|
// absRound(years / 100) + absRound(years / 400);
|
|
return years * 146097 / 400;
|
|
}
|
|
|
|
extend(moment.duration.fn = Duration.prototype, {
|
|
|
|
_bubble : function () {
|
|
var milliseconds = this._milliseconds,
|
|
days = this._days,
|
|
months = this._months,
|
|
data = this._data,
|
|
seconds, minutes, hours, years = 0;
|
|
|
|
// The following code bubbles up values, see the tests for
|
|
// examples of what that means.
|
|
data.milliseconds = milliseconds % 1000;
|
|
|
|
seconds = absRound(milliseconds / 1000);
|
|
data.seconds = seconds % 60;
|
|
|
|
minutes = absRound(seconds / 60);
|
|
data.minutes = minutes % 60;
|
|
|
|
hours = absRound(minutes / 60);
|
|
data.hours = hours % 24;
|
|
|
|
days += absRound(hours / 24);
|
|
|
|
// Accurately convert days to years, assume start from year 0.
|
|
years = absRound(daysToYears(days));
|
|
days -= absRound(yearsToDays(years));
|
|
|
|
// 30 days to a month
|
|
// TODO (iskren): Use anchor date (like 1st Jan) to compute this.
|
|
months += absRound(days / 30);
|
|
days %= 30;
|
|
|
|
// 12 months -> 1 year
|
|
years += absRound(months / 12);
|
|
months %= 12;
|
|
|
|
data.days = days;
|
|
data.months = months;
|
|
data.years = years;
|
|
},
|
|
|
|
abs : function () {
|
|
this._milliseconds = Math.abs(this._milliseconds);
|
|
this._days = Math.abs(this._days);
|
|
this._months = Math.abs(this._months);
|
|
|
|
this._data.milliseconds = Math.abs(this._data.milliseconds);
|
|
this._data.seconds = Math.abs(this._data.seconds);
|
|
this._data.minutes = Math.abs(this._data.minutes);
|
|
this._data.hours = Math.abs(this._data.hours);
|
|
this._data.months = Math.abs(this._data.months);
|
|
this._data.years = Math.abs(this._data.years);
|
|
|
|
return this;
|
|
},
|
|
|
|
weeks : function () {
|
|
return absRound(this.days() / 7);
|
|
},
|
|
|
|
valueOf : function () {
|
|
return this._milliseconds +
|
|
this._days * 864e5 +
|
|
(this._months % 12) * 2592e6 +
|
|
toInt(this._months / 12) * 31536e6;
|
|
},
|
|
|
|
humanize : function (withSuffix) {
|
|
var output = relativeTime(this, !withSuffix, this.localeData());
|
|
|
|
if (withSuffix) {
|
|
output = this.localeData().pastFuture(+this, output);
|
|
}
|
|
|
|
return this.localeData().postformat(output);
|
|
},
|
|
|
|
add : function (input, val) {
|
|
// supports only 2.0-style add(1, 's') or add(moment)
|
|
var dur = moment.duration(input, val);
|
|
|
|
this._milliseconds += dur._milliseconds;
|
|
this._days += dur._days;
|
|
this._months += dur._months;
|
|
|
|
this._bubble();
|
|
|
|
return this;
|
|
},
|
|
|
|
subtract : function (input, val) {
|
|
var dur = moment.duration(input, val);
|
|
|
|
this._milliseconds -= dur._milliseconds;
|
|
this._days -= dur._days;
|
|
this._months -= dur._months;
|
|
|
|
this._bubble();
|
|
|
|
return this;
|
|
},
|
|
|
|
get : function (units) {
|
|
units = normalizeUnits(units);
|
|
return this[units.toLowerCase() + 's']();
|
|
},
|
|
|
|
as : function (units) {
|
|
var days, months;
|
|
units = normalizeUnits(units);
|
|
|
|
if (units === 'month' || units === 'year') {
|
|
days = this._days + this._milliseconds / 864e5;
|
|
months = this._months + daysToYears(days) * 12;
|
|
return units === 'month' ? months : months / 12;
|
|
} else {
|
|
// handle milliseconds separately because of floating point math errors (issue #1867)
|
|
days = this._days + Math.round(yearsToDays(this._months / 12));
|
|
switch (units) {
|
|
case 'week': return days / 7 + this._milliseconds / 6048e5;
|
|
case 'day': return days + this._milliseconds / 864e5;
|
|
case 'hour': return days * 24 + this._milliseconds / 36e5;
|
|
case 'minute': return days * 24 * 60 + this._milliseconds / 6e4;
|
|
case 'second': return days * 24 * 60 * 60 + this._milliseconds / 1000;
|
|
// Math.floor prevents floating point math errors here
|
|
case 'millisecond': return Math.floor(days * 24 * 60 * 60 * 1000) + this._milliseconds;
|
|
default: throw new Error('Unknown unit ' + units);
|
|
}
|
|
}
|
|
},
|
|
|
|
lang : moment.fn.lang,
|
|
locale : moment.fn.locale,
|
|
|
|
toIsoString : deprecate(
|
|
'toIsoString() is deprecated. Please use toISOString() instead ' +
|
|
'(notice the capitals)',
|
|
function () {
|
|
return this.toISOString();
|
|
}
|
|
),
|
|
|
|
toISOString : function () {
|
|
// inspired by https://github.com/dordille/moment-isoduration/blob/master/moment.isoduration.js
|
|
var years = Math.abs(this.years()),
|
|
months = Math.abs(this.months()),
|
|
days = Math.abs(this.days()),
|
|
hours = Math.abs(this.hours()),
|
|
minutes = Math.abs(this.minutes()),
|
|
seconds = Math.abs(this.seconds() + this.milliseconds() / 1000);
|
|
|
|
if (!this.asSeconds()) {
|
|
// this is the same as C#'s (Noda) and python (isodate)...
|
|
// but not other JS (goog.date)
|
|
return 'P0D';
|
|
}
|
|
|
|
return (this.asSeconds() < 0 ? '-' : '') +
|
|
'P' +
|
|
(years ? years + 'Y' : '') +
|
|
(months ? months + 'M' : '') +
|
|
(days ? days + 'D' : '') +
|
|
((hours || minutes || seconds) ? 'T' : '') +
|
|
(hours ? hours + 'H' : '') +
|
|
(minutes ? minutes + 'M' : '') +
|
|
(seconds ? seconds + 'S' : '');
|
|
},
|
|
|
|
localeData : function () {
|
|
return this._locale;
|
|
}
|
|
});
|
|
|
|
moment.duration.fn.toString = moment.duration.fn.toISOString;
|
|
|
|
function makeDurationGetter(name) {
|
|
moment.duration.fn[name] = function () {
|
|
return this._data[name];
|
|
};
|
|
}
|
|
|
|
for (i in unitMillisecondFactors) {
|
|
if (hasOwnProp(unitMillisecondFactors, i)) {
|
|
makeDurationGetter(i.toLowerCase());
|
|
}
|
|
}
|
|
|
|
moment.duration.fn.asMilliseconds = function () {
|
|
return this.as('ms');
|
|
};
|
|
moment.duration.fn.asSeconds = function () {
|
|
return this.as('s');
|
|
};
|
|
moment.duration.fn.asMinutes = function () {
|
|
return this.as('m');
|
|
};
|
|
moment.duration.fn.asHours = function () {
|
|
return this.as('h');
|
|
};
|
|
moment.duration.fn.asDays = function () {
|
|
return this.as('d');
|
|
};
|
|
moment.duration.fn.asWeeks = function () {
|
|
return this.as('weeks');
|
|
};
|
|
moment.duration.fn.asMonths = function () {
|
|
return this.as('M');
|
|
};
|
|
moment.duration.fn.asYears = function () {
|
|
return this.as('y');
|
|
};
|
|
|
|
/************************************
|
|
Default Locale
|
|
************************************/
|
|
|
|
|
|
// Set default locale, other locale will inherit from English.
|
|
moment.locale('en', {
|
|
ordinalParse: /\d{1,2}(th|st|nd|rd)/,
|
|
ordinal : function (number) {
|
|
var b = number % 10,
|
|
output = (toInt(number % 100 / 10) === 1) ? 'th' :
|
|
(b === 1) ? 'st' :
|
|
(b === 2) ? 'nd' :
|
|
(b === 3) ? 'rd' : 'th';
|
|
return number + output;
|
|
}
|
|
});
|
|
|
|
/* EMBED_LOCALES */
|
|
|
|
/************************************
|
|
Exposing Moment
|
|
************************************/
|
|
|
|
function makeGlobal(shouldDeprecate) {
|
|
/*global ender:false */
|
|
if (typeof ender !== 'undefined') {
|
|
return;
|
|
}
|
|
oldGlobalMoment = globalScope.moment;
|
|
if (shouldDeprecate) {
|
|
globalScope.moment = deprecate(
|
|
'Accessing Moment through the global scope is ' +
|
|
'deprecated, and will be removed in an upcoming ' +
|
|
'release.',
|
|
moment);
|
|
} else {
|
|
globalScope.moment = moment;
|
|
}
|
|
}
|
|
|
|
// CommonJS module is defined
|
|
if (hasModule) {
|
|
module.exports = moment;
|
|
} else if (typeof define === 'function' && define.amd) {
|
|
define('moment', function (require, exports, module) {
|
|
if (module.config && module.config() && module.config().noGlobal === true) {
|
|
// release the global variable
|
|
globalScope.moment = oldGlobalMoment;
|
|
}
|
|
|
|
return moment;
|
|
});
|
|
makeGlobal(true);
|
|
} else {
|
|
makeGlobal();
|
|
}
|
|
}).call(this);
|
|
;
|
|
/* ========================================================================
|
|
* Bootstrap: affix.js v3.3.6
|
|
* http://getbootstrap.com/javascript/#affix
|
|
* ========================================================================
|
|
* Copyright 2011-2015 Twitter, Inc.
|
|
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
|
* ======================================================================== */
|
|
|
|
|
|
+function ($) {
|
|
'use strict';
|
|
|
|
// AFFIX CLASS DEFINITION
|
|
// ======================
|
|
|
|
var Affix = function (element, options) {
|
|
this.options = $.extend({}, Affix.DEFAULTS, options)
|
|
|
|
this.$target = $(this.options.target)
|
|
.on('scroll.bs.affix.data-api', $.proxy(this.checkPosition, this))
|
|
.on('click.bs.affix.data-api', $.proxy(this.checkPositionWithEventLoop, this))
|
|
|
|
this.$element = $(element)
|
|
this.affixed = null
|
|
this.unpin = null
|
|
this.pinnedOffset = null
|
|
|
|
this.checkPosition()
|
|
}
|
|
|
|
Affix.VERSION = '3.3.6'
|
|
|
|
Affix.RESET = 'affix affix-top affix-bottom'
|
|
|
|
Affix.DEFAULTS = {
|
|
offset: 0,
|
|
target: window
|
|
}
|
|
|
|
Affix.prototype.getState = function (scrollHeight, height, offsetTop, offsetBottom) {
|
|
var scrollTop = this.$target.scrollTop()
|
|
var position = this.$element.offset()
|
|
var targetHeight = this.$target.height()
|
|
|
|
if (offsetTop != null && this.affixed == 'top') return scrollTop < offsetTop ? 'top' : false
|
|
|
|
if (this.affixed == 'bottom') {
|
|
if (offsetTop != null) return (scrollTop + this.unpin <= position.top) ? false : 'bottom'
|
|
return (scrollTop + targetHeight <= scrollHeight - offsetBottom) ? false : 'bottom'
|
|
}
|
|
|
|
var initializing = this.affixed == null
|
|
var colliderTop = initializing ? scrollTop : position.top
|
|
var colliderHeight = initializing ? targetHeight : height
|
|
|
|
if (offsetTop != null && scrollTop <= offsetTop) return 'top'
|
|
if (offsetBottom != null && (colliderTop + colliderHeight >= scrollHeight - offsetBottom)) return 'bottom'
|
|
|
|
return false
|
|
}
|
|
|
|
Affix.prototype.getPinnedOffset = function () {
|
|
if (this.pinnedOffset) return this.pinnedOffset
|
|
this.$element.removeClass(Affix.RESET).addClass('affix')
|
|
var scrollTop = this.$target.scrollTop()
|
|
var position = this.$element.offset()
|
|
return (this.pinnedOffset = position.top - scrollTop)
|
|
}
|
|
|
|
Affix.prototype.checkPositionWithEventLoop = function () {
|
|
setTimeout($.proxy(this.checkPosition, this), 1)
|
|
}
|
|
|
|
Affix.prototype.checkPosition = function () {
|
|
if (!this.$element.is(':visible')) return
|
|
|
|
var height = this.$element.height()
|
|
var offset = this.options.offset
|
|
var offsetTop = offset.top
|
|
var offsetBottom = offset.bottom
|
|
var scrollHeight = Math.max($(document).height(), $(document.body).height())
|
|
|
|
if (typeof offset != 'object') offsetBottom = offsetTop = offset
|
|
if (typeof offsetTop == 'function') offsetTop = offset.top(this.$element)
|
|
if (typeof offsetBottom == 'function') offsetBottom = offset.bottom(this.$element)
|
|
|
|
var affix = this.getState(scrollHeight, height, offsetTop, offsetBottom)
|
|
|
|
if (this.affixed != affix) {
|
|
if (this.unpin != null) this.$element.css('top', '')
|
|
|
|
var affixType = 'affix' + (affix ? '-' + affix : '')
|
|
var e = $.Event(affixType + '.bs.affix')
|
|
|
|
this.$element.trigger(e)
|
|
|
|
if (e.isDefaultPrevented()) return
|
|
|
|
this.affixed = affix
|
|
this.unpin = affix == 'bottom' ? this.getPinnedOffset() : null
|
|
|
|
this.$element
|
|
.removeClass(Affix.RESET)
|
|
.addClass(affixType)
|
|
.trigger(affixType.replace('affix', 'affixed') + '.bs.affix')
|
|
}
|
|
|
|
if (affix == 'bottom') {
|
|
this.$element.offset({
|
|
top: scrollHeight - height - offsetBottom
|
|
})
|
|
}
|
|
}
|
|
|
|
|
|
// AFFIX PLUGIN DEFINITION
|
|
// =======================
|
|
|
|
function Plugin(option) {
|
|
return this.each(function () {
|
|
var $this = $(this)
|
|
var data = $this.data('bs.affix')
|
|
var options = typeof option == 'object' && option
|
|
|
|
if (!data) $this.data('bs.affix', (data = new Affix(this, options)))
|
|
if (typeof option == 'string') data[option]()
|
|
})
|
|
}
|
|
|
|
var old = $.fn.affix
|
|
|
|
$.fn.affix = Plugin
|
|
$.fn.affix.Constructor = Affix
|
|
|
|
|
|
// AFFIX NO CONFLICT
|
|
// =================
|
|
|
|
$.fn.affix.noConflict = function () {
|
|
$.fn.affix = old
|
|
return this
|
|
}
|
|
|
|
|
|
// AFFIX DATA-API
|
|
// ==============
|
|
|
|
$(window).on('load', function () {
|
|
$('[data-spy="affix"]').each(function () {
|
|
var $spy = $(this)
|
|
var data = $spy.data()
|
|
|
|
data.offset = data.offset || {}
|
|
|
|
if (data.offsetBottom != null) data.offset.bottom = data.offsetBottom
|
|
if (data.offsetTop != null) data.offset.top = data.offsetTop
|
|
|
|
Plugin.call($spy, data)
|
|
})
|
|
})
|
|
|
|
}(jQuery);
|
|
;
|
|
/* ========================================================================
|
|
* Bootstrap: dropdown.js v3.3.6
|
|
* http://getbootstrap.com/javascript/#dropdowns
|
|
* ========================================================================
|
|
* Copyright 2011-2015 Twitter, Inc.
|
|
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
|
* ======================================================================== */
|
|
|
|
|
|
+function ($) {
|
|
'use strict';
|
|
|
|
// DROPDOWN CLASS DEFINITION
|
|
// =========================
|
|
|
|
var backdrop = '.dropdown-backdrop'
|
|
var toggle = '[data-toggle="dropdown"]'
|
|
var Dropdown = function (element) {
|
|
$(element).on('click.bs.dropdown', this.toggle)
|
|
}
|
|
|
|
Dropdown.VERSION = '3.3.6'
|
|
|
|
function getParent($this) {
|
|
var selector = $this.attr('data-target')
|
|
|
|
if (!selector) {
|
|
selector = $this.attr('href')
|
|
selector = selector && /#[A-Za-z]/.test(selector) && selector.replace(/.*(?=#[^\s]*$)/, '') // strip for ie7
|
|
}
|
|
|
|
var $parent = selector && $(selector)
|
|
|
|
return $parent && $parent.length ? $parent : $this.parent()
|
|
}
|
|
|
|
function clearMenus(e) {
|
|
if (e && e.which === 3) return
|
|
$(backdrop).remove()
|
|
$(toggle).each(function () {
|
|
var $this = $(this)
|
|
var $parent = getParent($this)
|
|
var relatedTarget = { relatedTarget: this }
|
|
|
|
if (!$parent.hasClass('open')) return
|
|
|
|
if (e && e.type == 'click' && /input|textarea/i.test(e.target.tagName) && $.contains($parent[0], e.target)) return
|
|
|
|
$parent.trigger(e = $.Event('hide.bs.dropdown', relatedTarget))
|
|
|
|
if (e.isDefaultPrevented()) return
|
|
|
|
$this.attr('aria-expanded', 'false')
|
|
$parent.removeClass('open').trigger($.Event('hidden.bs.dropdown', relatedTarget))
|
|
})
|
|
}
|
|
|
|
Dropdown.prototype.toggle = function (e) {
|
|
var $this = $(this)
|
|
|
|
if ($this.is('.disabled, :disabled')) return
|
|
|
|
var $parent = getParent($this)
|
|
var isActive = $parent.hasClass('open')
|
|
|
|
clearMenus()
|
|
|
|
if (!isActive) {
|
|
if ('ontouchstart' in document.documentElement && !$parent.closest('.navbar-nav').length) {
|
|
// if mobile we use a backdrop because click events don't delegate
|
|
$(document.createElement('div'))
|
|
.addClass('dropdown-backdrop')
|
|
.insertAfter($(this))
|
|
.on('click', clearMenus)
|
|
}
|
|
|
|
var relatedTarget = { relatedTarget: this }
|
|
$parent.trigger(e = $.Event('show.bs.dropdown', relatedTarget))
|
|
|
|
if (e.isDefaultPrevented()) return
|
|
|
|
$this
|
|
.trigger('focus')
|
|
.attr('aria-expanded', 'true')
|
|
|
|
$parent
|
|
.toggleClass('open')
|
|
.trigger($.Event('shown.bs.dropdown', relatedTarget))
|
|
}
|
|
|
|
return false
|
|
}
|
|
|
|
Dropdown.prototype.keydown = function (e) {
|
|
if (!/(38|40|27|32)/.test(e.which) || /input|textarea/i.test(e.target.tagName)) return
|
|
|
|
var $this = $(this)
|
|
|
|
e.preventDefault()
|
|
e.stopPropagation()
|
|
|
|
if ($this.is('.disabled, :disabled')) return
|
|
|
|
var $parent = getParent($this)
|
|
var isActive = $parent.hasClass('open')
|
|
|
|
if (!isActive && e.which != 27 || isActive && e.which == 27) {
|
|
if (e.which == 27) $parent.find(toggle).trigger('focus')
|
|
return $this.trigger('click')
|
|
}
|
|
|
|
var desc = ' li:not(.disabled):visible a'
|
|
var $items = $parent.find('.dropdown-menu' + desc)
|
|
|
|
if (!$items.length) return
|
|
|
|
var index = $items.index(e.target)
|
|
|
|
if (e.which == 38 && index > 0) index-- // up
|
|
if (e.which == 40 && index < $items.length - 1) index++ // down
|
|
if (!~index) index = 0
|
|
|
|
$items.eq(index).trigger('focus')
|
|
}
|
|
|
|
|
|
// DROPDOWN PLUGIN DEFINITION
|
|
// ==========================
|
|
|
|
function Plugin(option) {
|
|
return this.each(function () {
|
|
var $this = $(this)
|
|
var data = $this.data('bs.dropdown')
|
|
|
|
if (!data) $this.data('bs.dropdown', (data = new Dropdown(this)))
|
|
if (typeof option == 'string') data[option].call($this)
|
|
})
|
|
}
|
|
|
|
var old = $.fn.dropdown
|
|
|
|
$.fn.dropdown = Plugin
|
|
$.fn.dropdown.Constructor = Dropdown
|
|
|
|
|
|
// DROPDOWN NO CONFLICT
|
|
// ====================
|
|
|
|
$.fn.dropdown.noConflict = function () {
|
|
$.fn.dropdown = old
|
|
return this
|
|
}
|
|
|
|
|
|
// APPLY TO STANDARD DROPDOWN ELEMENTS
|
|
// ===================================
|
|
|
|
$(document)
|
|
.on('click.bs.dropdown.data-api', clearMenus)
|
|
.on('click.bs.dropdown.data-api', '.dropdown form', function (e) { e.stopPropagation() })
|
|
.on('click.bs.dropdown.data-api', toggle, Dropdown.prototype.toggle)
|
|
.on('keydown.bs.dropdown.data-api', toggle, Dropdown.prototype.keydown)
|
|
.on('keydown.bs.dropdown.data-api', '.dropdown-menu', Dropdown.prototype.keydown)
|
|
|
|
}(jQuery);
|
|
;
|
|
/* ========================================================================
|
|
* Bootstrap: modal.js v3.3.6
|
|
* http://getbootstrap.com/javascript/#modals
|
|
* ========================================================================
|
|
* Copyright 2011-2015 Twitter, Inc.
|
|
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
|
* ======================================================================== */
|
|
|
|
|
|
+function ($) {
|
|
'use strict';
|
|
|
|
// MODAL CLASS DEFINITION
|
|
// ======================
|
|
|
|
var Modal = function (element, options) {
|
|
this.options = options
|
|
this.$body = $(document.body)
|
|
this.$element = $(element)
|
|
this.$dialog = this.$element.find('.modal-dialog')
|
|
this.$backdrop = null
|
|
this.isShown = null
|
|
this.originalBodyPad = null
|
|
this.scrollbarWidth = 0
|
|
this.ignoreBackdropClick = false
|
|
|
|
if (this.options.remote) {
|
|
this.$element
|
|
.find('.modal-content')
|
|
.load(this.options.remote, $.proxy(function () {
|
|
this.$element.trigger('loaded.bs.modal')
|
|
}, this))
|
|
}
|
|
}
|
|
|
|
Modal.VERSION = '3.3.6'
|
|
|
|
Modal.TRANSITION_DURATION = 300
|
|
Modal.BACKDROP_TRANSITION_DURATION = 150
|
|
|
|
Modal.DEFAULTS = {
|
|
backdrop: true,
|
|
keyboard: true,
|
|
show: true
|
|
}
|
|
|
|
Modal.prototype.toggle = function (_relatedTarget) {
|
|
return this.isShown ? this.hide() : this.show(_relatedTarget)
|
|
}
|
|
|
|
Modal.prototype.show = function (_relatedTarget) {
|
|
var that = this
|
|
var e = $.Event('show.bs.modal', { relatedTarget: _relatedTarget })
|
|
|
|
this.$element.trigger(e)
|
|
|
|
if (this.isShown || e.isDefaultPrevented()) return
|
|
|
|
this.isShown = true
|
|
|
|
this.checkScrollbar()
|
|
this.setScrollbar()
|
|
this.$body.addClass('modal-open')
|
|
|
|
this.escape()
|
|
this.resize()
|
|
|
|
this.$element.on('click.dismiss.bs.modal', '[data-dismiss="modal"]', $.proxy(this.hide, this))
|
|
|
|
this.$dialog.on('mousedown.dismiss.bs.modal', function () {
|
|
that.$element.one('mouseup.dismiss.bs.modal', function (e) {
|
|
if ($(e.target).is(that.$element)) that.ignoreBackdropClick = true
|
|
})
|
|
})
|
|
|
|
this.backdrop(function () {
|
|
var transition = $.support.transition && that.$element.hasClass('fade')
|
|
|
|
if (!that.$element.parent().length) {
|
|
that.$element.appendTo(that.$body) // don't move modals dom position
|
|
}
|
|
|
|
that.$element
|
|
.show()
|
|
.scrollTop(0)
|
|
|
|
that.adjustDialog()
|
|
|
|
if (transition) {
|
|
that.$element[0].offsetWidth // force reflow
|
|
}
|
|
|
|
that.$element.addClass('in')
|
|
|
|
that.enforceFocus()
|
|
|
|
var e = $.Event('shown.bs.modal', { relatedTarget: _relatedTarget })
|
|
|
|
transition ?
|
|
that.$dialog // wait for modal to slide in
|
|
.one('bsTransitionEnd', function () {
|
|
that.$element.trigger('focus').trigger(e)
|
|
})
|
|
.emulateTransitionEnd(Modal.TRANSITION_DURATION) :
|
|
that.$element.trigger('focus').trigger(e)
|
|
})
|
|
}
|
|
|
|
Modal.prototype.hide = function (e) {
|
|
if (e) e.preventDefault()
|
|
|
|
e = $.Event('hide.bs.modal')
|
|
|
|
this.$element.trigger(e)
|
|
|
|
if (!this.isShown || e.isDefaultPrevented()) return
|
|
|
|
this.isShown = false
|
|
|
|
this.escape()
|
|
this.resize()
|
|
|
|
$(document).off('focusin.bs.modal')
|
|
|
|
this.$element
|
|
.removeClass('in')
|
|
.off('click.dismiss.bs.modal')
|
|
.off('mouseup.dismiss.bs.modal')
|
|
|
|
this.$dialog.off('mousedown.dismiss.bs.modal')
|
|
|
|
$.support.transition && this.$element.hasClass('fade') ?
|
|
this.$element
|
|
.one('bsTransitionEnd', $.proxy(this.hideModal, this))
|
|
.emulateTransitionEnd(Modal.TRANSITION_DURATION) :
|
|
this.hideModal()
|
|
}
|
|
|
|
Modal.prototype.enforceFocus = function () {
|
|
$(document)
|
|
.off('focusin.bs.modal') // guard against infinite focus loop
|
|
.on('focusin.bs.modal', $.proxy(function (e) {
|
|
if (this.$element[0] !== e.target && !this.$element.has(e.target).length) {
|
|
this.$element.trigger('focus')
|
|
}
|
|
}, this))
|
|
}
|
|
|
|
Modal.prototype.escape = function () {
|
|
if (this.isShown && this.options.keyboard) {
|
|
this.$element.on('keydown.dismiss.bs.modal', $.proxy(function (e) {
|
|
e.which == 27 && this.hide()
|
|
}, this))
|
|
} else if (!this.isShown) {
|
|
this.$element.off('keydown.dismiss.bs.modal')
|
|
}
|
|
}
|
|
|
|
Modal.prototype.resize = function () {
|
|
if (this.isShown) {
|
|
$(window).on('resize.bs.modal', $.proxy(this.handleUpdate, this))
|
|
} else {
|
|
$(window).off('resize.bs.modal')
|
|
}
|
|
}
|
|
|
|
Modal.prototype.hideModal = function () {
|
|
var that = this
|
|
this.$element.hide()
|
|
this.backdrop(function () {
|
|
that.$body.removeClass('modal-open')
|
|
that.resetAdjustments()
|
|
that.resetScrollbar()
|
|
that.$element.trigger('hidden.bs.modal')
|
|
})
|
|
}
|
|
|
|
Modal.prototype.removeBackdrop = function () {
|
|
this.$backdrop && this.$backdrop.remove()
|
|
this.$backdrop = null
|
|
}
|
|
|
|
Modal.prototype.backdrop = function (callback) {
|
|
var that = this
|
|
var animate = this.$element.hasClass('fade') ? 'fade' : ''
|
|
|
|
if (this.isShown && this.options.backdrop) {
|
|
var doAnimate = $.support.transition && animate
|
|
|
|
this.$backdrop = $(document.createElement('div'))
|
|
.addClass('modal-backdrop ' + animate)
|
|
.appendTo(this.$body)
|
|
|
|
this.$element.on('click.dismiss.bs.modal', $.proxy(function (e) {
|
|
if (this.ignoreBackdropClick) {
|
|
this.ignoreBackdropClick = false
|
|
return
|
|
}
|
|
if (e.target !== e.currentTarget) return
|
|
this.options.backdrop == 'static'
|
|
? this.$element[0].focus()
|
|
: this.hide()
|
|
}, this))
|
|
|
|
if (doAnimate) this.$backdrop[0].offsetWidth // force reflow
|
|
|
|
this.$backdrop.addClass('in')
|
|
|
|
if (!callback) return
|
|
|
|
doAnimate ?
|
|
this.$backdrop
|
|
.one('bsTransitionEnd', callback)
|
|
.emulateTransitionEnd(Modal.BACKDROP_TRANSITION_DURATION) :
|
|
callback()
|
|
|
|
} else if (!this.isShown && this.$backdrop) {
|
|
this.$backdrop.removeClass('in')
|
|
|
|
var callbackRemove = function () {
|
|
that.removeBackdrop()
|
|
callback && callback()
|
|
}
|
|
$.support.transition && this.$element.hasClass('fade') ?
|
|
this.$backdrop
|
|
.one('bsTransitionEnd', callbackRemove)
|
|
.emulateTransitionEnd(Modal.BACKDROP_TRANSITION_DURATION) :
|
|
callbackRemove()
|
|
|
|
} else if (callback) {
|
|
callback()
|
|
}
|
|
}
|
|
|
|
// these following methods are used to handle overflowing modals
|
|
|
|
Modal.prototype.handleUpdate = function () {
|
|
this.adjustDialog()
|
|
}
|
|
|
|
Modal.prototype.adjustDialog = function () {
|
|
var modalIsOverflowing = this.$element[0].scrollHeight > document.documentElement.clientHeight
|
|
|
|
this.$element.css({
|
|
paddingLeft: !this.bodyIsOverflowing && modalIsOverflowing ? this.scrollbarWidth : '',
|
|
paddingRight: this.bodyIsOverflowing && !modalIsOverflowing ? this.scrollbarWidth : ''
|
|
})
|
|
}
|
|
|
|
Modal.prototype.resetAdjustments = function () {
|
|
this.$element.css({
|
|
paddingLeft: '',
|
|
paddingRight: ''
|
|
})
|
|
}
|
|
|
|
Modal.prototype.checkScrollbar = function () {
|
|
var fullWindowWidth = window.innerWidth
|
|
if (!fullWindowWidth) { // workaround for missing window.innerWidth in IE8
|
|
var documentElementRect = document.documentElement.getBoundingClientRect()
|
|
fullWindowWidth = documentElementRect.right - Math.abs(documentElementRect.left)
|
|
}
|
|
this.bodyIsOverflowing = document.body.clientWidth < fullWindowWidth
|
|
this.scrollbarWidth = this.measureScrollbar()
|
|
}
|
|
|
|
Modal.prototype.setScrollbar = function () {
|
|
var bodyPad = parseInt((this.$body.css('padding-right') || 0), 10)
|
|
this.originalBodyPad = document.body.style.paddingRight || ''
|
|
if (this.bodyIsOverflowing) this.$body.css('padding-right', bodyPad + this.scrollbarWidth)
|
|
}
|
|
|
|
Modal.prototype.resetScrollbar = function () {
|
|
this.$body.css('padding-right', this.originalBodyPad)
|
|
}
|
|
|
|
Modal.prototype.measureScrollbar = function () { // thx walsh
|
|
var scrollDiv = document.createElement('div')
|
|
scrollDiv.className = 'modal-scrollbar-measure'
|
|
this.$body.append(scrollDiv)
|
|
var scrollbarWidth = scrollDiv.offsetWidth - scrollDiv.clientWidth
|
|
this.$body[0].removeChild(scrollDiv)
|
|
return scrollbarWidth
|
|
}
|
|
|
|
|
|
// MODAL PLUGIN DEFINITION
|
|
// =======================
|
|
|
|
function Plugin(option, _relatedTarget) {
|
|
return this.each(function () {
|
|
var $this = $(this)
|
|
var data = $this.data('bs.modal')
|
|
var options = $.extend({}, Modal.DEFAULTS, $this.data(), typeof option == 'object' && option)
|
|
|
|
if (!data) $this.data('bs.modal', (data = new Modal(this, options)))
|
|
if (typeof option == 'string') data[option](_relatedTarget)
|
|
else if (options.show) data.show(_relatedTarget)
|
|
})
|
|
}
|
|
|
|
var old = $.fn.modal
|
|
|
|
$.fn.modal = Plugin
|
|
$.fn.modal.Constructor = Modal
|
|
|
|
|
|
// MODAL NO CONFLICT
|
|
// =================
|
|
|
|
$.fn.modal.noConflict = function () {
|
|
$.fn.modal = old
|
|
return this
|
|
}
|
|
|
|
|
|
// MODAL DATA-API
|
|
// ==============
|
|
|
|
$(document).on('click.bs.modal.data-api', '[data-toggle="modal"]', function (e) {
|
|
var $this = $(this)
|
|
var href = $this.attr('href')
|
|
var $target = $($this.attr('data-target') || (href && href.replace(/.*(?=#[^\s]+$)/, ''))) // strip for ie7
|
|
var option = $target.data('bs.modal') ? 'toggle' : $.extend({ remote: !/#/.test(href) && href }, $target.data(), $this.data())
|
|
|
|
if ($this.is('a')) e.preventDefault()
|
|
|
|
$target.one('show.bs.modal', function (showEvent) {
|
|
if (showEvent.isDefaultPrevented()) return // only register focus restorer if modal will actually get shown
|
|
$target.one('hidden.bs.modal', function () {
|
|
$this.is(':visible') && $this.trigger('focus')
|
|
})
|
|
})
|
|
Plugin.call($target, option, this)
|
|
})
|
|
|
|
}(jQuery);
|
|
;
|
|
/* ========================================================================
|
|
* Bootstrap: tooltip.js v3.3.6
|
|
* http://getbootstrap.com/javascript/#tooltip
|
|
* Inspired by the original jQuery.tipsy by Jason Frame
|
|
* ========================================================================
|
|
* Copyright 2011-2015 Twitter, Inc.
|
|
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
|
* ======================================================================== */
|
|
|
|
|
|
+function ($) {
|
|
'use strict';
|
|
|
|
// TOOLTIP PUBLIC CLASS DEFINITION
|
|
// ===============================
|
|
|
|
var Tooltip = function (element, options) {
|
|
this.type = null
|
|
this.options = null
|
|
this.enabled = null
|
|
this.timeout = null
|
|
this.hoverState = null
|
|
this.$element = null
|
|
this.inState = null
|
|
|
|
this.init('tooltip', element, options)
|
|
}
|
|
|
|
Tooltip.VERSION = '3.3.6'
|
|
|
|
Tooltip.TRANSITION_DURATION = 150
|
|
|
|
Tooltip.DEFAULTS = {
|
|
animation: true,
|
|
placement: 'top',
|
|
selector: false,
|
|
template: '<div class="tooltip" role="tooltip"><div class="tooltip-arrow"></div><div class="tooltip-inner"></div></div>',
|
|
trigger: 'hover focus',
|
|
title: '',
|
|
delay: 0,
|
|
html: false,
|
|
container: false,
|
|
viewport: {
|
|
selector: 'body',
|
|
padding: 0
|
|
}
|
|
}
|
|
|
|
Tooltip.prototype.init = function (type, element, options) {
|
|
this.enabled = true
|
|
this.type = type
|
|
this.$element = $(element)
|
|
this.options = this.getOptions(options)
|
|
this.$viewport = this.options.viewport && $($.isFunction(this.options.viewport) ? this.options.viewport.call(this, this.$element) : (this.options.viewport.selector || this.options.viewport))
|
|
this.inState = { click: false, hover: false, focus: false }
|
|
|
|
if (this.$element[0] instanceof document.constructor && !this.options.selector) {
|
|
throw new Error('`selector` option must be specified when initializing ' + this.type + ' on the window.document object!')
|
|
}
|
|
|
|
var triggers = this.options.trigger.split(' ')
|
|
|
|
for (var i = triggers.length; i--;) {
|
|
var trigger = triggers[i]
|
|
|
|
if (trigger == 'click') {
|
|
this.$element.on('click.' + this.type, this.options.selector, $.proxy(this.toggle, this))
|
|
} else if (trigger != 'manual') {
|
|
var eventIn = trigger == 'hover' ? 'mouseenter' : 'focusin'
|
|
var eventOut = trigger == 'hover' ? 'mouseleave' : 'focusout'
|
|
|
|
this.$element.on(eventIn + '.' + this.type, this.options.selector, $.proxy(this.enter, this))
|
|
this.$element.on(eventOut + '.' + this.type, this.options.selector, $.proxy(this.leave, this))
|
|
}
|
|
}
|
|
|
|
this.options.selector ?
|
|
(this._options = $.extend({}, this.options, { trigger: 'manual', selector: '' })) :
|
|
this.fixTitle()
|
|
}
|
|
|
|
Tooltip.prototype.getDefaults = function () {
|
|
return Tooltip.DEFAULTS
|
|
}
|
|
|
|
Tooltip.prototype.getOptions = function (options) {
|
|
options = $.extend({}, this.getDefaults(), this.$element.data(), options)
|
|
|
|
if (options.delay && typeof options.delay == 'number') {
|
|
options.delay = {
|
|
show: options.delay,
|
|
hide: options.delay
|
|
}
|
|
}
|
|
|
|
return options
|
|
}
|
|
|
|
Tooltip.prototype.getDelegateOptions = function () {
|
|
var options = {}
|
|
var defaults = this.getDefaults()
|
|
|
|
this._options && $.each(this._options, function (key, value) {
|
|
if (defaults[key] != value) options[key] = value
|
|
})
|
|
|
|
return options
|
|
}
|
|
|
|
Tooltip.prototype.enter = function (obj) {
|
|
var self = obj instanceof this.constructor ?
|
|
obj : $(obj.currentTarget).data('bs.' + this.type)
|
|
|
|
if (!self) {
|
|
self = new this.constructor(obj.currentTarget, this.getDelegateOptions())
|
|
$(obj.currentTarget).data('bs.' + this.type, self)
|
|
}
|
|
|
|
if (obj instanceof $.Event) {
|
|
self.inState[obj.type == 'focusin' ? 'focus' : 'hover'] = true
|
|
}
|
|
|
|
if (self.tip().hasClass('in') || self.hoverState == 'in') {
|
|
self.hoverState = 'in'
|
|
return
|
|
}
|
|
|
|
clearTimeout(self.timeout)
|
|
|
|
self.hoverState = 'in'
|
|
|
|
if (!self.options.delay || !self.options.delay.show) return self.show()
|
|
|
|
self.timeout = setTimeout(function () {
|
|
if (self.hoverState == 'in') self.show()
|
|
}, self.options.delay.show)
|
|
}
|
|
|
|
Tooltip.prototype.isInStateTrue = function () {
|
|
for (var key in this.inState) {
|
|
if (this.inState[key]) return true
|
|
}
|
|
|
|
return false
|
|
}
|
|
|
|
Tooltip.prototype.leave = function (obj) {
|
|
var self = obj instanceof this.constructor ?
|
|
obj : $(obj.currentTarget).data('bs.' + this.type)
|
|
|
|
if (!self) {
|
|
self = new this.constructor(obj.currentTarget, this.getDelegateOptions())
|
|
$(obj.currentTarget).data('bs.' + this.type, self)
|
|
}
|
|
|
|
if (obj instanceof $.Event) {
|
|
self.inState[obj.type == 'focusout' ? 'focus' : 'hover'] = false
|
|
}
|
|
|
|
if (self.isInStateTrue()) return
|
|
|
|
clearTimeout(self.timeout)
|
|
|
|
self.hoverState = 'out'
|
|
|
|
if (!self.options.delay || !self.options.delay.hide) return self.hide()
|
|
|
|
self.timeout = setTimeout(function () {
|
|
if (self.hoverState == 'out') self.hide()
|
|
}, self.options.delay.hide)
|
|
}
|
|
|
|
Tooltip.prototype.show = function () {
|
|
var e = $.Event('show.bs.' + this.type)
|
|
|
|
if (this.hasContent() && this.enabled) {
|
|
this.$element.trigger(e)
|
|
|
|
var inDom = $.contains(this.$element[0].ownerDocument.documentElement, this.$element[0])
|
|
if (e.isDefaultPrevented() || !inDom) return
|
|
var that = this
|
|
|
|
var $tip = this.tip()
|
|
|
|
var tipId = this.getUID(this.type)
|
|
|
|
this.setContent()
|
|
$tip.attr('id', tipId)
|
|
this.$element.attr('aria-describedby', tipId)
|
|
|
|
if (this.options.animation) $tip.addClass('fade')
|
|
|
|
var placement = typeof this.options.placement == 'function' ?
|
|
this.options.placement.call(this, $tip[0], this.$element[0]) :
|
|
this.options.placement
|
|
|
|
var autoToken = /\s?auto?\s?/i
|
|
var autoPlace = autoToken.test(placement)
|
|
if (autoPlace) placement = placement.replace(autoToken, '') || 'top'
|
|
|
|
$tip
|
|
.detach()
|
|
.css({ top: 0, left: 0, display: 'block' })
|
|
.addClass(placement)
|
|
.data('bs.' + this.type, this)
|
|
|
|
this.options.container ? $tip.appendTo(this.options.container) : $tip.insertAfter(this.$element)
|
|
this.$element.trigger('inserted.bs.' + this.type)
|
|
|
|
var pos = this.getPosition()
|
|
var actualWidth = $tip[0].offsetWidth
|
|
var actualHeight = $tip[0].offsetHeight
|
|
|
|
if (autoPlace) {
|
|
var orgPlacement = placement
|
|
var viewportDim = this.getPosition(this.$viewport)
|
|
|
|
placement = placement == 'bottom' && pos.bottom + actualHeight > viewportDim.bottom ? 'top' :
|
|
placement == 'top' && pos.top - actualHeight < viewportDim.top ? 'bottom' :
|
|
placement == 'right' && pos.right + actualWidth > viewportDim.width ? 'left' :
|
|
placement == 'left' && pos.left - actualWidth < viewportDim.left ? 'right' :
|
|
placement
|
|
|
|
$tip
|
|
.removeClass(orgPlacement)
|
|
.addClass(placement)
|
|
}
|
|
|
|
var calculatedOffset = this.getCalculatedOffset(placement, pos, actualWidth, actualHeight)
|
|
|
|
this.applyPlacement(calculatedOffset, placement)
|
|
|
|
var complete = function () {
|
|
var prevHoverState = that.hoverState
|
|
that.$element.trigger('shown.bs.' + that.type)
|
|
that.hoverState = null
|
|
|
|
if (prevHoverState == 'out') that.leave(that)
|
|
}
|
|
|
|
$.support.transition && this.$tip.hasClass('fade') ?
|
|
$tip
|
|
.one('bsTransitionEnd', complete)
|
|
.emulateTransitionEnd(Tooltip.TRANSITION_DURATION) :
|
|
complete()
|
|
}
|
|
}
|
|
|
|
Tooltip.prototype.applyPlacement = function (offset, placement) {
|
|
var $tip = this.tip()
|
|
var width = $tip[0].offsetWidth
|
|
var height = $tip[0].offsetHeight
|
|
|
|
// manually read margins because getBoundingClientRect includes difference
|
|
var marginTop = parseInt($tip.css('margin-top'), 10)
|
|
var marginLeft = parseInt($tip.css('margin-left'), 10)
|
|
|
|
// we must check for NaN for ie 8/9
|
|
if (isNaN(marginTop)) marginTop = 0
|
|
if (isNaN(marginLeft)) marginLeft = 0
|
|
|
|
offset.top += marginTop
|
|
offset.left += marginLeft
|
|
|
|
// $.fn.offset doesn't round pixel values
|
|
// so we use setOffset directly with our own function B-0
|
|
$.offset.setOffset($tip[0], $.extend({
|
|
using: function (props) {
|
|
$tip.css({
|
|
top: Math.round(props.top),
|
|
left: Math.round(props.left)
|
|
})
|
|
}
|
|
}, offset), 0)
|
|
|
|
$tip.addClass('in')
|
|
|
|
// check to see if placing tip in new offset caused the tip to resize itself
|
|
var actualWidth = $tip[0].offsetWidth
|
|
var actualHeight = $tip[0].offsetHeight
|
|
|
|
if (placement == 'top' && actualHeight != height) {
|
|
offset.top = offset.top + height - actualHeight
|
|
}
|
|
|
|
var delta = this.getViewportAdjustedDelta(placement, offset, actualWidth, actualHeight)
|
|
|
|
if (delta.left) offset.left += delta.left
|
|
else offset.top += delta.top
|
|
|
|
var isVertical = /top|bottom/.test(placement)
|
|
var arrowDelta = isVertical ? delta.left * 2 - width + actualWidth : delta.top * 2 - height + actualHeight
|
|
var arrowOffsetPosition = isVertical ? 'offsetWidth' : 'offsetHeight'
|
|
|
|
$tip.offset(offset)
|
|
this.replaceArrow(arrowDelta, $tip[0][arrowOffsetPosition], isVertical)
|
|
}
|
|
|
|
Tooltip.prototype.replaceArrow = function (delta, dimension, isVertical) {
|
|
this.arrow()
|
|
.css(isVertical ? 'left' : 'top', 50 * (1 - delta / dimension) + '%')
|
|
.css(isVertical ? 'top' : 'left', '')
|
|
}
|
|
|
|
Tooltip.prototype.setContent = function () {
|
|
var $tip = this.tip()
|
|
var title = this.getTitle()
|
|
|
|
$tip.find('.tooltip-inner')[this.options.html ? 'html' : 'text'](title)
|
|
$tip.removeClass('fade in top bottom left right')
|
|
}
|
|
|
|
Tooltip.prototype.hide = function (callback) {
|
|
var that = this
|
|
var $tip = $(this.$tip)
|
|
var e = $.Event('hide.bs.' + this.type)
|
|
|
|
function complete() {
|
|
if (that.hoverState != 'in') $tip.detach()
|
|
that.$element
|
|
.removeAttr('aria-describedby')
|
|
.trigger('hidden.bs.' + that.type)
|
|
callback && callback()
|
|
}
|
|
|
|
this.$element.trigger(e)
|
|
|
|
if (e.isDefaultPrevented()) return
|
|
|
|
$tip.removeClass('in')
|
|
|
|
$.support.transition && $tip.hasClass('fade') ?
|
|
$tip
|
|
.one('bsTransitionEnd', complete)
|
|
.emulateTransitionEnd(Tooltip.TRANSITION_DURATION) :
|
|
complete()
|
|
|
|
this.hoverState = null
|
|
|
|
return this
|
|
}
|
|
|
|
Tooltip.prototype.fixTitle = function () {
|
|
var $e = this.$element
|
|
if ($e.attr('title') || typeof $e.attr('data-original-title') != 'string') {
|
|
$e.attr('data-original-title', $e.attr('title') || '').attr('title', '')
|
|
}
|
|
}
|
|
|
|
Tooltip.prototype.hasContent = function () {
|
|
return this.getTitle()
|
|
}
|
|
|
|
Tooltip.prototype.getPosition = function ($element) {
|
|
$element = $element || this.$element
|
|
|
|
var el = $element[0]
|
|
var isBody = el.tagName == 'BODY'
|
|
|
|
var elRect = el.getBoundingClientRect()
|
|
if (elRect.width == null) {
|
|
// width and height are missing in IE8, so compute them manually; see https://github.com/twbs/bootstrap/issues/14093
|
|
elRect = $.extend({}, elRect, { width: elRect.right - elRect.left, height: elRect.bottom - elRect.top })
|
|
}
|
|
var elOffset = isBody ? { top: 0, left: 0 } : $element.offset()
|
|
var scroll = { scroll: isBody ? document.documentElement.scrollTop || document.body.scrollTop : $element.scrollTop() }
|
|
var outerDims = isBody ? { width: $(window).width(), height: $(window).height() } : null
|
|
|
|
return $.extend({}, elRect, scroll, outerDims, elOffset)
|
|
}
|
|
|
|
Tooltip.prototype.getCalculatedOffset = function (placement, pos, actualWidth, actualHeight) {
|
|
return placement == 'bottom' ? { top: pos.top + pos.height, left: pos.left + pos.width / 2 - actualWidth / 2 } :
|
|
placement == 'top' ? { top: pos.top - actualHeight, left: pos.left + pos.width / 2 - actualWidth / 2 } :
|
|
placement == 'left' ? { top: pos.top + pos.height / 2 - actualHeight / 2, left: pos.left - actualWidth } :
|
|
/* placement == 'right' */ { top: pos.top + pos.height / 2 - actualHeight / 2, left: pos.left + pos.width }
|
|
|
|
}
|
|
|
|
Tooltip.prototype.getViewportAdjustedDelta = function (placement, pos, actualWidth, actualHeight) {
|
|
var delta = { top: 0, left: 0 }
|
|
if (!this.$viewport) return delta
|
|
|
|
var viewportPadding = this.options.viewport && this.options.viewport.padding || 0
|
|
var viewportDimensions = this.getPosition(this.$viewport)
|
|
|
|
if (/right|left/.test(placement)) {
|
|
var topEdgeOffset = pos.top - viewportPadding - viewportDimensions.scroll
|
|
var bottomEdgeOffset = pos.top + viewportPadding - viewportDimensions.scroll + actualHeight
|
|
if (topEdgeOffset < viewportDimensions.top) { // top overflow
|
|
delta.top = viewportDimensions.top - topEdgeOffset
|
|
} else if (bottomEdgeOffset > viewportDimensions.top + viewportDimensions.height) { // bottom overflow
|
|
delta.top = viewportDimensions.top + viewportDimensions.height - bottomEdgeOffset
|
|
}
|
|
} else {
|
|
var leftEdgeOffset = pos.left - viewportPadding
|
|
var rightEdgeOffset = pos.left + viewportPadding + actualWidth
|
|
if (leftEdgeOffset < viewportDimensions.left) { // left overflow
|
|
delta.left = viewportDimensions.left - leftEdgeOffset
|
|
} else if (rightEdgeOffset > viewportDimensions.right) { // right overflow
|
|
delta.left = viewportDimensions.left + viewportDimensions.width - rightEdgeOffset
|
|
}
|
|
}
|
|
|
|
return delta
|
|
}
|
|
|
|
Tooltip.prototype.getTitle = function () {
|
|
var title
|
|
var $e = this.$element
|
|
var o = this.options
|
|
|
|
title = $e.attr('data-original-title')
|
|
|| (typeof o.title == 'function' ? o.title.call($e[0]) : o.title)
|
|
|
|
return title
|
|
}
|
|
|
|
Tooltip.prototype.getUID = function (prefix) {
|
|
do prefix += ~~(Math.random() * 1000000)
|
|
while (document.getElementById(prefix))
|
|
return prefix
|
|
}
|
|
|
|
Tooltip.prototype.tip = function () {
|
|
if (!this.$tip) {
|
|
this.$tip = $(this.options.template)
|
|
if (this.$tip.length != 1) {
|
|
throw new Error(this.type + ' `template` option must consist of exactly 1 top-level element!')
|
|
}
|
|
}
|
|
return this.$tip
|
|
}
|
|
|
|
Tooltip.prototype.arrow = function () {
|
|
return (this.$arrow = this.$arrow || this.tip().find('.tooltip-arrow'))
|
|
}
|
|
|
|
Tooltip.prototype.enable = function () {
|
|
this.enabled = true
|
|
}
|
|
|
|
Tooltip.prototype.disable = function () {
|
|
this.enabled = false
|
|
}
|
|
|
|
Tooltip.prototype.toggleEnabled = function () {
|
|
this.enabled = !this.enabled
|
|
}
|
|
|
|
Tooltip.prototype.toggle = function (e) {
|
|
var self = this
|
|
if (e) {
|
|
self = $(e.currentTarget).data('bs.' + this.type)
|
|
if (!self) {
|
|
self = new this.constructor(e.currentTarget, this.getDelegateOptions())
|
|
$(e.currentTarget).data('bs.' + this.type, self)
|
|
}
|
|
}
|
|
|
|
if (e) {
|
|
self.inState.click = !self.inState.click
|
|
if (self.isInStateTrue()) self.enter(self)
|
|
else self.leave(self)
|
|
} else {
|
|
self.tip().hasClass('in') ? self.leave(self) : self.enter(self)
|
|
}
|
|
}
|
|
|
|
Tooltip.prototype.destroy = function () {
|
|
var that = this
|
|
clearTimeout(this.timeout)
|
|
this.hide(function () {
|
|
that.$element.off('.' + that.type).removeData('bs.' + that.type)
|
|
if (that.$tip) {
|
|
that.$tip.detach()
|
|
}
|
|
that.$tip = null
|
|
that.$arrow = null
|
|
that.$viewport = null
|
|
})
|
|
}
|
|
|
|
|
|
// TOOLTIP PLUGIN DEFINITION
|
|
// =========================
|
|
|
|
function Plugin(option) {
|
|
return this.each(function () {
|
|
var $this = $(this)
|
|
var data = $this.data('bs.tooltip')
|
|
var options = typeof option == 'object' && option
|
|
|
|
if (!data && /destroy|hide/.test(option)) return
|
|
if (!data) $this.data('bs.tooltip', (data = new Tooltip(this, options)))
|
|
if (typeof option == 'string') data[option]()
|
|
})
|
|
}
|
|
|
|
var old = $.fn.tooltip
|
|
|
|
$.fn.tooltip = Plugin
|
|
$.fn.tooltip.Constructor = Tooltip
|
|
|
|
|
|
// TOOLTIP NO CONFLICT
|
|
// ===================
|
|
|
|
$.fn.tooltip.noConflict = function () {
|
|
$.fn.tooltip = old
|
|
return this
|
|
}
|
|
|
|
}(jQuery);
|
|
;
|
|
/* ========================================================================
|
|
* Bootstrap: transition.js v3.3.6
|
|
* http://getbootstrap.com/javascript/#transitions
|
|
* ========================================================================
|
|
* Copyright 2011-2015 Twitter, Inc.
|
|
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
|
* ======================================================================== */
|
|
|
|
|
|
+function ($) {
|
|
'use strict';
|
|
|
|
// CSS TRANSITION SUPPORT (Shoutout: http://www.modernizr.com/)
|
|
// ============================================================
|
|
|
|
function transitionEnd() {
|
|
var el = document.createElement('bootstrap')
|
|
|
|
var transEndEventNames = {
|
|
WebkitTransition : 'webkitTransitionEnd',
|
|
MozTransition : 'transitionend',
|
|
OTransition : 'oTransitionEnd otransitionend',
|
|
transition : 'transitionend'
|
|
}
|
|
|
|
for (var name in transEndEventNames) {
|
|
if (el.style[name] !== undefined) {
|
|
return { end: transEndEventNames[name] }
|
|
}
|
|
}
|
|
|
|
return false // explicit for ie8 ( ._.)
|
|
}
|
|
|
|
// http://blog.alexmaccaw.com/css-transitions
|
|
$.fn.emulateTransitionEnd = function (duration) {
|
|
var called = false
|
|
var $el = this
|
|
$(this).one('bsTransitionEnd', function () { called = true })
|
|
var callback = function () { if (!called) $($el).trigger($.support.transition.end) }
|
|
setTimeout(callback, duration)
|
|
return this
|
|
}
|
|
|
|
$(function () {
|
|
$.support.transition = transitionEnd()
|
|
|
|
if (!$.support.transition) return
|
|
|
|
$.event.special.bsTransitionEnd = {
|
|
bindType: $.support.transition.end,
|
|
delegateType: $.support.transition.end,
|
|
handle: function (e) {
|
|
if ($(e.target).is(this)) return e.handleObj.handler.apply(this, arguments)
|
|
}
|
|
}
|
|
})
|
|
|
|
}(jQuery);
|
|
;
|
|
/**
|
|
* Copyright (c) 2011-2014 Felix Gnass
|
|
* Licensed under the MIT license
|
|
*/
|
|
(function(root, factory) {
|
|
|
|
/* CommonJS */
|
|
if (typeof exports == 'object') module.exports = factory()
|
|
|
|
/* AMD module */
|
|
else if (typeof define == 'function' && define.amd) define(factory)
|
|
|
|
/* Browser global */
|
|
else root.Spinner = factory()
|
|
}
|
|
(this, function() {
|
|
"use strict";
|
|
|
|
var prefixes = ['webkit', 'Moz', 'ms', 'O'] /* Vendor prefixes */
|
|
, animations = {} /* Animation rules keyed by their name */
|
|
, useCssAnimations /* Whether to use CSS animations or setTimeout */
|
|
|
|
/**
|
|
* Utility function to create elements. If no tag name is given,
|
|
* a DIV is created. Optionally properties can be passed.
|
|
*/
|
|
function createEl(tag, prop) {
|
|
var el = document.createElement(tag || 'div')
|
|
, n
|
|
|
|
for(n in prop) el[n] = prop[n]
|
|
return el
|
|
}
|
|
|
|
/**
|
|
* Appends children and returns the parent.
|
|
*/
|
|
function ins(parent /* child1, child2, ...*/) {
|
|
for (var i=1, n=arguments.length; i<n; i++)
|
|
parent.appendChild(arguments[i])
|
|
|
|
return parent
|
|
}
|
|
|
|
/**
|
|
* Insert a new stylesheet to hold the @keyframe or VML rules.
|
|
*/
|
|
var sheet = (function() {
|
|
var el = createEl('style', {type : 'text/css'})
|
|
ins(document.getElementsByTagName('head')[0], el)
|
|
return el.sheet || el.styleSheet
|
|
}())
|
|
|
|
/**
|
|
* Creates an opacity keyframe animation rule and returns its name.
|
|
* Since most mobile Webkits have timing issues with animation-delay,
|
|
* we create separate rules for each line/segment.
|
|
*/
|
|
function addAnimation(alpha, trail, i, lines) {
|
|
var name = ['opacity', trail, ~~(alpha*100), i, lines].join('-')
|
|
, start = 0.01 + i/lines * 100
|
|
, z = Math.max(1 - (1-alpha) / trail * (100-start), alpha)
|
|
, prefix = useCssAnimations.substring(0, useCssAnimations.indexOf('Animation')).toLowerCase()
|
|
, pre = prefix && '-' + prefix + '-' || ''
|
|
|
|
if (!animations[name]) {
|
|
sheet.insertRule(
|
|
'@' + pre + 'keyframes ' + name + '{' +
|
|
'0%{opacity:' + z + '}' +
|
|
start + '%{opacity:' + alpha + '}' +
|
|
(start+0.01) + '%{opacity:1}' +
|
|
(start+trail) % 100 + '%{opacity:' + alpha + '}' +
|
|
'100%{opacity:' + z + '}' +
|
|
'}', sheet.cssRules.length)
|
|
|
|
animations[name] = 1
|
|
}
|
|
|
|
return name
|
|
}
|
|
|
|
/**
|
|
* Tries various vendor prefixes and returns the first supported property.
|
|
*/
|
|
function vendor(el, prop) {
|
|
var s = el.style
|
|
, pp
|
|
, i
|
|
|
|
prop = prop.charAt(0).toUpperCase() + prop.slice(1)
|
|
for(i=0; i<prefixes.length; i++) {
|
|
pp = prefixes[i]+prop
|
|
if(s[pp] !== undefined) return pp
|
|
}
|
|
if(s[prop] !== undefined) return prop
|
|
}
|
|
|
|
/**
|
|
* Sets multiple style properties at once.
|
|
*/
|
|
function css(el, prop) {
|
|
for (var n in prop)
|
|
el.style[vendor(el, n)||n] = prop[n]
|
|
|
|
return el
|
|
}
|
|
|
|
/**
|
|
* Fills in default values.
|
|
*/
|
|
function merge(obj) {
|
|
for (var i=1; i < arguments.length; i++) {
|
|
var def = arguments[i]
|
|
for (var n in def)
|
|
if (obj[n] === undefined) obj[n] = def[n]
|
|
}
|
|
return obj
|
|
}
|
|
|
|
/**
|
|
* Returns the line color from the given string or array.
|
|
*/
|
|
function getColor(color, idx) {
|
|
return typeof color == 'string' ? color : color[idx % color.length]
|
|
}
|
|
|
|
// Built-in defaults
|
|
|
|
var defaults = {
|
|
lines: 12, // The number of lines to draw
|
|
length: 7, // The length of each line
|
|
width: 5, // The line thickness
|
|
radius: 10, // The radius of the inner circle
|
|
rotate: 0, // Rotation offset
|
|
corners: 1, // Roundness (0..1)
|
|
color: '#000', // #rgb or #rrggbb
|
|
direction: 1, // 1: clockwise, -1: counterclockwise
|
|
speed: 1, // Rounds per second
|
|
trail: 100, // Afterglow percentage
|
|
opacity: 1/4, // Opacity of the lines
|
|
fps: 20, // Frames per second when using setTimeout()
|
|
zIndex: 2e9, // Use a high z-index by default
|
|
className: 'spinner', // CSS class to assign to the element
|
|
top: '50%', // center vertically
|
|
left: '50%', // center horizontally
|
|
position: 'absolute' // element position
|
|
}
|
|
|
|
/** The constructor */
|
|
function Spinner(o) {
|
|
this.opts = merge(o || {}, Spinner.defaults, defaults)
|
|
}
|
|
|
|
// Global defaults that override the built-ins:
|
|
Spinner.defaults = {}
|
|
|
|
merge(Spinner.prototype, {
|
|
|
|
/**
|
|
* Adds the spinner to the given target element. If this instance is already
|
|
* spinning, it is automatically removed from its previous target b calling
|
|
* stop() internally.
|
|
*/
|
|
spin: function(target) {
|
|
this.stop()
|
|
|
|
var self = this
|
|
, o = self.opts
|
|
, el = self.el = css(createEl(0, {className: o.className}), {position: o.position, width: 0, zIndex: o.zIndex})
|
|
|
|
css(el, {
|
|
left: o.left,
|
|
top: o.top
|
|
})
|
|
|
|
if (target) {
|
|
target.insertBefore(el, target.firstChild||null)
|
|
}
|
|
|
|
el.setAttribute('role', 'progressbar')
|
|
self.lines(el, self.opts)
|
|
|
|
if (!useCssAnimations) {
|
|
// No CSS animation support, use setTimeout() instead
|
|
var i = 0
|
|
, start = (o.lines - 1) * (1 - o.direction) / 2
|
|
, alpha
|
|
, fps = o.fps
|
|
, f = fps/o.speed
|
|
, ostep = (1-o.opacity) / (f*o.trail / 100)
|
|
, astep = f/o.lines
|
|
|
|
;(function anim() {
|
|
i++;
|
|
for (var j = 0; j < o.lines; j++) {
|
|
alpha = Math.max(1 - (i + (o.lines - j) * astep) % f * ostep, o.opacity)
|
|
|
|
self.opacity(el, j * o.direction + start, alpha, o)
|
|
}
|
|
self.timeout = self.el && setTimeout(anim, ~~(1000/fps))
|
|
})()
|
|
}
|
|
return self
|
|
},
|
|
|
|
/**
|
|
* Stops and removes the Spinner.
|
|
*/
|
|
stop: function() {
|
|
var el = this.el
|
|
if (el) {
|
|
clearTimeout(this.timeout)
|
|
if (el.parentNode) el.parentNode.removeChild(el)
|
|
this.el = undefined
|
|
}
|
|
return this
|
|
},
|
|
|
|
/**
|
|
* Internal method that draws the individual lines. Will be overwritten
|
|
* in VML fallback mode below.
|
|
*/
|
|
lines: function(el, o) {
|
|
var i = 0
|
|
, start = (o.lines - 1) * (1 - o.direction) / 2
|
|
, seg
|
|
|
|
function fill(color, shadow) {
|
|
return css(createEl(), {
|
|
position: 'absolute',
|
|
width: (o.length+o.width) + 'px',
|
|
height: o.width + 'px',
|
|
background: color,
|
|
boxShadow: shadow,
|
|
transformOrigin: 'left',
|
|
transform: 'rotate(' + ~~(360/o.lines*i+o.rotate) + 'deg) translate(' + o.radius+'px' +',0)',
|
|
borderRadius: (o.corners * o.width>>1) + 'px'
|
|
})
|
|
}
|
|
|
|
for (; i < o.lines; i++) {
|
|
seg = css(createEl(), {
|
|
position: 'absolute',
|
|
top: 1+~(o.width/2) + 'px',
|
|
transform: o.hwaccel ? 'translate3d(0,0,0)' : '',
|
|
opacity: o.opacity,
|
|
animation: useCssAnimations && addAnimation(o.opacity, o.trail, start + i * o.direction, o.lines) + ' ' + 1/o.speed + 's linear infinite'
|
|
})
|
|
|
|
if (o.shadow) ins(seg, css(fill('#000', '0 0 4px ' + '#000'), {top: 2+'px'}))
|
|
ins(el, ins(seg, fill(getColor(o.color, i), '0 0 1px rgba(0,0,0,.1)')))
|
|
}
|
|
return el
|
|
},
|
|
|
|
/**
|
|
* Internal method that adjusts the opacity of a single line.
|
|
* Will be overwritten in VML fallback mode below.
|
|
*/
|
|
opacity: function(el, i, val) {
|
|
if (i < el.childNodes.length) el.childNodes[i].style.opacity = val
|
|
}
|
|
|
|
})
|
|
|
|
|
|
function initVML() {
|
|
|
|
/* Utility function to create a VML tag */
|
|
function vml(tag, attr) {
|
|
return createEl('<' + tag + ' xmlns="urn:schemas-microsoft.com:vml" class="spin-vml">', attr)
|
|
}
|
|
|
|
// No CSS transforms but VML support, add a CSS rule for VML elements:
|
|
sheet.addRule('.spin-vml', 'behavior:url(#default#VML)')
|
|
|
|
Spinner.prototype.lines = function(el, o) {
|
|
var r = o.length+o.width
|
|
, s = 2*r
|
|
|
|
function grp() {
|
|
return css(
|
|
vml('group', {
|
|
coordsize: s + ' ' + s,
|
|
coordorigin: -r + ' ' + -r
|
|
}),
|
|
{ width: s, height: s }
|
|
)
|
|
}
|
|
|
|
var margin = -(o.width+o.length)*2 + 'px'
|
|
, g = css(grp(), {position: 'absolute', top: margin, left: margin})
|
|
, i
|
|
|
|
function seg(i, dx, filter) {
|
|
ins(g,
|
|
ins(css(grp(), {rotation: 360 / o.lines * i + 'deg', left: ~~dx}),
|
|
ins(css(vml('roundrect', {arcsize: o.corners}), {
|
|
width: r,
|
|
height: o.width,
|
|
left: o.radius,
|
|
top: -o.width>>1,
|
|
filter: filter
|
|
}),
|
|
vml('fill', {color: getColor(o.color, i), opacity: o.opacity}),
|
|
vml('stroke', {opacity: 0}) // transparent stroke to fix color bleeding upon opacity change
|
|
)
|
|
)
|
|
)
|
|
}
|
|
|
|
if (o.shadow)
|
|
for (i = 1; i <= o.lines; i++)
|
|
seg(i, -2, 'progid:DXImageTransform.Microsoft.Blur(pixelradius=2,makeshadow=1,shadowopacity=.3)')
|
|
|
|
for (i = 1; i <= o.lines; i++) seg(i)
|
|
return ins(el, g)
|
|
}
|
|
|
|
Spinner.prototype.opacity = function(el, i, val, o) {
|
|
var c = el.firstChild
|
|
o = o.shadow && o.lines || 0
|
|
if (c && i+o < c.childNodes.length) {
|
|
c = c.childNodes[i+o]; c = c && c.firstChild; c = c && c.firstChild
|
|
if (c) c.opacity = val
|
|
}
|
|
}
|
|
}
|
|
|
|
var probe = css(createEl('group'), {behavior: 'url(#default#VML)'})
|
|
|
|
if (!vendor(probe, 'transform') && probe.adj) initVML()
|
|
else useCssAnimations = vendor(probe, 'animation')
|
|
|
|
return Spinner
|
|
|
|
}));
|
|
;
|
|
/**
|
|
* Copyright (c) 2011-2014 Felix Gnass
|
|
* Licensed under the MIT license
|
|
*/
|
|
|
|
/*
|
|
|
|
Basic Usage:
|
|
============
|
|
|
|
$('#el').spin(); // Creates a default Spinner using the text color of #el.
|
|
$('#el').spin({ ... }); // Creates a Spinner using the provided options.
|
|
|
|
$('#el').spin(false); // Stops and removes the spinner.
|
|
|
|
Using Presets:
|
|
==============
|
|
|
|
$('#el').spin('small'); // Creates a 'small' Spinner using the text color of #el.
|
|
$('#el').spin('large', '#fff'); // Creates a 'large' white Spinner.
|
|
|
|
Adding a custom preset:
|
|
=======================
|
|
|
|
$.fn.spin.presets.flower = {
|
|
lines: 9,
|
|
length: 10,
|
|
width: 20,
|
|
radius: 0
|
|
}
|
|
|
|
$('#el').spin('flower', 'red');
|
|
|
|
*/
|
|
|
|
(function(factory) {
|
|
|
|
if (typeof exports == 'object') {
|
|
// CommonJS
|
|
factory(require('jquery'), require('spin.js'))
|
|
}
|
|
else if (typeof define == 'function' && define.amd) {
|
|
// AMD, register as anonymous module
|
|
define(['jquery', 'spin'], factory)
|
|
}
|
|
else {
|
|
// Browser globals
|
|
if (!window.Spinner) throw new Error('Spin.js not present')
|
|
factory(window.jQuery, window.Spinner)
|
|
}
|
|
|
|
}(function($, Spinner) {
|
|
|
|
$.fn.spin = function(opts, color) {
|
|
|
|
return this.each(function() {
|
|
var $this = $(this),
|
|
data = $this.data();
|
|
|
|
if (data.spinner) {
|
|
data.spinner.stop();
|
|
delete data.spinner;
|
|
}
|
|
if (opts !== false) {
|
|
opts = $.extend(
|
|
{ color: color || $this.css('color') },
|
|
$.fn.spin.presets[opts] || opts
|
|
)
|
|
data.spinner = new Spinner(opts).spin(this)
|
|
}
|
|
})
|
|
}
|
|
|
|
$.fn.spin.presets = {
|
|
tiny: { lines: 8, length: 2, width: 2, radius: 3 },
|
|
small: { lines: 8, length: 4, width: 3, radius: 5 },
|
|
large: { lines: 10, length: 8, width: 4, radius: 8 }
|
|
}
|
|
|
|
}));
|
|
;
|
|
'use strict';
|
|
|
|
System.register('flarum/app', ['flarum/App', 'flarum/initializers/store', 'flarum/initializers/preload', 'flarum/initializers/routes', 'flarum/initializers/boot'], function (_export, _context) {
|
|
var App, store, preload, routes, boot, app;
|
|
return {
|
|
setters: [function (_flarumApp) {
|
|
App = _flarumApp.default;
|
|
}, function (_flarumInitializersStore) {
|
|
store = _flarumInitializersStore.default;
|
|
}, function (_flarumInitializersPreload) {
|
|
preload = _flarumInitializersPreload.default;
|
|
}, function (_flarumInitializersRoutes) {
|
|
routes = _flarumInitializersRoutes.default;
|
|
}, function (_flarumInitializersBoot) {
|
|
boot = _flarumInitializersBoot.default;
|
|
}],
|
|
execute: function () {
|
|
app = new App();
|
|
|
|
|
|
app.initializers.add('store', store);
|
|
app.initializers.add('routes', routes);
|
|
|
|
app.initializers.add('preload', preload, -100);
|
|
app.initializers.add('boot', boot, -100);
|
|
|
|
app.extensionSettings = {};
|
|
|
|
_export('default', app);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/App', ['flarum/utils/ItemList', 'flarum/components/Alert', 'flarum/components/Button', 'flarum/components/RequestErrorModal', 'flarum/components/ConfirmPasswordModal', 'flarum/Translator', 'flarum/utils/extract', 'flarum/utils/patchMithril', 'flarum/utils/RequestError', 'flarum/extend'], function (_export, _context) {
|
|
var ItemList, Alert, Button, RequestErrorModal, ConfirmPasswordModal, Translator, extract, patchMithril, RequestError, extend, App;
|
|
return {
|
|
setters: [function (_flarumUtilsItemList) {
|
|
ItemList = _flarumUtilsItemList.default;
|
|
}, function (_flarumComponentsAlert) {
|
|
Alert = _flarumComponentsAlert.default;
|
|
}, function (_flarumComponentsButton) {
|
|
Button = _flarumComponentsButton.default;
|
|
}, function (_flarumComponentsRequestErrorModal) {
|
|
RequestErrorModal = _flarumComponentsRequestErrorModal.default;
|
|
}, function (_flarumComponentsConfirmPasswordModal) {
|
|
ConfirmPasswordModal = _flarumComponentsConfirmPasswordModal.default;
|
|
}, function (_flarumTranslator) {
|
|
Translator = _flarumTranslator.default;
|
|
}, function (_flarumUtilsExtract) {
|
|
extract = _flarumUtilsExtract.default;
|
|
}, function (_flarumUtilsPatchMithril) {
|
|
patchMithril = _flarumUtilsPatchMithril.default;
|
|
}, function (_flarumUtilsRequestError) {
|
|
RequestError = _flarumUtilsRequestError.default;
|
|
}, function (_flarumExtend) {
|
|
extend = _flarumExtend.extend;
|
|
}],
|
|
execute: function () {
|
|
App = function () {
|
|
function App() {
|
|
babelHelpers.classCallCheck(this, App);
|
|
|
|
patchMithril(window);
|
|
|
|
/**
|
|
* The forum model for this application.
|
|
*
|
|
* @type {Forum}
|
|
* @public
|
|
*/
|
|
this.forum = null;
|
|
|
|
/**
|
|
* A map of routes, keyed by a unique route name. Each route is an object
|
|
* containing the following properties:
|
|
*
|
|
* - `path` The path that the route is accessed at.
|
|
* - `component` The Mithril component to render when this route is active.
|
|
*
|
|
* @example
|
|
* app.routes.discussion = {path: '/d/:id', component: DiscussionPage.component()};
|
|
*
|
|
* @type {Object}
|
|
* @public
|
|
*/
|
|
this.routes = {};
|
|
|
|
/**
|
|
* An object containing data to preload into the application.
|
|
*
|
|
* @type {Object}
|
|
* @property {Object} preload.data An array of resource objects to preload
|
|
* into the data store.
|
|
* @property {Object} preload.document An API response document to be used
|
|
* by the route that is first activated.
|
|
* @property {Object} preload.session A response from the /api/token
|
|
* endpoint containing the session's authentication token and user ID.
|
|
* @public
|
|
*/
|
|
this.preload = {
|
|
data: null,
|
|
document: null,
|
|
session: null
|
|
};
|
|
|
|
/**
|
|
* An ordered list of initializers to bootstrap the application.
|
|
*
|
|
* @type {ItemList}
|
|
* @public
|
|
*/
|
|
this.initializers = new ItemList();
|
|
|
|
/**
|
|
* The app's session.
|
|
*
|
|
* @type {Session}
|
|
* @public
|
|
*/
|
|
this.session = null;
|
|
|
|
/**
|
|
* The app's translator.
|
|
*
|
|
* @type {Translator}
|
|
* @public
|
|
*/
|
|
this.translator = new Translator();
|
|
|
|
/**
|
|
* The app's data store.
|
|
*
|
|
* @type {Store}
|
|
* @public
|
|
*/
|
|
this.store = null;
|
|
|
|
/**
|
|
* A local cache that can be used to store data at the application level, so
|
|
* that is persists between different routes.
|
|
*
|
|
* @type {Object}
|
|
* @public
|
|
*/
|
|
this.cache = {};
|
|
|
|
/**
|
|
* Whether or not the app has been booted.
|
|
*
|
|
* @type {Boolean}
|
|
* @public
|
|
*/
|
|
this.booted = false;
|
|
|
|
/**
|
|
* An Alert that was shown as a result of an AJAX request error. If present,
|
|
* it will be dismissed on the next successful request.
|
|
*
|
|
* @type {null|Alert}
|
|
* @private
|
|
*/
|
|
this.requestError = null;
|
|
|
|
this.title = '';
|
|
this.titleCount = 0;
|
|
}
|
|
|
|
/**
|
|
* Boot the application by running all of the registered initializers.
|
|
*
|
|
* @public
|
|
*/
|
|
|
|
|
|
babelHelpers.createClass(App, [{
|
|
key: 'boot',
|
|
value: function boot() {
|
|
var _this = this;
|
|
|
|
this.translator.locale = this.locale;
|
|
|
|
this.initializers.toArray().forEach(function (initializer) {
|
|
return initializer(_this);
|
|
});
|
|
}
|
|
}, {
|
|
key: 'preloadedDocument',
|
|
value: function preloadedDocument() {
|
|
if (app.preload.document) {
|
|
var results = app.store.pushPayload(app.preload.document);
|
|
app.preload.document = null;
|
|
|
|
return results;
|
|
}
|
|
|
|
return null;
|
|
}
|
|
}, {
|
|
key: 'setTitle',
|
|
value: function setTitle(title) {
|
|
this.title = title;
|
|
this.updateTitle();
|
|
}
|
|
}, {
|
|
key: 'setTitleCount',
|
|
value: function setTitleCount(count) {
|
|
this.titleCount = count;
|
|
this.updateTitle();
|
|
}
|
|
}, {
|
|
key: 'updateTitle',
|
|
value: function updateTitle() {
|
|
document.title = (this.titleCount ? '(' + this.titleCount + ') ' : '') + (this.title ? this.title + ' - ' : '') + this.forum.attribute('title');
|
|
}
|
|
}, {
|
|
key: 'request',
|
|
value: function request(originalOptions) {
|
|
var _this2 = this;
|
|
|
|
var options = babelHelpers.extends({}, originalOptions);
|
|
|
|
// Set some default options if they haven't been overridden. We want to
|
|
// authenticate all requests with the session token. We also want all
|
|
// requests to run asynchronously in the background, so that they don't
|
|
// prevent redraws from occurring.
|
|
options.background = options.background || true;
|
|
|
|
extend(options, 'config', function (result, xhr) {
|
|
return xhr.setRequestHeader('X-CSRF-Token', _this2.session.csrfToken);
|
|
});
|
|
|
|
// If the method is something like PATCH or DELETE, which not all servers
|
|
// and clients support, then we'll send it as a POST request with the
|
|
// intended method specified in the X-HTTP-Method-Override header.
|
|
if (options.method !== 'GET' && options.method !== 'POST') {
|
|
(function () {
|
|
var method = options.method;
|
|
extend(options, 'config', function (result, xhr) {
|
|
return xhr.setRequestHeader('X-HTTP-Method-Override', method);
|
|
});
|
|
options.method = 'POST';
|
|
})();
|
|
}
|
|
|
|
// When we deserialize JSON data, if for some reason the server has provided
|
|
// a dud response, we don't want the application to crash. We'll show an
|
|
// error message to the user instead.
|
|
options.deserialize = options.deserialize || function (responseText) {
|
|
return responseText;
|
|
};
|
|
|
|
options.errorHandler = options.errorHandler || function (error) {
|
|
throw error;
|
|
};
|
|
|
|
// When extracting the data from the response, we can check the server
|
|
// response code and show an error message to the user if something's gone
|
|
// awry.
|
|
var original = options.extract;
|
|
options.extract = function (xhr) {
|
|
var responseText = void 0;
|
|
|
|
if (original) {
|
|
responseText = original(xhr.responseText);
|
|
} else {
|
|
responseText = xhr.responseText || null;
|
|
}
|
|
|
|
var status = xhr.status;
|
|
|
|
if (status < 200 || status > 299) {
|
|
throw new RequestError(status, responseText, options, xhr);
|
|
}
|
|
|
|
if (xhr.getResponseHeader) {
|
|
var csrfToken = xhr.getResponseHeader('X-CSRF-Token');
|
|
if (csrfToken) app.session.csrfToken = csrfToken;
|
|
}
|
|
|
|
try {
|
|
return JSON.parse(responseText);
|
|
} catch (e) {
|
|
throw new RequestError(500, responseText, options, xhr);
|
|
}
|
|
};
|
|
|
|
if (this.requestError) this.alerts.dismiss(this.requestError.alert);
|
|
|
|
// Now make the request. If it's a failure, inspect the error that was
|
|
// returned and show an alert containing its contents.
|
|
var deferred = m.deferred();
|
|
|
|
m.request(options).then(function (response) {
|
|
return deferred.resolve(response);
|
|
}, function (error) {
|
|
_this2.requestError = error;
|
|
|
|
var children = void 0;
|
|
|
|
switch (error.status) {
|
|
case 422:
|
|
children = error.response.errors.map(function (error) {
|
|
return [error.detail, m('br', null)];
|
|
}).reduce(function (a, b) {
|
|
return a.concat(b);
|
|
}, []).slice(0, -1);
|
|
break;
|
|
|
|
case 401:
|
|
case 403:
|
|
children = app.translator.trans('core.lib.error.permission_denied_message');
|
|
break;
|
|
|
|
case 404:
|
|
case 410:
|
|
children = app.translator.trans('core.lib.error.not_found_message');
|
|
break;
|
|
|
|
case 429:
|
|
children = app.translator.trans('core.lib.error.rate_limit_exceeded_message');
|
|
break;
|
|
|
|
default:
|
|
children = app.translator.trans('core.lib.error.generic_message');
|
|
}
|
|
|
|
error.alert = new Alert({
|
|
type: 'error',
|
|
children: children,
|
|
controls: app.forum.attribute('debug') ? [m(
|
|
Button,
|
|
{ className: 'Button Button--link', onclick: _this2.showDebug.bind(_this2, error) },
|
|
'Debug'
|
|
)] : undefined
|
|
});
|
|
|
|
try {
|
|
options.errorHandler(error);
|
|
} catch (error) {
|
|
_this2.alerts.show(error.alert);
|
|
}
|
|
|
|
deferred.reject(error);
|
|
});
|
|
|
|
return deferred.promise;
|
|
}
|
|
}, {
|
|
key: 'showDebug',
|
|
value: function showDebug(error) {
|
|
this.alerts.dismiss(this.requestErrorAlert);
|
|
|
|
this.modal.show(new RequestErrorModal({ error: error }));
|
|
}
|
|
}, {
|
|
key: 'route',
|
|
value: function route(name) {
|
|
var params = arguments.length <= 1 || arguments[1] === undefined ? {} : arguments[1];
|
|
|
|
var url = this.routes[name].path.replace(/:([^\/]+)/g, function (m, key) {
|
|
return extract(params, key);
|
|
});
|
|
var queryString = m.route.buildQueryString(params);
|
|
var prefix = m.route.mode === 'pathname' ? app.forum.attribute('basePath') : '';
|
|
|
|
return prefix + url + (queryString ? '?' + queryString : '');
|
|
}
|
|
}]);
|
|
return App;
|
|
}();
|
|
|
|
_export('default', App);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/Component', [], function (_export, _context) {
|
|
var Component;
|
|
return {
|
|
setters: [],
|
|
execute: function () {
|
|
Component = function () {
|
|
/**
|
|
* @param {Object} props
|
|
* @param {Array|Object} children
|
|
* @public
|
|
*/
|
|
|
|
function Component() {
|
|
var props = arguments.length <= 0 || arguments[0] === undefined ? {} : arguments[0];
|
|
var children = arguments.length <= 1 || arguments[1] === undefined ? null : arguments[1];
|
|
babelHelpers.classCallCheck(this, Component);
|
|
|
|
if (children) props.children = children;
|
|
|
|
this.constructor.initProps(props);
|
|
|
|
/**
|
|
* The properties passed into the component.
|
|
*
|
|
* @type {Object}
|
|
*/
|
|
this.props = props;
|
|
|
|
/**
|
|
* The root DOM element for the component.
|
|
*
|
|
* @type DOMElement
|
|
* @public
|
|
*/
|
|
this.element = null;
|
|
|
|
/**
|
|
* Whether or not to retain the component's subtree on redraw.
|
|
*
|
|
* @type {boolean}
|
|
* @public
|
|
*/
|
|
this.retain = false;
|
|
|
|
this.init();
|
|
}
|
|
|
|
/**
|
|
* Called when the component is constructed.
|
|
*
|
|
* @protected
|
|
*/
|
|
|
|
|
|
babelHelpers.createClass(Component, [{
|
|
key: 'init',
|
|
value: function init() {}
|
|
}, {
|
|
key: 'onunload',
|
|
value: function onunload() {}
|
|
}, {
|
|
key: 'render',
|
|
value: function render() {
|
|
var _this = this;
|
|
|
|
var vdom = this.retain ? { subtree: 'retain' } : this.view();
|
|
|
|
// Override the root element's config attribute with our own function, which
|
|
// will set the component instance's element property to the root DOM
|
|
// element, and then run the component class' config method.
|
|
vdom.attrs = vdom.attrs || {};
|
|
|
|
var originalConfig = vdom.attrs.config;
|
|
|
|
vdom.attrs.config = function () {
|
|
for (var _len = arguments.length, args = Array(_len), _key = 0; _key < _len; _key++) {
|
|
args[_key] = arguments[_key];
|
|
}
|
|
|
|
_this.element = args[0];
|
|
_this.config.apply(_this, args.slice(1));
|
|
if (originalConfig) originalConfig.apply(_this, args);
|
|
};
|
|
|
|
return vdom;
|
|
}
|
|
}, {
|
|
key: '$',
|
|
value: function (_$) {
|
|
function $(_x) {
|
|
return _$.apply(this, arguments);
|
|
}
|
|
|
|
$.toString = function () {
|
|
return _$.toString();
|
|
};
|
|
|
|
return $;
|
|
}(function (selector) {
|
|
var $element = $(this.element);
|
|
|
|
return selector ? $element.find(selector) : $element;
|
|
})
|
|
}, {
|
|
key: 'config',
|
|
value: function config() {}
|
|
}, {
|
|
key: 'view',
|
|
value: function view() {
|
|
throw new Error('Component#view must be implemented by subclass');
|
|
}
|
|
}], [{
|
|
key: 'component',
|
|
value: function component() {
|
|
var props = arguments.length <= 0 || arguments[0] === undefined ? {} : arguments[0];
|
|
var children = arguments.length <= 1 || arguments[1] === undefined ? null : arguments[1];
|
|
|
|
var componentProps = babelHelpers.extends({}, props);
|
|
|
|
if (children) componentProps.children = children;
|
|
|
|
this.initProps(componentProps);
|
|
|
|
// Set up a function for Mithril to get the component's view. It will accept
|
|
// the component's controller (which happens to be the component itself, in
|
|
// our case), update its props with the ones supplied, and then render the view.
|
|
var view = function view(component) {
|
|
component.props = componentProps;
|
|
return component.render();
|
|
};
|
|
|
|
// Mithril uses this property on the view function to cache component
|
|
// controllers between redraws, thus persisting component state.
|
|
view.$original = this.prototype.view;
|
|
|
|
// Our output object consists of a controller constructor + a view function
|
|
// which Mithril will use to instantiate and render the component. We also
|
|
// attach a reference to the props that were passed through and the
|
|
// component's class for reference.
|
|
var output = {
|
|
controller: this.bind(undefined, componentProps),
|
|
view: view,
|
|
props: componentProps,
|
|
component: this
|
|
};
|
|
|
|
// If a `key` prop was set, then we'll assume that we want that to actually
|
|
// show up as an attribute on the component object so that Mithril's key
|
|
// algorithm can be applied.
|
|
if (componentProps.key) {
|
|
output.attrs = { key: componentProps.key };
|
|
}
|
|
|
|
return output;
|
|
}
|
|
}, {
|
|
key: 'initProps',
|
|
value: function initProps(props) {}
|
|
}]);
|
|
return Component;
|
|
}();
|
|
|
|
_export('default', Component);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/AddExtensionModal', ['flarum/components/Modal'], function (_export, _context) {
|
|
var Modal, AddExtensionModal;
|
|
return {
|
|
setters: [function (_flarumComponentsModal) {
|
|
Modal = _flarumComponentsModal.default;
|
|
}],
|
|
execute: function () {
|
|
AddExtensionModal = function (_Modal) {
|
|
babelHelpers.inherits(AddExtensionModal, _Modal);
|
|
|
|
function AddExtensionModal() {
|
|
babelHelpers.classCallCheck(this, AddExtensionModal);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(AddExtensionModal).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(AddExtensionModal, [{
|
|
key: 'className',
|
|
value: function className() {
|
|
return 'AddExtensionModal Modal--small';
|
|
}
|
|
}, {
|
|
key: 'title',
|
|
value: function title() {
|
|
return 'Add Extension';
|
|
}
|
|
}, {
|
|
key: 'content',
|
|
value: function content() {
|
|
return m(
|
|
'div',
|
|
{ className: 'Modal-body' },
|
|
m(
|
|
'p',
|
|
null,
|
|
app.translator.trans('core.admin.add_extension.temporary_text')
|
|
),
|
|
m(
|
|
'p',
|
|
null,
|
|
app.translator.trans('core.admin.add_extension.install_text', { a: m('a', { href: 'https://discuss.flarum.org/t/extensions', target: '_blank' }) })
|
|
),
|
|
m(
|
|
'p',
|
|
null,
|
|
app.translator.trans('core.admin.add_extension.developer_text', { a: m('a', { href: 'http://flarum.org/docs/extend', target: '_blank' }) })
|
|
)
|
|
);
|
|
}
|
|
}]);
|
|
return AddExtensionModal;
|
|
}(Modal);
|
|
|
|
_export('default', AddExtensionModal);
|
|
}
|
|
};
|
|
});;
|
|
"use strict";
|
|
|
|
System.register("flarum/components/AdminLinkButton", ["flarum/components/LinkButton"], function (_export, _context) {
|
|
var LinkButton, AdminLinkButton;
|
|
return {
|
|
setters: [function (_flarumComponentsLinkButton) {
|
|
LinkButton = _flarumComponentsLinkButton.default;
|
|
}],
|
|
execute: function () {
|
|
AdminLinkButton = function (_LinkButton) {
|
|
babelHelpers.inherits(AdminLinkButton, _LinkButton);
|
|
|
|
function AdminLinkButton() {
|
|
babelHelpers.classCallCheck(this, AdminLinkButton);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(AdminLinkButton).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(AdminLinkButton, [{
|
|
key: "getButtonContent",
|
|
value: function getButtonContent() {
|
|
var content = babelHelpers.get(Object.getPrototypeOf(AdminLinkButton.prototype), "getButtonContent", this).call(this);
|
|
|
|
content.push(m(
|
|
"div",
|
|
{ className: "AdminLinkButton-description" },
|
|
this.props.description
|
|
));
|
|
|
|
return content;
|
|
}
|
|
}]);
|
|
return AdminLinkButton;
|
|
}(LinkButton);
|
|
|
|
_export("default", AdminLinkButton);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/AdminNav', ['flarum/Component', 'flarum/components/AdminLinkButton', 'flarum/components/SelectDropdown', 'flarum/utils/ItemList'], function (_export, _context) {
|
|
var Component, AdminLinkButton, SelectDropdown, ItemList, AdminNav;
|
|
return {
|
|
setters: [function (_flarumComponent) {
|
|
Component = _flarumComponent.default;
|
|
}, function (_flarumComponentsAdminLinkButton) {
|
|
AdminLinkButton = _flarumComponentsAdminLinkButton.default;
|
|
}, function (_flarumComponentsSelectDropdown) {
|
|
SelectDropdown = _flarumComponentsSelectDropdown.default;
|
|
}, function (_flarumUtilsItemList) {
|
|
ItemList = _flarumUtilsItemList.default;
|
|
}],
|
|
execute: function () {
|
|
AdminNav = function (_Component) {
|
|
babelHelpers.inherits(AdminNav, _Component);
|
|
|
|
function AdminNav() {
|
|
babelHelpers.classCallCheck(this, AdminNav);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(AdminNav).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(AdminNav, [{
|
|
key: 'view',
|
|
value: function view() {
|
|
return m(SelectDropdown, {
|
|
className: 'AdminNav App-titleControl',
|
|
buttonClassName: 'Button',
|
|
children: this.items().toArray()
|
|
});
|
|
}
|
|
}, {
|
|
key: 'items',
|
|
value: function items() {
|
|
var items = new ItemList();
|
|
|
|
items.add('dashboard', AdminLinkButton.component({
|
|
href: app.route('dashboard'),
|
|
icon: 'bar-chart',
|
|
children: app.translator.trans('core.admin.nav.dashboard_button'),
|
|
description: app.translator.trans('core.admin.nav.dashboard_text')
|
|
}));
|
|
|
|
items.add('basics', AdminLinkButton.component({
|
|
href: app.route('basics'),
|
|
icon: 'pencil',
|
|
children: app.translator.trans('core.admin.nav.basics_button'),
|
|
description: app.translator.trans('core.admin.nav.basics_text')
|
|
}));
|
|
|
|
items.add('permissions', AdminLinkButton.component({
|
|
href: app.route('permissions'),
|
|
icon: 'key',
|
|
children: app.translator.trans('core.admin.nav.permissions_button'),
|
|
description: app.translator.trans('core.admin.nav.permissions_text')
|
|
}));
|
|
|
|
items.add('appearance', AdminLinkButton.component({
|
|
href: app.route('appearance'),
|
|
icon: 'paint-brush',
|
|
children: app.translator.trans('core.admin.nav.appearance_button'),
|
|
description: app.translator.trans('core.admin.nav.appearance_text')
|
|
}));
|
|
|
|
items.add('extensions', AdminLinkButton.component({
|
|
href: app.route('extensions'),
|
|
icon: 'puzzle-piece',
|
|
children: app.translator.trans('core.admin.nav.extensions_button'),
|
|
description: app.translator.trans('core.admin.nav.extensions_text')
|
|
}));
|
|
|
|
items.add('mail', AdminLinkButton.component({
|
|
href: app.route('mail'),
|
|
icon: 'envelope',
|
|
children: app.translator.trans('core.admin.nav.email_button'),
|
|
description: app.translator.trans('core.admin.nav.email_text')
|
|
}));
|
|
|
|
return items;
|
|
}
|
|
}]);
|
|
return AdminNav;
|
|
}(Component);
|
|
|
|
_export('default', AdminNav);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/Alert', ['flarum/Component', 'flarum/components/Button', 'flarum/helpers/listItems', 'flarum/utils/extract'], function (_export, _context) {
|
|
var Component, Button, listItems, extract, Alert;
|
|
return {
|
|
setters: [function (_flarumComponent) {
|
|
Component = _flarumComponent.default;
|
|
}, function (_flarumComponentsButton) {
|
|
Button = _flarumComponentsButton.default;
|
|
}, function (_flarumHelpersListItems) {
|
|
listItems = _flarumHelpersListItems.default;
|
|
}, function (_flarumUtilsExtract) {
|
|
extract = _flarumUtilsExtract.default;
|
|
}],
|
|
execute: function () {
|
|
Alert = function (_Component) {
|
|
babelHelpers.inherits(Alert, _Component);
|
|
|
|
function Alert() {
|
|
babelHelpers.classCallCheck(this, Alert);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(Alert).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(Alert, [{
|
|
key: 'view',
|
|
value: function view() {
|
|
var attrs = babelHelpers.extends({}, this.props);
|
|
|
|
var type = extract(attrs, 'type');
|
|
attrs.className = 'Alert Alert--' + type + ' ' + (attrs.className || '');
|
|
|
|
var children = extract(attrs, 'children');
|
|
var controls = extract(attrs, 'controls') || [];
|
|
|
|
// If the alert is meant to be dismissible (which is the case by default),
|
|
// then we will create a dismiss button to append as the final control in
|
|
// the alert.
|
|
var dismissible = extract(attrs, 'dismissible');
|
|
var ondismiss = extract(attrs, 'ondismiss');
|
|
var dismissControl = [];
|
|
|
|
if (dismissible || dismissible === undefined) {
|
|
dismissControl.push(m(Button, {
|
|
icon: 'times',
|
|
className: 'Button Button--link Button--icon Alert-dismiss',
|
|
onclick: ondismiss }));
|
|
}
|
|
|
|
return m(
|
|
'div',
|
|
attrs,
|
|
m(
|
|
'span',
|
|
{ className: 'Alert-body' },
|
|
children
|
|
),
|
|
m(
|
|
'ul',
|
|
{ className: 'Alert-controls' },
|
|
listItems(controls.concat(dismissControl))
|
|
)
|
|
);
|
|
}
|
|
}]);
|
|
return Alert;
|
|
}(Component);
|
|
|
|
_export('default', Alert);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/AlertManager', ['flarum/Component', 'flarum/components/Alert'], function (_export, _context) {
|
|
var Component, Alert, AlertManager;
|
|
return {
|
|
setters: [function (_flarumComponent) {
|
|
Component = _flarumComponent.default;
|
|
}, function (_flarumComponentsAlert) {
|
|
Alert = _flarumComponentsAlert.default;
|
|
}],
|
|
execute: function () {
|
|
AlertManager = function (_Component) {
|
|
babelHelpers.inherits(AlertManager, _Component);
|
|
|
|
function AlertManager() {
|
|
babelHelpers.classCallCheck(this, AlertManager);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(AlertManager).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(AlertManager, [{
|
|
key: 'init',
|
|
value: function init() {
|
|
/**
|
|
* An array of Alert components which are currently showing.
|
|
*
|
|
* @type {Alert[]}
|
|
* @protected
|
|
*/
|
|
this.components = [];
|
|
}
|
|
}, {
|
|
key: 'view',
|
|
value: function view() {
|
|
return m(
|
|
'div',
|
|
{ className: 'AlertManager' },
|
|
this.components.map(function (component) {
|
|
return m(
|
|
'div',
|
|
{ className: 'AlertManager-alert' },
|
|
component
|
|
);
|
|
})
|
|
);
|
|
}
|
|
}, {
|
|
key: 'config',
|
|
value: function config(isInitialized, context) {
|
|
// Since this component is 'above' the content of the page (that is, it is a
|
|
// part of the global UI that persists between routes), we will flag the DOM
|
|
// to be retained across route changes.
|
|
context.retain = true;
|
|
}
|
|
}, {
|
|
key: 'show',
|
|
value: function show(component) {
|
|
if (!(component instanceof Alert)) {
|
|
throw new Error('The AlertManager component can only show Alert components');
|
|
}
|
|
|
|
component.props.ondismiss = this.dismiss.bind(this, component);
|
|
|
|
this.components.push(component);
|
|
m.redraw();
|
|
}
|
|
}, {
|
|
key: 'dismiss',
|
|
value: function dismiss(component) {
|
|
var index = this.components.indexOf(component);
|
|
|
|
if (index !== -1) {
|
|
this.components.splice(index, 1);
|
|
m.redraw();
|
|
}
|
|
}
|
|
}, {
|
|
key: 'clear',
|
|
value: function clear() {
|
|
this.components = [];
|
|
m.redraw();
|
|
}
|
|
}]);
|
|
return AlertManager;
|
|
}(Component);
|
|
|
|
_export('default', AlertManager);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/AppearancePage', ['flarum/components/Page', 'flarum/components/Button', 'flarum/components/Switch', 'flarum/components/EditCustomCssModal', 'flarum/utils/saveSettings'], function (_export, _context) {
|
|
var Page, Button, Switch, EditCustomCssModal, saveSettings, AppearancePage;
|
|
return {
|
|
setters: [function (_flarumComponentsPage) {
|
|
Page = _flarumComponentsPage.default;
|
|
}, function (_flarumComponentsButton) {
|
|
Button = _flarumComponentsButton.default;
|
|
}, function (_flarumComponentsSwitch) {
|
|
Switch = _flarumComponentsSwitch.default;
|
|
}, function (_flarumComponentsEditCustomCssModal) {
|
|
EditCustomCssModal = _flarumComponentsEditCustomCssModal.default;
|
|
}, function (_flarumUtilsSaveSettings) {
|
|
saveSettings = _flarumUtilsSaveSettings.default;
|
|
}],
|
|
execute: function () {
|
|
AppearancePage = function (_Page) {
|
|
babelHelpers.inherits(AppearancePage, _Page);
|
|
|
|
function AppearancePage() {
|
|
babelHelpers.classCallCheck(this, AppearancePage);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(AppearancePage).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(AppearancePage, [{
|
|
key: 'init',
|
|
value: function init() {
|
|
babelHelpers.get(Object.getPrototypeOf(AppearancePage.prototype), 'init', this).call(this);
|
|
|
|
this.primaryColor = m.prop(app.settings.theme_primary_color);
|
|
this.secondaryColor = m.prop(app.settings.theme_secondary_color);
|
|
this.darkMode = m.prop(app.settings.theme_dark_mode === '1');
|
|
this.coloredHeader = m.prop(app.settings.theme_colored_header === '1');
|
|
}
|
|
}, {
|
|
key: 'view',
|
|
value: function view() {
|
|
return m(
|
|
'div',
|
|
{ className: 'AppearancePage' },
|
|
m(
|
|
'div',
|
|
{ className: 'container' },
|
|
m(
|
|
'form',
|
|
{ onsubmit: this.onsubmit.bind(this) },
|
|
m(
|
|
'fieldset',
|
|
{ className: 'AppearancePage-colors' },
|
|
m(
|
|
'legend',
|
|
null,
|
|
app.translator.trans('core.admin.appearance.colors_heading')
|
|
),
|
|
m(
|
|
'div',
|
|
{ className: 'helpText' },
|
|
app.translator.trans('core.admin.appearance.colors_text')
|
|
),
|
|
m(
|
|
'div',
|
|
{ className: 'AppearancePage-colors-input' },
|
|
m('input', { className: 'FormControl', placeholder: '#aaaaaa', value: this.primaryColor(), onchange: m.withAttr('value', this.primaryColor) }),
|
|
m('input', { className: 'FormControl', placeholder: '#aaaaaa', value: this.secondaryColor(), onchange: m.withAttr('value', this.secondaryColor) })
|
|
),
|
|
Switch.component({
|
|
state: this.darkMode(),
|
|
children: app.translator.trans('core.admin.appearance.dark_mode_label'),
|
|
onchange: this.darkMode
|
|
}),
|
|
Switch.component({
|
|
state: this.coloredHeader(),
|
|
children: app.translator.trans('core.admin.appearance.colored_header_label'),
|
|
onchange: this.coloredHeader
|
|
}),
|
|
Button.component({
|
|
className: 'Button Button--primary',
|
|
type: 'submit',
|
|
children: app.translator.trans('core.admin.appearance.submit_button'),
|
|
loading: this.loading
|
|
})
|
|
)
|
|
),
|
|
m(
|
|
'fieldset',
|
|
null,
|
|
m(
|
|
'legend',
|
|
null,
|
|
app.translator.trans('core.admin.appearance.custom_styles_heading')
|
|
),
|
|
m(
|
|
'div',
|
|
{ className: 'helpText' },
|
|
app.translator.trans('core.admin.appearance.custom_styles_text')
|
|
),
|
|
Button.component({
|
|
className: 'Button',
|
|
children: app.translator.trans('core.admin.appearance.edit_css_button'),
|
|
onclick: function onclick() {
|
|
return app.modal.show(new EditCustomCssModal());
|
|
}
|
|
})
|
|
)
|
|
)
|
|
);
|
|
}
|
|
}, {
|
|
key: 'onsubmit',
|
|
value: function onsubmit(e) {
|
|
e.preventDefault();
|
|
|
|
var hex = /^#[0-9a-f]{3}([0-9a-f]{3})?$/i;
|
|
|
|
if (!hex.test(this.primaryColor()) || !hex.test(this.secondaryColor())) {
|
|
alert(app.translator.trans('core.admin.appearance.enter_hex_message'));
|
|
return;
|
|
}
|
|
|
|
this.loading = true;
|
|
|
|
saveSettings({
|
|
theme_primary_color: this.primaryColor(),
|
|
theme_secondary_color: this.secondaryColor(),
|
|
theme_dark_mode: this.darkMode(),
|
|
theme_colored_header: this.coloredHeader()
|
|
}).then(function () {
|
|
return window.location.reload();
|
|
});
|
|
}
|
|
}]);
|
|
return AppearancePage;
|
|
}(Page);
|
|
|
|
_export('default', AppearancePage);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/Badge', ['flarum/Component', 'flarum/helpers/icon', 'flarum/utils/extract'], function (_export, _context) {
|
|
var Component, icon, extract, Badge;
|
|
return {
|
|
setters: [function (_flarumComponent) {
|
|
Component = _flarumComponent.default;
|
|
}, function (_flarumHelpersIcon) {
|
|
icon = _flarumHelpersIcon.default;
|
|
}, function (_flarumUtilsExtract) {
|
|
extract = _flarumUtilsExtract.default;
|
|
}],
|
|
execute: function () {
|
|
Badge = function (_Component) {
|
|
babelHelpers.inherits(Badge, _Component);
|
|
|
|
function Badge() {
|
|
babelHelpers.classCallCheck(this, Badge);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(Badge).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(Badge, [{
|
|
key: 'view',
|
|
value: function view() {
|
|
var attrs = babelHelpers.extends({}, this.props);
|
|
var type = extract(attrs, 'type');
|
|
var iconName = extract(attrs, 'icon');
|
|
|
|
attrs.className = 'Badge ' + (type ? 'Badge--' + type : '') + ' ' + (attrs.className || '');
|
|
attrs.title = extract(attrs, 'label') || '';
|
|
|
|
return m(
|
|
'span',
|
|
attrs,
|
|
iconName ? icon(iconName, { className: 'Badge-icon' }) : m.trust(' ')
|
|
);
|
|
}
|
|
}, {
|
|
key: 'config',
|
|
value: function config(isInitialized) {
|
|
if (isInitialized) return;
|
|
|
|
if (this.props.label) this.$().tooltip({ container: 'body' });
|
|
}
|
|
}]);
|
|
return Badge;
|
|
}(Component);
|
|
|
|
_export('default', Badge);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/BasicsPage', ['flarum/components/Page', 'flarum/components/FieldSet', 'flarum/components/Select', 'flarum/components/Button', 'flarum/components/Alert', 'flarum/utils/saveSettings', 'flarum/utils/ItemList'], function (_export, _context) {
|
|
var Page, FieldSet, Select, Button, Alert, saveSettings, ItemList, BasicsPage;
|
|
return {
|
|
setters: [function (_flarumComponentsPage) {
|
|
Page = _flarumComponentsPage.default;
|
|
}, function (_flarumComponentsFieldSet) {
|
|
FieldSet = _flarumComponentsFieldSet.default;
|
|
}, function (_flarumComponentsSelect) {
|
|
Select = _flarumComponentsSelect.default;
|
|
}, function (_flarumComponentsButton) {
|
|
Button = _flarumComponentsButton.default;
|
|
}, function (_flarumComponentsAlert) {
|
|
Alert = _flarumComponentsAlert.default;
|
|
}, function (_flarumUtilsSaveSettings) {
|
|
saveSettings = _flarumUtilsSaveSettings.default;
|
|
}, function (_flarumUtilsItemList) {
|
|
ItemList = _flarumUtilsItemList.default;
|
|
}],
|
|
execute: function () {
|
|
BasicsPage = function (_Page) {
|
|
babelHelpers.inherits(BasicsPage, _Page);
|
|
|
|
function BasicsPage() {
|
|
babelHelpers.classCallCheck(this, BasicsPage);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(BasicsPage).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(BasicsPage, [{
|
|
key: 'init',
|
|
value: function init() {
|
|
var _this2 = this;
|
|
|
|
babelHelpers.get(Object.getPrototypeOf(BasicsPage.prototype), 'init', this).call(this);
|
|
|
|
this.loading = false;
|
|
|
|
this.fields = ['forum_title', 'forum_description', 'default_locale', 'default_route', 'welcome_title', 'welcome_message'];
|
|
this.values = {};
|
|
|
|
var settings = app.settings;
|
|
this.fields.forEach(function (key) {
|
|
return _this2.values[key] = m.prop(settings[key]);
|
|
});
|
|
|
|
this.localeOptions = {};
|
|
var locales = app.locales;
|
|
for (var i in locales) {
|
|
this.localeOptions[i] = locales[i] + ' (' + i + ')';
|
|
}
|
|
}
|
|
}, {
|
|
key: 'view',
|
|
value: function view() {
|
|
var _this3 = this;
|
|
|
|
return m(
|
|
'div',
|
|
{ className: 'BasicsPage' },
|
|
m(
|
|
'div',
|
|
{ className: 'container' },
|
|
m(
|
|
'form',
|
|
{ onsubmit: this.onsubmit.bind(this) },
|
|
FieldSet.component({
|
|
label: app.translator.trans('core.admin.basics.forum_title_heading'),
|
|
children: [m('input', { className: 'FormControl', value: this.values.forum_title(), oninput: m.withAttr('value', this.values.forum_title) })]
|
|
}),
|
|
FieldSet.component({
|
|
label: app.translator.trans('core.admin.basics.forum_description_heading'),
|
|
children: [m(
|
|
'div',
|
|
{ className: 'helpText' },
|
|
app.translator.trans('core.admin.basics.forum_description_text')
|
|
), m('textarea', { className: 'FormControl', value: this.values.forum_description(), oninput: m.withAttr('value', this.values.forum_description) })]
|
|
}),
|
|
Object.keys(this.localeOptions).length > 1 ? FieldSet.component({
|
|
label: app.translator.trans('core.admin.basics.default_language_heading'),
|
|
children: [Select.component({
|
|
options: this.localeOptions,
|
|
onchange: this.values.default_locale
|
|
})]
|
|
}) : '',
|
|
FieldSet.component({
|
|
label: app.translator.trans('core.admin.basics.home_page_heading'),
|
|
className: 'BasicsPage-homePage',
|
|
children: [m(
|
|
'div',
|
|
{ className: 'helpText' },
|
|
app.translator.trans('core.admin.basics.home_page_text')
|
|
), this.homePageItems().toArray().map(function (_ref) {
|
|
var path = _ref.path;
|
|
var label = _ref.label;
|
|
return m(
|
|
'label',
|
|
{ className: 'checkbox' },
|
|
m('input', { type: 'radio', name: 'homePage', value: path, checked: _this3.values.default_route() === path, onclick: m.withAttr('value', _this3.values.default_route) }),
|
|
label
|
|
);
|
|
})]
|
|
}),
|
|
FieldSet.component({
|
|
label: app.translator.trans('core.admin.basics.welcome_banner_heading'),
|
|
className: 'BasicsPage-welcomeBanner',
|
|
children: [m(
|
|
'div',
|
|
{ className: 'helpText' },
|
|
app.translator.trans('core.admin.basics.welcome_banner_text')
|
|
), m(
|
|
'div',
|
|
{ className: 'BasicsPage-welcomeBanner-input' },
|
|
m('input', { className: 'FormControl', value: this.values.welcome_title(), oninput: m.withAttr('value', this.values.welcome_title) }),
|
|
m('textarea', { className: 'FormControl', value: this.values.welcome_message(), oninput: m.withAttr('value', this.values.welcome_message) })
|
|
)]
|
|
}),
|
|
Button.component({
|
|
type: 'submit',
|
|
className: 'Button Button--primary',
|
|
children: app.translator.trans('core.admin.basics.submit_button'),
|
|
loading: this.loading,
|
|
disabled: !this.changed()
|
|
})
|
|
)
|
|
)
|
|
);
|
|
}
|
|
}, {
|
|
key: 'changed',
|
|
value: function changed() {
|
|
var _this4 = this;
|
|
|
|
return this.fields.some(function (key) {
|
|
return _this4.values[key]() !== app.settings[key];
|
|
});
|
|
}
|
|
}, {
|
|
key: 'homePageItems',
|
|
value: function homePageItems() {
|
|
var items = new ItemList();
|
|
|
|
items.add('allDiscussions', {
|
|
path: '/all',
|
|
label: app.translator.trans('core.admin.basics.all_discussions_label')
|
|
});
|
|
|
|
return items;
|
|
}
|
|
}, {
|
|
key: 'onsubmit',
|
|
value: function onsubmit(e) {
|
|
var _this5 = this;
|
|
|
|
e.preventDefault();
|
|
|
|
if (this.loading) return;
|
|
|
|
this.loading = true;
|
|
app.alerts.dismiss(this.successAlert);
|
|
|
|
var settings = {};
|
|
|
|
this.fields.forEach(function (key) {
|
|
return settings[key] = _this5.values[key]();
|
|
});
|
|
|
|
saveSettings(settings).then(function () {
|
|
app.alerts.show(_this5.successAlert = new Alert({ type: 'success', children: app.translator.trans('core.admin.basics.saved_message') }));
|
|
}).catch(function () {}).then(function () {
|
|
_this5.loading = false;
|
|
m.redraw();
|
|
});
|
|
}
|
|
}]);
|
|
return BasicsPage;
|
|
}(Page);
|
|
|
|
_export('default', BasicsPage);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/Button', ['flarum/Component', 'flarum/helpers/icon', 'flarum/utils/extract', 'flarum/utils/extractText', 'flarum/components/LoadingIndicator'], function (_export, _context) {
|
|
var Component, icon, extract, extractText, LoadingIndicator, Button;
|
|
return {
|
|
setters: [function (_flarumComponent) {
|
|
Component = _flarumComponent.default;
|
|
}, function (_flarumHelpersIcon) {
|
|
icon = _flarumHelpersIcon.default;
|
|
}, function (_flarumUtilsExtract) {
|
|
extract = _flarumUtilsExtract.default;
|
|
}, function (_flarumUtilsExtractText) {
|
|
extractText = _flarumUtilsExtractText.default;
|
|
}, function (_flarumComponentsLoadingIndicator) {
|
|
LoadingIndicator = _flarumComponentsLoadingIndicator.default;
|
|
}],
|
|
execute: function () {
|
|
Button = function (_Component) {
|
|
babelHelpers.inherits(Button, _Component);
|
|
|
|
function Button() {
|
|
babelHelpers.classCallCheck(this, Button);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(Button).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(Button, [{
|
|
key: 'view',
|
|
value: function view() {
|
|
var attrs = babelHelpers.extends({}, this.props);
|
|
|
|
delete attrs.children;
|
|
|
|
attrs.className = attrs.className || '';
|
|
attrs.type = attrs.type || 'button';
|
|
|
|
// If nothing else is provided, we use the textual button content as tooltip
|
|
if (!attrs.title && this.props.children) {
|
|
attrs.title = extractText(this.props.children);
|
|
}
|
|
|
|
var iconName = extract(attrs, 'icon');
|
|
if (iconName) attrs.className += ' hasIcon';
|
|
|
|
var loading = extract(attrs, 'loading');
|
|
if (attrs.disabled || loading) {
|
|
attrs.className += ' disabled' + (loading ? ' loading' : '');
|
|
delete attrs.onclick;
|
|
}
|
|
|
|
return m(
|
|
'button',
|
|
attrs,
|
|
this.getButtonContent()
|
|
);
|
|
}
|
|
}, {
|
|
key: 'getButtonContent',
|
|
value: function getButtonContent() {
|
|
var iconName = this.props.icon;
|
|
|
|
return [iconName && iconName !== true ? icon(iconName, { className: 'Button-icon' }) : '', this.props.children ? m(
|
|
'span',
|
|
{ className: 'Button-label' },
|
|
this.props.children
|
|
) : '', this.props.loading ? LoadingIndicator.component({ size: 'tiny', className: 'LoadingIndicator--inline' }) : ''];
|
|
}
|
|
}]);
|
|
return Button;
|
|
}(Component);
|
|
|
|
_export('default', Button);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/Checkbox', ['flarum/Component', 'flarum/components/LoadingIndicator', 'flarum/helpers/icon'], function (_export, _context) {
|
|
var Component, LoadingIndicator, icon, Checkbox;
|
|
return {
|
|
setters: [function (_flarumComponent) {
|
|
Component = _flarumComponent.default;
|
|
}, function (_flarumComponentsLoadingIndicator) {
|
|
LoadingIndicator = _flarumComponentsLoadingIndicator.default;
|
|
}, function (_flarumHelpersIcon) {
|
|
icon = _flarumHelpersIcon.default;
|
|
}],
|
|
execute: function () {
|
|
Checkbox = function (_Component) {
|
|
babelHelpers.inherits(Checkbox, _Component);
|
|
|
|
function Checkbox() {
|
|
babelHelpers.classCallCheck(this, Checkbox);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(Checkbox).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(Checkbox, [{
|
|
key: 'init',
|
|
value: function init() {
|
|
/**
|
|
* Whether or not the checkbox's value is in the process of being saved.
|
|
*
|
|
* @type {Boolean}
|
|
* @public
|
|
*/
|
|
this.loading = false;
|
|
}
|
|
}, {
|
|
key: 'view',
|
|
value: function view() {
|
|
var className = 'Checkbox ' + (this.props.state ? 'on' : 'off') + ' ' + (this.props.className || '');
|
|
if (this.loading) className += ' loading';
|
|
if (this.props.disabled) className += ' disabled';
|
|
|
|
return m(
|
|
'label',
|
|
{ className: className },
|
|
m('input', { type: 'checkbox',
|
|
checked: this.props.state,
|
|
disabled: this.props.disabled,
|
|
onchange: m.withAttr('checked', this.onchange.bind(this)) }),
|
|
m(
|
|
'div',
|
|
{ className: 'Checkbox-display' },
|
|
this.getDisplay()
|
|
),
|
|
this.props.children
|
|
);
|
|
}
|
|
}, {
|
|
key: 'getDisplay',
|
|
value: function getDisplay() {
|
|
return this.loading ? LoadingIndicator.component({ size: 'tiny' }) : icon(this.props.state ? 'check' : 'times');
|
|
}
|
|
}, {
|
|
key: 'onchange',
|
|
value: function onchange(checked) {
|
|
if (this.props.onchange) this.props.onchange(checked, this);
|
|
}
|
|
}]);
|
|
return Checkbox;
|
|
}(Component);
|
|
|
|
_export('default', Checkbox);
|
|
}
|
|
};
|
|
});;
|
|
"use strict";
|
|
|
|
System.register("flarum/components/DashboardPage", ["flarum/components/Page"], function (_export, _context) {
|
|
var Page, DashboardPage;
|
|
return {
|
|
setters: [function (_flarumComponentsPage) {
|
|
Page = _flarumComponentsPage.default;
|
|
}],
|
|
execute: function () {
|
|
DashboardPage = function (_Page) {
|
|
babelHelpers.inherits(DashboardPage, _Page);
|
|
|
|
function DashboardPage() {
|
|
babelHelpers.classCallCheck(this, DashboardPage);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(DashboardPage).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(DashboardPage, [{
|
|
key: "view",
|
|
value: function view() {
|
|
return m(
|
|
"div",
|
|
{ className: "DashboardPage" },
|
|
m(
|
|
"div",
|
|
{ className: "container" },
|
|
m(
|
|
"h2",
|
|
null,
|
|
app.translator.trans('core.admin.dashboard.welcome_text')
|
|
),
|
|
m(
|
|
"p",
|
|
null,
|
|
app.translator.trans('core.admin.dashboard.version_text', { version: m(
|
|
"strong",
|
|
null,
|
|
app.forum.attribute('version')
|
|
) })
|
|
),
|
|
m(
|
|
"p",
|
|
null,
|
|
app.translator.trans('core.admin.dashboard.beta_warning_text', { strong: m("strong", null) })
|
|
),
|
|
m(
|
|
"ul",
|
|
null,
|
|
m(
|
|
"li",
|
|
null,
|
|
app.translator.trans('core.admin.dashboard.contributing_text', { a: m("a", { href: "http://flarum.org/docs/contributing", target: "_blank" }) })
|
|
),
|
|
m(
|
|
"li",
|
|
null,
|
|
app.translator.trans('core.admin.dashboard.troubleshooting_text', { a: m("a", { href: "http://flarum.org/docs/troubleshooting", target: "_blank" }) })
|
|
),
|
|
m(
|
|
"li",
|
|
null,
|
|
app.translator.trans('core.admin.dashboard.support_text', { a: m("a", { href: "http://discuss.flarum.org/t/support", target: "_blank" }) })
|
|
),
|
|
m(
|
|
"li",
|
|
null,
|
|
app.translator.trans('core.admin.dashboard.features_text', { a: m("a", { href: "http://discuss.flarum.org/t/features", target: "_blank" }) })
|
|
),
|
|
m(
|
|
"li",
|
|
null,
|
|
app.translator.trans('core.admin.dashboard.extension_text', { a: m("a", { href: "http://flarum.org/docs/extend", target: "_blank" }) })
|
|
)
|
|
)
|
|
)
|
|
);
|
|
}
|
|
}]);
|
|
return DashboardPage;
|
|
}(Page);
|
|
|
|
_export("default", DashboardPage);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/Dropdown', ['flarum/Component', 'flarum/helpers/icon', 'flarum/helpers/listItems'], function (_export, _context) {
|
|
var Component, icon, listItems, Dropdown;
|
|
return {
|
|
setters: [function (_flarumComponent) {
|
|
Component = _flarumComponent.default;
|
|
}, function (_flarumHelpersIcon) {
|
|
icon = _flarumHelpersIcon.default;
|
|
}, function (_flarumHelpersListItems) {
|
|
listItems = _flarumHelpersListItems.default;
|
|
}],
|
|
execute: function () {
|
|
Dropdown = function (_Component) {
|
|
babelHelpers.inherits(Dropdown, _Component);
|
|
|
|
function Dropdown() {
|
|
babelHelpers.classCallCheck(this, Dropdown);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(Dropdown).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(Dropdown, [{
|
|
key: 'view',
|
|
value: function view() {
|
|
var items = this.props.children ? listItems(this.props.children) : [];
|
|
|
|
return m(
|
|
'div',
|
|
{ className: 'ButtonGroup Dropdown dropdown ' + this.props.className + ' itemCount' + items.length },
|
|
this.getButton(),
|
|
this.getMenu(items)
|
|
);
|
|
}
|
|
}, {
|
|
key: 'config',
|
|
value: function config(isInitialized) {
|
|
var _this2 = this;
|
|
|
|
if (isInitialized) return;
|
|
|
|
// When opening the dropdown menu, work out if the menu goes beyond the
|
|
// bottom of the viewport. If it does, we will apply class to make it show
|
|
// above the toggle button instead of below it.
|
|
this.$().on('shown.bs.dropdown', function () {
|
|
var $menu = _this2.$('.Dropdown-menu');
|
|
var isRight = $menu.hasClass('Dropdown-menu--right');
|
|
$menu.removeClass('Dropdown-menu--top Dropdown-menu--right');
|
|
|
|
$menu.toggleClass('Dropdown-menu--top', $menu.offset().top + $menu.height() > $(window).scrollTop() + $(window).height());
|
|
|
|
$menu.toggleClass('Dropdown-menu--right', isRight || $menu.offset().left + $menu.width() > $(window).scrollLeft() + $(window).width());
|
|
|
|
if (_this2.props.onshow) {
|
|
_this2.props.onshow();
|
|
m.redraw();
|
|
}
|
|
});
|
|
|
|
this.$().on('hidden.bs.dropdown', function () {
|
|
if (_this2.props.onhide) {
|
|
_this2.props.onhide();
|
|
m.redraw();
|
|
}
|
|
});
|
|
}
|
|
}, {
|
|
key: 'getButton',
|
|
value: function getButton() {
|
|
return m(
|
|
'button',
|
|
{
|
|
className: 'Dropdown-toggle ' + this.props.buttonClassName,
|
|
'data-toggle': 'dropdown',
|
|
onclick: this.props.onclick },
|
|
this.getButtonContent()
|
|
);
|
|
}
|
|
}, {
|
|
key: 'getButtonContent',
|
|
value: function getButtonContent() {
|
|
return [this.props.icon ? icon(this.props.icon, { className: 'Button-icon' }) : '', m(
|
|
'span',
|
|
{ className: 'Button-label' },
|
|
this.props.label
|
|
), this.props.caretIcon ? icon(this.props.caretIcon, { className: 'Button-caret' }) : ''];
|
|
}
|
|
}, {
|
|
key: 'getMenu',
|
|
value: function getMenu(items) {
|
|
return m(
|
|
'ul',
|
|
{ className: 'Dropdown-menu dropdown-menu ' + this.props.menuClassName },
|
|
items
|
|
);
|
|
}
|
|
}], [{
|
|
key: 'initProps',
|
|
value: function initProps(props) {
|
|
babelHelpers.get(Object.getPrototypeOf(Dropdown), 'initProps', this).call(this, props);
|
|
|
|
props.className = props.className || '';
|
|
props.buttonClassName = props.buttonClassName || '';
|
|
props.menuClassName = props.menuClassName || '';
|
|
props.label = props.label || '';
|
|
props.caretIcon = typeof props.caretIcon !== 'undefined' ? props.caretIcon : 'caret-down';
|
|
}
|
|
}]);
|
|
return Dropdown;
|
|
}(Component);
|
|
|
|
_export('default', Dropdown);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/EditCustomCssModal', ['flarum/components/Modal', 'flarum/components/Button', 'flarum/utils/saveSettings'], function (_export, _context) {
|
|
var Modal, Button, saveSettings, EditCustomCssModal;
|
|
return {
|
|
setters: [function (_flarumComponentsModal) {
|
|
Modal = _flarumComponentsModal.default;
|
|
}, function (_flarumComponentsButton) {
|
|
Button = _flarumComponentsButton.default;
|
|
}, function (_flarumUtilsSaveSettings) {
|
|
saveSettings = _flarumUtilsSaveSettings.default;
|
|
}],
|
|
execute: function () {
|
|
EditCustomCssModal = function (_Modal) {
|
|
babelHelpers.inherits(EditCustomCssModal, _Modal);
|
|
|
|
function EditCustomCssModal() {
|
|
babelHelpers.classCallCheck(this, EditCustomCssModal);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(EditCustomCssModal).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(EditCustomCssModal, [{
|
|
key: 'init',
|
|
value: function init() {
|
|
this.customLess = m.prop(app.settings.custom_less || '');
|
|
}
|
|
}, {
|
|
key: 'className',
|
|
value: function className() {
|
|
return 'EditCustomCssModal Modal--large';
|
|
}
|
|
}, {
|
|
key: 'title',
|
|
value: function title() {
|
|
return app.translator.trans('core.admin.edit_css.title');
|
|
}
|
|
}, {
|
|
key: 'content',
|
|
value: function content() {
|
|
return m(
|
|
'div',
|
|
{ className: 'Modal-body' },
|
|
m(
|
|
'p',
|
|
null,
|
|
app.translator.trans('core.admin.edit_css.customize_text', { a: m('a', { href: 'https://github.com/flarum/core/tree/master/less', target: '_blank' }) })
|
|
),
|
|
m(
|
|
'div',
|
|
{ className: 'Form' },
|
|
m(
|
|
'div',
|
|
{ className: 'Form-group' },
|
|
m('textarea', { className: 'FormControl', rows: '30', value: this.customLess(), onchange: m.withAttr('value', this.customLess) })
|
|
),
|
|
m(
|
|
'div',
|
|
{ className: 'Form-group' },
|
|
Button.component({
|
|
className: 'Button Button--primary',
|
|
type: 'submit',
|
|
children: app.translator.trans('core.admin.edit_css.submit_button'),
|
|
loading: this.loading
|
|
})
|
|
)
|
|
)
|
|
);
|
|
}
|
|
}, {
|
|
key: 'onsubmit',
|
|
value: function onsubmit(e) {
|
|
e.preventDefault();
|
|
|
|
this.loading = true;
|
|
|
|
saveSettings({
|
|
custom_less: this.customLess()
|
|
}).then(function () {
|
|
return window.location.reload();
|
|
});
|
|
}
|
|
}]);
|
|
return EditCustomCssModal;
|
|
}(Modal);
|
|
|
|
_export('default', EditCustomCssModal);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/EditGroupModal', ['flarum/components/Modal', 'flarum/components/Button', 'flarum/components/Badge', 'flarum/models/Group'], function (_export, _context) {
|
|
var Modal, Button, Badge, Group, EditGroupModal;
|
|
return {
|
|
setters: [function (_flarumComponentsModal) {
|
|
Modal = _flarumComponentsModal.default;
|
|
}, function (_flarumComponentsButton) {
|
|
Button = _flarumComponentsButton.default;
|
|
}, function (_flarumComponentsBadge) {
|
|
Badge = _flarumComponentsBadge.default;
|
|
}, function (_flarumModelsGroup) {
|
|
Group = _flarumModelsGroup.default;
|
|
}],
|
|
execute: function () {
|
|
EditGroupModal = function (_Modal) {
|
|
babelHelpers.inherits(EditGroupModal, _Modal);
|
|
|
|
function EditGroupModal() {
|
|
babelHelpers.classCallCheck(this, EditGroupModal);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(EditGroupModal).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(EditGroupModal, [{
|
|
key: 'init',
|
|
value: function init() {
|
|
this.group = this.props.group || app.store.createRecord('groups');
|
|
|
|
this.nameSingular = m.prop(this.group.nameSingular() || '');
|
|
this.namePlural = m.prop(this.group.namePlural() || '');
|
|
this.icon = m.prop(this.group.icon() || '');
|
|
this.color = m.prop(this.group.color() || '');
|
|
}
|
|
}, {
|
|
key: 'className',
|
|
value: function className() {
|
|
return 'EditGroupModal Modal--small';
|
|
}
|
|
}, {
|
|
key: 'title',
|
|
value: function title() {
|
|
return [this.color() || this.icon() ? Badge.component({
|
|
icon: this.icon(),
|
|
style: { backgroundColor: this.color() }
|
|
}) : '', ' ', this.namePlural() || app.translator.trans('core.admin.edit_group.title')];
|
|
}
|
|
}, {
|
|
key: 'content',
|
|
value: function content() {
|
|
return m(
|
|
'div',
|
|
{ className: 'Modal-body' },
|
|
m(
|
|
'div',
|
|
{ className: 'Form' },
|
|
m(
|
|
'div',
|
|
{ className: 'Form-group' },
|
|
m(
|
|
'label',
|
|
null,
|
|
app.translator.trans('core.admin.edit_group.name_label')
|
|
),
|
|
m(
|
|
'div',
|
|
{ className: 'EditGroupModal-name-input' },
|
|
m('input', { className: 'FormControl', placeholder: app.translator.trans('core.admin.edit_group.singular_placeholder'), value: this.nameSingular(), oninput: m.withAttr('value', this.nameSingular) }),
|
|
m('input', { className: 'FormControl', placeholder: app.translator.trans('core.admin.edit_group.plural_placeholder'), value: this.namePlural(), oninput: m.withAttr('value', this.namePlural) })
|
|
)
|
|
),
|
|
m(
|
|
'div',
|
|
{ className: 'Form-group' },
|
|
m(
|
|
'label',
|
|
null,
|
|
app.translator.trans('core.admin.edit_group.color_label')
|
|
),
|
|
m('input', { className: 'FormControl', placeholder: '#aaaaaa', value: this.color(), oninput: m.withAttr('value', this.color) })
|
|
),
|
|
m(
|
|
'div',
|
|
{ className: 'Form-group' },
|
|
m(
|
|
'label',
|
|
null,
|
|
app.translator.trans('core.admin.edit_group.icon_label')
|
|
),
|
|
m(
|
|
'div',
|
|
{ className: 'helpText' },
|
|
app.translator.trans('core.admin.edit_group.icon_text', { a: m('a', { href: 'http://fortawesome.github.io/Font-Awesome/icons/', tabindex: '-1' }) }, { em: m('em', null) }, { code: m('code', null) })
|
|
),
|
|
m('input', { className: 'FormControl', placeholder: 'bolt', value: this.icon(), oninput: m.withAttr('value', this.icon) })
|
|
),
|
|
m(
|
|
'div',
|
|
{ className: 'Form-group' },
|
|
Button.component({
|
|
type: 'submit',
|
|
className: 'Button Button--primary EditGroupModal-save',
|
|
loading: this.loading,
|
|
children: app.translator.trans('core.admin.edit_group.submit_button')
|
|
}),
|
|
this.group.exists && this.group.id() !== Group.ADMINISTRATOR_ID ? m(
|
|
'button',
|
|
{ type: 'button', className: 'Button EditGroupModal-delete', onclick: this.deleteGroup.bind(this) },
|
|
app.translator.trans('core.admin.edit_group.delete_button')
|
|
) : ''
|
|
)
|
|
)
|
|
);
|
|
}
|
|
}, {
|
|
key: 'onsubmit',
|
|
value: function onsubmit(e) {
|
|
var _this2 = this;
|
|
|
|
e.preventDefault();
|
|
|
|
this.loading = true;
|
|
|
|
this.group.save({
|
|
nameSingular: this.nameSingular(),
|
|
namePlural: this.namePlural(),
|
|
color: this.color(),
|
|
icon: this.icon()
|
|
}, { errorHandler: this.onerror.bind(this) }).then(this.hide.bind(this)).catch(function () {
|
|
_this2.loading = false;
|
|
m.redraw();
|
|
});
|
|
}
|
|
}, {
|
|
key: 'deleteGroup',
|
|
value: function deleteGroup() {
|
|
if (confirm(app.translator.trans('core.admin.edit_group.delete_confirmation'))) {
|
|
this.group.delete().then(function () {
|
|
return m.redraw();
|
|
});
|
|
this.hide();
|
|
}
|
|
}
|
|
}]);
|
|
return EditGroupModal;
|
|
}(Modal);
|
|
|
|
_export('default', EditGroupModal);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/ExtensionsPage', ['flarum/components/Page', 'flarum/components/LinkButton', 'flarum/components/Button', 'flarum/components/Dropdown', 'flarum/components/Separator', 'flarum/components/AddExtensionModal', 'flarum/components/LoadingModal', 'flarum/utils/ItemList', 'flarum/helpers/icon', 'flarum/helpers/listItems'], function (_export, _context) {
|
|
var Page, LinkButton, Button, Dropdown, Separator, AddExtensionModal, LoadingModal, ItemList, icon, listItems, ExtensionsPage;
|
|
return {
|
|
setters: [function (_flarumComponentsPage) {
|
|
Page = _flarumComponentsPage.default;
|
|
}, function (_flarumComponentsLinkButton) {
|
|
LinkButton = _flarumComponentsLinkButton.default;
|
|
}, function (_flarumComponentsButton) {
|
|
Button = _flarumComponentsButton.default;
|
|
}, function (_flarumComponentsDropdown) {
|
|
Dropdown = _flarumComponentsDropdown.default;
|
|
}, function (_flarumComponentsSeparator) {
|
|
Separator = _flarumComponentsSeparator.default;
|
|
}, function (_flarumComponentsAddExtensionModal) {
|
|
AddExtensionModal = _flarumComponentsAddExtensionModal.default;
|
|
}, function (_flarumComponentsLoadingModal) {
|
|
LoadingModal = _flarumComponentsLoadingModal.default;
|
|
}, function (_flarumUtilsItemList) {
|
|
ItemList = _flarumUtilsItemList.default;
|
|
}, function (_flarumHelpersIcon) {
|
|
icon = _flarumHelpersIcon.default;
|
|
}, function (_flarumHelpersListItems) {
|
|
listItems = _flarumHelpersListItems.default;
|
|
}],
|
|
execute: function () {
|
|
ExtensionsPage = function (_Page) {
|
|
babelHelpers.inherits(ExtensionsPage, _Page);
|
|
|
|
function ExtensionsPage() {
|
|
babelHelpers.classCallCheck(this, ExtensionsPage);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(ExtensionsPage).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(ExtensionsPage, [{
|
|
key: 'view',
|
|
value: function view() {
|
|
var _this2 = this;
|
|
|
|
return m(
|
|
'div',
|
|
{ className: 'ExtensionsPage' },
|
|
m(
|
|
'div',
|
|
{ className: 'ExtensionsPage-header' },
|
|
m(
|
|
'div',
|
|
{ className: 'container' },
|
|
Button.component({
|
|
children: app.translator.trans('core.admin.extensions.add_button'),
|
|
icon: 'plus',
|
|
className: 'Button Button--primary',
|
|
onclick: function onclick() {
|
|
return app.modal.show(new AddExtensionModal());
|
|
}
|
|
})
|
|
)
|
|
),
|
|
m(
|
|
'div',
|
|
{ className: 'ExtensionsPage-list' },
|
|
m(
|
|
'div',
|
|
{ className: 'container' },
|
|
m(
|
|
'ul',
|
|
{ className: 'ExtensionList' },
|
|
Object.keys(app.extensions).map(function (id) {
|
|
var extension = app.extensions[id];
|
|
var controls = _this2.controlItems(extension.id).toArray();
|
|
|
|
return m(
|
|
'li',
|
|
{ className: 'ExtensionListItem ' + (!_this2.isEnabled(extension.id) ? 'disabled' : '') },
|
|
m(
|
|
'div',
|
|
{ className: 'ExtensionListItem-content' },
|
|
m(
|
|
'span',
|
|
{ className: 'ExtensionListItem-icon ExtensionIcon', style: extension.icon },
|
|
extension.icon ? icon(extension.icon.name) : ''
|
|
),
|
|
controls.length ? m(
|
|
Dropdown,
|
|
{
|
|
className: 'ExtensionListItem-controls',
|
|
buttonClassName: 'Button Button--icon Button--flat',
|
|
menuClassName: 'Dropdown-menu--right',
|
|
icon: 'ellipsis-h' },
|
|
controls
|
|
) : '',
|
|
m(
|
|
'label',
|
|
{ className: 'ExtensionListItem-title' },
|
|
m('input', { type: 'checkbox', checked: _this2.isEnabled(extension.id), onclick: _this2.toggle.bind(_this2, extension.id) }),
|
|
' ',
|
|
' ',
|
|
extension.extra['flarum-extension'].title
|
|
),
|
|
m(
|
|
'div',
|
|
{ className: 'ExtensionListItem-version' },
|
|
extension.version
|
|
)
|
|
)
|
|
);
|
|
})
|
|
)
|
|
)
|
|
)
|
|
);
|
|
}
|
|
}, {
|
|
key: 'controlItems',
|
|
value: function controlItems(name) {
|
|
var items = new ItemList();
|
|
var enabled = this.isEnabled(name);
|
|
|
|
if (app.extensionSettings[name]) {
|
|
items.add('settings', Button.component({
|
|
icon: 'cog',
|
|
children: app.translator.trans('core.admin.extensions.settings_button'),
|
|
onclick: app.extensionSettings[name]
|
|
}));
|
|
}
|
|
|
|
if (!enabled) {
|
|
items.add('uninstall', Button.component({
|
|
icon: 'trash-o',
|
|
children: app.translator.trans('core.admin.extensions.uninstall_button'),
|
|
onclick: function onclick() {
|
|
app.request({
|
|
url: app.forum.attribute('apiUrl') + '/extensions/' + name,
|
|
method: 'DELETE'
|
|
}).then(function () {
|
|
return window.location.reload();
|
|
});
|
|
|
|
app.modal.show(new LoadingModal());
|
|
}
|
|
}));
|
|
}
|
|
|
|
return items;
|
|
}
|
|
}, {
|
|
key: 'isEnabled',
|
|
value: function isEnabled(name) {
|
|
var enabled = JSON.parse(app.settings.extensions_enabled);
|
|
|
|
return enabled.indexOf(name) !== -1;
|
|
}
|
|
}, {
|
|
key: 'toggle',
|
|
value: function toggle(id) {
|
|
var enabled = this.isEnabled(id);
|
|
|
|
app.request({
|
|
url: app.forum.attribute('apiUrl') + '/extensions/' + id,
|
|
method: 'PATCH',
|
|
data: { enabled: !enabled }
|
|
}).then(function () {
|
|
if (!enabled) localStorage.setItem('enabledExtension', id);
|
|
window.location.reload();
|
|
});
|
|
|
|
app.modal.show(new LoadingModal());
|
|
}
|
|
}]);
|
|
return ExtensionsPage;
|
|
}(Page);
|
|
|
|
_export('default', ExtensionsPage);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/FieldSet', ['flarum/Component', 'flarum/helpers/listItems'], function (_export, _context) {
|
|
var Component, listItems, FieldSet;
|
|
return {
|
|
setters: [function (_flarumComponent) {
|
|
Component = _flarumComponent.default;
|
|
}, function (_flarumHelpersListItems) {
|
|
listItems = _flarumHelpersListItems.default;
|
|
}],
|
|
execute: function () {
|
|
FieldSet = function (_Component) {
|
|
babelHelpers.inherits(FieldSet, _Component);
|
|
|
|
function FieldSet() {
|
|
babelHelpers.classCallCheck(this, FieldSet);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(FieldSet).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(FieldSet, [{
|
|
key: 'view',
|
|
value: function view() {
|
|
return m(
|
|
'fieldset',
|
|
{ className: this.props.className },
|
|
m(
|
|
'legend',
|
|
null,
|
|
this.props.label
|
|
),
|
|
m(
|
|
'ul',
|
|
null,
|
|
listItems(this.props.children)
|
|
)
|
|
);
|
|
}
|
|
}]);
|
|
return FieldSet;
|
|
}(Component);
|
|
|
|
_export('default', FieldSet);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/GroupBadge', ['flarum/components/Badge'], function (_export, _context) {
|
|
var Badge, GroupBadge;
|
|
return {
|
|
setters: [function (_flarumComponentsBadge) {
|
|
Badge = _flarumComponentsBadge.default;
|
|
}],
|
|
execute: function () {
|
|
GroupBadge = function (_Badge) {
|
|
babelHelpers.inherits(GroupBadge, _Badge);
|
|
|
|
function GroupBadge() {
|
|
babelHelpers.classCallCheck(this, GroupBadge);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(GroupBadge).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(GroupBadge, null, [{
|
|
key: 'initProps',
|
|
value: function initProps(props) {
|
|
babelHelpers.get(Object.getPrototypeOf(GroupBadge), 'initProps', this).call(this, props);
|
|
|
|
if (props.group) {
|
|
props.icon = props.group.icon();
|
|
props.style = { backgroundColor: props.group.color() };
|
|
props.label = typeof props.label === 'undefined' ? props.group.nameSingular() : props.label;
|
|
props.type = 'group--' + props.group.id();
|
|
|
|
delete props.group;
|
|
}
|
|
}
|
|
}]);
|
|
return GroupBadge;
|
|
}(Badge);
|
|
|
|
_export('default', GroupBadge);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/HeaderPrimary', ['flarum/Component', 'flarum/utils/ItemList', 'flarum/helpers/listItems'], function (_export, _context) {
|
|
var Component, ItemList, listItems, HeaderPrimary;
|
|
return {
|
|
setters: [function (_flarumComponent) {
|
|
Component = _flarumComponent.default;
|
|
}, function (_flarumUtilsItemList) {
|
|
ItemList = _flarumUtilsItemList.default;
|
|
}, function (_flarumHelpersListItems) {
|
|
listItems = _flarumHelpersListItems.default;
|
|
}],
|
|
execute: function () {
|
|
HeaderPrimary = function (_Component) {
|
|
babelHelpers.inherits(HeaderPrimary, _Component);
|
|
|
|
function HeaderPrimary() {
|
|
babelHelpers.classCallCheck(this, HeaderPrimary);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(HeaderPrimary).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(HeaderPrimary, [{
|
|
key: 'view',
|
|
value: function view() {
|
|
return m(
|
|
'ul',
|
|
{ className: 'Header-controls' },
|
|
listItems(this.items().toArray())
|
|
);
|
|
}
|
|
}, {
|
|
key: 'config',
|
|
value: function config(isInitialized, context) {
|
|
// Since this component is 'above' the content of the page (that is, it is a
|
|
// part of the global UI that persists between routes), we will flag the DOM
|
|
// to be retained across route changes.
|
|
context.retain = true;
|
|
}
|
|
}, {
|
|
key: 'items',
|
|
value: function items() {
|
|
return new ItemList();
|
|
}
|
|
}]);
|
|
return HeaderPrimary;
|
|
}(Component);
|
|
|
|
_export('default', HeaderPrimary);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/HeaderSecondary', ['flarum/Component', 'flarum/components/SessionDropdown', 'flarum/utils/ItemList', 'flarum/helpers/listItems'], function (_export, _context) {
|
|
var Component, SessionDropdown, ItemList, listItems, HeaderSecondary;
|
|
return {
|
|
setters: [function (_flarumComponent) {
|
|
Component = _flarumComponent.default;
|
|
}, function (_flarumComponentsSessionDropdown) {
|
|
SessionDropdown = _flarumComponentsSessionDropdown.default;
|
|
}, function (_flarumUtilsItemList) {
|
|
ItemList = _flarumUtilsItemList.default;
|
|
}, function (_flarumHelpersListItems) {
|
|
listItems = _flarumHelpersListItems.default;
|
|
}],
|
|
execute: function () {
|
|
HeaderSecondary = function (_Component) {
|
|
babelHelpers.inherits(HeaderSecondary, _Component);
|
|
|
|
function HeaderSecondary() {
|
|
babelHelpers.classCallCheck(this, HeaderSecondary);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(HeaderSecondary).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(HeaderSecondary, [{
|
|
key: 'view',
|
|
value: function view() {
|
|
return m(
|
|
'ul',
|
|
{ className: 'Header-controls' },
|
|
listItems(this.items().toArray())
|
|
);
|
|
}
|
|
}, {
|
|
key: 'config',
|
|
value: function config(isInitialized, context) {
|
|
// Since this component is 'above' the content of the page (that is, it is a
|
|
// part of the global UI that persists between routes), we will flag the DOM
|
|
// to be retained across route changes.
|
|
context.retain = true;
|
|
}
|
|
}, {
|
|
key: 'items',
|
|
value: function items() {
|
|
var items = new ItemList();
|
|
|
|
items.add('session', SessionDropdown.component());
|
|
|
|
return items;
|
|
}
|
|
}]);
|
|
return HeaderSecondary;
|
|
}(Component);
|
|
|
|
_export('default', HeaderSecondary);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/LinkButton', ['flarum/components/Button'], function (_export, _context) {
|
|
var Button, LinkButton;
|
|
return {
|
|
setters: [function (_flarumComponentsButton) {
|
|
Button = _flarumComponentsButton.default;
|
|
}],
|
|
execute: function () {
|
|
LinkButton = function (_Button) {
|
|
babelHelpers.inherits(LinkButton, _Button);
|
|
|
|
function LinkButton() {
|
|
babelHelpers.classCallCheck(this, LinkButton);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(LinkButton).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(LinkButton, [{
|
|
key: 'view',
|
|
value: function view() {
|
|
var vdom = babelHelpers.get(Object.getPrototypeOf(LinkButton.prototype), 'view', this).call(this);
|
|
|
|
vdom.tag = 'a';
|
|
|
|
return vdom;
|
|
}
|
|
}], [{
|
|
key: 'initProps',
|
|
value: function initProps(props) {
|
|
props.active = this.isActive(props);
|
|
props.config = props.config || m.route;
|
|
}
|
|
}, {
|
|
key: 'isActive',
|
|
value: function isActive(props) {
|
|
return typeof props.active !== 'undefined' ? props.active : m.route() === props.href;
|
|
}
|
|
}]);
|
|
return LinkButton;
|
|
}(Button);
|
|
|
|
_export('default', LinkButton);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/LoadingIndicator', ['flarum/Component'], function (_export, _context) {
|
|
var Component, LoadingIndicator;
|
|
return {
|
|
setters: [function (_flarumComponent) {
|
|
Component = _flarumComponent.default;
|
|
}],
|
|
execute: function () {
|
|
LoadingIndicator = function (_Component) {
|
|
babelHelpers.inherits(LoadingIndicator, _Component);
|
|
|
|
function LoadingIndicator() {
|
|
babelHelpers.classCallCheck(this, LoadingIndicator);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(LoadingIndicator).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(LoadingIndicator, [{
|
|
key: 'view',
|
|
value: function view() {
|
|
var attrs = babelHelpers.extends({}, this.props);
|
|
|
|
attrs.className = 'LoadingIndicator ' + (attrs.className || '');
|
|
delete attrs.size;
|
|
|
|
return m(
|
|
'div',
|
|
attrs,
|
|
m.trust(' ')
|
|
);
|
|
}
|
|
}, {
|
|
key: 'config',
|
|
value: function config() {
|
|
var size = this.props.size || 'small';
|
|
|
|
$.fn.spin.presets[size].zIndex = 'auto';
|
|
this.$().spin(size);
|
|
}
|
|
}]);
|
|
return LoadingIndicator;
|
|
}(Component);
|
|
|
|
_export('default', LoadingIndicator);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/LoadingModal', ['flarum/components/Modal'], function (_export, _context) {
|
|
var Modal, LoadingModal;
|
|
return {
|
|
setters: [function (_flarumComponentsModal) {
|
|
Modal = _flarumComponentsModal.default;
|
|
}],
|
|
execute: function () {
|
|
LoadingModal = function (_Modal) {
|
|
babelHelpers.inherits(LoadingModal, _Modal);
|
|
|
|
function LoadingModal() {
|
|
babelHelpers.classCallCheck(this, LoadingModal);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(LoadingModal).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(LoadingModal, [{
|
|
key: 'isDismissible',
|
|
value: function isDismissible() {
|
|
return false;
|
|
}
|
|
}, {
|
|
key: 'className',
|
|
value: function className() {
|
|
return 'LoadingModal Modal--small';
|
|
}
|
|
}, {
|
|
key: 'title',
|
|
value: function title() {
|
|
return app.translator.trans('core.admin.loading.title');
|
|
}
|
|
}, {
|
|
key: 'content',
|
|
value: function content() {
|
|
return '';
|
|
}
|
|
}]);
|
|
return LoadingModal;
|
|
}(Modal);
|
|
|
|
_export('default', LoadingModal);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/MailPage', ['flarum/components/Page', 'flarum/components/FieldSet', 'flarum/components/Button', 'flarum/components/Alert', 'flarum/utils/saveSettings'], function (_export, _context) {
|
|
var Page, FieldSet, Button, Alert, saveSettings, MailPage;
|
|
return {
|
|
setters: [function (_flarumComponentsPage) {
|
|
Page = _flarumComponentsPage.default;
|
|
}, function (_flarumComponentsFieldSet) {
|
|
FieldSet = _flarumComponentsFieldSet.default;
|
|
}, function (_flarumComponentsButton) {
|
|
Button = _flarumComponentsButton.default;
|
|
}, function (_flarumComponentsAlert) {
|
|
Alert = _flarumComponentsAlert.default;
|
|
}, function (_flarumUtilsSaveSettings) {
|
|
saveSettings = _flarumUtilsSaveSettings.default;
|
|
}],
|
|
execute: function () {
|
|
MailPage = function (_Page) {
|
|
babelHelpers.inherits(MailPage, _Page);
|
|
|
|
function MailPage() {
|
|
babelHelpers.classCallCheck(this, MailPage);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(MailPage).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(MailPage, [{
|
|
key: 'init',
|
|
value: function init() {
|
|
var _this2 = this;
|
|
|
|
babelHelpers.get(Object.getPrototypeOf(MailPage.prototype), 'init', this).call(this);
|
|
|
|
this.loading = false;
|
|
|
|
this.fields = ['mail_driver', 'mail_host', 'mail_from', 'mail_port', 'mail_username', 'mail_password', 'mail_encryption'];
|
|
this.values = {};
|
|
|
|
var settings = app.settings;
|
|
this.fields.forEach(function (key) {
|
|
return _this2.values[key] = m.prop(settings[key]);
|
|
});
|
|
|
|
this.localeOptions = {};
|
|
var locales = app.locales;
|
|
for (var i in locales) {
|
|
this.localeOptions[i] = locales[i] + ' (' + i + ')';
|
|
}
|
|
}
|
|
}, {
|
|
key: 'view',
|
|
value: function view() {
|
|
return m(
|
|
'div',
|
|
{ className: 'MailPage' },
|
|
m(
|
|
'div',
|
|
{ className: 'container' },
|
|
m(
|
|
'form',
|
|
{ onsubmit: this.onsubmit.bind(this) },
|
|
m(
|
|
'div',
|
|
{ className: 'helpText' },
|
|
app.translator.trans('core.admin.email.text')
|
|
),
|
|
FieldSet.component({
|
|
label: app.translator.trans('core.admin.email.server_heading'),
|
|
className: 'MailPage-MailSettings',
|
|
children: [m(
|
|
'div',
|
|
{ className: 'MailPage-MailSettings-input' },
|
|
m(
|
|
'label',
|
|
null,
|
|
app.translator.trans('core.admin.email.driver_label')
|
|
),
|
|
m('input', { className: 'FormControl', value: this.values.mail_driver() || '', oninput: m.withAttr('value', this.values.mail_driver) }),
|
|
m(
|
|
'label',
|
|
null,
|
|
app.translator.trans('core.admin.email.host_label')
|
|
),
|
|
m('input', { className: 'FormControl', value: this.values.mail_host() || '', oninput: m.withAttr('value', this.values.mail_host) }),
|
|
m(
|
|
'label',
|
|
null,
|
|
app.translator.trans('core.admin.email.port_label')
|
|
),
|
|
m('input', { className: 'FormControl', value: this.values.mail_port() || '', oninput: m.withAttr('value', this.values.mail_port) }),
|
|
m(
|
|
'label',
|
|
null,
|
|
app.translator.trans('core.admin.email.encryption_label')
|
|
),
|
|
m('input', { className: 'FormControl', value: this.values.mail_encryption() || '', oninput: m.withAttr('value', this.values.mail_encryption) })
|
|
)]
|
|
}),
|
|
FieldSet.component({
|
|
label: app.translator.trans('core.admin.email.account_heading'),
|
|
className: 'MailPage-MailSettings',
|
|
children: [m(
|
|
'div',
|
|
{ className: 'MailPage-MailSettings-input' },
|
|
m(
|
|
'label',
|
|
null,
|
|
app.translator.trans('core.admin.email.username_label')
|
|
),
|
|
m('input', { className: 'FormControl', value: this.values.mail_username() || '', oninput: m.withAttr('value', this.values.mail_username) }),
|
|
m(
|
|
'label',
|
|
null,
|
|
app.translator.trans('core.admin.email.password_label')
|
|
),
|
|
m('input', { className: 'FormControl', value: this.values.mail_password() || '', oninput: m.withAttr('value', this.values.mail_password) })
|
|
)]
|
|
}),
|
|
FieldSet.component({
|
|
label: app.translator.trans('core.admin.email.addresses_heading'),
|
|
className: 'MailPage-MailSettings',
|
|
children: [m(
|
|
'div',
|
|
{ className: 'MailPage-MailSettings-input' },
|
|
m(
|
|
'label',
|
|
null,
|
|
app.translator.trans('core.admin.email.from_label')
|
|
),
|
|
m('input', { className: 'FormControl', value: this.values.mail_from() || '', oninput: m.withAttr('value', this.values.mail_from) })
|
|
)]
|
|
}),
|
|
Button.component({
|
|
type: 'submit',
|
|
className: 'Button Button--primary',
|
|
children: app.translator.trans('core.admin.email.submit_button'),
|
|
loading: this.loading,
|
|
disabled: !this.changed()
|
|
})
|
|
)
|
|
)
|
|
);
|
|
}
|
|
}, {
|
|
key: 'changed',
|
|
value: function changed() {
|
|
var _this3 = this;
|
|
|
|
return this.fields.some(function (key) {
|
|
return _this3.values[key]() !== app.settings[key];
|
|
});
|
|
}
|
|
}, {
|
|
key: 'onsubmit',
|
|
value: function onsubmit(e) {
|
|
var _this4 = this;
|
|
|
|
e.preventDefault();
|
|
|
|
if (this.loading) return;
|
|
|
|
this.loading = true;
|
|
app.alerts.dismiss(this.successAlert);
|
|
|
|
var settings = {};
|
|
|
|
this.fields.forEach(function (key) {
|
|
return settings[key] = _this4.values[key]();
|
|
});
|
|
|
|
saveSettings(settings).then(function () {
|
|
app.alerts.show(_this4.successAlert = new Alert({ type: 'success', children: app.translator.trans('core.admin.basics.saved_message') }));
|
|
}).catch(function () {}).then(function () {
|
|
_this4.loading = false;
|
|
m.redraw();
|
|
});
|
|
}
|
|
}]);
|
|
return MailPage;
|
|
}(Page);
|
|
|
|
_export('default', MailPage);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/Modal', ['flarum/Component', 'flarum/components/Alert', 'flarum/components/Button'], function (_export, _context) {
|
|
var Component, Alert, Button, Modal;
|
|
return {
|
|
setters: [function (_flarumComponent) {
|
|
Component = _flarumComponent.default;
|
|
}, function (_flarumComponentsAlert) {
|
|
Alert = _flarumComponentsAlert.default;
|
|
}, function (_flarumComponentsButton) {
|
|
Button = _flarumComponentsButton.default;
|
|
}],
|
|
execute: function () {
|
|
Modal = function (_Component) {
|
|
babelHelpers.inherits(Modal, _Component);
|
|
|
|
function Modal() {
|
|
babelHelpers.classCallCheck(this, Modal);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(Modal).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(Modal, [{
|
|
key: 'init',
|
|
value: function init() {
|
|
/**
|
|
* An alert component to show below the header.
|
|
*
|
|
* @type {Alert}
|
|
*/
|
|
this.alert = null;
|
|
}
|
|
}, {
|
|
key: 'view',
|
|
value: function view() {
|
|
if (this.alert) {
|
|
this.alert.props.dismissible = false;
|
|
}
|
|
|
|
return m(
|
|
'div',
|
|
{ className: 'Modal modal-dialog ' + this.className() },
|
|
m(
|
|
'div',
|
|
{ className: 'Modal-content' },
|
|
this.isDismissible() ? m(
|
|
'div',
|
|
{ className: 'Modal-close App-backControl' },
|
|
Button.component({
|
|
icon: 'times',
|
|
onclick: this.hide.bind(this),
|
|
className: 'Button Button--icon Button--link'
|
|
})
|
|
) : '',
|
|
m(
|
|
'form',
|
|
{ onsubmit: this.onsubmit.bind(this) },
|
|
m(
|
|
'div',
|
|
{ className: 'Modal-header' },
|
|
m(
|
|
'h3',
|
|
{ className: 'App-titleControl App-titleControl--text' },
|
|
this.title()
|
|
)
|
|
),
|
|
alert ? m(
|
|
'div',
|
|
{ className: 'Modal-alert' },
|
|
this.alert
|
|
) : '',
|
|
this.content()
|
|
)
|
|
)
|
|
);
|
|
}
|
|
}, {
|
|
key: 'isDismissible',
|
|
value: function isDismissible() {
|
|
return true;
|
|
}
|
|
}, {
|
|
key: 'className',
|
|
value: function className() {}
|
|
}, {
|
|
key: 'title',
|
|
value: function title() {}
|
|
}, {
|
|
key: 'content',
|
|
value: function content() {}
|
|
}, {
|
|
key: 'onsubmit',
|
|
value: function onsubmit() {}
|
|
}, {
|
|
key: 'onready',
|
|
value: function onready() {
|
|
this.$('form').find('input, select, textarea').first().focus().select();
|
|
}
|
|
}, {
|
|
key: 'onhide',
|
|
value: function onhide() {}
|
|
}, {
|
|
key: 'hide',
|
|
value: function hide() {
|
|
app.modal.close();
|
|
}
|
|
}, {
|
|
key: 'loaded',
|
|
value: function loaded() {
|
|
this.loading = false;
|
|
m.redraw();
|
|
}
|
|
}, {
|
|
key: 'onerror',
|
|
value: function onerror(error) {
|
|
this.alert = error.alert;
|
|
|
|
m.redraw();
|
|
|
|
if (error.status === 422 && error.response.errors) {
|
|
this.$('form [name=' + error.response.errors[0].source.pointer.replace('/data/attributes/', '') + ']').select();
|
|
} else {
|
|
this.onready();
|
|
}
|
|
}
|
|
}]);
|
|
return Modal;
|
|
}(Component);
|
|
|
|
_export('default', Modal);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/ModalManager', ['flarum/Component', 'flarum/components/Modal'], function (_export, _context) {
|
|
var Component, Modal, ModalManager;
|
|
return {
|
|
setters: [function (_flarumComponent) {
|
|
Component = _flarumComponent.default;
|
|
}, function (_flarumComponentsModal) {
|
|
Modal = _flarumComponentsModal.default;
|
|
}],
|
|
execute: function () {
|
|
ModalManager = function (_Component) {
|
|
babelHelpers.inherits(ModalManager, _Component);
|
|
|
|
function ModalManager() {
|
|
babelHelpers.classCallCheck(this, ModalManager);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(ModalManager).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(ModalManager, [{
|
|
key: 'init',
|
|
value: function init() {
|
|
this.showing = false;
|
|
this.component = null;
|
|
}
|
|
}, {
|
|
key: 'view',
|
|
value: function view() {
|
|
return m(
|
|
'div',
|
|
{ className: 'ModalManager modal fade' },
|
|
this.component && this.component.render()
|
|
);
|
|
}
|
|
}, {
|
|
key: 'config',
|
|
value: function config(isInitialized, context) {
|
|
if (isInitialized) return;
|
|
|
|
// Since this component is 'above' the content of the page (that is, it is a
|
|
// part of the global UI that persists between routes), we will flag the DOM
|
|
// to be retained across route changes.
|
|
context.retain = true;
|
|
|
|
this.$().on('hidden.bs.modal', this.clear.bind(this)).on('shown.bs.modal', this.onready.bind(this));
|
|
}
|
|
}, {
|
|
key: 'show',
|
|
value: function show(component) {
|
|
if (!(component instanceof Modal)) {
|
|
throw new Error('The ModalManager component can only show Modal components');
|
|
}
|
|
|
|
clearTimeout(this.hideTimeout);
|
|
|
|
this.showing = true;
|
|
this.component = component;
|
|
|
|
app.current.retain = true;
|
|
|
|
m.redraw(true);
|
|
|
|
this.$().modal({ backdrop: this.component.isDismissible() ? true : 'static' }).modal('show');
|
|
this.onready();
|
|
}
|
|
}, {
|
|
key: 'close',
|
|
value: function close() {
|
|
var _this2 = this;
|
|
|
|
if (!this.showing) return;
|
|
|
|
// Don't hide the modal immediately, because if the consumer happens to call
|
|
// the `show` method straight after to show another modal dialog, it will
|
|
// cause Bootstrap's modal JS to misbehave. Instead we will wait for a tiny
|
|
// bit to give the `show` method the opportunity to prevent this from going
|
|
// ahead.
|
|
this.hideTimeout = setTimeout(function () {
|
|
_this2.$().modal('hide');
|
|
_this2.showing = false;
|
|
});
|
|
}
|
|
}, {
|
|
key: 'clear',
|
|
value: function clear() {
|
|
if (this.component) {
|
|
this.component.onhide();
|
|
}
|
|
|
|
this.component = null;
|
|
|
|
app.current.retain = false;
|
|
|
|
m.lazyRedraw();
|
|
}
|
|
}, {
|
|
key: 'onready',
|
|
value: function onready() {
|
|
if (this.component && this.component.onready) {
|
|
this.component.onready(this.$());
|
|
}
|
|
}
|
|
}]);
|
|
return ModalManager;
|
|
}(Component);
|
|
|
|
_export('default', ModalManager);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/Navigation', ['flarum/Component', 'flarum/components/Button', 'flarum/components/LinkButton'], function (_export, _context) {
|
|
var Component, Button, LinkButton, Navigation;
|
|
return {
|
|
setters: [function (_flarumComponent) {
|
|
Component = _flarumComponent.default;
|
|
}, function (_flarumComponentsButton) {
|
|
Button = _flarumComponentsButton.default;
|
|
}, function (_flarumComponentsLinkButton) {
|
|
LinkButton = _flarumComponentsLinkButton.default;
|
|
}],
|
|
execute: function () {
|
|
Navigation = function (_Component) {
|
|
babelHelpers.inherits(Navigation, _Component);
|
|
|
|
function Navigation() {
|
|
babelHelpers.classCallCheck(this, Navigation);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(Navigation).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(Navigation, [{
|
|
key: 'view',
|
|
value: function view() {
|
|
var _app = app;
|
|
var history = _app.history;
|
|
var pane = _app.pane;
|
|
|
|
|
|
return m(
|
|
'div',
|
|
{ className: 'Navigation ButtonGroup ' + (this.props.className || ''),
|
|
onmouseenter: pane && pane.show.bind(pane),
|
|
onmouseleave: pane && pane.onmouseleave.bind(pane) },
|
|
history.canGoBack() ? [this.getBackButton(), this.getPaneButton()] : this.getDrawerButton()
|
|
);
|
|
}
|
|
}, {
|
|
key: 'config',
|
|
value: function config(isInitialized, context) {
|
|
// Since this component is 'above' the content of the page (that is, it is a
|
|
// part of the global UI that persists between routes), we will flag the DOM
|
|
// to be retained across route changes.
|
|
context.retain = true;
|
|
}
|
|
}, {
|
|
key: 'getBackButton',
|
|
value: function getBackButton() {
|
|
var _app2 = app;
|
|
var history = _app2.history;
|
|
|
|
var previous = history.getPrevious() || {};
|
|
|
|
return LinkButton.component({
|
|
className: 'Button Navigation-back ' + (previous.title ? '' : 'Button--icon'),
|
|
href: history.backUrl(),
|
|
icon: 'chevron-left',
|
|
children: previous.title,
|
|
config: function config() {},
|
|
onclick: function onclick(e) {
|
|
if (e.shiftKey || e.ctrlKey || e.metaKey || e.which === 2) return;
|
|
e.preventDefault();
|
|
history.back();
|
|
}
|
|
});
|
|
}
|
|
}, {
|
|
key: 'getPaneButton',
|
|
value: function getPaneButton() {
|
|
var _app3 = app;
|
|
var pane = _app3.pane;
|
|
|
|
|
|
if (!pane || !pane.active) return '';
|
|
|
|
return Button.component({
|
|
className: 'Button Button--icon Navigation-pin' + (pane.pinned ? ' active' : ''),
|
|
onclick: pane.togglePinned.bind(pane),
|
|
icon: 'thumb-tack'
|
|
});
|
|
}
|
|
}, {
|
|
key: 'getDrawerButton',
|
|
value: function getDrawerButton() {
|
|
if (!this.props.drawer) return '';
|
|
|
|
var _app4 = app;
|
|
var drawer = _app4.drawer;
|
|
|
|
var user = app.session.user;
|
|
|
|
return Button.component({
|
|
className: 'Button Button--icon Navigation-drawer' + (user && user.newNotificationsCount() ? ' new' : ''),
|
|
onclick: function onclick(e) {
|
|
e.stopPropagation();
|
|
drawer.show();
|
|
},
|
|
icon: 'reorder'
|
|
});
|
|
}
|
|
}]);
|
|
return Navigation;
|
|
}(Component);
|
|
|
|
_export('default', Navigation);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/Page', ['flarum/Component'], function (_export, _context) {
|
|
var Component, Page;
|
|
return {
|
|
setters: [function (_flarumComponent) {
|
|
Component = _flarumComponent.default;
|
|
}],
|
|
execute: function () {
|
|
Page = function (_Component) {
|
|
babelHelpers.inherits(Page, _Component);
|
|
|
|
function Page() {
|
|
babelHelpers.classCallCheck(this, Page);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(Page).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(Page, [{
|
|
key: 'init',
|
|
value: function init() {
|
|
app.previous = app.current;
|
|
app.current = this;
|
|
|
|
app.modal.close();
|
|
|
|
/**
|
|
* A class name to apply to the body while the route is active.
|
|
*
|
|
* @type {String}
|
|
*/
|
|
this.bodyClass = '';
|
|
}
|
|
}, {
|
|
key: 'config',
|
|
value: function config(isInitialized, context) {
|
|
var _this2 = this;
|
|
|
|
if (isInitialized) return;
|
|
|
|
if (this.bodyClass) {
|
|
$('#app').addClass(this.bodyClass);
|
|
|
|
context.onunload = function () {
|
|
return $('#app').removeClass(_this2.bodyClass);
|
|
};
|
|
}
|
|
}
|
|
}]);
|
|
return Page;
|
|
}(Component);
|
|
|
|
_export('default', Page);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/PermissionDropdown', ['flarum/components/Dropdown', 'flarum/components/Button', 'flarum/components/Separator', 'flarum/models/Group', 'flarum/components/GroupBadge'], function (_export, _context) {
|
|
var Dropdown, Button, Separator, Group, GroupBadge, PermissionDropdown;
|
|
|
|
|
|
function badgeForId(id) {
|
|
var group = app.store.getById('groups', id);
|
|
|
|
return group ? GroupBadge.component({ group: group, label: null }) : '';
|
|
}
|
|
|
|
return {
|
|
setters: [function (_flarumComponentsDropdown) {
|
|
Dropdown = _flarumComponentsDropdown.default;
|
|
}, function (_flarumComponentsButton) {
|
|
Button = _flarumComponentsButton.default;
|
|
}, function (_flarumComponentsSeparator) {
|
|
Separator = _flarumComponentsSeparator.default;
|
|
}, function (_flarumModelsGroup) {
|
|
Group = _flarumModelsGroup.default;
|
|
}, function (_flarumComponentsGroupBadge) {
|
|
GroupBadge = _flarumComponentsGroupBadge.default;
|
|
}],
|
|
execute: function () {
|
|
PermissionDropdown = function (_Dropdown) {
|
|
babelHelpers.inherits(PermissionDropdown, _Dropdown);
|
|
|
|
function PermissionDropdown() {
|
|
babelHelpers.classCallCheck(this, PermissionDropdown);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(PermissionDropdown).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(PermissionDropdown, [{
|
|
key: 'view',
|
|
value: function view() {
|
|
var _this2 = this;
|
|
|
|
this.props.children = [];
|
|
|
|
var groupIds = app.permissions[this.props.permission] || [];
|
|
var everyone = groupIds.indexOf(Group.GUEST_ID) !== -1;
|
|
var members = groupIds.indexOf(Group.MEMBER_ID) !== -1;
|
|
var adminGroup = app.store.getById('groups', Group.ADMINISTRATOR_ID);
|
|
|
|
if (everyone) {
|
|
this.props.label = app.translator.trans('core.admin.permissions_controls.everyone_button');
|
|
} else if (members) {
|
|
this.props.label = app.translator.trans('core.admin.permissions_controls.members_button');
|
|
} else {
|
|
this.props.label = [badgeForId(Group.ADMINISTRATOR_ID), groupIds.map(badgeForId)];
|
|
}
|
|
|
|
if (this.props.allowGuest) {
|
|
this.props.children.push(Button.component({
|
|
children: app.translator.trans('core.admin.permissions_controls.everyone_button'),
|
|
icon: everyone ? 'check' : true,
|
|
onclick: function onclick() {
|
|
return _this2.save([Group.GUEST_ID]);
|
|
}
|
|
}));
|
|
}
|
|
|
|
this.props.children.push(Button.component({
|
|
children: app.translator.trans('core.admin.permissions_controls.members_button'),
|
|
icon: members ? 'check' : true,
|
|
onclick: function onclick() {
|
|
return _this2.save([Group.MEMBER_ID]);
|
|
}
|
|
}), Separator.component(), Button.component({
|
|
children: [GroupBadge.component({ group: adminGroup, label: null }), ' ', adminGroup.namePlural()],
|
|
icon: !everyone && !members ? 'check' : true,
|
|
disabled: !everyone && !members,
|
|
onclick: function onclick(e) {
|
|
if (e.shiftKey) e.stopPropagation();
|
|
_this2.save([]);
|
|
}
|
|
}));
|
|
|
|
[].push.apply(this.props.children, app.store.all('groups').filter(function (group) {
|
|
return [Group.ADMINISTRATOR_ID, Group.GUEST_ID, Group.MEMBER_ID].indexOf(group.id()) === -1;
|
|
}).map(function (group) {
|
|
return Button.component({
|
|
children: [GroupBadge.component({ group: group, label: null }), ' ', group.namePlural()],
|
|
icon: groupIds.indexOf(group.id()) !== -1 ? 'check' : true,
|
|
onclick: function onclick(e) {
|
|
if (e.shiftKey) e.stopPropagation();
|
|
_this2.toggle(group.id());
|
|
}
|
|
});
|
|
}));
|
|
|
|
return babelHelpers.get(Object.getPrototypeOf(PermissionDropdown.prototype), 'view', this).call(this);
|
|
}
|
|
}, {
|
|
key: 'save',
|
|
value: function save(groupIds) {
|
|
var permission = this.props.permission;
|
|
|
|
app.permissions[permission] = groupIds;
|
|
|
|
app.request({
|
|
method: 'POST',
|
|
url: app.forum.attribute('apiUrl') + '/permission',
|
|
data: { permission: permission, groupIds: groupIds }
|
|
});
|
|
}
|
|
}, {
|
|
key: 'toggle',
|
|
value: function toggle(groupId) {
|
|
var permission = this.props.permission;
|
|
|
|
var groupIds = app.permissions[permission] || [];
|
|
|
|
var index = groupIds.indexOf(groupId);
|
|
|
|
if (index !== -1) {
|
|
groupIds.splice(index, 1);
|
|
} else {
|
|
groupIds.push(groupId);
|
|
groupIds = groupIds.filter(function (id) {
|
|
return [Group.GUEST_ID, Group.MEMBER_ID].indexOf(id) === -1;
|
|
});
|
|
}
|
|
|
|
this.save(groupIds);
|
|
}
|
|
}], [{
|
|
key: 'initProps',
|
|
value: function initProps(props) {
|
|
babelHelpers.get(Object.getPrototypeOf(PermissionDropdown), 'initProps', this).call(this, props);
|
|
|
|
props.className = 'PermissionDropdown';
|
|
props.buttonClassName = 'Button Button--text';
|
|
}
|
|
}]);
|
|
return PermissionDropdown;
|
|
}(Dropdown);
|
|
|
|
_export('default', PermissionDropdown);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/PermissionGrid', ['flarum/Component', 'flarum/components/PermissionDropdown', 'flarum/components/SettingDropdown', 'flarum/components/Button', 'flarum/utils/ItemList', 'flarum/helpers/icon'], function (_export, _context) {
|
|
var Component, PermissionDropdown, SettingDropdown, Button, ItemList, icon, PermissionGrid;
|
|
return {
|
|
setters: [function (_flarumComponent) {
|
|
Component = _flarumComponent.default;
|
|
}, function (_flarumComponentsPermissionDropdown) {
|
|
PermissionDropdown = _flarumComponentsPermissionDropdown.default;
|
|
}, function (_flarumComponentsSettingDropdown) {
|
|
SettingDropdown = _flarumComponentsSettingDropdown.default;
|
|
}, function (_flarumComponentsButton) {
|
|
Button = _flarumComponentsButton.default;
|
|
}, function (_flarumUtilsItemList) {
|
|
ItemList = _flarumUtilsItemList.default;
|
|
}, function (_flarumHelpersIcon) {
|
|
icon = _flarumHelpersIcon.default;
|
|
}],
|
|
execute: function () {
|
|
PermissionGrid = function (_Component) {
|
|
babelHelpers.inherits(PermissionGrid, _Component);
|
|
|
|
function PermissionGrid() {
|
|
babelHelpers.classCallCheck(this, PermissionGrid);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(PermissionGrid).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(PermissionGrid, [{
|
|
key: 'init',
|
|
value: function init() {
|
|
this.permissions = this.permissionItems().toArray();
|
|
}
|
|
}, {
|
|
key: 'view',
|
|
value: function view() {
|
|
var scopes = this.scopeItems().toArray();
|
|
|
|
var permissionCells = function permissionCells(permission) {
|
|
return scopes.map(function (scope) {
|
|
return m(
|
|
'td',
|
|
null,
|
|
scope.render(permission)
|
|
);
|
|
});
|
|
};
|
|
|
|
return m(
|
|
'table',
|
|
{ className: 'PermissionGrid' },
|
|
m(
|
|
'thead',
|
|
null,
|
|
m(
|
|
'tr',
|
|
null,
|
|
m('td', null),
|
|
scopes.map(function (scope) {
|
|
return m(
|
|
'th',
|
|
null,
|
|
scope.label,
|
|
' ',
|
|
scope.onremove ? Button.component({ icon: 'times', className: 'Button Button--text PermissionGrid-removeScope', onclick: scope.onremove }) : ''
|
|
);
|
|
}),
|
|
m(
|
|
'th',
|
|
null,
|
|
this.scopeControlItems().toArray()
|
|
)
|
|
)
|
|
),
|
|
this.permissions.map(function (section) {
|
|
return m(
|
|
'tbody',
|
|
null,
|
|
m(
|
|
'tr',
|
|
{ className: 'PermissionGrid-section' },
|
|
m(
|
|
'th',
|
|
null,
|
|
section.label
|
|
),
|
|
permissionCells(section),
|
|
m('td', null)
|
|
),
|
|
section.children.map(function (child) {
|
|
return m(
|
|
'tr',
|
|
{ className: 'PermissionGrid-child' },
|
|
m(
|
|
'th',
|
|
null,
|
|
child.icon ? icon(child.icon) : '',
|
|
child.label
|
|
),
|
|
permissionCells(child),
|
|
m('td', null)
|
|
);
|
|
})
|
|
);
|
|
})
|
|
);
|
|
}
|
|
}, {
|
|
key: 'permissionItems',
|
|
value: function permissionItems() {
|
|
var items = new ItemList();
|
|
|
|
items.add('view', {
|
|
label: app.translator.trans('core.admin.permissions.read_heading'),
|
|
children: this.viewItems().toArray()
|
|
}, 100);
|
|
|
|
items.add('start', {
|
|
label: app.translator.trans('core.admin.permissions.create_heading'),
|
|
children: this.startItems().toArray()
|
|
}, 90);
|
|
|
|
items.add('reply', {
|
|
label: app.translator.trans('core.admin.permissions.participate_heading'),
|
|
children: this.replyItems().toArray()
|
|
}, 80);
|
|
|
|
items.add('moderate', {
|
|
label: app.translator.trans('core.admin.permissions.moderate_heading'),
|
|
children: this.moderateItems().toArray()
|
|
}, 70);
|
|
|
|
return items;
|
|
}
|
|
}, {
|
|
key: 'viewItems',
|
|
value: function viewItems() {
|
|
var items = new ItemList();
|
|
|
|
items.add('viewDiscussions', {
|
|
icon: 'eye',
|
|
label: app.translator.trans('core.admin.permissions.view_discussions_label'),
|
|
permission: 'viewDiscussions',
|
|
allowGuest: true
|
|
}, 100);
|
|
|
|
items.add('signUp', {
|
|
icon: 'user-plus',
|
|
label: app.translator.trans('core.admin.permissions.sign_up_label'),
|
|
setting: function setting() {
|
|
return SettingDropdown.component({
|
|
key: 'allow_sign_up',
|
|
options: [{ value: '1', label: app.translator.trans('core.admin.permissions_controls.signup_open_button') }, { value: '0', label: app.translator.trans('core.admin.permissions_controls.signup_closed_button') }]
|
|
});
|
|
}
|
|
}, 90);
|
|
|
|
return items;
|
|
}
|
|
}, {
|
|
key: 'startItems',
|
|
value: function startItems() {
|
|
var items = new ItemList();
|
|
|
|
items.add('start', {
|
|
icon: 'edit',
|
|
label: app.translator.trans('core.admin.permissions.start_discussions_label'),
|
|
permission: 'startDiscussion'
|
|
}, 100);
|
|
|
|
items.add('allowRenaming', {
|
|
icon: 'i-cursor',
|
|
label: app.translator.trans('core.admin.permissions.allow_renaming_label'),
|
|
setting: function setting() {
|
|
var minutes = parseInt(app.settings.allow_renaming, 10);
|
|
|
|
return SettingDropdown.component({
|
|
defaultLabel: minutes ? app.translator.transChoice('core.admin.permissions_controls.allow_some_minutes_button', minutes, { count: minutes }) : app.translator.trans('core.admin.permissions_controls.allow_indefinitely_button'),
|
|
key: 'allow_renaming',
|
|
options: [{ value: '-1', label: app.translator.trans('core.admin.permissions_controls.allow_indefinitely_button') }, { value: '10', label: app.translator.trans('core.admin.permissions_controls.allow_ten_minutes_button') }, { value: 'reply', label: app.translator.trans('core.admin.permissions_controls.allow_until_reply_button') }]
|
|
});
|
|
}
|
|
}, 90);
|
|
|
|
return items;
|
|
}
|
|
}, {
|
|
key: 'replyItems',
|
|
value: function replyItems() {
|
|
var items = new ItemList();
|
|
|
|
items.add('reply', {
|
|
icon: 'reply',
|
|
label: app.translator.trans('core.admin.permissions.reply_to_discussions_label'),
|
|
permission: 'discussion.reply'
|
|
}, 100);
|
|
|
|
items.add('allowPostEditing', {
|
|
icon: 'pencil',
|
|
label: app.translator.trans('core.admin.permissions.allow_post_editing_label'),
|
|
setting: function setting() {
|
|
var minutes = parseInt(app.settings.allow_post_editing, 10);
|
|
|
|
return SettingDropdown.component({
|
|
defaultLabel: minutes ? app.translator.transChoice('core.admin.permissions_controls.allow_some_minutes_button', minutes, { count: minutes }) : app.translator.trans('core.admin.permissions_controls.allow_indefinitely_button'),
|
|
key: 'allow_post_editing',
|
|
options: [{ value: '-1', label: app.translator.trans('core.admin.permissions_controls.allow_indefinitely_button') }, { value: '10', label: app.translator.trans('core.admin.permissions_controls.allow_ten_minutes_button') }, { value: 'reply', label: app.translator.trans('core.admin.permissions_controls.allow_until_reply_button') }]
|
|
});
|
|
}
|
|
}, 90);
|
|
|
|
return items;
|
|
}
|
|
}, {
|
|
key: 'moderateItems',
|
|
value: function moderateItems() {
|
|
var items = new ItemList();
|
|
|
|
items.add('renameDiscussions', {
|
|
icon: 'i-cursor',
|
|
label: app.translator.trans('core.admin.permissions.rename_discussions_label'),
|
|
permission: 'discussion.rename'
|
|
}, 100);
|
|
|
|
items.add('hideDiscussions', {
|
|
icon: 'trash-o',
|
|
label: app.translator.trans('core.admin.permissions.delete_discussions_label'),
|
|
permission: 'discussion.hide'
|
|
}, 90);
|
|
|
|
items.add('deleteDiscussions', {
|
|
icon: 'times',
|
|
label: app.translator.trans('core.admin.permissions.delete_discussions_forever_label'),
|
|
permission: 'discussion.delete'
|
|
}, 80);
|
|
|
|
items.add('editPosts', {
|
|
icon: 'pencil',
|
|
label: app.translator.trans('core.admin.permissions.edit_and_delete_posts_label'),
|
|
permission: 'discussion.editPosts'
|
|
}, 70);
|
|
|
|
items.add('deletePosts', {
|
|
icon: 'times',
|
|
label: app.translator.trans('core.admin.permissions.delete_posts_forever_label'),
|
|
permission: 'discussion.deletePosts'
|
|
}, 60);
|
|
|
|
return items;
|
|
}
|
|
}, {
|
|
key: 'scopeItems',
|
|
value: function scopeItems() {
|
|
var items = new ItemList();
|
|
|
|
items.add('global', {
|
|
label: app.translator.trans('core.admin.permissions.global_heading'),
|
|
render: function render(item) {
|
|
if (item.setting) {
|
|
return item.setting();
|
|
} else if (item.permission) {
|
|
return PermissionDropdown.component({
|
|
permission: item.permission,
|
|
allowGuest: item.allowGuest
|
|
});
|
|
}
|
|
|
|
return '';
|
|
}
|
|
}, 100);
|
|
|
|
return items;
|
|
}
|
|
}, {
|
|
key: 'scopeControlItems',
|
|
value: function scopeControlItems() {
|
|
return new ItemList();
|
|
}
|
|
}]);
|
|
return PermissionGrid;
|
|
}(Component);
|
|
|
|
_export('default', PermissionGrid);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/PermissionsPage', ['flarum/components/Page', 'flarum/components/GroupBadge', 'flarum/components/EditGroupModal', 'flarum/models/Group', 'flarum/helpers/icon', 'flarum/components/PermissionGrid'], function (_export, _context) {
|
|
var Page, GroupBadge, EditGroupModal, Group, icon, PermissionGrid, PermissionsPage;
|
|
return {
|
|
setters: [function (_flarumComponentsPage) {
|
|
Page = _flarumComponentsPage.default;
|
|
}, function (_flarumComponentsGroupBadge) {
|
|
GroupBadge = _flarumComponentsGroupBadge.default;
|
|
}, function (_flarumComponentsEditGroupModal) {
|
|
EditGroupModal = _flarumComponentsEditGroupModal.default;
|
|
}, function (_flarumModelsGroup) {
|
|
Group = _flarumModelsGroup.default;
|
|
}, function (_flarumHelpersIcon) {
|
|
icon = _flarumHelpersIcon.default;
|
|
}, function (_flarumComponentsPermissionGrid) {
|
|
PermissionGrid = _flarumComponentsPermissionGrid.default;
|
|
}],
|
|
execute: function () {
|
|
PermissionsPage = function (_Page) {
|
|
babelHelpers.inherits(PermissionsPage, _Page);
|
|
|
|
function PermissionsPage() {
|
|
babelHelpers.classCallCheck(this, PermissionsPage);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(PermissionsPage).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(PermissionsPage, [{
|
|
key: 'view',
|
|
value: function view() {
|
|
return m(
|
|
'div',
|
|
{ className: 'PermissionsPage' },
|
|
m(
|
|
'div',
|
|
{ className: 'PermissionsPage-groups' },
|
|
m(
|
|
'div',
|
|
{ className: 'container' },
|
|
app.store.all('groups').filter(function (group) {
|
|
return [Group.GUEST_ID, Group.MEMBER_ID].indexOf(group.id()) === -1;
|
|
}).map(function (group) {
|
|
return m(
|
|
'button',
|
|
{ className: 'Button Group', onclick: function onclick() {
|
|
return app.modal.show(new EditGroupModal({ group: group }));
|
|
} },
|
|
GroupBadge.component({
|
|
group: group,
|
|
className: 'Group-icon',
|
|
label: null
|
|
}),
|
|
m(
|
|
'span',
|
|
{ className: 'Group-name' },
|
|
group.namePlural()
|
|
)
|
|
);
|
|
}),
|
|
m(
|
|
'button',
|
|
{ className: 'Button Group Group--add', onclick: function onclick() {
|
|
return app.modal.show(new EditGroupModal());
|
|
} },
|
|
icon('plus', { className: 'Group-icon' }),
|
|
m(
|
|
'span',
|
|
{ className: 'Group-name' },
|
|
app.translator.trans('core.admin.permissions.new_group_button')
|
|
)
|
|
)
|
|
)
|
|
),
|
|
m(
|
|
'div',
|
|
{ className: 'PermissionsPage-permissions' },
|
|
m(
|
|
'div',
|
|
{ className: 'container' },
|
|
PermissionGrid.component()
|
|
)
|
|
)
|
|
);
|
|
}
|
|
}]);
|
|
return PermissionsPage;
|
|
}(Page);
|
|
|
|
_export('default', PermissionsPage);
|
|
}
|
|
};
|
|
});;
|
|
"use strict";
|
|
|
|
System.register("flarum/components/Placeholder", ["flarum/Component"], function (_export, _context) {
|
|
var Component, Placeholder;
|
|
return {
|
|
setters: [function (_flarumComponent) {
|
|
Component = _flarumComponent.default;
|
|
}],
|
|
execute: function () {
|
|
Placeholder = function (_Component) {
|
|
babelHelpers.inherits(Placeholder, _Component);
|
|
|
|
function Placeholder() {
|
|
babelHelpers.classCallCheck(this, Placeholder);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(Placeholder).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(Placeholder, [{
|
|
key: "view",
|
|
value: function view() {
|
|
return m(
|
|
"div",
|
|
{ className: "Placeholder" },
|
|
m(
|
|
"p",
|
|
null,
|
|
this.props.text
|
|
)
|
|
);
|
|
}
|
|
}]);
|
|
return Placeholder;
|
|
}(Component);
|
|
|
|
_export("default", Placeholder);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/RequestErrorModal', ['flarum/components/Modal'], function (_export, _context) {
|
|
var Modal, RequestErrorModal;
|
|
return {
|
|
setters: [function (_flarumComponentsModal) {
|
|
Modal = _flarumComponentsModal.default;
|
|
}],
|
|
execute: function () {
|
|
RequestErrorModal = function (_Modal) {
|
|
babelHelpers.inherits(RequestErrorModal, _Modal);
|
|
|
|
function RequestErrorModal() {
|
|
babelHelpers.classCallCheck(this, RequestErrorModal);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(RequestErrorModal).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(RequestErrorModal, [{
|
|
key: 'className',
|
|
value: function className() {
|
|
return 'RequestErrorModal Modal--large';
|
|
}
|
|
}, {
|
|
key: 'title',
|
|
value: function title() {
|
|
return this.props.error.xhr ? this.props.error.xhr.status + ' ' + this.props.error.xhr.statusText : '';
|
|
}
|
|
}, {
|
|
key: 'content',
|
|
value: function content() {
|
|
var responseText = void 0;
|
|
|
|
try {
|
|
responseText = JSON.stringify(JSON.parse(this.props.error.responseText), null, 2);
|
|
} catch (e) {
|
|
responseText = this.props.error.responseText;
|
|
}
|
|
|
|
return m(
|
|
'div',
|
|
{ className: 'Modal-body' },
|
|
m(
|
|
'pre',
|
|
null,
|
|
this.props.error.options.method,
|
|
' ',
|
|
this.props.error.options.url,
|
|
m('br', null),
|
|
m('br', null),
|
|
responseText
|
|
)
|
|
);
|
|
}
|
|
}]);
|
|
return RequestErrorModal;
|
|
}(Modal);
|
|
|
|
_export('default', RequestErrorModal);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/Select', ['flarum/Component', 'flarum/helpers/icon'], function (_export, _context) {
|
|
var Component, icon, Select;
|
|
return {
|
|
setters: [function (_flarumComponent) {
|
|
Component = _flarumComponent.default;
|
|
}, function (_flarumHelpersIcon) {
|
|
icon = _flarumHelpersIcon.default;
|
|
}],
|
|
execute: function () {
|
|
Select = function (_Component) {
|
|
babelHelpers.inherits(Select, _Component);
|
|
|
|
function Select() {
|
|
babelHelpers.classCallCheck(this, Select);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(Select).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(Select, [{
|
|
key: 'view',
|
|
value: function view() {
|
|
var _props = this.props;
|
|
var options = _props.options;
|
|
var onchange = _props.onchange;
|
|
var value = _props.value;
|
|
|
|
|
|
return m(
|
|
'span',
|
|
{ className: 'Select' },
|
|
m(
|
|
'select',
|
|
{ className: 'Select-input FormControl', onchange: onchange ? m.withAttr('value', onchange.bind(this)) : undefined, value: value },
|
|
Object.keys(options).map(function (key) {
|
|
return m(
|
|
'option',
|
|
{ value: key },
|
|
options[key]
|
|
);
|
|
})
|
|
),
|
|
icon('sort', { className: 'Select-caret' })
|
|
);
|
|
}
|
|
}]);
|
|
return Select;
|
|
}(Component);
|
|
|
|
_export('default', Select);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/SelectDropdown', ['flarum/components/Dropdown', 'flarum/helpers/icon'], function (_export, _context) {
|
|
var Dropdown, icon, SelectDropdown;
|
|
return {
|
|
setters: [function (_flarumComponentsDropdown) {
|
|
Dropdown = _flarumComponentsDropdown.default;
|
|
}, function (_flarumHelpersIcon) {
|
|
icon = _flarumHelpersIcon.default;
|
|
}],
|
|
execute: function () {
|
|
SelectDropdown = function (_Dropdown) {
|
|
babelHelpers.inherits(SelectDropdown, _Dropdown);
|
|
|
|
function SelectDropdown() {
|
|
babelHelpers.classCallCheck(this, SelectDropdown);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(SelectDropdown).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(SelectDropdown, [{
|
|
key: 'getButtonContent',
|
|
value: function getButtonContent() {
|
|
var activeChild = this.props.children.filter(function (child) {
|
|
return child.props.active;
|
|
})[0];
|
|
var label = activeChild && activeChild.props.children || this.props.defaultLabel;
|
|
|
|
if (label instanceof Array) label = label[0];
|
|
|
|
return [m(
|
|
'span',
|
|
{ className: 'Button-label' },
|
|
label
|
|
), icon(this.props.caretIcon, { className: 'Button-caret' })];
|
|
}
|
|
}], [{
|
|
key: 'initProps',
|
|
value: function initProps(props) {
|
|
props.caretIcon = typeof props.caretIcon !== 'undefined' ? props.caretIcon : 'sort';
|
|
|
|
babelHelpers.get(Object.getPrototypeOf(SelectDropdown), 'initProps', this).call(this, props);
|
|
|
|
props.className += ' Dropdown--select';
|
|
}
|
|
}]);
|
|
return SelectDropdown;
|
|
}(Dropdown);
|
|
|
|
_export('default', SelectDropdown);
|
|
}
|
|
};
|
|
});;
|
|
"use strict";
|
|
|
|
System.register("flarum/components/Separator", ["flarum/Component"], function (_export, _context) {
|
|
var Component, Separator;
|
|
return {
|
|
setters: [function (_flarumComponent) {
|
|
Component = _flarumComponent.default;
|
|
}],
|
|
execute: function () {
|
|
Separator = function (_Component) {
|
|
babelHelpers.inherits(Separator, _Component);
|
|
|
|
function Separator() {
|
|
babelHelpers.classCallCheck(this, Separator);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(Separator).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(Separator, [{
|
|
key: "view",
|
|
value: function view() {
|
|
return m("li", { className: "Dropdown-separator" });
|
|
}
|
|
}]);
|
|
return Separator;
|
|
}(Component);
|
|
|
|
Separator.isListItem = true;
|
|
|
|
_export("default", Separator);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/SessionDropdown', ['flarum/helpers/avatar', 'flarum/helpers/username', 'flarum/components/Dropdown', 'flarum/components/Button', 'flarum/utils/ItemList'], function (_export, _context) {
|
|
var avatar, username, Dropdown, Button, ItemList, SessionDropdown;
|
|
return {
|
|
setters: [function (_flarumHelpersAvatar) {
|
|
avatar = _flarumHelpersAvatar.default;
|
|
}, function (_flarumHelpersUsername) {
|
|
username = _flarumHelpersUsername.default;
|
|
}, function (_flarumComponentsDropdown) {
|
|
Dropdown = _flarumComponentsDropdown.default;
|
|
}, function (_flarumComponentsButton) {
|
|
Button = _flarumComponentsButton.default;
|
|
}, function (_flarumUtilsItemList) {
|
|
ItemList = _flarumUtilsItemList.default;
|
|
}],
|
|
execute: function () {
|
|
SessionDropdown = function (_Dropdown) {
|
|
babelHelpers.inherits(SessionDropdown, _Dropdown);
|
|
|
|
function SessionDropdown() {
|
|
babelHelpers.classCallCheck(this, SessionDropdown);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(SessionDropdown).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(SessionDropdown, [{
|
|
key: 'view',
|
|
value: function view() {
|
|
this.props.children = this.items().toArray();
|
|
|
|
return babelHelpers.get(Object.getPrototypeOf(SessionDropdown.prototype), 'view', this).call(this);
|
|
}
|
|
}, {
|
|
key: 'getButtonContent',
|
|
value: function getButtonContent() {
|
|
var user = app.session.user;
|
|
|
|
return [avatar(user), ' ', m(
|
|
'span',
|
|
{ className: 'Button-label' },
|
|
username(user)
|
|
)];
|
|
}
|
|
}, {
|
|
key: 'items',
|
|
value: function items() {
|
|
var items = new ItemList();
|
|
|
|
items.add('logOut', Button.component({
|
|
icon: 'sign-out',
|
|
children: app.translator.trans('core.admin.header.log_out_button'),
|
|
onclick: app.session.logout.bind(app.session)
|
|
}), -100);
|
|
|
|
return items;
|
|
}
|
|
}], [{
|
|
key: 'initProps',
|
|
value: function initProps(props) {
|
|
babelHelpers.get(Object.getPrototypeOf(SessionDropdown), 'initProps', this).call(this, props);
|
|
|
|
props.className = 'SessionDropdown';
|
|
props.buttonClassName = 'Button Button--user Button--flat';
|
|
props.menuClassName = 'Dropdown-menu--right';
|
|
}
|
|
}]);
|
|
return SessionDropdown;
|
|
}(Dropdown);
|
|
|
|
_export('default', SessionDropdown);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/SettingDropdown', ['flarum/components/SelectDropdown', 'flarum/components/Button', 'flarum/utils/saveSettings'], function (_export, _context) {
|
|
var SelectDropdown, Button, saveSettings, SettingDropdown;
|
|
return {
|
|
setters: [function (_flarumComponentsSelectDropdown) {
|
|
SelectDropdown = _flarumComponentsSelectDropdown.default;
|
|
}, function (_flarumComponentsButton) {
|
|
Button = _flarumComponentsButton.default;
|
|
}, function (_flarumUtilsSaveSettings) {
|
|
saveSettings = _flarumUtilsSaveSettings.default;
|
|
}],
|
|
execute: function () {
|
|
SettingDropdown = function (_SelectDropdown) {
|
|
babelHelpers.inherits(SettingDropdown, _SelectDropdown);
|
|
|
|
function SettingDropdown() {
|
|
babelHelpers.classCallCheck(this, SettingDropdown);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(SettingDropdown).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(SettingDropdown, null, [{
|
|
key: 'initProps',
|
|
value: function initProps(props) {
|
|
var _this2 = this;
|
|
|
|
babelHelpers.get(Object.getPrototypeOf(SettingDropdown), 'initProps', this).call(this, props);
|
|
|
|
props.className = 'SettingDropdown';
|
|
props.buttonClassName = 'Button Button--text';
|
|
props.caretIcon = 'caret-down';
|
|
props.defaultLabel = 'Custom';
|
|
|
|
props.children = props.options.map(function (_ref) {
|
|
var value = _ref.value;
|
|
var label = _ref.label;
|
|
|
|
var active = app.settings[props.key] === value;
|
|
|
|
return Button.component({
|
|
children: label,
|
|
icon: active ? 'check' : true,
|
|
onclick: saveSettings.bind(_this2, babelHelpers.defineProperty({}, props.key, value)),
|
|
active: active
|
|
});
|
|
});
|
|
}
|
|
}]);
|
|
return SettingDropdown;
|
|
}(SelectDropdown);
|
|
|
|
_export('default', SettingDropdown);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/SettingsModal', ['flarum/components/Modal', 'flarum/components/Button', 'flarum/utils/saveSettings'], function (_export, _context) {
|
|
var Modal, Button, saveSettings, SettingsModal;
|
|
return {
|
|
setters: [function (_flarumComponentsModal) {
|
|
Modal = _flarumComponentsModal.default;
|
|
}, function (_flarumComponentsButton) {
|
|
Button = _flarumComponentsButton.default;
|
|
}, function (_flarumUtilsSaveSettings) {
|
|
saveSettings = _flarumUtilsSaveSettings.default;
|
|
}],
|
|
execute: function () {
|
|
SettingsModal = function (_Modal) {
|
|
babelHelpers.inherits(SettingsModal, _Modal);
|
|
|
|
function SettingsModal() {
|
|
babelHelpers.classCallCheck(this, SettingsModal);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(SettingsModal).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(SettingsModal, [{
|
|
key: 'init',
|
|
value: function init() {
|
|
this.settings = {};
|
|
this.loading = false;
|
|
}
|
|
}, {
|
|
key: 'form',
|
|
value: function form() {
|
|
return '';
|
|
}
|
|
}, {
|
|
key: 'content',
|
|
value: function content() {
|
|
return m(
|
|
'div',
|
|
{ className: 'Modal-body' },
|
|
m(
|
|
'div',
|
|
{ className: 'Form' },
|
|
this.form(),
|
|
m(
|
|
'div',
|
|
{ className: 'Form-group' },
|
|
this.submitButton()
|
|
)
|
|
)
|
|
);
|
|
}
|
|
}, {
|
|
key: 'submitButton',
|
|
value: function submitButton() {
|
|
return m(
|
|
Button,
|
|
{
|
|
type: 'submit',
|
|
className: 'Button Button--primary',
|
|
loading: this.loading,
|
|
disabled: !this.changed() },
|
|
app.translator.trans('core.admin.settings.submit_button')
|
|
);
|
|
}
|
|
}, {
|
|
key: 'setting',
|
|
value: function setting(key) {
|
|
var fallback = arguments.length <= 1 || arguments[1] === undefined ? '' : arguments[1];
|
|
|
|
this.settings[key] = this.settings[key] || m.prop(app.settings[key] || fallback);
|
|
|
|
return this.settings[key];
|
|
}
|
|
}, {
|
|
key: 'dirty',
|
|
value: function dirty() {
|
|
var _this2 = this;
|
|
|
|
var dirty = {};
|
|
|
|
Object.keys(this.settings).forEach(function (key) {
|
|
var value = _this2.settings[key]();
|
|
|
|
if (value !== app.settings[key]) {
|
|
dirty[key] = value;
|
|
}
|
|
});
|
|
|
|
return dirty;
|
|
}
|
|
}, {
|
|
key: 'changed',
|
|
value: function changed() {
|
|
return Object.keys(this.dirty()).length;
|
|
}
|
|
}, {
|
|
key: 'onsubmit',
|
|
value: function onsubmit(e) {
|
|
e.preventDefault();
|
|
|
|
this.loading = true;
|
|
|
|
saveSettings(this.dirty()).then(this.hide.bind(this), this.loaded.bind(this));
|
|
}
|
|
}]);
|
|
return SettingsModal;
|
|
}(Modal);
|
|
|
|
_export('default', SettingsModal);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/SplitDropdown', ['flarum/components/Dropdown', 'flarum/components/Button', 'flarum/helpers/icon'], function (_export, _context) {
|
|
var Dropdown, Button, icon, SplitDropdown;
|
|
return {
|
|
setters: [function (_flarumComponentsDropdown) {
|
|
Dropdown = _flarumComponentsDropdown.default;
|
|
}, function (_flarumComponentsButton) {
|
|
Button = _flarumComponentsButton.default;
|
|
}, function (_flarumHelpersIcon) {
|
|
icon = _flarumHelpersIcon.default;
|
|
}],
|
|
execute: function () {
|
|
SplitDropdown = function (_Dropdown) {
|
|
babelHelpers.inherits(SplitDropdown, _Dropdown);
|
|
|
|
function SplitDropdown() {
|
|
babelHelpers.classCallCheck(this, SplitDropdown);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(SplitDropdown).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(SplitDropdown, [{
|
|
key: 'getButton',
|
|
value: function getButton() {
|
|
// Make a copy of the props of the first child component. We will assign
|
|
// these props to a new button, so that it has exactly the same behaviour as
|
|
// the first child.
|
|
var firstChild = this.getFirstChild();
|
|
var buttonProps = babelHelpers.extends({}, firstChild.props);
|
|
buttonProps.className = (buttonProps.className || '') + ' SplitDropdown-button Button ' + this.props.buttonClassName;
|
|
|
|
return [Button.component(buttonProps), m(
|
|
'button',
|
|
{
|
|
className: 'Dropdown-toggle Button Button--icon ' + this.props.buttonClassName,
|
|
'data-toggle': 'dropdown' },
|
|
icon(this.props.icon, { className: 'Button-icon' }),
|
|
icon('caret-down', { className: 'Button-caret' })
|
|
)];
|
|
}
|
|
}, {
|
|
key: 'getFirstChild',
|
|
value: function getFirstChild() {
|
|
var firstChild = this.props.children;
|
|
|
|
while (firstChild instanceof Array) {
|
|
firstChild = firstChild[0];
|
|
}return firstChild;
|
|
}
|
|
}], [{
|
|
key: 'initProps',
|
|
value: function initProps(props) {
|
|
babelHelpers.get(Object.getPrototypeOf(SplitDropdown), 'initProps', this).call(this, props);
|
|
|
|
props.className += ' Dropdown--split';
|
|
props.menuClassName += ' Dropdown-menu--right';
|
|
}
|
|
}]);
|
|
return SplitDropdown;
|
|
}(Dropdown);
|
|
|
|
_export('default', SplitDropdown);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/components/Switch', ['flarum/components/Checkbox'], function (_export, _context) {
|
|
var Checkbox, Switch;
|
|
return {
|
|
setters: [function (_flarumComponentsCheckbox) {
|
|
Checkbox = _flarumComponentsCheckbox.default;
|
|
}],
|
|
execute: function () {
|
|
Switch = function (_Checkbox) {
|
|
babelHelpers.inherits(Switch, _Checkbox);
|
|
|
|
function Switch() {
|
|
babelHelpers.classCallCheck(this, Switch);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(Switch).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(Switch, [{
|
|
key: 'getDisplay',
|
|
value: function getDisplay() {
|
|
return this.loading ? babelHelpers.get(Object.getPrototypeOf(Switch.prototype), 'getDisplay', this).call(this) : '';
|
|
}
|
|
}], [{
|
|
key: 'initProps',
|
|
value: function initProps(props) {
|
|
babelHelpers.get(Object.getPrototypeOf(Switch), 'initProps', this).call(this, props);
|
|
|
|
props.className = (props.className || '') + ' Checkbox--switch';
|
|
}
|
|
}]);
|
|
return Switch;
|
|
}(Checkbox);
|
|
|
|
_export('default', Switch);
|
|
}
|
|
};
|
|
});;
|
|
"use strict";
|
|
|
|
System.register("flarum/extend", [], function (_export, _context) {
|
|
return {
|
|
setters: [],
|
|
execute: function () {
|
|
/**
|
|
* Extend an object's method by running its output through a mutating callback
|
|
* every time it is called.
|
|
*
|
|
* The callback accepts the method's return value and should perform any
|
|
* mutations directly on this value. For this reason, this function will not be
|
|
* effective on methods which return scalar values (numbers, strings, booleans).
|
|
*
|
|
* Care should be taken to extend the correct object – in most cases, a class'
|
|
* prototype will be the desired target of extension, not the class itself.
|
|
*
|
|
* @example
|
|
* extend(Discussion.prototype, 'badges', function(badges) {
|
|
* // do something with `badges`
|
|
* });
|
|
*
|
|
* @param {Object} object The object that owns the method
|
|
* @param {String} method The name of the method to extend
|
|
* @param {function} callback A callback which mutates the method's output
|
|
*/
|
|
function extend(object, method, callback) {
|
|
var original = object[method];
|
|
|
|
object[method] = function () {
|
|
for (var _len = arguments.length, args = Array(_len), _key = 0; _key < _len; _key++) {
|
|
args[_key] = arguments[_key];
|
|
}
|
|
|
|
var value = original ? original.apply(this, args) : undefined;
|
|
|
|
callback.apply(this, [value].concat(args));
|
|
|
|
return value;
|
|
};
|
|
|
|
babelHelpers.extends(object[method], original);
|
|
}
|
|
|
|
/**
|
|
* Override an object's method by replacing it with a new function, so that the
|
|
* new function will be run every time the object's method is called.
|
|
*
|
|
* The replacement function accepts the original method as its first argument,
|
|
* which is like a call to 'super'. Any arguments passed to the original method
|
|
* are also passed to the replacement.
|
|
*
|
|
* Care should be taken to extend the correct object – in most cases, a class'
|
|
* prototype will be the desired target of extension, not the class itself.
|
|
*
|
|
* @example
|
|
* override(Discussion.prototype, 'badges', function(original) {
|
|
* const badges = original();
|
|
* // do something with badges
|
|
* return badges;
|
|
* });
|
|
*
|
|
* @param {Object} object The object that owns the method
|
|
* @param {String} method The name of the method to override
|
|
* @param {function} newMethod The method to replace it with
|
|
*/
|
|
|
|
_export("extend", extend);
|
|
|
|
function override(object, method, newMethod) {
|
|
var original = object[method];
|
|
|
|
object[method] = function () {
|
|
for (var _len2 = arguments.length, args = Array(_len2), _key2 = 0; _key2 < _len2; _key2++) {
|
|
args[_key2] = arguments[_key2];
|
|
}
|
|
|
|
return newMethod.apply(this, [original.bind(this)].concat(args));
|
|
};
|
|
|
|
babelHelpers.extends(object[method], original);
|
|
}
|
|
|
|
_export("override", override);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/helpers/avatar', [], function (_export, _context) {
|
|
function avatar(user) {
|
|
var attrs = arguments.length <= 1 || arguments[1] === undefined ? {} : arguments[1];
|
|
|
|
attrs.className = 'Avatar ' + (attrs.className || '');
|
|
var content = '';
|
|
|
|
// If the `title` attribute is set to null or false, we don't want to give the
|
|
// avatar a title. On the other hand, if it hasn't been given at all, we can
|
|
// safely default it to the user's username.
|
|
var hasTitle = attrs.title === 'undefined' || attrs.title;
|
|
if (!hasTitle) delete attrs.title;
|
|
|
|
// If a user has been passed, then we will set up an avatar using their
|
|
// uploaded image, or the first letter of their username if they haven't
|
|
// uploaded one.
|
|
if (user) {
|
|
var username = user.username() || '?';
|
|
var avatarUrl = user.avatarUrl();
|
|
|
|
if (hasTitle) attrs.title = attrs.title || username;
|
|
|
|
if (avatarUrl) {
|
|
return m('img', babelHelpers.extends({}, attrs, { src: avatarUrl }));
|
|
}
|
|
|
|
content = username.charAt(0).toUpperCase();
|
|
attrs.style = { background: user.color() };
|
|
}
|
|
|
|
return m(
|
|
'span',
|
|
attrs,
|
|
content
|
|
);
|
|
}
|
|
|
|
_export('default', avatar);
|
|
|
|
return {
|
|
setters: [],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/helpers/fullTime', [], function (_export, _context) {
|
|
function fullTime(time) {
|
|
var mo = moment(time);
|
|
|
|
var datetime = mo.format();
|
|
var full = mo.format('LLLL');
|
|
|
|
return m(
|
|
'time',
|
|
{ pubdate: true, datetime: datetime },
|
|
full
|
|
);
|
|
}
|
|
|
|
_export('default', fullTime);
|
|
|
|
return {
|
|
setters: [],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/helpers/highlight', ['flarum/utils/string'], function (_export, _context) {
|
|
var truncate;
|
|
function highlight(string, phrase, length) {
|
|
if (!phrase && !length) return string;
|
|
|
|
// Convert the word phrase into a global regular expression (if it isn't
|
|
// already) so we can search the string for matched.
|
|
var regexp = phrase instanceof RegExp ? phrase : new RegExp(phrase, 'gi');
|
|
|
|
var highlighted = string;
|
|
var start = 0;
|
|
|
|
// If a length was given, the truncate the string surrounding the first match.
|
|
if (length) {
|
|
if (phrase) start = Math.max(0, string.search(regexp) - length / 2);
|
|
|
|
highlighted = truncate(highlighted, length, start);
|
|
}
|
|
|
|
// Convert the string into HTML entities, then highlight all matches with
|
|
// <mark> tags. Then we will return the result as a trusted HTML string.
|
|
highlighted = $('<div/>').text(highlighted).html();
|
|
|
|
if (phrase) highlighted = highlighted.replace(regexp, '<mark>$&</mark>');
|
|
|
|
return m.trust(highlighted);
|
|
}
|
|
|
|
_export('default', highlight);
|
|
|
|
return {
|
|
setters: [function (_flarumUtilsString) {
|
|
truncate = _flarumUtilsString.truncate;
|
|
}],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/helpers/humanTime', ['flarum/utils/humanTime'], function (_export, _context) {
|
|
var humanTimeUtil;
|
|
function humanTime(time) {
|
|
var mo = moment(time);
|
|
|
|
var datetime = mo.format();
|
|
var full = mo.format('LLLL');
|
|
var ago = humanTimeUtil(time);
|
|
|
|
return m(
|
|
'time',
|
|
{ pubdate: true, datetime: datetime, title: full, 'data-humantime': true },
|
|
ago
|
|
);
|
|
}
|
|
|
|
_export('default', humanTime);
|
|
|
|
return {
|
|
setters: [function (_flarumUtilsHumanTime) {
|
|
humanTimeUtil = _flarumUtilsHumanTime.default;
|
|
}],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/helpers/icon', [], function (_export, _context) {
|
|
function icon(name) {
|
|
var attrs = arguments.length <= 1 || arguments[1] === undefined ? {} : arguments[1];
|
|
|
|
attrs.className = 'icon fa fa-fw fa-' + name + ' ' + (attrs.className || '');
|
|
|
|
return m('i', attrs);
|
|
}
|
|
|
|
_export('default', icon);
|
|
|
|
return {
|
|
setters: [],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/helpers/listItems', ['flarum/components/Separator', 'flarum/utils/classList'], function (_export, _context) {
|
|
var Separator, classList;
|
|
|
|
|
|
function isSeparator(item) {
|
|
return item && item.component === Separator;
|
|
}
|
|
|
|
function withoutUnnecessarySeparators(items) {
|
|
var newItems = [];
|
|
var prevItem = void 0;
|
|
|
|
items.forEach(function (item, i) {
|
|
if (!isSeparator(item) || prevItem && !isSeparator(prevItem) && i !== items.length - 1) {
|
|
prevItem = item;
|
|
newItems.push(item);
|
|
}
|
|
});
|
|
|
|
return newItems;
|
|
}
|
|
|
|
/**
|
|
* The `listItems` helper wraps a collection of components in <li> tags,
|
|
* stripping out any unnecessary `Separator` components.
|
|
*
|
|
* @param {*} items
|
|
* @return {Array}
|
|
*/
|
|
function listItems(items) {
|
|
if (!(items instanceof Array)) items = [items];
|
|
|
|
return withoutUnnecessarySeparators(items).map(function (item) {
|
|
var isListItem = item.component && item.component.isListItem;
|
|
var active = item.component && item.component.isActive && item.component.isActive(item.props);
|
|
var className = item.props ? item.props.itemClassName : item.itemClassName;
|
|
|
|
if (isListItem) {
|
|
item.attrs = item.attrs || {};
|
|
item.attrs.key = item.attrs.key || item.itemName;
|
|
}
|
|
|
|
var space = new String(' ');
|
|
space.attrs = { key: '_space_' + item.itemName };
|
|
|
|
return [isListItem ? item : m(
|
|
'li',
|
|
{ className: classList([item.itemName ? 'item-' + item.itemName : '', className, active ? 'active' : '']),
|
|
key: item.itemName },
|
|
item
|
|
), space];
|
|
});
|
|
}
|
|
|
|
_export('default', listItems);
|
|
|
|
return {
|
|
setters: [function (_flarumComponentsSeparator) {
|
|
Separator = _flarumComponentsSeparator.default;
|
|
}, function (_flarumUtilsClassList) {
|
|
classList = _flarumUtilsClassList.default;
|
|
}],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/helpers/punctuateSeries', [], function (_export, _context) {
|
|
function punctuateSeries(items) {
|
|
if (items.length === 2) {
|
|
return app.translator.trans('core.lib.series.two_text', {
|
|
first: items[0],
|
|
second: items[1]
|
|
});
|
|
} else if (items.length >= 3) {
|
|
// If there are three or more items, we will join all but the first and
|
|
// last items with the equivalent of a comma, and then we will feed that
|
|
// into the translator along with the first and last item.
|
|
var second = items.slice(1, items.length - 1).reduce(function (list, item) {
|
|
return list.concat([item, app.translator.trans('core.lib.series.glue_text')]);
|
|
}, []).slice(0, -1);
|
|
|
|
return app.translator.trans('core.lib.series.three_text', {
|
|
first: items[0],
|
|
second: second,
|
|
third: items[items.length - 1]
|
|
});
|
|
}
|
|
|
|
return items;
|
|
}
|
|
|
|
_export('default', punctuateSeries);
|
|
|
|
return {
|
|
setters: [],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
"use strict";
|
|
|
|
System.register("flarum/helpers/username", [], function (_export, _context) {
|
|
function username(user) {
|
|
var name = user && user.username() || app.translator.trans('core.lib.username.deleted_text');
|
|
|
|
return m(
|
|
"span",
|
|
{ className: "username" },
|
|
name
|
|
);
|
|
}
|
|
|
|
_export("default", username);
|
|
|
|
return {
|
|
setters: [],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/helpers/userOnline', ['flarum/helpers/icon'], function (_export, _context) {
|
|
var icon;
|
|
function userOnline(user) {
|
|
if (user.lastSeenTime() && user.isOnline()) {
|
|
return m(
|
|
'span',
|
|
{ className: 'UserOnline' },
|
|
icon('circle')
|
|
);
|
|
}
|
|
}
|
|
|
|
_export('default', userOnline);
|
|
|
|
return {
|
|
setters: [function (_flarumHelpersIcon) {
|
|
icon = _flarumHelpersIcon.default;
|
|
}],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/initializers/boot', ['flarum/utils/ScrollListener', 'flarum/utils/Drawer', 'flarum/utils/mapRoutes', 'flarum/components/Navigation', 'flarum/components/HeaderPrimary', 'flarum/components/HeaderSecondary', 'flarum/components/AdminNav', 'flarum/components/ModalManager', 'flarum/components/AlertManager'], function (_export, _context) {
|
|
var ScrollListener, Drawer, mapRoutes, Navigation, HeaderPrimary, HeaderSecondary, AdminNav, ModalManager, AlertManager;
|
|
function boot(app) {
|
|
m.startComputation();
|
|
|
|
m.mount(document.getElementById('app-navigation'), Navigation.component({ className: 'App-backControl', drawer: true }));
|
|
m.mount(document.getElementById('header-navigation'), Navigation.component());
|
|
m.mount(document.getElementById('header-primary'), HeaderPrimary.component());
|
|
m.mount(document.getElementById('header-secondary'), HeaderSecondary.component());
|
|
m.mount(document.getElementById('admin-navigation'), AdminNav.component());
|
|
|
|
app.drawer = new Drawer();
|
|
app.modal = m.mount(document.getElementById('modal'), ModalManager.component());
|
|
app.alerts = m.mount(document.getElementById('alerts'), AlertManager.component());
|
|
app.history = {
|
|
canGoBack: function canGoBack() {
|
|
return true;
|
|
},
|
|
getPrevious: function getPrevious() {},
|
|
backUrl: function backUrl() {
|
|
return app.forum.attribute('baseUrl');
|
|
},
|
|
back: function back() {
|
|
window.location = this.backUrl();
|
|
}
|
|
};
|
|
|
|
m.route.mode = 'hash';
|
|
m.route(document.getElementById('content'), '/', mapRoutes(app.routes));
|
|
|
|
m.endComputation();
|
|
|
|
// Add a class to the body which indicates that the page has been scrolled
|
|
// down.
|
|
new ScrollListener(function (top) {
|
|
var $app = $('#app');
|
|
var offset = $app.offset().top;
|
|
|
|
$app.toggleClass('affix', top >= offset).toggleClass('scrolled', top > offset);
|
|
}).start();
|
|
|
|
app.booted = true;
|
|
|
|
// If an extension has just been enabled, then we will run its settings
|
|
// callback.
|
|
var enabled = localStorage.getItem('enabledExtension');
|
|
if (enabled && app.extensionSettings[enabled]) {
|
|
app.extensionSettings[enabled]();
|
|
localStorage.removeItem('enabledExtension');
|
|
}
|
|
}
|
|
|
|
_export('default', boot);
|
|
|
|
return {
|
|
setters: [function (_flarumUtilsScrollListener) {
|
|
ScrollListener = _flarumUtilsScrollListener.default;
|
|
}, function (_flarumUtilsDrawer) {
|
|
Drawer = _flarumUtilsDrawer.default;
|
|
}, function (_flarumUtilsMapRoutes) {
|
|
mapRoutes = _flarumUtilsMapRoutes.default;
|
|
}, function (_flarumComponentsNavigation) {
|
|
Navigation = _flarumComponentsNavigation.default;
|
|
}, function (_flarumComponentsHeaderPrimary) {
|
|
HeaderPrimary = _flarumComponentsHeaderPrimary.default;
|
|
}, function (_flarumComponentsHeaderSecondary) {
|
|
HeaderSecondary = _flarumComponentsHeaderSecondary.default;
|
|
}, function (_flarumComponentsAdminNav) {
|
|
AdminNav = _flarumComponentsAdminNav.default;
|
|
}, function (_flarumComponentsModalManager) {
|
|
ModalManager = _flarumComponentsModalManager.default;
|
|
}, function (_flarumComponentsAlertManager) {
|
|
AlertManager = _flarumComponentsAlertManager.default;
|
|
}],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/initializers/humanTime', ['flarum/utils/humanTime'], function (_export, _context) {
|
|
var humanTimeUtil;
|
|
|
|
|
|
function updateHumanTimes() {
|
|
$('[data-humantime]').each(function () {
|
|
var $this = $(this);
|
|
var ago = humanTimeUtil($this.attr('datetime'));
|
|
|
|
$this.html(ago);
|
|
});
|
|
}
|
|
|
|
/**
|
|
* The `humanTime` initializer sets up a loop every 1 second to update
|
|
* timestamps rendered with the `humanTime` helper.
|
|
*/
|
|
function humanTime() {
|
|
setInterval(updateHumanTimes, 10000);
|
|
}
|
|
|
|
_export('default', humanTime);
|
|
|
|
return {
|
|
setters: [function (_flarumUtilsHumanTime) {
|
|
humanTimeUtil = _flarumUtilsHumanTime.default;
|
|
}],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/initializers/preload', ['flarum/Session'], function (_export, _context) {
|
|
var Session;
|
|
function preload(app) {
|
|
app.store.pushPayload({ data: app.preload.data });
|
|
|
|
app.forum = app.store.getById('forums', 1);
|
|
|
|
app.session = new Session(app.store.getById('users', app.preload.session.userId), app.preload.session.csrfToken);
|
|
}
|
|
|
|
_export('default', preload);
|
|
|
|
return {
|
|
setters: [function (_flarumSession) {
|
|
Session = _flarumSession.default;
|
|
}],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/initializers/routes', ['flarum/components/DashboardPage', 'flarum/components/BasicsPage', 'flarum/components/PermissionsPage', 'flarum/components/AppearancePage', 'flarum/components/ExtensionsPage', 'flarum/components/MailPage'], function (_export, _context) {
|
|
var DashboardPage, BasicsPage, PermissionsPage, AppearancePage, ExtensionsPage, MailPage;
|
|
|
|
_export('default', function (app) {
|
|
app.routes = {
|
|
'dashboard': { path: '/', component: DashboardPage.component() },
|
|
'basics': { path: '/basics', component: BasicsPage.component() },
|
|
'permissions': { path: '/permissions', component: PermissionsPage.component() },
|
|
'appearance': { path: '/appearance', component: AppearancePage.component() },
|
|
'extensions': { path: '/extensions', component: ExtensionsPage.component() },
|
|
'mail': { path: '/mail', component: MailPage.component() }
|
|
};
|
|
});
|
|
|
|
return {
|
|
setters: [function (_flarumComponentsDashboardPage) {
|
|
DashboardPage = _flarumComponentsDashboardPage.default;
|
|
}, function (_flarumComponentsBasicsPage) {
|
|
BasicsPage = _flarumComponentsBasicsPage.default;
|
|
}, function (_flarumComponentsPermissionsPage) {
|
|
PermissionsPage = _flarumComponentsPermissionsPage.default;
|
|
}, function (_flarumComponentsAppearancePage) {
|
|
AppearancePage = _flarumComponentsAppearancePage.default;
|
|
}, function (_flarumComponentsExtensionsPage) {
|
|
ExtensionsPage = _flarumComponentsExtensionsPage.default;
|
|
}, function (_flarumComponentsMailPage) {
|
|
MailPage = _flarumComponentsMailPage.default;
|
|
}],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/initializers/store', ['flarum/Store', 'flarum/models/Forum', 'flarum/models/User', 'flarum/models/Discussion', 'flarum/models/Post', 'flarum/models/Group', 'flarum/models/Activity', 'flarum/models/Notification'], function (_export, _context) {
|
|
var Store, Forum, User, Discussion, Post, Group, Activity, Notification;
|
|
function store(app) {
|
|
app.store = new Store({
|
|
forums: Forum,
|
|
users: User,
|
|
discussions: Discussion,
|
|
posts: Post,
|
|
groups: Group,
|
|
activity: Activity,
|
|
notifications: Notification
|
|
});
|
|
}
|
|
|
|
_export('default', store);
|
|
|
|
return {
|
|
setters: [function (_flarumStore) {
|
|
Store = _flarumStore.default;
|
|
}, function (_flarumModelsForum) {
|
|
Forum = _flarumModelsForum.default;
|
|
}, function (_flarumModelsUser) {
|
|
User = _flarumModelsUser.default;
|
|
}, function (_flarumModelsDiscussion) {
|
|
Discussion = _flarumModelsDiscussion.default;
|
|
}, function (_flarumModelsPost) {
|
|
Post = _flarumModelsPost.default;
|
|
}, function (_flarumModelsGroup) {
|
|
Group = _flarumModelsGroup.default;
|
|
}, function (_flarumModelsActivity) {
|
|
Activity = _flarumModelsActivity.default;
|
|
}, function (_flarumModelsNotification) {
|
|
Notification = _flarumModelsNotification.default;
|
|
}],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/Model', [], function (_export, _context) {
|
|
var Model;
|
|
return {
|
|
setters: [],
|
|
execute: function () {
|
|
Model = function () {
|
|
/**
|
|
* @param {Object} data A resource object from the API.
|
|
* @param {Store} store The data store that this model should be persisted to.
|
|
* @public
|
|
*/
|
|
|
|
function Model() {
|
|
var data = arguments.length <= 0 || arguments[0] === undefined ? {} : arguments[0];
|
|
var store = arguments.length <= 1 || arguments[1] === undefined ? null : arguments[1];
|
|
babelHelpers.classCallCheck(this, Model);
|
|
|
|
/**
|
|
* The resource object from the API.
|
|
*
|
|
* @type {Object}
|
|
* @public
|
|
*/
|
|
this.data = data;
|
|
|
|
/**
|
|
* The time at which the model's data was last updated. Watching the value
|
|
* of this property is a fast way to retain/cache a subtree if data hasn't
|
|
* changed.
|
|
*
|
|
* @type {Date}
|
|
* @public
|
|
*/
|
|
this.freshness = new Date();
|
|
|
|
/**
|
|
* Whether or not the resource exists on the server.
|
|
*
|
|
* @type {Boolean}
|
|
* @public
|
|
*/
|
|
this.exists = false;
|
|
|
|
/**
|
|
* The data store that this resource should be persisted to.
|
|
*
|
|
* @type {Store}
|
|
* @protected
|
|
*/
|
|
this.store = store;
|
|
}
|
|
|
|
/**
|
|
* Get the model's ID.
|
|
*
|
|
* @return {Integer}
|
|
* @public
|
|
* @final
|
|
*/
|
|
|
|
|
|
babelHelpers.createClass(Model, [{
|
|
key: 'id',
|
|
value: function id() {
|
|
return this.data.id;
|
|
}
|
|
}, {
|
|
key: 'attribute',
|
|
value: function attribute(_attribute) {
|
|
return this.data.attributes[_attribute];
|
|
}
|
|
}, {
|
|
key: 'pushData',
|
|
value: function pushData(data) {
|
|
// Since most of the top-level items in a resource object are objects
|
|
// (e.g. relationships, attributes), we'll need to check and perform the
|
|
// merge at the second level if that's the case.
|
|
for (var key in data) {
|
|
if (babelHelpers.typeof(data[key]) === 'object') {
|
|
this.data[key] = this.data[key] || {};
|
|
|
|
// For every item in a second-level object, we want to check if we've
|
|
// been handed a Model instance. If so, we will convert it to a
|
|
// relationship data object.
|
|
for (var innerKey in data[key]) {
|
|
if (data[key][innerKey] instanceof Model) {
|
|
data[key][innerKey] = { data: Model.getIdentifier(data[key][innerKey]) };
|
|
}
|
|
this.data[key][innerKey] = data[key][innerKey];
|
|
}
|
|
} else {
|
|
this.data[key] = data[key];
|
|
}
|
|
}
|
|
|
|
// Now that we've updated the data, we can say that the model is fresh.
|
|
// This is an easy way to invalidate retained subtrees etc.
|
|
this.freshness = new Date();
|
|
}
|
|
}, {
|
|
key: 'pushAttributes',
|
|
value: function pushAttributes(attributes) {
|
|
this.pushData({ attributes: attributes });
|
|
}
|
|
}, {
|
|
key: 'save',
|
|
value: function save(attributes) {
|
|
var _this = this;
|
|
|
|
var options = arguments.length <= 1 || arguments[1] === undefined ? {} : arguments[1];
|
|
|
|
var data = {
|
|
type: this.data.type,
|
|
id: this.data.id,
|
|
attributes: attributes
|
|
};
|
|
|
|
// If a 'relationships' key exists, extract it from the attributes hash and
|
|
// set it on the top-level data object instead. We will be sending this data
|
|
// object to the API for persistence.
|
|
if (attributes.relationships) {
|
|
data.relationships = {};
|
|
|
|
for (var key in attributes.relationships) {
|
|
var model = attributes.relationships[key];
|
|
|
|
data.relationships[key] = {
|
|
data: model instanceof Array ? model.map(Model.getIdentifier) : Model.getIdentifier(model)
|
|
};
|
|
}
|
|
|
|
delete attributes.relationships;
|
|
}
|
|
|
|
// Before we update the model's data, we should make a copy of the model's
|
|
// old data so that we can revert back to it if something goes awry during
|
|
// persistence.
|
|
var oldData = this.copyData();
|
|
|
|
this.pushData(data);
|
|
|
|
var request = { data: data };
|
|
if (options.meta) request.meta = options.meta;
|
|
|
|
return app.request(babelHelpers.extends({
|
|
method: this.exists ? 'PATCH' : 'POST',
|
|
url: app.forum.attribute('apiUrl') + this.apiEndpoint(),
|
|
data: request
|
|
}, options)).then(
|
|
// If everything went well, we'll make sure the store knows that this
|
|
// model exists now (if it didn't already), and we'll push the data that
|
|
// the API returned into the store.
|
|
function (payload) {
|
|
_this.store.data[payload.data.type] = _this.store.data[payload.data.type] || {};
|
|
_this.store.data[payload.data.type][payload.data.id] = _this;
|
|
return _this.store.pushPayload(payload);
|
|
},
|
|
|
|
// If something went wrong, though... good thing we backed up our model's
|
|
// old data! We'll revert to that and let others handle the error.
|
|
function (response) {
|
|
_this.pushData(oldData);
|
|
m.lazyRedraw();
|
|
throw response;
|
|
});
|
|
}
|
|
}, {
|
|
key: 'delete',
|
|
value: function _delete(data) {
|
|
var _this2 = this;
|
|
|
|
var options = arguments.length <= 1 || arguments[1] === undefined ? {} : arguments[1];
|
|
|
|
if (!this.exists) return m.deferred.resolve().promise;
|
|
|
|
return app.request(babelHelpers.extends({
|
|
method: 'DELETE',
|
|
url: app.forum.attribute('apiUrl') + this.apiEndpoint(),
|
|
data: data
|
|
}, options)).then(function () {
|
|
_this2.exists = false;
|
|
_this2.store.remove(_this2);
|
|
});
|
|
}
|
|
}, {
|
|
key: 'apiEndpoint',
|
|
value: function apiEndpoint() {
|
|
return '/' + this.data.type + (this.exists ? '/' + this.data.id : '');
|
|
}
|
|
}, {
|
|
key: 'copyData',
|
|
value: function copyData() {
|
|
return JSON.parse(JSON.stringify(this.data));
|
|
}
|
|
}], [{
|
|
key: 'attribute',
|
|
value: function attribute(name, transform) {
|
|
return function () {
|
|
var value = this.data.attributes && this.data.attributes[name];
|
|
|
|
return transform ? transform(value) : value;
|
|
};
|
|
}
|
|
}, {
|
|
key: 'hasOne',
|
|
value: function hasOne(name) {
|
|
return function () {
|
|
if (this.data.relationships) {
|
|
var relationship = this.data.relationships[name];
|
|
|
|
if (relationship) {
|
|
return app.store.getById(relationship.data.type, relationship.data.id);
|
|
}
|
|
}
|
|
|
|
return false;
|
|
};
|
|
}
|
|
}, {
|
|
key: 'hasMany',
|
|
value: function hasMany(name) {
|
|
return function () {
|
|
if (this.data.relationships) {
|
|
var relationship = this.data.relationships[name];
|
|
|
|
if (relationship) {
|
|
return relationship.data.map(function (data) {
|
|
return app.store.getById(data.type, data.id);
|
|
});
|
|
}
|
|
}
|
|
|
|
return false;
|
|
};
|
|
}
|
|
}, {
|
|
key: 'transformDate',
|
|
value: function transformDate(value) {
|
|
return value ? new Date(value) : null;
|
|
}
|
|
}, {
|
|
key: 'getIdentifier',
|
|
value: function getIdentifier(model) {
|
|
return {
|
|
type: model.data.type,
|
|
id: model.data.id
|
|
};
|
|
}
|
|
}]);
|
|
return Model;
|
|
}();
|
|
|
|
_export('default', Model);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/models/Discussion', ['flarum/Model', 'flarum/utils/computed', 'flarum/utils/ItemList', 'flarum/components/Badge'], function (_export, _context) {
|
|
var Model, computed, ItemList, Badge, Discussion;
|
|
return {
|
|
setters: [function (_flarumModel) {
|
|
Model = _flarumModel.default;
|
|
}, function (_flarumUtilsComputed) {
|
|
computed = _flarumUtilsComputed.default;
|
|
}, function (_flarumUtilsItemList) {
|
|
ItemList = _flarumUtilsItemList.default;
|
|
}, function (_flarumComponentsBadge) {
|
|
Badge = _flarumComponentsBadge.default;
|
|
}],
|
|
execute: function () {
|
|
Discussion = function (_Model) {
|
|
babelHelpers.inherits(Discussion, _Model);
|
|
|
|
function Discussion() {
|
|
babelHelpers.classCallCheck(this, Discussion);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(Discussion).apply(this, arguments));
|
|
}
|
|
|
|
return Discussion;
|
|
}(Model);
|
|
|
|
_export('default', Discussion);
|
|
|
|
babelHelpers.extends(Discussion.prototype, {
|
|
title: Model.attribute('title'),
|
|
slug: Model.attribute('slug'),
|
|
|
|
startTime: Model.attribute('startTime', Model.transformDate),
|
|
startUser: Model.hasOne('startUser'),
|
|
startPost: Model.hasOne('startPost'),
|
|
|
|
lastTime: Model.attribute('lastTime', Model.transformDate),
|
|
lastUser: Model.hasOne('lastUser'),
|
|
lastPost: Model.hasOne('lastPost'),
|
|
lastPostNumber: Model.attribute('lastPostNumber'),
|
|
|
|
commentsCount: Model.attribute('commentsCount'),
|
|
repliesCount: computed('commentsCount', function (commentsCount) {
|
|
return Math.max(0, commentsCount - 1);
|
|
}),
|
|
posts: Model.hasMany('posts'),
|
|
relevantPosts: Model.hasMany('relevantPosts'),
|
|
|
|
readTime: Model.attribute('readTime', Model.transformDate),
|
|
readNumber: Model.attribute('readNumber'),
|
|
isUnread: computed('unreadCount', function (unreadCount) {
|
|
return !!unreadCount;
|
|
}),
|
|
isRead: computed('unreadCount', function (unreadCount) {
|
|
return app.session.user && !unreadCount;
|
|
}),
|
|
|
|
hideTime: Model.attribute('hideTime', Model.transformDate),
|
|
hideUser: Model.hasOne('hideUser'),
|
|
isHidden: computed('hideTime', 'commentsCount', function (hideTime, commentsCount) {
|
|
return !!hideTime || commentsCount === 0;
|
|
}),
|
|
|
|
canReply: Model.attribute('canReply'),
|
|
canRename: Model.attribute('canRename'),
|
|
canHide: Model.attribute('canHide'),
|
|
canDelete: Model.attribute('canDelete'),
|
|
|
|
removePost: function removePost(id) {
|
|
var relationships = this.data.relationships;
|
|
var posts = relationships && relationships.posts;
|
|
|
|
if (posts) {
|
|
posts.data.some(function (data, i) {
|
|
if (id === data.id) {
|
|
posts.data.splice(i, 1);
|
|
return true;
|
|
}
|
|
});
|
|
}
|
|
},
|
|
unreadCount: function unreadCount() {
|
|
var user = app.session.user;
|
|
|
|
if (user && user.readTime() < this.lastTime()) {
|
|
return Math.max(0, this.lastPostNumber() - (this.readNumber() || 0));
|
|
}
|
|
|
|
return 0;
|
|
},
|
|
badges: function badges() {
|
|
var items = new ItemList();
|
|
|
|
if (this.isHidden()) {
|
|
items.add('hidden', m(Badge, { type: 'hidden', icon: 'trash', label: app.translator.trans('core.lib.badge.hidden_tooltip') }));
|
|
}
|
|
|
|
return items;
|
|
},
|
|
postIds: function postIds() {
|
|
var posts = this.data.relationships.posts;
|
|
|
|
return posts ? posts.data.map(function (link) {
|
|
return link.id;
|
|
}) : [];
|
|
}
|
|
});
|
|
|
|
_export('default', Discussion);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/models/Forum', ['flarum/Model'], function (_export, _context) {
|
|
var Model, Forum;
|
|
return {
|
|
setters: [function (_flarumModel) {
|
|
Model = _flarumModel.default;
|
|
}],
|
|
execute: function () {
|
|
Forum = function (_Model) {
|
|
babelHelpers.inherits(Forum, _Model);
|
|
|
|
function Forum() {
|
|
babelHelpers.classCallCheck(this, Forum);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(Forum).apply(this, arguments));
|
|
}
|
|
|
|
babelHelpers.createClass(Forum, [{
|
|
key: 'apiEndpoint',
|
|
value: function apiEndpoint() {
|
|
return '/forum';
|
|
}
|
|
}]);
|
|
return Forum;
|
|
}(Model);
|
|
|
|
_export('default', Forum);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/models/Group', ['flarum/Model'], function (_export, _context) {
|
|
var Model, Group;
|
|
return {
|
|
setters: [function (_flarumModel) {
|
|
Model = _flarumModel.default;
|
|
}],
|
|
execute: function () {
|
|
Group = function (_Model) {
|
|
babelHelpers.inherits(Group, _Model);
|
|
|
|
function Group() {
|
|
babelHelpers.classCallCheck(this, Group);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(Group).apply(this, arguments));
|
|
}
|
|
|
|
return Group;
|
|
}(Model);
|
|
|
|
babelHelpers.extends(Group.prototype, {
|
|
nameSingular: Model.attribute('nameSingular'),
|
|
namePlural: Model.attribute('namePlural'),
|
|
color: Model.attribute('color'),
|
|
icon: Model.attribute('icon')
|
|
});
|
|
|
|
Group.ADMINISTRATOR_ID = '1';
|
|
Group.GUEST_ID = '2';
|
|
Group.MEMBER_ID = '3';
|
|
|
|
_export('default', Group);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/models/Notification', ['flarum/Model', 'flarum/utils/computed'], function (_export, _context) {
|
|
var Model, computed, Notification;
|
|
return {
|
|
setters: [function (_flarumModel) {
|
|
Model = _flarumModel.default;
|
|
}, function (_flarumUtilsComputed) {
|
|
computed = _flarumUtilsComputed.default;
|
|
}],
|
|
execute: function () {
|
|
Notification = function (_Model) {
|
|
babelHelpers.inherits(Notification, _Model);
|
|
|
|
function Notification() {
|
|
babelHelpers.classCallCheck(this, Notification);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(Notification).apply(this, arguments));
|
|
}
|
|
|
|
return Notification;
|
|
}(Model);
|
|
|
|
_export('default', Notification);
|
|
|
|
babelHelpers.extends(Notification.prototype, {
|
|
contentType: Model.attribute('contentType'),
|
|
subjectId: Model.attribute('subjectId'),
|
|
content: Model.attribute('content'),
|
|
time: Model.attribute('time', Model.date),
|
|
|
|
isRead: Model.attribute('isRead'),
|
|
unreadCount: Model.attribute('unreadCount'),
|
|
additionalUnreadCount: computed('unreadCount', function (unreadCount) {
|
|
return Math.max(0, unreadCount - 1);
|
|
}),
|
|
|
|
user: Model.hasOne('user'),
|
|
sender: Model.hasOne('sender'),
|
|
subject: Model.hasOne('subject')
|
|
});
|
|
|
|
_export('default', Notification);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/models/Post', ['flarum/Model', 'flarum/utils/computed', 'flarum/utils/string'], function (_export, _context) {
|
|
var Model, computed, getPlainContent, Post;
|
|
return {
|
|
setters: [function (_flarumModel) {
|
|
Model = _flarumModel.default;
|
|
}, function (_flarumUtilsComputed) {
|
|
computed = _flarumUtilsComputed.default;
|
|
}, function (_flarumUtilsString) {
|
|
getPlainContent = _flarumUtilsString.getPlainContent;
|
|
}],
|
|
execute: function () {
|
|
Post = function (_Model) {
|
|
babelHelpers.inherits(Post, _Model);
|
|
|
|
function Post() {
|
|
babelHelpers.classCallCheck(this, Post);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(Post).apply(this, arguments));
|
|
}
|
|
|
|
return Post;
|
|
}(Model);
|
|
|
|
_export('default', Post);
|
|
|
|
babelHelpers.extends(Post.prototype, {
|
|
number: Model.attribute('number'),
|
|
discussion: Model.hasOne('discussion'),
|
|
|
|
time: Model.attribute('time', Model.transformDate),
|
|
user: Model.hasOne('user'),
|
|
contentType: Model.attribute('contentType'),
|
|
content: Model.attribute('content'),
|
|
contentHtml: Model.attribute('contentHtml'),
|
|
contentPlain: computed('contentHtml', getPlainContent),
|
|
|
|
editTime: Model.attribute('editTime', Model.transformDate),
|
|
editUser: Model.hasOne('editUser'),
|
|
isEdited: computed('editTime', function (editTime) {
|
|
return !!editTime;
|
|
}),
|
|
|
|
hideTime: Model.attribute('hideTime', Model.transformDate),
|
|
hideUser: Model.hasOne('hideUser'),
|
|
isHidden: computed('hideTime', function (hideTime) {
|
|
return !!hideTime;
|
|
}),
|
|
|
|
canEdit: Model.attribute('canEdit'),
|
|
canDelete: Model.attribute('canDelete')
|
|
});
|
|
|
|
_export('default', Post);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/models/User', ['flarum/Model', 'flarum/utils/stringToColor', 'flarum/utils/ItemList', 'flarum/utils/computed', 'flarum/components/GroupBadge'], function (_export, _context) {
|
|
var Model, stringToColor, ItemList, computed, GroupBadge, User;
|
|
return {
|
|
setters: [function (_flarumModel) {
|
|
Model = _flarumModel.default;
|
|
}, function (_flarumUtilsStringToColor) {
|
|
stringToColor = _flarumUtilsStringToColor.default;
|
|
}, function (_flarumUtilsItemList) {
|
|
ItemList = _flarumUtilsItemList.default;
|
|
}, function (_flarumUtilsComputed) {
|
|
computed = _flarumUtilsComputed.default;
|
|
}, function (_flarumComponentsGroupBadge) {
|
|
GroupBadge = _flarumComponentsGroupBadge.default;
|
|
}],
|
|
execute: function () {
|
|
User = function (_Model) {
|
|
babelHelpers.inherits(User, _Model);
|
|
|
|
function User() {
|
|
babelHelpers.classCallCheck(this, User);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(User).apply(this, arguments));
|
|
}
|
|
|
|
return User;
|
|
}(Model);
|
|
|
|
_export('default', User);
|
|
|
|
babelHelpers.extends(User.prototype, {
|
|
username: Model.attribute('username'),
|
|
email: Model.attribute('email'),
|
|
isActivated: Model.attribute('isActivated'),
|
|
password: Model.attribute('password'),
|
|
|
|
avatarUrl: Model.attribute('avatarUrl'),
|
|
bio: Model.attribute('bio'),
|
|
bioHtml: computed('bio', function (bio) {
|
|
return bio ? '<p>' + $('<div/>').text(bio).html().replace(/\n/g, '<br>').autoLink({ rel: 'nofollow' }) + '</p>' : '';
|
|
}),
|
|
preferences: Model.attribute('preferences'),
|
|
groups: Model.hasMany('groups'),
|
|
|
|
joinTime: Model.attribute('joinTime', Model.transformDate),
|
|
lastSeenTime: Model.attribute('lastSeenTime', Model.transformDate),
|
|
readTime: Model.attribute('readTime', Model.transformDate),
|
|
unreadNotificationsCount: Model.attribute('unreadNotificationsCount'),
|
|
newNotificationsCount: Model.attribute('newNotificationsCount'),
|
|
|
|
discussionsCount: Model.attribute('discussionsCount'),
|
|
commentsCount: Model.attribute('commentsCount'),
|
|
|
|
canEdit: Model.attribute('canEdit'),
|
|
canDelete: Model.attribute('canDelete'),
|
|
|
|
avatarColor: null,
|
|
color: computed('username', 'avatarUrl', 'avatarColor', function (username, avatarUrl, avatarColor) {
|
|
// If we've already calculated and cached the dominant color of the user's
|
|
// avatar, then we can return that in RGB format. If we haven't, we'll want
|
|
// to calculate it. Unless the user doesn't have an avatar, in which case
|
|
// we generate a color from their username.
|
|
if (avatarColor) {
|
|
return 'rgb(' + avatarColor.join(', ') + ')';
|
|
} else if (avatarUrl) {
|
|
this.calculateAvatarColor();
|
|
return '';
|
|
}
|
|
|
|
return '#' + stringToColor(username);
|
|
}),
|
|
|
|
isOnline: function isOnline() {
|
|
return this.lastSeenTime() > moment().subtract(5, 'minutes').toDate();
|
|
},
|
|
badges: function badges() {
|
|
var items = new ItemList();
|
|
var groups = this.groups();
|
|
|
|
if (groups) {
|
|
groups.forEach(function (group) {
|
|
items.add('group' + group.id(), GroupBadge.component({ group: group }));
|
|
});
|
|
}
|
|
|
|
return items;
|
|
},
|
|
calculateAvatarColor: function calculateAvatarColor() {
|
|
var image = new Image();
|
|
var user = this;
|
|
|
|
image.onload = function () {
|
|
var colorThief = new ColorThief();
|
|
user.avatarColor = colorThief.getColor(this);
|
|
user.freshness = new Date();
|
|
m.redraw();
|
|
};
|
|
image.src = this.avatarUrl();
|
|
},
|
|
savePreferences: function savePreferences(newPreferences) {
|
|
var preferences = this.preferences();
|
|
|
|
babelHelpers.extends(preferences, newPreferences);
|
|
|
|
return this.save({ preferences: preferences });
|
|
}
|
|
});
|
|
|
|
_export('default', User);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/Session', [], function (_export, _context) {
|
|
var Session;
|
|
return {
|
|
setters: [],
|
|
execute: function () {
|
|
Session = function () {
|
|
function Session(user, csrfToken) {
|
|
babelHelpers.classCallCheck(this, Session);
|
|
|
|
/**
|
|
* The current authenticated user.
|
|
*
|
|
* @type {User|null}
|
|
* @public
|
|
*/
|
|
this.user = user;
|
|
|
|
/**
|
|
* The CSRF token.
|
|
*
|
|
* @type {String|null}
|
|
* @public
|
|
*/
|
|
this.csrfToken = csrfToken;
|
|
}
|
|
|
|
/**
|
|
* Attempt to log in a user.
|
|
*
|
|
* @param {String} identification The username/email.
|
|
* @param {String} password
|
|
* @param {Object} [options]
|
|
* @return {Promise}
|
|
* @public
|
|
*/
|
|
|
|
|
|
babelHelpers.createClass(Session, [{
|
|
key: 'login',
|
|
value: function login(identification, password) {
|
|
var options = arguments.length <= 2 || arguments[2] === undefined ? {} : arguments[2];
|
|
|
|
return app.request(babelHelpers.extends({
|
|
method: 'POST',
|
|
url: app.forum.attribute('baseUrl') + '/login',
|
|
data: { identification: identification, password: password }
|
|
}, options));
|
|
}
|
|
}, {
|
|
key: 'logout',
|
|
value: function logout() {
|
|
window.location = app.forum.attribute('baseUrl') + '/logout?token=' + this.csrfToken;
|
|
}
|
|
}]);
|
|
return Session;
|
|
}();
|
|
|
|
_export('default', Session);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/Store', [], function (_export, _context) {
|
|
var Store;
|
|
return {
|
|
setters: [],
|
|
execute: function () {
|
|
Store = function () {
|
|
function Store(models) {
|
|
babelHelpers.classCallCheck(this, Store);
|
|
|
|
/**
|
|
* The local data store. A tree of resource types to IDs, such that
|
|
* accessing data[type][id] will return the model for that type/ID.
|
|
*
|
|
* @type {Object}
|
|
* @protected
|
|
*/
|
|
this.data = {};
|
|
|
|
/**
|
|
* The model registry. A map of resource types to the model class that
|
|
* should be used to represent resources of that type.
|
|
*
|
|
* @type {Object}
|
|
* @public
|
|
*/
|
|
this.models = models;
|
|
}
|
|
|
|
/**
|
|
* Push resources contained within an API payload into the store.
|
|
*
|
|
* @param {Object} payload
|
|
* @return {Model|Model[]} The model(s) representing the resource(s) contained
|
|
* within the 'data' key of the payload.
|
|
* @public
|
|
*/
|
|
|
|
|
|
babelHelpers.createClass(Store, [{
|
|
key: 'pushPayload',
|
|
value: function pushPayload(payload) {
|
|
if (payload.included) payload.included.map(this.pushObject.bind(this));
|
|
|
|
var result = payload.data instanceof Array ? payload.data.map(this.pushObject.bind(this)) : this.pushObject(payload.data);
|
|
|
|
// Attach the original payload to the model that we give back. This is
|
|
// useful to consumers as it allows them to access meta information
|
|
// associated with their request.
|
|
result.payload = payload;
|
|
|
|
return result;
|
|
}
|
|
}, {
|
|
key: 'pushObject',
|
|
value: function pushObject(data) {
|
|
if (!this.models[data.type]) return null;
|
|
|
|
var type = this.data[data.type] = this.data[data.type] || {};
|
|
|
|
if (type[data.id]) {
|
|
type[data.id].pushData(data);
|
|
} else {
|
|
type[data.id] = this.createRecord(data.type, data);
|
|
}
|
|
|
|
type[data.id].exists = true;
|
|
|
|
return type[data.id];
|
|
}
|
|
}, {
|
|
key: 'find',
|
|
value: function find(type, id) {
|
|
var query = arguments.length <= 2 || arguments[2] === undefined ? {} : arguments[2];
|
|
var options = arguments.length <= 3 || arguments[3] === undefined ? {} : arguments[3];
|
|
|
|
var data = query;
|
|
var url = app.forum.attribute('apiUrl') + '/' + type;
|
|
|
|
if (id instanceof Array) {
|
|
url += '?filter[id]=' + id.join(',');
|
|
} else if ((typeof id === 'undefined' ? 'undefined' : babelHelpers.typeof(id)) === 'object') {
|
|
data = id;
|
|
} else if (id) {
|
|
url += '/' + id;
|
|
}
|
|
|
|
return app.request(babelHelpers.extends({
|
|
method: 'GET',
|
|
url: url,
|
|
data: data
|
|
}, options)).then(this.pushPayload.bind(this));
|
|
}
|
|
}, {
|
|
key: 'getById',
|
|
value: function getById(type, id) {
|
|
return this.data[type] && this.data[type][id];
|
|
}
|
|
}, {
|
|
key: 'getBy',
|
|
value: function getBy(type, key, value) {
|
|
return this.all(type).filter(function (model) {
|
|
return model[key]() === value;
|
|
})[0];
|
|
}
|
|
}, {
|
|
key: 'all',
|
|
value: function all(type) {
|
|
var records = this.data[type];
|
|
|
|
return records ? Object.keys(records).map(function (id) {
|
|
return records[id];
|
|
}) : [];
|
|
}
|
|
}, {
|
|
key: 'remove',
|
|
value: function remove(model) {
|
|
delete this.data[model.data.type][model.id()];
|
|
}
|
|
}, {
|
|
key: 'createRecord',
|
|
value: function createRecord(type) {
|
|
var data = arguments.length <= 1 || arguments[1] === undefined ? {} : arguments[1];
|
|
|
|
data.type = data.type || type;
|
|
|
|
return new this.models[type](data, this);
|
|
}
|
|
}]);
|
|
return Store;
|
|
}();
|
|
|
|
_export('default', Store);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/Translator', ['flarum/models/User', 'flarum/helpers/username', 'flarum/utils/extractText', 'flarum/utils/extract'], function (_export, _context) {
|
|
var User, username, extractText, extract, Translator;
|
|
return {
|
|
setters: [function (_flarumModelsUser) {
|
|
User = _flarumModelsUser.default;
|
|
}, function (_flarumHelpersUsername) {
|
|
username = _flarumHelpersUsername.default;
|
|
}, function (_flarumUtilsExtractText) {
|
|
extractText = _flarumUtilsExtractText.default;
|
|
}, function (_flarumUtilsExtract) {
|
|
extract = _flarumUtilsExtract.default;
|
|
}],
|
|
execute: function () {
|
|
Translator = function () {
|
|
function Translator() {
|
|
babelHelpers.classCallCheck(this, Translator);
|
|
|
|
/**
|
|
* A map of translation keys to their translated values.
|
|
*
|
|
* @type {Object}
|
|
* @public
|
|
*/
|
|
this.translations = {};
|
|
|
|
this.locale = null;
|
|
}
|
|
|
|
babelHelpers.createClass(Translator, [{
|
|
key: 'trans',
|
|
value: function trans(id, parameters) {
|
|
var translation = this.translations[id];
|
|
|
|
if (translation) {
|
|
return this.apply(translation, parameters || {});
|
|
}
|
|
|
|
return id;
|
|
}
|
|
}, {
|
|
key: 'transChoice',
|
|
value: function transChoice(id, number, parameters) {
|
|
var translation = this.translations[id];
|
|
|
|
if (translation) {
|
|
number = parseInt(number, 10);
|
|
|
|
translation = this.pluralize(translation, number);
|
|
|
|
return this.apply(translation, parameters || {});
|
|
}
|
|
|
|
return id;
|
|
}
|
|
}, {
|
|
key: 'apply',
|
|
value: function apply(translation, input) {
|
|
// If we've been given a user model as one of the input parameters, then
|
|
// we'll extract the username and use that for the translation. In the
|
|
// future there should be a hook here to inspect the user and change the
|
|
// translation key. This will allow a gender property to determine which
|
|
// translation key is used.
|
|
if ('user' in input) {
|
|
var user = extract(input, 'user');
|
|
|
|
if (!input.username) input.username = username(user);
|
|
}
|
|
|
|
translation = translation.split(new RegExp('({[a-z0-9_]+}|</?[a-z0-9_]+>)', 'gi'));
|
|
|
|
var hydrated = [];
|
|
var open = [hydrated];
|
|
|
|
translation.forEach(function (part) {
|
|
var match = part.match(new RegExp('{([a-z0-9_]+)}|<(/?)([a-z0-9_]+)>', 'i'));
|
|
|
|
if (match) {
|
|
if (match[1]) {
|
|
open[0].push(input[match[1]]);
|
|
} else if (match[3]) {
|
|
if (match[2]) {
|
|
open.shift();
|
|
} else {
|
|
var tag = input[match[3]] || [];
|
|
open[0].push(tag);
|
|
open.unshift(tag.children || tag);
|
|
}
|
|
}
|
|
} else {
|
|
open[0].push(part);
|
|
}
|
|
});
|
|
|
|
return hydrated.filter(function (part) {
|
|
return part;
|
|
});
|
|
}
|
|
}, {
|
|
key: 'pluralize',
|
|
value: function pluralize(translation, number) {
|
|
var _this = this;
|
|
|
|
var sPluralRegex = new RegExp(/^\w+\: +(.+)$/),
|
|
cPluralRegex = new RegExp(/^\s*((\{\s*(\-?\d+[\s*,\s*\-?\d+]*)\s*\})|([\[\]])\s*(-Inf|\-?\d+)\s*,\s*(\+?Inf|\-?\d+)\s*([\[\]]))\s?(.+?)$/),
|
|
iPluralRegex = new RegExp(/^\s*(\{\s*(\-?\d+[\s*,\s*\-?\d+]*)\s*\})|([\[\]])\s*(-Inf|\-?\d+)\s*,\s*(\+?Inf|\-?\d+)\s*([\[\]])/),
|
|
standardRules = [],
|
|
explicitRules = [];
|
|
|
|
translation.split('|').forEach(function (part) {
|
|
if (cPluralRegex.test(part)) {
|
|
var matches = part.match(cPluralRegex);
|
|
explicitRules[matches[0]] = matches[matches.length - 1];
|
|
} else if (sPluralRegex.test(part)) {
|
|
var _matches = part.match(sPluralRegex);
|
|
standardRules.push(_matches[1]);
|
|
} else {
|
|
standardRules.push(part);
|
|
}
|
|
});
|
|
|
|
explicitRules.forEach(function (rule, e) {
|
|
if (iPluralRegex.test(e)) {
|
|
var matches = e.match(iPluralRegex);
|
|
|
|
if (matches[1]) {
|
|
var ns = matches[2].split(',');
|
|
|
|
for (var n in ns) {
|
|
if (number == ns[n]) {
|
|
return explicitRules[e];
|
|
}
|
|
}
|
|
} else {
|
|
var leftNumber = _this.convertNumber(matches[4]);
|
|
var rightNumber = _this.convertNumber(matches[5]);
|
|
|
|
if (('[' === matches[3] ? number >= leftNumber : number > leftNumber) && (']' === matches[6] ? number <= rightNumber : number < rightNumber)) {
|
|
return explicitRules[e];
|
|
}
|
|
}
|
|
}
|
|
});
|
|
|
|
return standardRules[this.pluralPosition(number, this.locale)] || standardRules[0] || undefined;
|
|
}
|
|
}, {
|
|
key: 'convertNumber',
|
|
value: function convertNumber(number) {
|
|
if ('-Inf' === number) {
|
|
return Number.NEGATIVE_INFINITY;
|
|
} else if ('+Inf' === number || 'Inf' === number) {
|
|
return Number.POSITIVE_INFINITY;
|
|
}
|
|
|
|
return parseInt(number, 10);
|
|
}
|
|
}, {
|
|
key: 'pluralPosition',
|
|
value: function pluralPosition(number, locale) {
|
|
if ('pt_BR' === locale) {
|
|
locale = 'xbr';
|
|
}
|
|
|
|
if (locale.length > 3) {
|
|
locale = locale.split('_')[0];
|
|
}
|
|
|
|
switch (locale) {
|
|
case 'bo':
|
|
case 'dz':
|
|
case 'id':
|
|
case 'ja':
|
|
case 'jv':
|
|
case 'ka':
|
|
case 'km':
|
|
case 'kn':
|
|
case 'ko':
|
|
case 'ms':
|
|
case 'th':
|
|
case 'tr':
|
|
case 'vi':
|
|
case 'zh':
|
|
return 0;
|
|
case 'af':
|
|
case 'az':
|
|
case 'bn':
|
|
case 'bg':
|
|
case 'ca':
|
|
case 'da':
|
|
case 'de':
|
|
case 'el':
|
|
case 'en':
|
|
case 'eo':
|
|
case 'es':
|
|
case 'et':
|
|
case 'eu':
|
|
case 'fa':
|
|
case 'fi':
|
|
case 'fo':
|
|
case 'fur':
|
|
case 'fy':
|
|
case 'gl':
|
|
case 'gu':
|
|
case 'ha':
|
|
case 'he':
|
|
case 'hu':
|
|
case 'is':
|
|
case 'it':
|
|
case 'ku':
|
|
case 'lb':
|
|
case 'ml':
|
|
case 'mn':
|
|
case 'mr':
|
|
case 'nah':
|
|
case 'nb':
|
|
case 'ne':
|
|
case 'nl':
|
|
case 'nn':
|
|
case 'no':
|
|
case 'om':
|
|
case 'or':
|
|
case 'pa':
|
|
case 'pap':
|
|
case 'ps':
|
|
case 'pt':
|
|
case 'so':
|
|
case 'sq':
|
|
case 'sv':
|
|
case 'sw':
|
|
case 'ta':
|
|
case 'te':
|
|
case 'tk':
|
|
case 'ur':
|
|
case 'zu':
|
|
return number == 1 ? 0 : 1;
|
|
|
|
case 'am':
|
|
case 'bh':
|
|
case 'fil':
|
|
case 'fr':
|
|
case 'gun':
|
|
case 'hi':
|
|
case 'ln':
|
|
case 'mg':
|
|
case 'nso':
|
|
case 'xbr':
|
|
case 'ti':
|
|
case 'wa':
|
|
return number === 0 || number == 1 ? 0 : 1;
|
|
|
|
case 'be':
|
|
case 'bs':
|
|
case 'hr':
|
|
case 'ru':
|
|
case 'sr':
|
|
case 'uk':
|
|
return number % 10 == 1 && number % 100 != 11 ? 0 : number % 10 >= 2 && number % 10 <= 4 && (number % 100 < 10 || number % 100 >= 20) ? 1 : 2;
|
|
|
|
case 'cs':
|
|
case 'sk':
|
|
return number == 1 ? 0 : number >= 2 && number <= 4 ? 1 : 2;
|
|
|
|
case 'ga':
|
|
return number == 1 ? 0 : number == 2 ? 1 : 2;
|
|
|
|
case 'lt':
|
|
return number % 10 == 1 && number % 100 != 11 ? 0 : number % 10 >= 2 && (number % 100 < 10 || number % 100 >= 20) ? 1 : 2;
|
|
|
|
case 'sl':
|
|
return number % 100 == 1 ? 0 : number % 100 == 2 ? 1 : number % 100 == 3 || number % 100 == 4 ? 2 : 3;
|
|
|
|
case 'mk':
|
|
return number % 10 == 1 ? 0 : 1;
|
|
|
|
case 'mt':
|
|
return number == 1 ? 0 : number === 0 || number % 100 > 1 && number % 100 < 11 ? 1 : number % 100 > 10 && number % 100 < 20 ? 2 : 3;
|
|
|
|
case 'lv':
|
|
return number === 0 ? 0 : number % 10 == 1 && number % 100 != 11 ? 1 : 2;
|
|
|
|
case 'pl':
|
|
return number == 1 ? 0 : number % 10 >= 2 && number % 10 <= 4 && (number % 100 < 12 || number % 100 > 14) ? 1 : 2;
|
|
|
|
case 'cy':
|
|
return number == 1 ? 0 : number == 2 ? 1 : number == 8 || number == 11 ? 2 : 3;
|
|
|
|
case 'ro':
|
|
return number == 1 ? 0 : number === 0 || number % 100 > 0 && number % 100 < 20 ? 1 : 2;
|
|
|
|
case 'ar':
|
|
return number === 0 ? 0 : number == 1 ? 1 : number == 2 ? 2 : number >= 3 && number <= 10 ? 3 : number >= 11 && number <= 99 ? 4 : 5;
|
|
|
|
default:
|
|
return 0;
|
|
}
|
|
}
|
|
}]);
|
|
return Translator;
|
|
}();
|
|
|
|
_export('default', Translator);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/utils/abbreviateNumber', [], function (_export, _context) {
|
|
function abbreviateNumber(number) {
|
|
// TODO: translation
|
|
if (number >= 1000000) {
|
|
return Math.floor(number / 1000000) + app.translator.trans('core.lib.number_suffix.mega_text');
|
|
} else if (number >= 1000) {
|
|
return Math.floor(number / 1000) + app.translator.trans('core.lib.number_suffix.kilo_text');
|
|
} else {
|
|
return number.toString();
|
|
}
|
|
}
|
|
|
|
_export('default', abbreviateNumber);
|
|
|
|
return {
|
|
setters: [],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
"use strict";
|
|
|
|
System.register("flarum/utils/anchorScroll", [], function (_export, _context) {
|
|
function anchorScroll(element, callback) {
|
|
var $window = $(window);
|
|
var relativeScroll = $(element).offset().top - $window.scrollTop();
|
|
|
|
callback();
|
|
|
|
$window.scrollTop($(element).offset().top - relativeScroll);
|
|
}
|
|
|
|
_export("default", anchorScroll);
|
|
|
|
return {
|
|
setters: [],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/utils/classList', [], function (_export, _context) {
|
|
function classList(classes) {
|
|
var classNames = void 0;
|
|
|
|
if (classes instanceof Array) {
|
|
classNames = classes.filter(function (name) {
|
|
return name;
|
|
});
|
|
} else {
|
|
classNames = [];
|
|
|
|
for (var i in classes) {
|
|
if (classes[i]) classNames.push(i);
|
|
}
|
|
}
|
|
|
|
return classNames.join(' ');
|
|
}
|
|
|
|
_export('default', classList);
|
|
|
|
return {
|
|
setters: [],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/utils/computed', [], function (_export, _context) {
|
|
function computed() {
|
|
for (var _len = arguments.length, dependentKeys = Array(_len), _key = 0; _key < _len; _key++) {
|
|
dependentKeys[_key] = arguments[_key];
|
|
}
|
|
|
|
var keys = dependentKeys.slice(0, -1);
|
|
var compute = dependentKeys.slice(-1)[0];
|
|
|
|
var dependentValues = {};
|
|
var computedValue = void 0;
|
|
|
|
return function () {
|
|
var _this = this;
|
|
|
|
var recompute = false;
|
|
|
|
// Read all of the dependent values. If any of them have changed since last
|
|
// time, then we'll want to recompute our output.
|
|
keys.forEach(function (key) {
|
|
var value = typeof _this[key] === 'function' ? _this[key]() : _this[key];
|
|
|
|
if (dependentValues[key] !== value) {
|
|
recompute = true;
|
|
dependentValues[key] = value;
|
|
}
|
|
});
|
|
|
|
if (recompute) {
|
|
computedValue = compute.apply(this, keys.map(function (key) {
|
|
return dependentValues[key];
|
|
}));
|
|
}
|
|
|
|
return computedValue;
|
|
};
|
|
}
|
|
|
|
_export('default', computed);
|
|
|
|
return {
|
|
setters: [],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/utils/Drawer', [], function (_export, _context) {
|
|
var Drawer;
|
|
return {
|
|
setters: [],
|
|
execute: function () {
|
|
Drawer = function () {
|
|
function Drawer() {
|
|
var _this = this;
|
|
|
|
babelHelpers.classCallCheck(this, Drawer);
|
|
|
|
// Set up an event handler so that whenever the content area is tapped,
|
|
// the drawer will close.
|
|
$('#content').click(function (e) {
|
|
if (_this.isOpen()) {
|
|
e.preventDefault();
|
|
_this.hide();
|
|
}
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Check whether or not the drawer is currently open.
|
|
*
|
|
* @return {Boolean}
|
|
* @public
|
|
*/
|
|
|
|
|
|
babelHelpers.createClass(Drawer, [{
|
|
key: 'isOpen',
|
|
value: function isOpen() {
|
|
return $('#app').hasClass('drawerOpen');
|
|
}
|
|
}, {
|
|
key: 'hide',
|
|
value: function hide() {
|
|
$('#app').removeClass('drawerOpen');
|
|
|
|
if (this.$backdrop) this.$backdrop.remove();
|
|
}
|
|
}, {
|
|
key: 'show',
|
|
value: function show() {
|
|
var _this2 = this;
|
|
|
|
$('#app').addClass('drawerOpen');
|
|
|
|
this.$backdrop = $('<div/>').addClass('drawer-backdrop fade').appendTo('body').click(function () {
|
|
return _this2.hide();
|
|
});
|
|
|
|
setTimeout(function () {
|
|
return _this2.$backdrop.addClass('in');
|
|
});
|
|
}
|
|
}]);
|
|
return Drawer;
|
|
}();
|
|
|
|
_export('default', Drawer);
|
|
}
|
|
};
|
|
});;
|
|
"use strict";
|
|
|
|
System.register("flarum/utils/evented", [], function (_export, _context) {
|
|
return {
|
|
setters: [],
|
|
execute: function () {
|
|
_export("default", {
|
|
/**
|
|
* Arrays of registered event handlers, grouped by the event name.
|
|
*
|
|
* @type {Object}
|
|
* @protected
|
|
*/
|
|
handlers: null,
|
|
|
|
getHandlers: function getHandlers(event) {
|
|
this.handlers = this.handlers || {};
|
|
|
|
this.handlers[event] = this.handlers[event] || [];
|
|
|
|
return this.handlers[event];
|
|
},
|
|
trigger: function trigger(event) {
|
|
var _this = this;
|
|
|
|
for (var _len = arguments.length, args = Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {
|
|
args[_key - 1] = arguments[_key];
|
|
}
|
|
|
|
this.getHandlers(event).forEach(function (handler) {
|
|
return handler.apply(_this, args);
|
|
});
|
|
},
|
|
on: function on(event, handler) {
|
|
this.getHandlers(event).push(handler);
|
|
},
|
|
one: function one(event, handler) {
|
|
var wrapper = function wrapper() {
|
|
handler.apply(this, arguments);
|
|
|
|
this.off(event, wrapper);
|
|
};
|
|
|
|
this.getHandlers(event).push(wrapper);
|
|
},
|
|
off: function off(event, handler) {
|
|
var handlers = this.getHandlers(event);
|
|
var index = handlers.indexOf(handler);
|
|
|
|
if (index !== -1) {
|
|
handlers.splice(index, 1);
|
|
}
|
|
}
|
|
});
|
|
}
|
|
};
|
|
});;
|
|
"use strict";
|
|
|
|
System.register("flarum/utils/extract", [], function (_export, _context) {
|
|
function extract(object, property) {
|
|
var value = object[property];
|
|
|
|
delete object[property];
|
|
|
|
return value;
|
|
}
|
|
|
|
_export("default", extract);
|
|
|
|
return {
|
|
setters: [],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/utils/extractText', [], function (_export, _context) {
|
|
function extractText(vdom) {
|
|
if (vdom instanceof Array) {
|
|
return vdom.map(function (element) {
|
|
return extractText(element);
|
|
}).join('');
|
|
} else if ((typeof vdom === 'undefined' ? 'undefined' : babelHelpers.typeof(vdom)) === 'object') {
|
|
return extractText(vdom.children);
|
|
} else {
|
|
return vdom;
|
|
}
|
|
}
|
|
|
|
_export('default', extractText);
|
|
|
|
return {
|
|
setters: [],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/utils/formatNumber', [], function (_export, _context) {
|
|
function formatNumber(number) {
|
|
return number.toString().replace(/\B(?=(\d{3})+(?!\d))/g, ',');
|
|
}
|
|
|
|
_export('default', formatNumber);
|
|
|
|
return {
|
|
setters: [],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/utils/humanTime', [], function (_export, _context) {
|
|
function humanTime(time) {
|
|
var m = moment(time);
|
|
var now = moment();
|
|
|
|
// To prevent showing things like "in a few seconds" due to small offsets
|
|
// between client and server time, we always reset future dates to the
|
|
// current time. This will result in "just now" being shown instead.
|
|
if (m.isAfter(now)) {
|
|
m = now;
|
|
}
|
|
|
|
var day = 864e5;
|
|
var diff = m.diff(moment());
|
|
var ago = null;
|
|
|
|
// If this date was more than a month ago, we'll show the name of the month
|
|
// in the string. If it wasn't this year, we'll show the year as well.
|
|
if (diff < -30 * day) {
|
|
if (m.year() === moment().year()) {
|
|
ago = m.format('D MMM');
|
|
} else {
|
|
ago = m.format('MMM \'YY');
|
|
}
|
|
} else {
|
|
ago = m.fromNow();
|
|
}
|
|
|
|
return ago;
|
|
}
|
|
_export('default', humanTime);
|
|
|
|
return {
|
|
setters: [],
|
|
execute: function () {
|
|
; /**
|
|
* The `humanTime` utility converts a date to a localized, human-readable time-
|
|
* ago string.
|
|
*
|
|
* @param {Date} time
|
|
* @return {String}
|
|
*/
|
|
}
|
|
};
|
|
});;
|
|
"use strict";
|
|
|
|
System.register("flarum/utils/ItemList", [], function (_export, _context) {
|
|
var Item, ItemList;
|
|
return {
|
|
setters: [],
|
|
execute: function () {
|
|
Item = function Item(content, priority) {
|
|
babelHelpers.classCallCheck(this, Item);
|
|
|
|
this.content = content;
|
|
this.priority = priority;
|
|
};
|
|
|
|
ItemList = function () {
|
|
function ItemList() {
|
|
babelHelpers.classCallCheck(this, ItemList);
|
|
|
|
/**
|
|
* The items in the list.
|
|
*
|
|
* @type {Object}
|
|
* @public
|
|
*/
|
|
this.items = {};
|
|
}
|
|
|
|
/**
|
|
* Check whether an item is present in the list.
|
|
*
|
|
* @param key
|
|
* @returns {boolean}
|
|
*/
|
|
|
|
|
|
babelHelpers.createClass(ItemList, [{
|
|
key: "has",
|
|
value: function has(key) {
|
|
return !!this.items[key];
|
|
}
|
|
}, {
|
|
key: "get",
|
|
value: function get(key) {
|
|
return this.items[key].content;
|
|
}
|
|
}, {
|
|
key: "add",
|
|
value: function add(key, content) {
|
|
var priority = arguments.length <= 2 || arguments[2] === undefined ? 0 : arguments[2];
|
|
|
|
this.items[key] = new Item(content, priority);
|
|
}
|
|
}, {
|
|
key: "replace",
|
|
value: function replace(key) {
|
|
var content = arguments.length <= 1 || arguments[1] === undefined ? null : arguments[1];
|
|
var priority = arguments.length <= 2 || arguments[2] === undefined ? null : arguments[2];
|
|
|
|
if (this.items[key]) {
|
|
if (content !== null) {
|
|
this.items[key].content = content;
|
|
}
|
|
|
|
if (priority !== null) {
|
|
this.items[key].priority = priority;
|
|
}
|
|
}
|
|
}
|
|
}, {
|
|
key: "remove",
|
|
value: function remove(key) {
|
|
delete this.items[key];
|
|
}
|
|
}, {
|
|
key: "merge",
|
|
value: function merge(items) {
|
|
for (var i in items.items) {
|
|
if (items.items.hasOwnProperty(i) && items.items[i] instanceof Item) {
|
|
this.items[i] = items.items[i];
|
|
}
|
|
}
|
|
}
|
|
}, {
|
|
key: "toArray",
|
|
value: function toArray() {
|
|
var items = [];
|
|
|
|
for (var i in this.items) {
|
|
if (this.items.hasOwnProperty(i) && this.items[i] instanceof Item) {
|
|
this.items[i].content = Object(this.items[i].content);
|
|
|
|
this.items[i].content.itemName = i;
|
|
items.push(this.items[i]);
|
|
this.items[i].key = items.length;
|
|
}
|
|
}
|
|
|
|
return items.sort(function (a, b) {
|
|
if (a.priority === b.priority) {
|
|
return a.key - b.key;
|
|
} else if (a.priority > b.priority) {
|
|
return -1;
|
|
}
|
|
return 1;
|
|
}).map(function (item) {
|
|
return item.content;
|
|
});
|
|
}
|
|
}]);
|
|
return ItemList;
|
|
}();
|
|
|
|
_export("default", ItemList);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/utils/mapRoutes', [], function (_export, _context) {
|
|
function mapRoutes(routes) {
|
|
var basePath = arguments.length <= 1 || arguments[1] === undefined ? '' : arguments[1];
|
|
|
|
var map = {};
|
|
|
|
for (var key in routes) {
|
|
var route = routes[key];
|
|
|
|
if (route.component) route.component.props.routeName = key;
|
|
|
|
map[basePath + route.path] = route.component;
|
|
}
|
|
|
|
return map;
|
|
}
|
|
|
|
_export('default', mapRoutes);
|
|
|
|
return {
|
|
setters: [],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
"use strict";
|
|
|
|
System.register("flarum/utils/mixin", [], function (_export, _context) {
|
|
function mixin(Parent) {
|
|
var Mixed = function (_Parent) {
|
|
babelHelpers.inherits(Mixed, _Parent);
|
|
|
|
function Mixed() {
|
|
babelHelpers.classCallCheck(this, Mixed);
|
|
return babelHelpers.possibleConstructorReturn(this, Object.getPrototypeOf(Mixed).apply(this, arguments));
|
|
}
|
|
|
|
return Mixed;
|
|
}(Parent);
|
|
|
|
for (var _len = arguments.length, mixins = Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {
|
|
mixins[_key - 1] = arguments[_key];
|
|
}
|
|
|
|
mixins.forEach(function (object) {
|
|
babelHelpers.extends(Mixed.prototype, object);
|
|
});
|
|
|
|
return Mixed;
|
|
}
|
|
|
|
_export("default", mixin);
|
|
|
|
return {
|
|
setters: [],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/utils/patchMithril', ['../Component'], function (_export, _context) {
|
|
var Component;
|
|
function patchMithril(global) {
|
|
var mo = global.m;
|
|
|
|
var m = function m(comp) {
|
|
for (var _len = arguments.length, args = Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {
|
|
args[_key - 1] = arguments[_key];
|
|
}
|
|
|
|
if (comp.prototype && comp.prototype instanceof Component) {
|
|
return comp.component.apply(comp, args);
|
|
}
|
|
|
|
var node = mo.apply(this, arguments);
|
|
|
|
if (node.attrs.bidi) {
|
|
m.bidi(node, node.attrs.bidi);
|
|
}
|
|
|
|
if (node.attrs.route) {
|
|
node.attrs.href = node.attrs.route;
|
|
node.attrs.config = m.route;
|
|
|
|
delete node.attrs.route;
|
|
}
|
|
|
|
return node;
|
|
};
|
|
|
|
Object.keys(mo).forEach(function (key) {
|
|
return m[key] = mo[key];
|
|
});
|
|
|
|
/**
|
|
* Redraw only if not in the middle of a computation (e.g. a route change).
|
|
*
|
|
* @return {void}
|
|
*/
|
|
m.lazyRedraw = function () {
|
|
m.startComputation();
|
|
m.endComputation();
|
|
};
|
|
|
|
global.m = m;
|
|
}
|
|
|
|
_export('default', patchMithril);
|
|
|
|
return {
|
|
setters: [function (_Component) {
|
|
Component = _Component.default;
|
|
}],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
"use strict";
|
|
|
|
System.register("flarum/utils/RequestError", [], function (_export, _context) {
|
|
var RequestError;
|
|
return {
|
|
setters: [],
|
|
execute: function () {
|
|
RequestError = function RequestError(status, responseText, options, xhr) {
|
|
babelHelpers.classCallCheck(this, RequestError);
|
|
|
|
this.status = status;
|
|
this.responseText = responseText;
|
|
this.options = options;
|
|
this.xhr = xhr;
|
|
|
|
try {
|
|
this.response = JSON.parse(responseText);
|
|
} catch (e) {
|
|
this.response = null;
|
|
}
|
|
|
|
this.alert = null;
|
|
};
|
|
|
|
_export("default", RequestError);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/utils/saveSettings', [], function (_export, _context) {
|
|
function saveSettings(settings) {
|
|
var oldSettings = JSON.parse(JSON.stringify(app.settings));
|
|
|
|
babelHelpers.extends(app.settings, settings);
|
|
|
|
return app.request({
|
|
method: 'POST',
|
|
url: app.forum.attribute('apiUrl') + '/settings',
|
|
data: settings
|
|
}).catch(function (error) {
|
|
app.settings = oldSettings;
|
|
throw error;
|
|
});
|
|
}
|
|
|
|
_export('default', saveSettings);
|
|
|
|
return {
|
|
setters: [],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
"use strict";
|
|
|
|
System.register("flarum/utils/ScrollListener", [], function (_export, _context) {
|
|
var scroll, ScrollListener;
|
|
return {
|
|
setters: [],
|
|
execute: function () {
|
|
scroll = window.requestAnimationFrame || window.webkitRequestAnimationFrame || window.mozRequestAnimationFrame || window.msRequestAnimationFrame || window.oRequestAnimationFrame || function (callback) {
|
|
return window.setTimeout(callback, 1000 / 60);
|
|
};
|
|
|
|
ScrollListener = function () {
|
|
/**
|
|
* @param {Function} callback The callback to run when the scroll position
|
|
* changes.
|
|
* @public
|
|
*/
|
|
|
|
function ScrollListener(callback) {
|
|
babelHelpers.classCallCheck(this, ScrollListener);
|
|
|
|
this.callback = callback;
|
|
this.lastTop = -1;
|
|
}
|
|
|
|
/**
|
|
* On each animation frame, as long as the listener is active, run the
|
|
* `update` method.
|
|
*
|
|
* @protected
|
|
*/
|
|
|
|
|
|
babelHelpers.createClass(ScrollListener, [{
|
|
key: "loop",
|
|
value: function loop() {
|
|
if (!this.active) return;
|
|
|
|
this.update();
|
|
|
|
scroll(this.loop.bind(this));
|
|
}
|
|
}, {
|
|
key: "update",
|
|
value: function update(force) {
|
|
var top = window.pageYOffset;
|
|
|
|
if (this.lastTop !== top || force) {
|
|
this.callback(top);
|
|
this.lastTop = top;
|
|
}
|
|
}
|
|
}, {
|
|
key: "start",
|
|
value: function start() {
|
|
if (!this.active) {
|
|
this.active = true;
|
|
this.loop();
|
|
}
|
|
}
|
|
}, {
|
|
key: "stop",
|
|
value: function stop() {
|
|
this.active = false;
|
|
}
|
|
}]);
|
|
return ScrollListener;
|
|
}();
|
|
|
|
_export("default", ScrollListener);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/utils/string', [], function (_export, _context) {
|
|
return {
|
|
setters: [],
|
|
execute: function () {
|
|
/**
|
|
* Truncate a string to the given length, appending ellipses if necessary.
|
|
*
|
|
* @param {String} string
|
|
* @param {Number} length
|
|
* @param {Number} [start=0]
|
|
* @return {String}
|
|
*/
|
|
function truncate(string, length) {
|
|
var start = arguments.length <= 2 || arguments[2] === undefined ? 0 : arguments[2];
|
|
|
|
return (start > 0 ? '...' : '') + string.substring(start, start + length) + (string.length > start + length ? '...' : '');
|
|
}
|
|
|
|
/**
|
|
* Create a slug out of the given string. Non-alphanumeric characters are
|
|
* converted to hyphens.
|
|
*
|
|
* @param {String} string
|
|
* @return {String}
|
|
*/
|
|
|
|
_export('truncate', truncate);
|
|
|
|
function slug(string) {
|
|
return string.toLowerCase().replace(/[^a-z0-9]/gi, '-').replace(/-+/g, '-').replace(/-$|^-/g, '') || '-';
|
|
}
|
|
|
|
/**
|
|
* Strip HTML tags and quotes out of the given string, replacing them with
|
|
* meaningful punctuation.
|
|
*
|
|
* @param {String} string
|
|
* @return {String}
|
|
*/
|
|
|
|
_export('slug', slug);
|
|
|
|
function getPlainContent(string) {
|
|
var dom = $('<div/>').html(string.replace(/(<\/p>|<br>)/g, '$1 '));
|
|
|
|
dom.find(getPlainContent.removeSelectors.join(',')).remove();
|
|
|
|
return dom.text();
|
|
}
|
|
|
|
/**
|
|
* An array of DOM selectors to remove when getting plain content.
|
|
*
|
|
* @type {Array}
|
|
*/
|
|
|
|
_export('getPlainContent', getPlainContent);
|
|
|
|
getPlainContent.removeSelectors = ['blockquote', 'script'];
|
|
|
|
/**
|
|
* Make a string's first character uppercase.
|
|
*
|
|
* @param {String} string
|
|
* @return {String}
|
|
*/
|
|
function ucfirst(string) {
|
|
return string.substr(0, 1).toUpperCase() + string.substr(1);
|
|
}
|
|
|
|
_export('ucfirst', ucfirst);
|
|
}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/utils/stringToColor', [], function (_export, _context) {
|
|
function hsvToRgb(h, s, v) {
|
|
var r = void 0;
|
|
var g = void 0;
|
|
var b = void 0;
|
|
|
|
var i = Math.floor(h * 6);
|
|
var f = h * 6 - i;
|
|
var p = v * (1 - s);
|
|
var q = v * (1 - f * s);
|
|
var t = v * (1 - (1 - f) * s);
|
|
|
|
switch (i % 6) {
|
|
case 0:
|
|
r = v;g = t;b = p;break;
|
|
case 1:
|
|
r = q;g = v;b = p;break;
|
|
case 2:
|
|
r = p;g = v;b = t;break;
|
|
case 3:
|
|
r = p;g = q;b = v;break;
|
|
case 4:
|
|
r = t;g = p;b = v;break;
|
|
case 5:
|
|
r = v;g = p;b = q;break;
|
|
}
|
|
|
|
return {
|
|
r: Math.floor(r * 255),
|
|
g: Math.floor(g * 255),
|
|
b: Math.floor(b * 255)
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Convert the given string to a unique color.
|
|
*
|
|
* @param {String} string
|
|
* @return {String}
|
|
*/
|
|
function stringToColor(string) {
|
|
var num = 0;
|
|
|
|
// Convert the username into a number based on the ASCII value of each
|
|
// character.
|
|
for (var i = 0; i < string.length; i++) {
|
|
num += string.charCodeAt(i);
|
|
}
|
|
|
|
// Construct a color using the remainder of that number divided by 360, and
|
|
// some predefined saturation and value values.
|
|
var hue = num % 360;
|
|
var rgb = hsvToRgb(hue / 360, 0.3, 0.9);
|
|
|
|
return '' + rgb.r.toString(16) + rgb.g.toString(16) + rgb.b.toString(16);
|
|
}
|
|
|
|
_export('default', stringToColor);
|
|
|
|
return {
|
|
setters: [],
|
|
execute: function () {}
|
|
};
|
|
});;
|
|
'use strict';
|
|
|
|
System.register('flarum/utils/SubtreeRetainer', [], function (_export, _context) {
|
|
var SubtreeRetainer;
|
|
return {
|
|
setters: [],
|
|
execute: function () {
|
|
SubtreeRetainer = function () {
|
|
/**
|
|
* @param {...callbacks} callbacks Functions returning data to keep track of.
|
|
*/
|
|
|
|
function SubtreeRetainer() {
|
|
babelHelpers.classCallCheck(this, SubtreeRetainer);
|
|
|
|
for (var _len = arguments.length, callbacks = Array(_len), _key = 0; _key < _len; _key++) {
|
|
callbacks[_key] = arguments[_key];
|
|
}
|
|
|
|
this.callbacks = callbacks;
|
|
this.data = {};
|
|
}
|
|
|
|
/**
|
|
* Return a virtual DOM directive that will retain a subtree if no data has
|
|
* changed since the last check.
|
|
*
|
|
* @return {Object|false}
|
|
* @public
|
|
*/
|
|
|
|
|
|
babelHelpers.createClass(SubtreeRetainer, [{
|
|
key: 'retain',
|
|
value: function retain() {
|
|
var _this = this;
|
|
|
|
var needsRebuild = false;
|
|
|
|
this.callbacks.forEach(function (callback, i) {
|
|
var result = callback();
|
|
|
|
if (result !== _this.data[i]) {
|
|
_this.data[i] = result;
|
|
needsRebuild = true;
|
|
}
|
|
});
|
|
|
|
return needsRebuild ? false : { subtree: 'retain' };
|
|
}
|
|
}, {
|
|
key: 'check',
|
|
value: function check() {
|
|
for (var _len2 = arguments.length, callbacks = Array(_len2), _key2 = 0; _key2 < _len2; _key2++) {
|
|
callbacks[_key2] = arguments[_key2];
|
|
}
|
|
|
|
this.callbacks = this.callbacks.concat(callbacks);
|
|
}
|
|
}, {
|
|
key: 'invalidate',
|
|
value: function invalidate() {
|
|
this.data = {};
|
|
}
|
|
}]);
|
|
return SubtreeRetainer;
|
|
}();
|
|
|
|
_export('default', SubtreeRetainer);
|
|
}
|
|
};
|
|
}); |